{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6f23c337-b30e-477e-9cbe-6f602f716933",
          "code": "6471-51-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6471-51-8",
          "code_system": "CAS",
          "references": [
            "a92f0fc8-d9d0-40e3-a974-21f87102f7be",
            "32fe8f91-aa7f-4444-aefd-5d90ab157a99"
          ]
        },
        {
          "uuid": "54bc17ef-2613-4002-9110-fcf09c5eb6a2",
          "code": "229-315-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.651",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a92f0fc8-d9d0-40e3-a974-21f87102f7be"
          ]
        },
        {
          "uuid": "5337a99f-047e-5b30-95d5-ef7d207e4ed2",
          "code": "DTXSID5064382",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5064382",
          "code_system": "EPA CompTox",
          "references": [
            "a1a64b6e-ee74-c2f8-d5b0-ee543b3b557c"
          ]
        },
        {
          "uuid": "4059f575-965c-78da-f265-723c8b98a524",
          "code": "1872249",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1872249/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "6cfc9723-925e-4974-bc21-59cb0b897204",
          "code": "5Z5A89AQ44",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b6968f5-fe98-3483-9b63-f3b34a5ac551",
          "code": "100000134367",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "163e02c8-9962-e69c-871a-28c9aebeb664"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eef36d0d-1fa6-4b4b-af66-a918edd6c0b7",
          "name": "2-NAPHTHALENECARBOXAMIDE, N-(4-CHLORO-2-METHYLPHENYL)-4-((4-CHLORO-2-METHYLPHENYL)AZO)-3-HYDROXY-",
          "stdName": "2-NAPHTHALENECARBOXAMIDE, N-(4-CHLORO-2-METHYLPHENYL)-4-((4-CHLORO-2-METHYLPHENYL)AZO)-3-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b2b3f9-dcce-4332-badb-cfeadfb3752a",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": false
        },
        {
          "uuid": "cbbaf892-7a53-47b7-8227-7c9269583261",
          "name": "2-NAPHTHALENECARBOXAMIDE, N-(4-CHLORO-2-METHYLPHENYL)-4-(2-(4-CHLORO-2-METHYLPHENYL)DIAZENYL)-3-HYDROXY-",
          "stdName": "2-NAPHTHALENECARBOXAMIDE, N-(4-CHLORO-2-METHYLPHENYL)-4-(2-(4-CHLORO-2-METHYLPHENYL)DIAZENYL)-3-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b2b3f9-dcce-4332-badb-cfeadfb3752a",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": false
        },
        {
          "uuid": "97186b32-81b5-43c7-8e35-9531384b5de9",
          "name": "C.I. PIGMENT RED 7",
          "stdName": "C.I. PIGMENT RED 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87c13ac3-7bef-49f4-9799-3a9a90b990f5"
          ],
          "display_name": false
        },
        {
          "uuid": "01ed5afb-de0e-4c45-9eed-a0154e181142",
          "name": "CI 12420",
          "stdName": "CI 12420",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e5218699-80af-4169-9913-c233c03b6c17",
            "d5e17856-cbd7-4b2c-a8fb-9b6d95a8603d",
            "65e5861d-b792-42b5-ad7f-3d659e487dca"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c63de304-0208-4245-a742-b084f25c2dd8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1d3dc90f-2c24-4326-8312-e14a5f81827e",
          "name": "NAPHTHOL CRIMSON RED AS-TR",
          "stdName": "NAPHTHOL CRIMSON RED AS-TR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcd4e92f-7b0a-4092-bc0f-2960f620c371",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": false
        },
        {
          "uuid": "933db2b2-9d51-46e0-a96d-371a9b6cfb84",
          "name": "PERMANENT CARMINE",
          "stdName": "PERMANENT CARMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcd4e92f-7b0a-4092-bc0f-2960f620c371",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": false
        },
        {
          "uuid": "9cf8d2fa-d21f-47d1-92ab-85719e2907d3",
          "name": "PERMANENT CRIMSON",
          "stdName": "PERMANENT CRIMSON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcd4e92f-7b0a-4092-bc0f-2960f620c371",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5f7001-59ee-45bd-8bfc-c4dd8f0ed39b",
          "name": "PIGMENT RED 7",
          "stdName": "PIGMENT RED 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b2b3f9-dcce-4332-badb-cfeadfb3752a",
            "e5218699-80af-4169-9913-c233c03b6c17"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "87c13ac3-7bef-49f4-9799-3a9a90b990f5",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "52b2b3f9-dcce-4332-badb-cfeadfb3752a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5218699-80af-4169-9913-c233c03b6c17",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcd4e92f-7b0a-4092-bc0f-2960f620c371",
          "citation": "http://www.artiscreation.com/red.html#PR7",
          "url": "http://www.artiscreation.com/red.html#PR7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5e17856-cbd7-4b2c-a8fb-9b6d95a8603d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a92f0fc8-d9d0-40e3-a974-21f87102f7be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391005000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bf18fa5-d890-4929-b1ae-69b5bbca6fd7",
          "citation": "SRS import [5Z5A89AQ44]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5Z5A89AQ44",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391005000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03a4172d-347b-4fe6-8f5a-250677172f2b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65e5861d-b792-42b5-ad7f-3d659e487dca",
          "citation": "CI 12420 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a1a64b6e-ee74-c2f8-d5b0-ee543b3b557c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6471-51-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "163e02c8-9962-e69c-871a-28c9aebeb664",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2bb8ae62-7b48-8528-7fed-ddacb2e97fc6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "32fe8f91-aa7f-4444-aefd-5d90ab157a99",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e1b2b412-bf50-4606-82f6-f6ef852b444e",
          "id": "e1b2b412-bf50-4606-82f6-f6ef852b444e",
          "molfile": "\n  Marvin  01132111412D          \n\n 32 35  0  0  0  0            999 V2000\n    5.7308   -7.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0167   -7.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -7.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5912   -7.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8741   -7.9391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5912   -6.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3012   -6.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0167   -6.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7295   -6.2874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7295   -5.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0107   -5.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4431   -5.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4431   -4.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1608   -3.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1608   -2.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8824   -2.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5957   -2.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5957   -3.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8742   -4.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8742   -5.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5896   -5.4635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5896   -6.2887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3029   -6.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0167   -6.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7316   -6.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7316   -7.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4503   -7.9336    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.0178   -7.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3029   -7.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5936   -7.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -5.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -6.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 31  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 31 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 29  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  2  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(ccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4ccc(cc4C)Cl)Cl",
          "formula": "C25H19Cl2N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "453163d3-2e46-49a4-b303-18b1528ae838"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "464.3441",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "65735563-6ec0-4cde-9751-5d67507176dc",
      "version": "8",
      "structure": {
        "id": "5e2028ed-1239-457e-a314-cc6de939c161",
        "molfile": "\n  Marvin  01132104522D          \n\n 32 35  0  0  0  0            999 V2000\n    5.0107   -5.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7295   -5.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7295   -6.2874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0167   -6.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0167   -7.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -7.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5912   -7.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5912   -6.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3012   -6.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8741   -7.9391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7308   -7.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4431   -5.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -5.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1621   -6.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8742   -5.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5896   -5.4635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5896   -6.2887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3029   -6.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3029   -7.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0178   -7.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7316   -7.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7316   -6.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0167   -6.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4503   -7.9336    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.5936   -7.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8742   -4.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1608   -3.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1608   -2.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8824   -2.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5957   -2.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5957   -3.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4431   -4.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  7 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 18  2  0  0  0  0\n 21 24  1  0  0  0  0\n 19 25  1  0  0  0  0\n 15 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 26  2  0  0  0  0\n 27 32  1  0  0  0  0\n 32 12  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(ccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4ccc(cc4C)Cl)Cl",
        "formula": "C25H19Cl2N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "464.3441",
        "optical_activity": "NONE",
        "references": [
          "5bf18fa5-d890-4929-b1ae-69b5bbca6fd7",
          "03a4172d-347b-4fe6-8f5a-250677172f2b"
        ],
        "stereo_centers": 0
      },
      "unii": "5Z5A89AQ44"
    }
  ]
}