{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "200687b0-9965-415b-9e41-6322224b562e",
          "code": "N07AX02",
          "comments": "ATC|NERVOUS SYSTEM|OTHER NERVOUS SYSTEM DRUGS|PARASYMPATHOMIMETICS|Other parasympathomimetics|choline alfoscerate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N07AX02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "db62236a-1232-471d-b2b1-246c3bf34e20",
          "code": "QN07AX02",
          "comments": "VATC|OTHER NERVOUS SYSTEM DRUGS|PARASYMPATHOMIMETICS|Other parasympatomimetics|choline alfoscerate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN07AX02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "4e23a492-e929-45d8-b723-38c2ec32df9f",
          "code": "28319-77-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28319-77-9",
          "code_system": "CAS",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118",
            "e5deb7c1-3b49-46d4-a6e0-3ca70f09821d"
          ]
        },
        {
          "uuid": "48230eab-88bd-4ca8-b633-1f0a28f425e0",
          "code": "SUB06216MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "cec6a147-c7ff-4b53-a949-86f5ce63f750",
          "code": "5203",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5203",
          "code_system": "INN",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "68f621e1-d729-4b2f-919a-57b50d7b443e",
          "code": "m3482",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3482?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "f53d3272-34b9-44aa-80a5-6cb72e13c5aa",
          "code": "CHEMBL1567463",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1567463",
          "code_system": "ChEMBL",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "091486f3-8128-40dd-8f0e-56fe9d5e055e",
          "code": "248-962-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.496",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "d430722a-050e-4b23-b11a-0d1d408dfc83",
          "code": "657272",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/657272",
          "code_system": "PUBCHEM",
          "references": [
            "b3e94e60-12d8-4d01-a129-b3cb4239d118"
          ]
        },
        {
          "uuid": "58eb7152-5675-426b-9613-de81435c9edd",
          "code": "4918",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4918/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "122eabc6-6256-b632-d9a8-21271d734706"
          ]
        },
        {
          "uuid": "8809fd32-0f09-d9c3-2deb-4080a4a1d11b",
          "code": "10578-3",
          "comments": "LOINC|ACTIVE|CHEM|Semin plas|Glycerophosphocholine [Moles/volume] in Seminal plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/10578-3/",
          "code_system": "LOINC",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "fd7f8a86-ca19-e08a-4031-c9e552039920",
          "code": "C166883",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166883",
          "code_system": "NCI_THESAURUS",
          "references": [
            "04e58c04-1ca5-99ec-a821-c2fd4a2983cf"
          ]
        },
        {
          "uuid": "7edd4292-4ac9-44bd-8e3b-9fd83653e091",
          "code": "60M22SGW66",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dbbdfd52-65d9-a2e8-1557-a0b33a570644",
          "code": "315 (Number of products:313)",
          "comments": "Dietary Supplement Label Database|chemical|Alpha-GPC",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=315&item=Alpha-GPC",
          "code_system": "DSLD",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "ede4470b-e234-fb0f-43ad-0807da1f7233",
          "code": "627",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/627",
          "code_system": "DRUG CENTRAL",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "10ec1a0c-6075-efd7-a30b-f5b4ee9fef5c",
          "code": "DB04660",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04660",
          "code_system": "DRUG BANK",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "bbb95efe-7fc0-8b22-e92b-280a8edf828c",
          "code": "16870",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16870",
          "code_system": "CHEBI",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "1c0c1598-cbcb-581f-807d-32d359c6b009",
          "code": "Alpha-GPC",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alpha-GPC",
          "code_system": "WIKIPEDIA",
          "references": [
            "871a1728-8290-d0f6-035a-631f3e8da454"
          ]
        },
        {
          "uuid": "c3b3c25d-b91d-a393-04b1-437b3373d4c6",
          "code": "1295786",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1295786",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "62c74ac9-db3e-f11e-4a8c-a1eaa97bf437",
          "code": "100000090092",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "534a16f4-a5b3-2282-f6a1-0d0e6f37340a"
          ]
        },
        {
          "uuid": "c602e9a1-02be-5a43-5f26-5b9ee215215c",
          "code": "DTXSID70951010",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70951010",
          "code_system": "EPA CompTox",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        },
        {
          "uuid": "2a48e82b-4605-a6c2-50dc-1b8068092959",
          "code": "419",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=419",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "f23f5c09-f149-72a4-9d1a-9adae5f50f9a"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "00722c4e-0cff-4901-aef3-2455926b2c25",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "166aca01-1aff-4a70-8ebc-b3fee36ba9f2",
          "citation": "INN Proposed List 60",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL60.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9bceb44a-346a-4ded-99f3-bb82d9443794",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc080892-de13-4be0-ab3a-8dc31ec41853",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3a1569a-c72f-4f70-8cf5-3594cea0db13",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c2c8de4-45dd-45f4-9669-f06e4d00420b",
          "citation": "D07349",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff815d60-b526-4c91-8f59-69c93acc8f48",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f03e81f4-574c-4c87-a048-c8bc4f9a1a9f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "845703d9-e49c-4fb8-b662-28f0aa0c450d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc11e6f1-2bbc-446c-a7eb-1d9625cf1e6c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3e94e60-12d8-4d01-a129-b3cb4239d118",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f40ac63b-936b-445b-b0f0-4183b3f1b98f",
          "citation": "SRS import [60M22SGW66]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=60M22SGW66",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390699000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbd4d257-45cd-44f6-9541-979e1e76e21d",
          "citation": "CHOLINE ALFOSCERATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fa059f19-b693-4189-9096-8bc3d49fda9b",
          "citation": "CHOLINE ALFOSCERATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53600bf7-f064-4033-8b30-b3cfe57a25b0",
          "citation": "CHOLINE ALFOSCERATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c271ed1d-0d6d-4428-b60b-7a371be85506",
          "citation": "GLYCEROPHOSPHOCHOLINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bfaf6bf9-1b5b-44e3-bd35-400668625042",
          "citation": "CHOLINE ALFOSCERATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0368aebd-3b31-f4eb-6aac-3a9e1c61798b",
          "citation": "CLIN",
          "doc_type": "CLINICALTRIALS",
          "public_domain": true
        },
        {
          "uuid": "534a16f4-a5b3-2282-f6a1-0d0e6f37340a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "122eabc6-6256-b632-d9a8-21271d734706",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "e5deb7c1-3b49-46d4-a6e0-3ca70f09821d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f23f5c09-f149-72a4-9d1a-9adae5f50f9a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "871a1728-8290-d0f6-035a-631f3e8da454",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "04e58c04-1ca5-99ec-a821-c2fd4a2983cf",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "f661a4a9-00f6-b88d-b487-85dfd18229cb",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c9a3dac1-f117-3aa1-a8bf-1a262225eff7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "06d8bfb7-ee6c-f464-e001-072ae645c46a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "764c9139-eb4d-44d6-a3ba-2e0b2077393b",
          "id": "764c9139-eb4d-44d6-a3ba-2e0b2077393b",
          "molfile": "\n  Marvin  01132106082D          \n\n 16 15  0  0  1  0            999 V2000\n   -0.8553   -0.6922    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.1236   -1.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8603    0.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1335    0.4696    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.5821   -1.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3139   -0.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0407   -1.0878    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4708   -1.7503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6303   -1.7503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7725   -0.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.4993   -1.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2310   -0.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.9577   -1.0926    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   -6.6994   -0.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.3880   -1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.5474   -1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\nM  CHG  2   4  -1  13   1\nM  END",
          "smiles": "C[N+](C)(C)CCOP(=O)(O)OC[C@@H](C[O-])O",
          "formula": "C8H20NO6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65d653dd-8970-490b-9316-5322d021ba10"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "257.2216",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9bbc7ff5-41af-46fb-8d71-393893cd7161",
      "version": "28",
      "structure": {
        "id": "ca6e7996-0583-4b72-a35f-1bd96f90a799",
        "molfile": "\n  Marvin  01132110272D          \n\n 16 15  0  0  1  0            999 V2000\n   -3.0407   -1.0878    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4708   -1.7503    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.3139   -0.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6303   -1.7503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.9577   -1.0926    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.1236   -1.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7725   -0.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5821   -1.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1335    0.4696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8553   -0.6922    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -4.4993   -1.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8603    0.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2310   -0.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.6994   -0.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.3880   -1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.5474   -1.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5 13  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n 10 12  1  1  0  0  0\n 13 11  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  5  1  0  0  0  0\nM  CHG  2   2  -1   5   1\nM  END",
        "smiles": "C[N+](C)(C)CCOP(=O)([O-])OC[C@@H](CO)O",
        "formula": "C8H20NO6P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "257.2216",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "00722c4e-0cff-4901-aef3-2455926b2c25",
          "f40ac63b-936b-445b-b0f0-4183b3f1b98f",
          "166aca01-1aff-4a70-8ebc-b3fee36ba9f2"
        ],
        "stereo_centers": 1
      },
      "unii": "60M22SGW66",
      "relationships": [
        {
          "uuid": "f5954aaa-3118-47f2-a750-4be1b9fc1666",
          "amount": {
            "uuid": "1949ace0-9b93-4df3-aae4-f2c911dfd3ef"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "07ba7fa1-0997-4909-a4ee-6b56940c0127",
            "refuuid": "9bbc7ff5-41af-46fb-8d71-393893cd7161",
            "name": "CHOLINE ALFOSCERATE",
            "unii": "60M22SGW66",
            "linking_id": "60M22SGW66",
            "ref_pname": "CHOLINE ALFOSCERATE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "f1df62db-a452-4c97-8a98-66e5c7801979",
          "name": "ALPHA-GLYCERYLPHOSPHORYLCHOLINE",
          "stdName": "ALPHA-GLYCERYLPHOSPHORYLCHOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
            "fc11e6f1-2bbc-446c-a7eb-1d9625cf1e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "94a2dc34-ba6d-4733-baf5-36720756b7dd",
          "name": "CHOLINE ALFOSCERATE",
          "stdName": "CHOLINE ALFOSCERATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbd4d257-45cd-44f6-9541-979e1e76e21d",
            "fa059f19-b693-4189-9096-8bc3d49fda9b",
            "00722c4e-0cff-4901-aef3-2455926b2c25",
            "9bceb44a-346a-4ded-99f3-bb82d9443794",
            "166aca01-1aff-4a70-8ebc-b3fee36ba9f2",
            "f03e81f4-574c-4c87-a048-c8bc4f9a1a9f",
            "53600bf7-f064-4033-8b30-b3cfe57a25b0",
            "fc080892-de13-4be0-ab3a-8dc31ec41853",
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
            "bfaf6bf9-1b5b-44e3-bd35-400668625042"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "48fc2094-94d8-4648-a0af-fe61df27c498",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "0830fbc3-5595-472d-a5b7-e231f2126ad0",
          "name": "CHOLINE ALFOSCERATE [MART.]",
          "stdName": "CHOLINE ALFOSCERATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bceb44a-346a-4ded-99f3-bb82d9443794"
          ],
          "display_name": false
        },
        {
          "uuid": "09c2a33f-93ec-43a0-9a4e-b65b401ea264",
          "name": "CHOLINE ALFOSCERATE [MI]",
          "stdName": "CHOLINE ALFOSCERATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc080892-de13-4be0-ab3a-8dc31ec41853",
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf"
          ],
          "display_name": false
        },
        {
          "uuid": "f9f0fd6e-7067-9e59-f429-d09639be8192",
          "name": "CHOLINE ALPHOSCERATE",
          "stdName": "CHOLINE ALPHOSCERATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0368aebd-3b31-f4eb-6aac-3a9e1c61798b"
          ],
          "display_name": false
        },
        {
          "uuid": "80bfec29-7f06-4b67-8cbe-41551eea9c11",
          "name": "CHOLINE HYDROXIDE, (R)-2,3-DIHYDROXYPROPYL HYDROGEN PHOSPHATE, INNER SALT",
          "stdName": "CHOLINE HYDROXIDE, (R)-2,3-DIHYDROXYPROPYL HYDROGEN PHOSPHATE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00722c4e-0cff-4901-aef3-2455926b2c25"
          ],
          "display_name": false
        },
        {
          "uuid": "a55a4f5c-212c-5206-d3d6-3bd7c0aec62e",
          "name": "Choline alfoscerate [WHO-DD]",
          "stdName": "CHOLINE ALFOSCERATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06d8bfb7-ee6c-f464-e001-072ae645c46a"
          ],
          "display_name": false
        },
        {
          "uuid": "f76faec5-99b8-4ae9-9b37-6012e773cd5b",
          "name": "ETHANAMINIUM, 2-((((2R)-2,3-DIHYDROXYPROPOXXY)HYDROXYPHOSPHINYL)OXY)-N,N,N-TRIMETHYL-, INNER SALT",
          "stdName": "ETHANAMINIUM, 2-((((2R)-2,3-DIHYDROXYPROPOXXY)HYDROXYPHOSPHINYL)OXY)-N,N,N-TRIMETHYL-, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
            "ff815d60-b526-4c91-8f59-69c93acc8f48"
          ],
          "display_name": false
        },
        {
          "uuid": "fd299024-ce1e-45b8-a98a-46df8e472ea1",
          "name": "GLIATILIN",
          "stdName": "GLIATILIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c2c8de4-45dd-45f4-9669-f06e4d00420b",
            "b3a1569a-c72f-4f70-8cf5-3594cea0db13"
          ],
          "display_name": false
        },
        {
          "uuid": "09d08ce3-861b-4012-8233-9936ab8af9a7",
          "name": "GLYCEROPHOSPHOCHOLINE",
          "stdName": "GLYCEROPHOSPHOCHOLINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "845703d9-e49c-4fb8-b662-28f0aa0c450d",
            "c271ed1d-0d6d-4428-b60b-7a371be85506",
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
            "ff815d60-b526-4c91-8f59-69c93acc8f48"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2de9317b-1d81-409c-b50a-162828ca0ddc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9b03ead9-5c40-4587-aaf5-5a65f26d20be",
          "name": "L-.ALPHA.-GLYCERYLPHOSPHORYLCHOLINE",
          "stdName": "L-.ALPHA.-GLYCERYLPHOSPHORYLCHOLINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6329fc10-5b5e-4b52-9d25-ffb6fc19a1bf",
            "ff815d60-b526-4c91-8f59-69c93acc8f48"
          ],
          "display_name": false
        },
        {
          "uuid": "8b62088c-6327-aa1a-449f-9c83c7fe986d",
          "name": "L-ALPHA-GLYCERYLPHOSPHORYLCHOLINE [USP-RS]",
          "stdName": "L-ALPHA-GLYCERYLPHOSPHORYLCHOLINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f661a4a9-00f6-b88d-b487-85dfd18229cb"
          ],
          "display_name": false
        },
        {
          "uuid": "6b72c588-0fdf-4624-a674-39fa5f5c9eac",
          "name": "choline alfoscerate [INN]",
          "stdName": "CHOLINE ALFOSCERATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "166aca01-1aff-4a70-8ebc-b3fee36ba9f2"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "9593355e-1862-440f-aa9c-df902fe1a0a1"
      }
    }
  ]
}