{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "19fd6f10-1a1f-43bb-8169-f9b1630a6edf",
          "code": "L01BB07",
          "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ANTINEOPLASTIC AGENTS|ANTIMETABOLITES|Purine analogues|nelarabine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=L01BB07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "58931226-f923-4f66-83ae-c5635c95e63a",
          "code": "N0000175595",
          "comments": "Established Pharmacologic Class [EPC]|Nucleoside Metabolic Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175595",
          "code_system": "NDF-RT",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "b93b43f4-7b3e-4f55-ac0c-f2e21a285a20",
          "code": "N0000000233",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Nucleic Acid Synthesis Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000233",
          "code_system": "NDF-RT",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "ad53b72a-5b3c-4dec-9f0c-a587b0c1d727",
          "code": "QL01BB07",
          "comments": "VATC|ANTINEOPLASTIC AGENTS|ANTIMETABOLITES|Purine analogues|nelarabine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL01BB07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "dac23082-bcd0-44d9-83d0-eef6878dea20",
          "code": "121032-29-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=121032-29-9",
          "code_system": "CAS",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0",
            "512ba057-6563-43c5-a77c-14d320d83330"
          ]
        },
        {
          "uuid": "f452fa0e-1298-46ec-9d7b-bcf0e4594a6a",
          "code": "C1704",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1704",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "19e866c9-c7d5-4091-b3d3-75b07cf3943d",
          "code": "C104457",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67104457",
          "code_system": "MESH",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "a8151f9a-f530-4fb1-be83-866d42f1d225",
          "code": "NBK548515",
          "comments": "LiverTox|Antineoplastic|Leukemia, Lymphoma|Antimetabolite, guanosine analogue",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548515/",
          "code_system": "LIVERTOX",
          "references": [
            "3d9b1d23-6854-1c65-befa-5bd0eb23495b"
          ]
        },
        {
          "uuid": "49a19fc3-7e88-45f6-8f54-c7ed5d036089",
          "code": "NELARABINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nelarabine",
          "code_system": "WIKIPEDIA",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "8d74997a-1a4b-44b8-b580-33c172dbcae6",
          "code": "SUB09188MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "6ba9910d-8883-4faf-a39e-45023ac9605b",
          "code": "7704",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7704",
          "code_system": "INN",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "6ba25d80-d4e2-4372-8232-8d1f5115cd5c",
          "code": "ATTRIANCE (AUTHORIZED: PRECURSOR T-CELL LYMPHOBLASTIC LEUKEMIA-LYMPHOMA)",
          "comments": "EMA EPAR|DISEASES|BLOOD AND LYMPHATIC DISEASES|LYMPHATIC DISEASES|LYMPHOPROLIFERATIVE DISORDERS|LEUKEMIA, LYMPHOID|PRECURSOR CELL LYMPHOBLASTIC LEUKEMIA-LYMPHOMA|PRECURSOR T-CELL LYMPHOBLASTIC LEUKEMIA-LYMPHOMA",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000752/human_med_000656.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "afbe25ed-62a9-4eae-b718-dc914f870df6",
          "code": "7090",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7090",
          "code_system": "IUPHAR",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "9ef1edd3-ddc8-499c-9ee3-d71d34487691",
          "code": "274771",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/274771/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "628e4587-5e91-4e88-b56d-dd5c0ff9f9ca",
          "code": "m7797",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7797?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "5c8d2a89-a467-4546-ac07-d3fdaf0397db",
          "code": "DB01280",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01280",
          "code_system": "DRUG BANK",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "e3f09a2d-9322-4d22-8504-3d83f40a6d8a",
          "code": "CHEMBL1201112",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201112",
          "code_system": "ChEMBL",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "4cf32b29-ba58-4589-b2c5-5ad727c1f8ee",
          "code": "3011155",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3011155",
          "code_system": "PUBCHEM",
          "references": [
            "2700180b-eb4e-40e2-8c41-861208ddeef0"
          ]
        },
        {
          "uuid": "a47d562a-40c0-bd5d-7499-1dd75e61f6fd",
          "code": "DTXSID6046842",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046842",
          "code_system": "EPA CompTox",
          "references": [
            "56f1298b-ee22-75b2-65f4-eed22e2cdbd8"
          ]
        },
        {
          "uuid": "15702f47-30c8-ad6a-2a58-ea437b7bedcd",
          "code": "125999",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of chronic lymphocytic leukemia.",
          "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of chronic lymphocytic leukemia.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=125999",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "c5af6b34-d441-17ef-3686-f3f26812f4de",
          "code": "184404",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of acute lymphoblastic leukemia and lymphoblastic lymphoma",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=184404",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "6a649ae3-cf6c-843e-698b-4160684c5017",
          "code": "C1556",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antimetabolite[C272]|Purine Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1556",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3d9b1d23-6854-1c65-befa-5bd0eb23495b"
          ]
        },
        {
          "uuid": "4352fbb8-100a-e694-b2b7-84e6a85c508a",
          "code": "EU/3/05/293",
          "comments": "EU ORPHAN DRUG|Expired|Treatment of acute lymphoblastic leukaemia",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu305293",
          "code_system": "EU-Orphan Drug",
          "references": [
            "3d9b1d23-6854-1c65-befa-5bd0eb23495b"
          ]
        },
        {
          "uuid": "7fa885bd-b231-426c-80e0-b80a21aa2e9f",
          "code": "60158CV180",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "eb90733a-7803-e8b0-0403-f5689ca95ef8",
          "code": "1892",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1892",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3d9b1d23-6854-1c65-befa-5bd0eb23495b"
          ]
        },
        {
          "uuid": "8ace7552-a9b7-d052-49c1-1beb540a3d9a",
          "code": "63612",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:63612",
          "code_system": "CHEBI",
          "references": [
            "3d9b1d23-6854-1c65-befa-5bd0eb23495b"
          ]
        },
        {
          "uuid": "628551e6-7dce-62aa-1246-1f1e8f176b68",
          "code": "60158CV180",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=60158CV180",
          "code_system": "DAILYMED",
          "references": [
            "b0196309-891f-504e-25d6-f89f5f8679c2"
          ]
        },
        {
          "uuid": "1c5de488-8597-4797-d8e7-b62c3711a57a",
          "code": "100000085469",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "558765df-fde2-230c-cbf6-c5eed16111e2"
          ]
        },
        {
          "uuid": "ff2163b5-fe09-85ca-0190-53fc4e009c72",
          "code": "759876",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759876",
          "code_system": "NSC",
          "references": [
            "f4f46454-d98f-262a-2fc7-46aa518cbf85"
          ]
        },
        {
          "uuid": "b14ce935-55ad-c634-eb15-06fcab66f8d6",
          "code": "686673",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=686673",
          "code_system": "NSC",
          "references": [
            "f4f46454-d98f-262a-2fc7-46aa518cbf85"
          ]
        },
        {
          "uuid": "e03403d1-a6e6-ff23-e7ad-7ec44c62ad49",
          "code": "755985",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755985",
          "code_system": "NSC",
          "references": [
            "f4f46454-d98f-262a-2fc7-46aa518cbf85"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "7069389e-9ecc-4dfe-8b91-ac83c5cdabdd",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ac9aab9-42c7-4d22-90a1-cf6c56ff35db",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cc2bae2-09a6-493d-8403-430b7f4c0ddb",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f040a94c-a4bd-4978-9e9c-55beeac0c9e2",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84e8ec76-9284-462a-afc5-865eaf5944fa",
          "citation": "INN Proposed List 80",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL80.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5bbb8b5-c91f-4ed0-8958-2b2fa66cd510",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff145556-86ff-4625-94c5-7730433b062b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2cb10b2-c187-4db2-b60c-ccca7456bd5b",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b687c4e-7c36-42ad-b620-a15a11e4fd62",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d11ee08e-c595-4aed-aaaf-de5f7f7f8ff3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fea4e4bb-bc64-440b-8dc9-1ca85faf5295",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd7c7e7b-0fba-4c22-a474-5ffdbdb07193",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7305849f-2124-45b6-8de8-f97165846bad",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5704f73-3f10-4867-b58e-9ca4da812f01",
          "citation": "USP DICTIONARY 2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bff382f-c75d-4eb0-a7b1-b1b560bd0618",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb841cae-bffc-4804-8328-0951606dfc67",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000752/human_med_000656.",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000752/human_med_000656.",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33c17a5c-9dc2-4dfe-9c95-18998689b3a3",
          "citation": "NCT00005982",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c8ab5a9-1a66-4640-bcf4-6eb4ed58f530",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2700180b-eb4e-40e2-8c41-861208ddeef0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390233000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94fce8b9-afe0-4c80-a054-bc0ad1fa8a11",
          "citation": "SRS import [60158CV180]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=60158CV180",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390233000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7832bbdc-2795-4482-96d2-0bf9406947e6",
          "citation": "NELARABINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a47ac17e-7104-4974-b0ba-a39e50f9b9d8",
          "citation": "NELARABINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b706431-e024-4c29-9375-c729c1dcea2b",
          "citation": "NELARABINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0607c0a6-2c60-4aec-872e-2e9da01295bd",
          "citation": "NELARABINE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae0bfa47-32a7-4191-80c1-addf07117120",
          "citation": "NELARABINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15ca0c37-d642-413a-9228-318b5c839865",
          "citation": "NELARABINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af462425-6d95-46bf-a17f-fde9ea0eb9f5",
          "citation": "NELARABINE [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c50c2e9-a97f-4679-b42c-df551b2c92d5",
          "citation": "NELARABINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e859671-d3af-468e-b0ba-89d59454518e",
          "citation": "NELARABINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56f1298b-ee22-75b2-65f4-eed22e2cdbd8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=121032-29-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "558765df-fde2-230c-cbf6-c5eed16111e2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3d9b1d23-6854-1c65-befa-5bd0eb23495b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ec261bc7-ba4c-860b-66cd-094b47dd5335",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c1c55270-3bea-4a78-aac5-e27cd3540be0",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "512ba057-6563-43c5-a77c-14d320d83330",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "675602de-9298-4d3a-a3b2-acb278b1e581",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d78fcb0-ce58-476f-9f82-d7f245f91372",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0e25725-b886-4683-a0e0-9dba8e250c25",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d4309906-cc72-483e-af81-57ca5a7beb59",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "97de77a2-f911-47b3-9c4e-2ec5da097b7e",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f4f46454-d98f-262a-2fc7-46aa518cbf85",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b0196309-891f-504e-25d6-f89f5f8679c2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5023c447-b57c-4507-6c1f-c694612ddb57",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "71cedf94-83c0-45fa-ac8c-2e4f5972d485",
          "id": "71cedf94-83c0-45fa-ac8c-2e4f5972d485",
          "molfile": "\n  Marvin  01132105542D          \n\n 21 23  0  0  1  0            999 V2000\n    6.5920   -3.9395    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8990   -3.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0286   -3.8817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2520   -3.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9203   -3.9478    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.9451   -2.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4236   -1.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9409   -1.1674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1696   -1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -0.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -0.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1819    0.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6598   -1.3737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6598   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9049   -2.6731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -2.6731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1696   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6810   -4.7109    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3700   -5.2141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8560   -4.7109    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.9897   -5.2760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 20  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 17  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 17  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  6  0  0  0\nM  END",
          "smiles": "COc1c2c(nc(N)n1)n(cn2)[C@H]3[C@H]([C@@H]([C@@H](CO)O3)O)O",
          "formula": "C11H15N5O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "527a2888-7fc0-42de-9300-d3850968655f"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "297.2677",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a2002599-0fc8-4e34-af18-c318477785cf",
      "version": "31",
      "structure": {
        "id": "055e8a4a-fe01-4ed1-80c4-c9129b50cb25",
        "molfile": "\n  Marvin  01132100342D          \n\n 21 23  0  0  1  0            999 V2000\n    7.9451   -2.4875    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1696   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9203   -3.9478    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1696   -1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -2.6731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9409   -1.1674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6810   -4.7109    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4236   -1.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6598   -1.3737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2520   -3.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -0.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6598   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8560   -4.7109    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5920   -3.9395    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3700   -5.2141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9049   -2.6731    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9897   -5.2760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4229   -0.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8990   -3.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0286   -3.8817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1819    0.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  1  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  8  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  5  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14 10  1  0  0  0  0\n  7 15  1  1  0  0  0\n 16 12  1  0  0  0  0\n 13 17  1  6  0  0  0\n 18 11  1  0  0  0  0\n 14 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n  4  6  1  0  0  0  0\n  9 11  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "COc1c2c(nc(N)n1)n(cn2)[C@H]3[C@H]([C@@H]([C@@H](CO)O3)O)O",
        "formula": "C11H15N5O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "297.2677",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4ac9aab9-42c7-4d22-90a1-cf6c56ff35db",
          "94fce8b9-afe0-4c80-a054-bc0ad1fa8a11",
          "84e8ec76-9284-462a-afc5-865eaf5944fa"
        ],
        "stereo_centers": 4
      },
      "unii": "60158CV180",
      "relationships": [
        {
          "uuid": "b47d4190-0725-4cfa-b87f-650d69cd788c",
          "amount": {
            "uuid": "7b7a1f34-2ddb-4c22-bc11-b48016e16745"
          },
          "type": "METABOLITE ACTIVE->PRODRUG",
          "references": [
            "ec261bc7-ba4c-860b-66cd-094b47dd5335"
          ],
          "related_substance": {
            "uuid": "25f89bf3-ac9d-400b-9cc6-132ec3890234",
            "refuuid": "14b0bf77-bc3c-41c4-8fcc-3211aaa5c513",
            "name": "ARAGUANOSINE",
            "unii": "0Z99WX0GPF",
            "linking_id": "0Z99WX0GPF",
            "ref_pname": "ARAGUANOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "be9eecba-cea4-4969-8b3a-597d5f2c1e81",
          "amount": {
            "uuid": "377dc133-be6c-421f-8951-dbbd67f62390",
            "high": 25,
            "units": "%"
          },
          "comments": "Plasma protein binding is independent on  nelarabine concentrations.",
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "ec261bc7-ba4c-860b-66cd-094b47dd5335"
          ],
          "related_substance": {
            "uuid": "6ddfc9d9-21b2-4a5b-82b9-56f8efb19ec2",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e9e9f119-e86a-4a0f-b411-33beeecb0612",
          "amount": {
            "uuid": "beff97de-1678-45ff-9bbb-f4fab1b06c11",
            "average": 5.8,
            "high": 10.3,
            "low": 1.3,
            "units": "%"
          },
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "ec261bc7-ba4c-860b-66cd-094b47dd5335"
          ],
          "related_substance": {
            "uuid": "b6e1aaf9-efb6-47af-964d-47c670430a03",
            "refuuid": "a2002599-0fc8-4e34-af18-c318477785cf",
            "name": "NELARABINE",
            "unii": "60158CV180",
            "linking_id": "60158CV180",
            "ref_pname": "NELARABINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3bdebdf1-b2bc-4aa2-8818-6c4787710ee4",
          "amount": {
            "uuid": "0ef9614a-c9d2-43d7-822c-de640ea62979"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "d4309906-cc72-483e-af81-57ca5a7beb59"
          ],
          "related_substance": {
            "uuid": "0a07dff2-ed6b-4235-85e9-c1f3bf72b787",
            "refuuid": "200a62d1-cf09-42cd-8fcf-29de3ba5b137",
            "name": "Guanine",
            "unii": "5Z93L87A1R",
            "linking_id": "5Z93L87A1R",
            "ref_pname": "Guanine"
          }
        },
        {
          "uuid": "718d1da0-3dfb-44cc-aa2c-5e98035b2e12",
          "amount": {
            "uuid": "aba0c399-1935-4a80-bb0a-f386257eaae8"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "f0e25725-b886-4683-a0e0-9dba8e250c25"
          ],
          "related_substance": {
            "uuid": "70f55b98-a278-4fe5-a75a-3185a1fb1ae9",
            "refuuid": "671e85b9-87bd-43c4-a264-78f4b9a71584",
            "name": "URIC ACID",
            "unii": "268B43MJ25",
            "linking_id": "268B43MJ25",
            "ref_pname": "URIC ACID"
          }
        },
        {
          "uuid": "261a95d6-f82a-4d07-b2a4-0bf5c23e15bb",
          "amount": {
            "uuid": "e2034aca-2466-4642-92db-41ac8b6feb8a"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "c1c55270-3bea-4a78-aac5-e27cd3540be0"
          ],
          "related_substance": {
            "uuid": "3d271d8d-5b1a-4c11-ad81-0fa3229e79cc",
            "refuuid": "d108ef9f-3e3b-4676-a367-2b1283068899",
            "name": "Allantoin",
            "unii": "344S277G0Z",
            "linking_id": "344S277G0Z",
            "ref_pname": "Allantoin"
          }
        },
        {
          "uuid": "68b55fff-2dcb-467b-a5bb-5ccd39cf8c4b",
          "amount": {
            "uuid": "c7fe0d6b-3302-411c-8b42-ca87238ff86f"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "2d78fcb0-ce58-476f-9f82-d7f245f91372"
          ],
          "related_substance": {
            "uuid": "66f98277-9ba1-4cbc-87e6-9fdef1922214",
            "refuuid": "ffa44da2-9ad4-42f1-b66e-db50913d6b2b",
            "name": "6-METHOXYGUANINE",
            "unii": "9B710FV2AE",
            "linking_id": "9B710FV2AE",
            "ref_pname": "6-METHOXYGUANINE"
          }
        },
        {
          "uuid": "2903edad-76ad-4052-ba0e-ec3795306c8c",
          "amount": {
            "uuid": "ef9f326d-df09-439a-842d-688ce461f527"
          },
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "references": [
            "97de77a2-f911-47b3-9c4e-2ec5da097b7e"
          ],
          "related_substance": {
            "uuid": "9c469112-8c66-42fe-a5fc-cb86fc99afc3",
            "refuuid": "d6f6c4f0-f360-4bd4-a785-12b73597a12d",
            "name": "XANTHINE",
            "unii": "1AVZ07U9S7",
            "linking_id": "1AVZ07U9S7",
            "ref_pname": "XANTHINE"
          }
        }
      ],
      "names": [
        {
          "uuid": "fe53c1fc-e218-465a-a2bf-4db5ade3c0b9",
          "name": "2-AMINO-9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-9H-PURINE",
          "stdName": "2-AMINO-9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-9H-PURINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5704f73-3f10-4867-b58e-9ca4da812f01"
          ],
          "display_name": false
        },
        {
          "uuid": "351edde5-eaeb-4936-98a6-755ed892d052",
          "name": "506U",
          "stdName": "506U",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cc2bae2-09a6-493d-8403-430b7f4c0ddb"
          ],
          "display_name": false
        },
        {
          "uuid": "05f7d26e-fc15-4b22-a8b0-76e0ee727dff",
          "name": "506U78",
          "stdName": "506U78",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33c17a5c-9dc2-4dfe-9c95-18998689b3a3"
          ],
          "display_name": false
        },
        {
          "uuid": "8696186a-4e13-40b8-9a42-7e1287161b6d",
          "name": "9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-9H-PURIN-2-AMINE",
          "stdName": "9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-9H-PURIN-2-AMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cc2bae2-09a6-493d-8403-430b7f4c0ddb"
          ],
          "display_name": false
        },
        {
          "uuid": "721b2074-d6d5-47c9-afbf-ede8034eb471",
          "name": "9H-PURIN-2-AMINE, 9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-",
          "stdName": "9H-PURIN-2-AMINE, 9-.BETA.-D-ARABINOFURANOSYL-6-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bff382f-c75d-4eb0-a7b1-b1b560bd0618"
          ],
          "display_name": false
        },
        {
          "uuid": "0625f958-80fb-47c1-923d-e57a8ba727d4",
          "name": "ARRANON",
          "stdName": "ARRANON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f040a94c-a4bd-4978-9e9c-55beeac0c9e2"
          ],
          "display_name": false
        },
        {
          "uuid": "3d5b8e8e-1700-4f29-8a12-c51eab416040",
          "name": "ATTRIANCE",
          "stdName": "ATTRIANCE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb841cae-bffc-4804-8328-0951606dfc67"
          ],
          "display_name": false
        },
        {
          "uuid": "fb9d7d72-f7df-481e-ab7c-5998939d85b0",
          "name": "GW-506U78",
          "stdName": "GW-506U78",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bff382f-c75d-4eb0-a7b1-b1b560bd0618"
          ],
          "display_name": false
        },
        {
          "uuid": "5e9ba446-205e-45a1-a9b8-fa80f3f4b32e",
          "name": "MAY",
          "stdName": "MAY",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cc2bae2-09a6-493d-8403-430b7f4c0ddb"
          ],
          "display_name": false
        },
        {
          "uuid": "43c8ae77-94dc-42c6-8864-b1d47d26d7b3",
          "name": "NELARABINE",
          "stdName": "NELARABINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ac9aab9-42c7-4d22-90a1-cf6c56ff35db",
            "d5bbb8b5-c91f-4ed0-8958-2b2fa66cd510",
            "fea4e4bb-bc64-440b-8dc9-1ca85faf5295",
            "cd7c7e7b-0fba-4c22-a474-5ffdbdb07193",
            "ff145556-86ff-4625-94c5-7730433b062b",
            "0607c0a6-2c60-4aec-872e-2e9da01295bd",
            "7305849f-2124-45b6-8de8-f97165846bad",
            "e2cb10b2-c187-4db2-b60c-ccca7456bd5b",
            "ae0bfa47-32a7-4191-80c1-addf07117120",
            "4e859671-d3af-468e-b0ba-89d59454518e",
            "0b687c4e-7c36-42ad-b620-a15a11e4fd62",
            "15ca0c37-d642-413a-9228-318b5c839865",
            "af462425-6d95-46bf-a17f-fde9ea0eb9f5",
            "d11ee08e-c595-4aed-aaaf-de5f7f7f8ff3",
            "7832bbdc-2795-4482-96d2-0bf9406947e6",
            "a47ac17e-7104-4974-b0ba-a39e50f9b9d8",
            "9c50c2e9-a97f-4679-b42c-df551b2c92d5",
            "84e8ec76-9284-462a-afc5-865eaf5944fa",
            "8b706431-e024-4c29-9375-c729c1dcea2b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c356616f-d687-4f2d-8a8c-bc206f7cfd78",
              "name_org": "INN"
            },
            {
              "uuid": "e0243973-c37b-4ac1-9f0f-b1dbd82b0dd9",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "2774ed98-271e-45be-a559-5cb7aed239ba",
          "name": "NELARABINE [EMA EPAR]",
          "stdName": "NELARABINE [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fea4e4bb-bc64-440b-8dc9-1ca85faf5295"
          ],
          "display_name": false
        },
        {
          "uuid": "cf8ca7fc-3889-421a-87c5-413d9cc4403e",
          "name": "NELARABINE [JAN]",
          "stdName": "NELARABINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff145556-86ff-4625-94c5-7730433b062b"
          ],
          "display_name": false
        },
        {
          "uuid": "55269888-223e-428e-a0f9-7821372e5437",
          "name": "NELARABINE [MART.]",
          "stdName": "NELARABINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b687c4e-7c36-42ad-b620-a15a11e4fd62"
          ],
          "display_name": false
        },
        {
          "uuid": "78cc80b1-05cf-449e-9a50-9e9938b8b68b",
          "name": "NELARABINE [MI]",
          "stdName": "NELARABINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d11ee08e-c595-4aed-aaaf-de5f7f7f8ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "0bd4a3a4-cc26-429f-9f32-fcdd3a1da53d",
          "name": "NELARABINE [ORANGE BOOK]",
          "stdName": "NELARABINE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2cb10b2-c187-4db2-b60c-ccca7456bd5b"
          ],
          "display_name": false
        },
        {
          "uuid": "e516ecba-e0a5-4a95-8488-bf83028bce31",
          "name": "NELARABINE [USAN]",
          "stdName": "NELARABINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5bbb8b5-c91f-4ed0-8958-2b2fa66cd510"
          ],
          "display_name": false
        },
        {
          "uuid": "7d0f2fcb-aae1-4932-adf6-3823d4519ecb",
          "name": "NELARABINE [VANDF]",
          "stdName": "NELARABINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7305849f-2124-45b6-8de8-f97165846bad"
          ],
          "display_name": false
        },
        {
          "uuid": "5000a7fa-c8c1-46d5-895e-0492d017b6cf",
          "name": "NELZARABINE",
          "stdName": "NELZARABINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7069389e-9ecc-4dfe-8b91-ac83c5cdabdd"
          ],
          "display_name": false
        },
        {
          "uuid": "b25f9dc3-bfcc-4a75-bb8d-b0aa045cb9e2",
          "name": "NSC-686673",
          "stdName": "NSC-686673",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ab5a9-1a66-4640-bcf4-6eb4ed58f530"
          ],
          "display_name": false
        },
        {
          "uuid": "9737dab1-90c8-0503-89a4-58a0e75833b5",
          "name": "NSC-755985",
          "stdName": "NSC-755985",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4f46454-d98f-262a-2fc7-46aa518cbf85"
          ],
          "display_name": false
        },
        {
          "uuid": "bf0a40b5-c07a-6ae9-4a0e-f09b85b007ba",
          "name": "NSC-759876",
          "stdName": "NSC-759876",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4f46454-d98f-262a-2fc7-46aa518cbf85"
          ],
          "display_name": false
        },
        {
          "uuid": "b0d96051-8134-29cc-e8ef-dd83c671282e",
          "name": "Nelarabine [WHO-DD]",
          "stdName": "NELARABINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5023c447-b57c-4507-6c1f-c694612ddb57"
          ],
          "display_name": false
        },
        {
          "uuid": "3e26a995-7fa4-4a7b-8ef8-a3128f9f80c7",
          "name": "nelarabine [INN]",
          "stdName": "NELARABINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84e8ec76-9284-462a-afc5-865eaf5944fa"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "b869458e-7c0c-43e6-8db6-6077ca14a700",
          "name": "Biological Half-life",
          "value": {
            "uuid": "f574ee40-1275-4eea-b10c-a69dbda7b777",
            "average": 0.3,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "9c79fe4a-a7cd-41f0-9b08-02201c79ed48",
              "name": "SINGLE DOSE ADMINISTRATION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "ec261bc7-ba4c-860b-66cd-094b47dd5335"
          ]
        }
      ]
    }
  ]
}