{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2d776615-c99c-4d01-908b-0580e66c875c",
          "code": "6107-56-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6107-56-8",
          "code_system": "CAS",
          "references": [
            "21b7fc07-b367-47b3-98cf-9e0f1e9d5bdc",
            "df394587-dc2d-4257-bf0a-e5ec7042413c"
          ]
        },
        {
          "uuid": "8ed5a079-8a5b-4d4c-b0c7-a31881120d76",
          "code": "SUB77921",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "21b7fc07-b367-47b3-98cf-9e0f1e9d5bdc"
          ]
        },
        {
          "uuid": "cabb8c1c-c607-4bd8-a6c6-53a8ef2fbd99",
          "code": "228-067-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.516",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "21b7fc07-b367-47b3-98cf-9e0f1e9d5bdc"
          ]
        },
        {
          "uuid": "3cf737ab-ee71-8489-c3a3-66a653bfb9b6",
          "code": "DTXSID7052280",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7052280",
          "code_system": "EPA CompTox",
          "references": [
            "678b21a8-bf1f-ed53-ff1e-a515b1999253"
          ]
        },
        {
          "uuid": "b4ce6d74-ca38-1268-43f4-137839020719",
          "code": "16610",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16610",
          "code_system": "PUBCHEM",
          "references": [
            "755e37c3-4e87-525c-cd4e-27d108d49c07"
          ]
        },
        {
          "uuid": "eca90f87-d63d-b92d-6e86-d38c734281b8",
          "code": "4193 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|other|calcium Octanoate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4193&item=calcium Octanoate",
          "code_system": "DSLD",
          "references": [
            "28c06ca9-1e2d-8772-c120-c79e5331edd9"
          ]
        },
        {
          "uuid": "83cf8e62-20e9-4774-8aaa-5842148b2712",
          "code": "606VZD154T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "95743a73-fd1f-939c-df4b-feaead3e891d",
          "code": "100000138418",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9d26758d-b250-f659-4774-fb475995acab"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "06b2046c-47c3-4c97-8e4c-138800deb55e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "256db419-d529-427c-af50-256b3b3000db",
            "refuuid": "7180aff9-4e84-47ff-822c-26dae136e1a2",
            "name": "Caprylic Acid",
            "unii": "OBL58JN025",
            "linking_id": "OBL58JN025",
            "ref_pname": "Caprylic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0f9eb30f-a291-1a00-f833-9532a716b22f",
          "name": "CALCIUM CAPRYLATE",
          "stdName": "CALCIUM CAPRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "678b21a8-bf1f-ed53-ff1e-a515b1999253"
          ],
          "display_name": false
        },
        {
          "uuid": "cac16a86-1120-4f5d-b7d4-3ba80ba8b1a9",
          "name": "CALCIUM N-OCTANOATE",
          "stdName": "CALCIUM N-OCTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3808608f-16cc-40eb-9418-fa448b3fec0c"
          ],
          "display_name": false
        },
        {
          "uuid": "646af398-6e11-4b10-a050-e213d7fb09c4",
          "name": "CALCIUM OCTANOATE",
          "stdName": "CALCIUM OCTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ba585db-bf02-487a-a2ec-6bc759f6d61e"
          ],
          "display_name": true
        },
        {
          "uuid": "f2a2f14e-acc4-6b73-491b-088f055b5832",
          "name": "CAPRYLIC ACID CALCIUM SALT",
          "stdName": "CAPRYLIC ACID CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "678b21a8-bf1f-ed53-ff1e-a515b1999253"
          ],
          "display_name": false
        },
        {
          "uuid": "1379b40e-a2d2-89b2-c054-ffe2c78ca962",
          "name": "Calcium caprylate [WHO-DD]",
          "stdName": "CALCIUM CAPRYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02044053-503e-c445-5724-b57177177736"
          ],
          "display_name": false
        },
        {
          "uuid": "185b2720-5e05-4658-82f1-2dca4f18a1e8",
          "name": "N-OCTANOIC ACID, CALCIUM SALT",
          "stdName": "N-OCTANOIC ACID, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3808608f-16cc-40eb-9418-fa448b3fec0c"
          ],
          "display_name": false
        },
        {
          "uuid": "e79dc698-fa40-412a-a317-a20a8bcb7080",
          "name": "OCTANOIC ACID, CALCIUM SALT",
          "stdName": "OCTANOIC ACID, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73f87e28-9e22-43d9-acec-fffe4e455f86"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2ba585db-bf02-487a-a2ec-6bc759f6d61e",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3808608f-16cc-40eb-9418-fa448b3fec0c",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73f87e28-9e22-43d9-acec-fffe4e455f86",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21b7fc07-b367-47b3-98cf-9e0f1e9d5bdc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38d5d855-8565-43c0-8167-52d4708ab090",
          "citation": "SRS import [606VZD154T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=606VZD154T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fbce2ee-66af-40cd-9c49-dfbbb33f95f8",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "678b21a8-bf1f-ed53-ff1e-a515b1999253",
          "citation": "https://www.parchem.com/chemical-supplier-distributor/Calcium-caprylate-097238.aspx",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6107-56-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d26758d-b250-f659-4774-fb475995acab",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "df394587-dc2d-4257-bf0a-e5ec7042413c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "755e37c3-4e87-525c-cd4e-27d108d49c07",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "28c06ca9-1e2d-8772-c120-c79e5331edd9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "02044053-503e-c445-5724-b57177177736",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd885d8a-8e58-4ac5-a63e-1e2e7c204b33",
          "id": "bd885d8a-8e58-4ac5-a63e-1e2e7c204b33",
          "molfile": "\n  Marvin  01132109482D          \n\n  1  0  0  0  0  0            999 V2000\n   11.0854   -4.5920    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d9600ba4-a929-4c86-b350-2e6ee52a5e54"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8c802a4e-f51b-448e-8fa8-1be707bf6cc0",
          "id": "8c802a4e-f51b-448e-8fa8-1be707bf6cc0",
          "molfile": "\n  Marvin  01132107182D          \n\n 10  9  0  0  0  0            999 V2000\n    3.5947   -3.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3050   -3.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0247   -3.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7347   -3.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4502   -3.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1698   -3.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8843   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -3.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -2.4838    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.3195   -3.7211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "CCCCCCCC(=O)[O-]",
          "formula": "C8H15O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "28991ba9-ab7a-4ce5-ab01-678460ae6a26"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "143.2038",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "247403ff-c4d9-46eb-a7bd-68fde13dd165",
      "version": "12",
      "structure": {
        "id": "bb5185ae-3db0-42a8-8c55-2d634cd41b3e",
        "molfile": "\n  Marvin  01132109412D          \n\n 21 18  0  0  0  0            999 V2000\n   11.0854   -4.5920    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    7.1698   -3.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4502   -3.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7347   -3.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0247   -3.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3050   -3.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5947   -3.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8843   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -3.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -2.4838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3195   -3.7211    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1698   -3.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4502   -3.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7347   -3.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0247   -3.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3050   -3.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5947   -3.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8843   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -3.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5998   -2.4838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3195   -3.7211    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\nM  CHG  3   1   2  11  -1  21  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  5  17  18  19  20  21\nM  SPA   1 10   2   3   4   5   6   7   8   9  10  11\nM  SDI   1  4    3.1747   -4.1571    3.1747   -2.0638\nM  SDI   1  4    9.7395   -2.0638    9.7395   -4.1571\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCCC(=O)[O-].CCCCCCCC(=O)[O-].[Ca+2]",
        "formula": "2C8H15O2.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.4856",
        "optical_activity": "NONE",
        "references": [
          "4fbce2ee-66af-40cd-9c49-dfbbb33f95f8",
          "38d5d855-8565-43c0-8167-52d4708ab090"
        ],
        "stereo_centers": 0
      },
      "unii": "606VZD154T"
    }
  ]
}