{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "373c73e8-441c-4460-9f4a-fb16c9352cfb", "code": "1382469-39-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1382469-39-7", "code_system": "CAS", "references": [ "3d523d2c-5684-4a54-a2d6-d2b7b93b8f71", "f6e8032c-d503-4045-b120-382ec002b5aa" ] }, { "uuid": "44a4f57e-4d4b-404e-af1b-7ac9f578747a", "code": "57380301", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57380301", "code_system": "PUBCHEM", "references": [ "3d523d2c-5684-4a54-a2d6-d2b7b93b8f71" ] }, { "uuid": "89334011-8ae6-af08-06b0-668663368d52", "code": "DB15235", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB15235", "code_system": "DRUG BANK", "references": [ "39be3ef9-fb53-5e14-6070-33e182d7b457" ] }, { "uuid": "66f04896-909e-46cc-b5b3-6d7cb82af1b8", "code": "6068Z4Y7QI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2d962cf3-7b69-ad41-ea36-a1f58a05faa6", "code": "100000177905", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "07354468-c943-3966-2563-990502d2d91b" ] } ], "relationships": [ { "uuid": "0910bd60-cff7-453c-96f0-f649d8d2af8f", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "b69b6d73-9765-49b7-a34b-98a86611c531", "refuuid": "1b1148d9-8e90-4f1b-bbe4-6e22d526b8b8", "name": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE", "unii": "6068Z4Y7QI", "linking_id": "6068Z4Y7QI", "ref_pname": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE", "substance_class": "reference" } }, { "uuid": "0a3f14eb-4300-410d-8c14-1dc1d122fc95", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "1afded44-144c-4e4b-8530-78990022daaa", "refuuid": "62432069-c979-4d64-9bd0-f2a866f2157c", "name": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE HYDROCHLORIDE", "unii": "592GM24H49", "linking_id": "592GM24H49", "ref_pname": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE HYDROCHLORIDE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "ac28515e-a4ee-427c-b17f-40d89abc862c", "name": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE", "stdName": "DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7da007d3-3658-4068-9283-044247a770ae", "dcaaa0dd-dae4-4491-bbf3-3699723e4d50" ], "display_name": true }, { "uuid": "2796fd11-6005-44d3-aa23-3322fe65fcd6", "name": "DP4CYCH4MT", "stdName": "DP4CYCH4MT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1becb3a9-bee6-4081-a0a4-61bdd7e65f31", "7da007d3-3658-4068-9283-044247a770ae" ], "display_name": false }, { "uuid": "6f096e95-af7b-41c8-8838-e71e378e5c7b", "name": "DPC", "stdName": "DPC", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dd0a8c6d-c30d-4598-9056-86b9609ced33" ], "display_name": false } ], "references": [ { "uuid": "1becb3a9-bee6-4081-a0a4-61bdd7e65f31", "citation": "https://clinicaltrials.gov/ct2/show/NCT02688101?intr=DPC&rank=3", "url": "https://clinicaltrials.gov/ct2/show/NCT02688101?intr=DPC&rank=3", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7da007d3-3658-4068-9283-044247a770ae", "citation": "CLINICALTRIALS", "doc_type": "CLINICALTRIALS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dcaaa0dd-dae4-4491-bbf3-3699723e4d50", "citation": "http://molpharm.aspetjournals.org/content/early/2011/08/16/mol.111.073627.full.pdf", "url": "http://molpharm.aspetjournals.org/content/early/2011/08/16/mol.111.073627.full.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dd0a8c6d-c30d-4598-9056-86b9609ced33", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d523d2c-5684-4a54-a2d6-d2b7b93b8f71", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393596000, "tags": [ "NOMEN" ] }, { "uuid": "4a0b1f40-b6d6-446e-9788-78110daee9c4", "citation": "SRS import [6068Z4Y7QI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6068Z4Y7QI", "doc_type": "SRS", "public_domain": true, "document_date": 1493393596000, "tags": [ "NOMEN" ] }, { "uuid": "07354468-c943-3966-2563-990502d2d91b", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "39be3ef9-fb53-5e14-6070-33e182d7b457", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f6e8032c-d503-4045-b120-382ec002b5aa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "112b6f95-3448-427d-a992-2cbb910be85d", "id": "112b6f95-3448-427d-a992-2cbb910be85d", "molfile": "\n Marvin 01132101072D \n\n 25 27 0 0 0 0 999 V2000\n 4.1010 -6.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1010 -5.9419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3864 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3864 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6719 -4.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9575 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9575 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6719 -5.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8155 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8155 -4.7043 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5300 -5.9419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2445 -5.5294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9591 -5.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6736 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6738 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3866 -4.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1013 -4.7063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1029 -5.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3912 -5.9437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9591 -6.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2415 -7.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2462 -8.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9580 -8.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6727 -8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6735 -7.1797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 9 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 20 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 19 2 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 21 1 0 0 0 0\n 25 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CN(C1CCCCC1)C(=S)NN=C(c2ccccn2)c3ccccn3", "formula": "C19H23N5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6129a22f-b56c-4cee-bf2c-06f53b98f0a6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "353.4862", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "1b1148d9-8e90-4f1b-bbe4-6e22d526b8b8", "version": "6", "structure": { "id": "85222677-759f-4b84-b097-fba1eb6ff279", "molfile": "\n Marvin 01132106542D \n\n 25 27 0 0 0 0 999 V2000\n 1.9575 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6719 -4.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3864 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3864 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6719 -5.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9575 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1010 -5.9419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8155 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5300 -5.9419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2445 -5.5294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9591 -5.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6736 -5.5294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6738 -4.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3866 -4.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1013 -4.7063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1029 -5.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3912 -5.9437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9591 -6.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6735 -7.1797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6727 -8.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9580 -8.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2462 -8.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2415 -7.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8155 -4.7043 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1010 -6.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 1 6 1 0 0 0 0\n 6 5 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 12 17 1 0 0 0 0\n 11 18 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 18 23 1 0 0 0 0\n 8 24 2 0 0 0 0\n 7 25 1 0 0 0 0\nM END", "smiles": "CN(C1CCCCC1)C(=S)NN=C(c2ccccn2)c3ccccn3", "formula": "C19H23N5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "353.4862", "optical_activity": "NONE", "references": [ "4a0b1f40-b6d6-446e-9788-78110daee9c4", "dd0a8c6d-c30d-4598-9056-86b9609ced33" ], "stereo_centers": 0 }, "unii": "6068Z4Y7QI" } ] }