{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7b2ff8ef-c959-4f2b-8fc9-997bea82a28b",
          "code": "552-79-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=552-79-4",
          "code_system": "CAS",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab",
            "79948314-b62a-46f0-a51d-7a4190a2860d"
          ]
        },
        {
          "uuid": "0c0e87eb-8f49-4de7-8ee0-9d53252b43e0",
          "code": "C041707",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67041707",
          "code_system": "MESH",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "1f627c45-985d-46fc-b0e1-f94a5524f524",
          "code": "N-METHYLEPHEDRINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Methylephedrine",
          "code_system": "WIKIPEDIA",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "e7c8994b-1986-4bd1-a5a6-d040e21d6418",
          "code": "1311545",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311545/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "ce4c2856-74ca-4882-98d1-655098ecc9f0",
          "code": "m7410",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7410?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "79246205-66a3-41e4-97c5-72b94094184a",
          "code": "1739004",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1739004/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "67de4174-d92e-430d-9492-fe663e8e3778",
          "code": "SUB14555MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "51042101-69e5-4155-a9df-610ba2f980ff",
          "code": "CHEMBL1589978",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1589978",
          "code_system": "ChEMBL",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "3ce2e0c3-ce70-4fc3-88ae-53569e6f6f2c",
          "code": "209-022-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.203",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "b5b1b45d-f105-41d0-86b4-1e5663680cd2",
          "code": "64782",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64782",
          "code_system": "PUBCHEM",
          "references": [
            "773c47c7-e5d2-4648-9307-c618fa7a40ab"
          ]
        },
        {
          "uuid": "6a90454a-f8e9-cbbd-ad4b-87f3385913fe",
          "code": "DTXSID7045992",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045992",
          "code_system": "EPA CompTox",
          "references": [
            "0a0bf534-8096-0914-c46d-1efbadc57ec4"
          ]
        },
        {
          "uuid": "ac5498b1-5632-5655-4165-4fac550f5851",
          "code": "3351",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3351",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3a1f9c3d-788f-5412-1b3e-bd6bbf9207a9"
          ]
        },
        {
          "uuid": "d571fdc2-8d8b-4a66-87d3-363cb5e7b53d",
          "code": "60VH42A1KJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ae64bd9c-d1d0-7e2c-66ac-bb0a3ea2ea18",
          "code": "100000076213",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "570087f9-3025-4374-b422-9416613ca2e3"
          ]
        },
        {
          "uuid": "82844dbe-97a1-affe-06bd-2e7e785be9ec",
          "code": "760389",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760389",
          "code_system": "NSC",
          "references": [
            "b7b91851-4c94-fb2f-4dad-2c9130a1a0f8"
          ]
        },
        {
          "uuid": "da6686cb-4962-4f0b-8766-c5fba2afb0d6",
          "code": "8115",
          "comments": "PART 1310 -- Records and Reports of Listed Chemicals ...|Sec. 1310.2|List I chemicals",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1310/section-1310.02",
          "code_system": "DEA NO."
        }
      ],
      "relationships": [
        {
          "uuid": "f07af3f8-103e-4be2-9d92-57ab73b1b222",
          "amount": {
            "uuid": "eeb27cd6-fec1-4c0f-89eb-acbbe2f4078e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "afd1ec93-7d31-45fa-bc2b-8846144418bf",
            "refuuid": "4c25b2e0-f324-44a6-95ec-3885c890a082",
            "name": "METHYLEPHEDRINE",
            "unii": "60VH42A1KJ",
            "linking_id": "60VH42A1KJ",
            "ref_pname": "METHYLEPHEDRINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "39534eb2-d0a1-4d61-9316-00c62e0f7365",
          "amount": {
            "uuid": "39e39e39-34a2-4a4d-bd16-a77994d59d5b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6094bc5b-8dbe-4a62-90c7-f8b195e6744e",
            "refuuid": "b6b4bc86-34fe-439f-b9f8-d92eae43d27d",
            "name": "METHYLEPHEDRINE HYDROCHLORIDE",
            "unii": "8ONA78V6FO",
            "linking_id": "8ONA78V6FO",
            "ref_pname": "METHYLEPHEDRINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fa144e56-b3ca-4228-97e9-6724bcd1035e",
          "amount": {
            "uuid": "04853d58-f4d9-46c8-8c09-c71749dff4b1"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "bd5f4d32-ef1d-47ae-916d-73c6038c9152",
            "refuuid": "0574480d-804d-46c4-b243-15def1e377b0",
            "name": "METHYLEPHEDRINE, (±)-",
            "unii": "SHS9PGQ2LS",
            "linking_id": "SHS9PGQ2LS",
            "ref_pname": "METHYLEPHEDRINE, (±)-"
          }
        },
        {
          "uuid": "3e7303ab-f41f-4018-85ea-4c6a8cf3e360",
          "amount": {
            "uuid": "9c84f5ce-b936-4528-96a2-12951c3e86f1"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "ddc410bf-b71f-465f-96ab-e44d89679752",
            "refuuid": "204f64ed-01a8-4065-b658-0ef43c04d18d",
            "name": "METHYLEPHEDRINE, (+)-",
            "unii": "VP306Z33KI",
            "linking_id": "VP306Z33KI",
            "ref_pname": "METHYLEPHEDRINE, (+)-"
          }
        },
        {
          "uuid": "c3ffe795-9370-4643-a96b-002153385a72",
          "amount": {
            "uuid": "e771c326-a3dd-4c1b-a00a-6fdd7f476fa7"
          },
          "type": "PARENT->PRECURSOR",
          "references": [
            "b38fffff-3e64-46b9-964e-d1caced49344"
          ],
          "related_substance": {
            "uuid": "fc881cbe-5d29-4803-a357-07a3d8db4390",
            "refuuid": "dfe50c81-a2c9-4448-9ca2-1687bb52c02c",
            "name": "N,N-DIMETHYLAMPHETAMINE",
            "unii": "IYE3F3MHCU",
            "linking_id": "IYE3F3MHCU",
            "ref_pname": "N,N-DIMETHYLAMPHETAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "12ad9cfa-f8f5-44fb-a865-6bf2693fda98",
          "name": "(1R,2S)-2-DIMETHYLAMINO-1-PHENYL-1-PROPANOL",
          "stdName": "(1R,2S)-2-DIMETHYLAMINO-1-PHENYL-1-PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
            "feead8e9-05ef-43f9-859d-12081f053f29"
          ],
          "display_name": false
        },
        {
          "uuid": "326bff89-e9e4-4e37-a331-16a56f542608",
          "name": "BENZENEMETHANOL, ALPHA-((1S)-1-(DIMETHYLAMINO)ETHYL)-, (.ALPHA.R)-",
          "stdName": "BENZENEMETHANOL, ALPHA-((1S)-1-(DIMETHYLAMINO)ETHYL)-, (.ALPHA.R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
            "feead8e9-05ef-43f9-859d-12081f053f29"
          ],
          "display_name": false
        },
        {
          "uuid": "671580e8-a635-4c41-ab4d-fd393a30e548",
          "name": "METHYLEPHEDRINE",
          "stdName": "METHYLEPHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2d242bc-a675-499f-9e1b-0d939d6cc0a1",
            "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
            "4f22b1c2-4495-4cc7-a096-5904b1f969bb",
            "a96ec2ed-27b8-4809-a224-be73c5aed19f"
          ],
          "display_name": true
        },
        {
          "uuid": "445c5efc-19e5-a483-ef4d-e4d96ad208db",
          "name": "Methylephedrine [WHO-DD]",
          "stdName": "METHYLEPHEDRINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "203a0af8-704e-3f0a-98d0-978919d42215"
          ],
          "display_name": false
        },
        {
          "uuid": "62f21bbe-fb09-4cee-bc1e-505a2c269f65",
          "name": "N-METHYLEPHEDRINE",
          "stdName": "N-METHYLEPHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
            "feead8e9-05ef-43f9-859d-12081f053f29",
            "c4afc333-8cfa-4e23-b56d-fa97e9d89df3",
            "20f0a695-3de5-4207-83d0-c84b488cc18d"
          ],
          "display_name": false
        },
        {
          "uuid": "e4559f73-84d6-46f1-b328-2c087c5db150",
          "name": "N-METHYLEPHEDRINE [MI]",
          "stdName": "N-METHYLEPHEDRINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
            "20f0a695-3de5-4207-83d0-c84b488cc18d"
          ],
          "display_name": false
        },
        {
          "uuid": "324cc47c-83a8-a2fb-2140-4de75f476cc2",
          "name": "NSC-760389",
          "stdName": "NSC-760389",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7b91851-4c94-fb2f-4dad-2c9130a1a0f8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a2d242bc-a675-499f-9e1b-0d939d6cc0a1",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "feead8e9-05ef-43f9-859d-12081f053f29",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1d74cfa-512d-41e2-ba8a-a2e155bf36f8",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20f0a695-3de5-4207-83d0-c84b488cc18d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a96ec2ed-27b8-4809-a224-be73c5aed19f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "773c47c7-e5d2-4648-9307-c618fa7a40ab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d80dbf3-6ec0-40ad-808f-bca6084ddc48",
          "citation": "SRS import [60VH42A1KJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=60VH42A1KJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4afc333-8cfa-4e23-b56d-fa97e9d89df3",
          "citation": "N-METHYLEPHEDRINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f22b1c2-4495-4cc7-a096-5904b1f969bb",
          "citation": "METHYLEPHEDRINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a0bf534-8096-0914-c46d-1efbadc57ec4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=552-79-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "570087f9-3025-4374-b422-9416613ca2e3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3a1f9c3d-788f-5412-1b3e-bd6bbf9207a9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "79948314-b62a-46f0-a51d-7a4190a2860d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b7b91851-4c94-fb2f-4dad-2c9130a1a0f8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "203a0af8-704e-3f0a-98d0-978919d42215",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b38fffff-3e64-46b9-964e-d1caced49344",
          "citation": "https://www.deadiversion.usdoj.gov/schedules/orangebook/orangebook.pdf",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/orangebook.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e1b0d6db-710b-48bd-a2ab-cf1d67ffb707",
          "id": "e1b0d6db-710b-48bd-a2ab-cf1d67ffb707",
          "molfile": "\n  Marvin  01132111412D          \n\n 13 13  0  0  1  0            999 V2000\n    6.2072   -2.5483    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.5990   -1.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3731   -2.5483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9814   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9584   -1.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6220   -3.2534    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.2211   -3.9724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4561   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8340   -2.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6728   -2.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0783   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6958   -3.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8708   -3.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]([C@@H](c1ccccc1)O)N(C)C",
          "formula": "C11H17NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef7c5228-0989-4d24-97b4-a20d98353b94"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "179.2592",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4c25b2e0-f324-44a6-95ec-3885c890a082",
      "version": "17",
      "structure": {
        "id": "3195ce08-f400-42f3-91b8-2510366a8ab9",
        "molfile": "\n  Marvin  01132102392D          \n\n 13 13  0  0  1  0            999 V2000\n    6.6220   -3.2534    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2072   -2.5483    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3731   -2.5483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9814   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9584   -1.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5990   -1.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4561   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8340   -2.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6728   -2.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0783   -3.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6958   -3.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8708   -3.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2211   -3.9724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  2  6  1  1  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  7  2  0  0  0  0\n  1 13  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H]([C@@H](c1ccccc1)O)N(C)C",
        "formula": "C11H17NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "179.2592",
        "optical_activity": "( - )",
        "references": [
          "a2d242bc-a675-499f-9e1b-0d939d6cc0a1",
          "3d80dbf3-6ec0-40ad-808f-bca6084ddc48"
        ],
        "stereo_centers": 2
      },
      "unii": "60VH42A1KJ"
    }
  ]
}