{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "da6a09b1-1f39-4293-ac58-4fe7e072c377",
          "code": "21321-88-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21321-88-0",
          "code_system": "CAS",
          "references": [
            "2383d73c-e6c6-4cd7-a665-8c799116cfb1",
            "f9165265-9a1e-48d7-b50e-6f7b917360fb"
          ]
        },
        {
          "uuid": "3ea484e1-877d-4cfa-a1e2-ad0cdcccabd5",
          "code": "14263442",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14263442",
          "code_system": "PUBCHEM",
          "references": [
            "2383d73c-e6c6-4cd7-a665-8c799116cfb1"
          ]
        },
        {
          "uuid": "d4e22e0d-22cb-d6c9-5cd4-f4f548fb7fb1",
          "code": "DTXSID70175597",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70175597",
          "code_system": "EPA CompTox",
          "references": [
            "e6c7e9c3-973b-a306-d0b1-ced6ceb283d2"
          ]
        },
        {
          "uuid": "7eadf837-bbf9-4ec8-b0bf-d59c2ff32fdd",
          "code": "5Y7P8234P5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "45b8aa6a-b310-40c6-86d1-ceaaaa10497a",
          "name": "MURICIN AGLYCONE",
          "stdName": "MURICIN AGLYCONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48357f73-31e4-4cd6-ae75-a27bdecf49e9",
            "2cb12a42-c5a6-4cc0-aaaf-d456ea01419f"
          ],
          "display_name": false
        },
        {
          "uuid": "d7d1cfb9-aeb8-46d3-b33a-c3f9f83d3d38",
          "name": "PREGNA-5,20-DIEN-3-OL, (3.BETA.)-",
          "stdName": "PREGNA-5,20-DIEN-3-OL, (3.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cb12a42-c5a6-4cc0-aaaf-d456ea01419f",
            "460b25a6-116e-4461-bd2f-9691be0e8515"
          ],
          "display_name": false
        },
        {
          "uuid": "8dc4bc8a-6bc0-428e-b055-6111d963a297",
          "name": "PREGNA-5,20-DIEN-3.BETA.-OL",
          "stdName": "PREGNA-5,20-DIEN-3.BETA.-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cb12a42-c5a6-4cc0-aaaf-d456ea01419f",
            "460b25a6-116e-4461-bd2f-9691be0e8515"
          ],
          "display_name": false
        },
        {
          "uuid": "265fabc0-3e3e-463e-aa29-c8d9bcb16022",
          "name": "PREGNADIENOL",
          "stdName": "PREGNADIENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48357f73-31e4-4cd6-ae75-a27bdecf49e9",
            "cb1dcebd-3a43-45d5-9dc8-8caa00f01dd8",
            "2cb12a42-c5a6-4cc0-aaaf-d456ea01419f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ebaac057-afad-4876-9bfe-58bcf0447893",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "48357f73-31e4-4cd6-ae75-a27bdecf49e9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2cb12a42-c5a6-4cc0-aaaf-d456ea01419f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "460b25a6-116e-4461-bd2f-9691be0e8515",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2383d73c-e6c6-4cd7-a665-8c799116cfb1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71542a21-1c9e-4042-af60-f2bafd907b0c",
          "citation": "SRS import [5Y7P8234P5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5Y7P8234P5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb1dcebd-3a43-45d5-9dc8-8caa00f01dd8",
          "citation": "PREGNADIENOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0857851c-94a9-7567-3b3b-8c76f5415684",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=21321-88-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f9165265-9a1e-48d7-b50e-6f7b917360fb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e6c7e9c3-973b-a306-d0b1-ced6ceb283d2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "70db56be-c75c-4fd8-864d-8c7280fdbd02",
          "id": "70db56be-c75c-4fd8-864d-8c7280fdbd02",
          "molfile": "\n  Marvin  01132105512D          \n\n 22 25  0  0  1  0            999 V2000\n    8.3832   -3.4838    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.8681   -4.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3832   -4.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5985   -4.5638    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8841   -4.9762    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8841   -5.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1696   -6.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4551   -5.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7407   -6.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0262   -5.8012    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3117   -6.2138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0262   -4.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7407   -4.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4552   -4.9762    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4552   -4.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1696   -4.5638    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1696   -3.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -3.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5986   -3.7388    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6848   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6381   -2.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4451   -2.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 19  1  1  0  0  0  0\n  1 21  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 16  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 14  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "C=C[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O",
          "formula": "C21H32O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ebcf7dc6-c2d5-41d9-acf6-1e5b0b402591"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "300.479",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85b01b7a-88e6-43a4-a814-54bf3b661084",
      "version": "6",
      "structure": {
        "id": "103a1ba2-0b2c-44e2-bf4b-374c14f48729",
        "molfile": "\n  Marvin  01132101042D          \n\n 25 28  0  0  1  0            999 V2000\n    4.0262   -5.8012    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4552   -4.9762    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1696   -4.5638    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5986   -3.7388    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3832   -3.4838    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5985   -4.5638    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8841   -4.9762    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0262   -4.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7407   -4.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1696   -3.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -3.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8681   -4.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3832   -4.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -5.3842    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -5.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1696   -6.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4551   -5.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7407   -6.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -4.1512    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6381   -2.6992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4451   -2.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1696   -5.3888    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4552   -4.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3117   -6.2138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n 12  5  1  0  0  0  0\n  6 13  1  0  0  0  0\n 13 12  1  0  0  0  0\n  6 14  1  6  0  0  0\n 15  7  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17  2  1  0  0  0  0\n 18 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n  7 19  1  1  0  0  0\n  5 20  1  1  0  0  0\n 20 21  2  0  0  0  0\n  4 22  1  1  0  0  0\n  3 23  1  6  0  0  0\n  2 24  1  1  0  0  0\n  1 25  1  1  0  0  0\nM  END",
        "smiles": "C=C[C@H]1CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O",
        "formula": "C21H32O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "300.479",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "460b25a6-116e-4461-bd2f-9691be0e8515",
          "71542a21-1c9e-4042-af60-f2bafd907b0c"
        ],
        "stereo_centers": 7
      },
      "unii": "5Y7P8234P5"
    }
  ]
}