{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7a2acb2c-d159-4b98-88f9-ffdbae984c22",
          "code": "2440-22-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2440-22-4",
          "code_system": "CAS",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1",
            "f35570a9-4cc4-4ff9-ba7f-7f644d138320"
          ]
        },
        {
          "uuid": "0d439215-5c83-4ddd-82c7-45bace60cc50",
          "code": "C77133",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77133",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "0ee76cb5-a3f4-4950-8673-8d811098f125",
          "code": "C401764",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67401764",
          "code_system": "MESH",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "afdec0ff-9a80-46fb-a332-20bd1d276827",
          "code": "SUB06406MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "8f72f742-9a16-4bd0-8016-11e91970fde5",
          "code": "4717",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4717",
          "code_system": "INN",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "090d452b-c7e9-4896-b4d9-697658308abe",
          "code": "1426903",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426903/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "76b1b09c-9de2-46d4-a12e-8da97c9effb1",
          "code": "m4766",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4766?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "34d75c43-7619-4508-ad73-5e2ac7fdfbe8",
          "code": "CHEMBL1564747",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1564747",
          "code_system": "ChEMBL",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "523709c5-20e2-40ee-83ff-1a4bf27aea80",
          "code": "219-470-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.700",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "cc006f3d-25f7-4b53-b88e-b2bf94394f3e",
          "code": "17113",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17113",
          "code_system": "PUBCHEM",
          "references": [
            "7e6ede31-02c0-482d-9b1e-ba160ee737f1"
          ]
        },
        {
          "uuid": "6fba295a-826e-fe2a-dec5-095949a7a1bb",
          "code": "DTXSID1027479",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1027479",
          "code_system": "EPA CompTox",
          "references": [
            "5825e891-db1a-b399-8c6c-b5b896f03d64"
          ]
        },
        {
          "uuid": "9bd98513-9243-35a0-23f1-003ff65433ee",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "793f367c-7eda-ce6b-1f81-12378e9ebb61"
          ]
        },
        {
          "uuid": "e9efcdf9-fc9f-4d90-83a2-0d4b64836e3f",
          "code": "5X93W9OFZL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c4ac94e7-25e5-9ecc-5318-af5214f69e74",
          "code": "3166",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3166",
          "code_system": "DRUG CENTRAL",
          "references": [
            "793f367c-7eda-ce6b-1f81-12378e9ebb61"
          ]
        },
        {
          "uuid": "b911b570-eac4-71ad-2a45-8d9c3d2aedb3",
          "code": "1228009",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1228009",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "793f367c-7eda-ce6b-1f81-12378e9ebb61"
          ]
        },
        {
          "uuid": "a1fd687f-0e28-b2b8-b8e4-741ff685ef60",
          "code": "91885",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=91885",
          "code_system": "NSC",
          "references": [
            "7ca7f0a6-6a17-4c00-de78-cb948bfe111e"
          ]
        },
        {
          "uuid": "99895fa7-cd22-a006-d86b-a3cc079a98fd",
          "code": "100000081024",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "639be97b-86a0-278c-236e-e55435db64b3"
          ]
        },
        {
          "uuid": "26d59920-47d7-528f-c4f7-7a5e7533aea7",
          "code": "5X93W9OFZL",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5X93W9OFZL",
          "code_system": "DAILYMED",
          "references": [
            "6c423803-86f6-b126-7139-0cf4d0c52450"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a2d06eb6-0cdd-454b-a9a8-f6f722a4a4df",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7d1398f9-5622-4280-a095-e12ad4c6adce",
            "refuuid": "44316b86-b382-4d72-81ec-d5a46cde51ea",
            "name": "DROMETRIZOLE",
            "unii": "5X93W9OFZL",
            "linking_id": "5X93W9OFZL",
            "ref_pname": "DROMETRIZOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ca6fecdf-a8c0-40e8-9e5d-e2a42eb7c18b",
          "name": "2-(2'-HYDROXY-5'-METHYLPHENYL)BENZOTRIAZOLE",
          "stdName": "2-(2'-HYDROXY-5'-METHYLPHENYL)BENZOTRIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca",
            "54f41d4b-bfd2-4d5f-ae74-20a8cd9c6ccc"
          ],
          "display_name": false
        },
        {
          "uuid": "0dcfe6d3-ab7c-4aac-ba74-a36fc7289b0f",
          "name": "2-(2-HYDROXY-5-METHYLPHENYL)BENZOTRIAZOLE",
          "stdName": "2-(2-HYDROXY-5-METHYLPHENYL)BENZOTRIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "712cac2b-15c9-4f19-af5a-38b05325af20",
            "51ec1ce2-b1d2-48b5-a586-4e59ec25a436"
          ],
          "display_name": false
        },
        {
          "uuid": "4500d225-871e-4ea1-99c7-2911e692dc18",
          "name": "2-(2H-BENZOTRIAZOL-2-YL)-4-METHYLPHENOL",
          "stdName": "2-(2H-BENZOTRIAZOL-2-YL)-4-METHYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "14d848fc-ed99-4b59-8722-f4dc8958949e",
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca"
          ],
          "display_name": false
        },
        {
          "uuid": "b4bcb6c7-cd3f-458f-aba3-0d3edf9b4af0",
          "name": "DROMETRIZOLE",
          "stdName": "DROMETRIZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39b14f28-7bcf-47b5-964e-318605ac072b",
            "85c54b8c-542f-4f41-b577-f063a912f714",
            "cd2f9583-10f6-4d3e-b215-609e7609dbb4",
            "9beed2c7-6767-4879-928b-d9e52e5325aa",
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca",
            "f1c18d47-097c-4796-81d5-ea560b2f6011",
            "170bc6a4-4d88-4ca3-9768-35775dd9e388",
            "31422419-46ec-476c-801a-72634c9e4ad3",
            "a8cbd0f8-b7c6-4a5e-a318-fee97c34b68a",
            "279297b9-aed0-475e-bc35-4e6370bc4c89",
            "9d2fd6fb-a02d-4fb0-ba4f-77d36310db60",
            "e1da2cfa-44d1-4fa0-b6f2-a8b92460e687",
            "bb0833b9-ea90-414c-8f47-6cc633132f57",
            "74f34b32-2d75-4f0f-8304-02bd34e44cd8"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "580dc947-d7ae-499a-927a-45f6457a9657",
              "name_org": "INN"
            },
            {
              "uuid": "7c288ce5-1a9e-4b83-83bc-90eecaf083d8",
              "name_org": "USAN"
            },
            {
              "uuid": "38954f0d-69e0-405f-997c-6150fd2d1342",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b3b309d1-928b-41f6-b1b6-53f5a47d999b",
          "name": "DROMETRIZOLE [MART.]",
          "stdName": "DROMETRIZOLE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb0833b9-ea90-414c-8f47-6cc633132f57"
          ],
          "display_name": false
        },
        {
          "uuid": "4e3479c0-a355-40e0-b682-bae694c7503f",
          "name": "DROMETRIZOLE [MI]",
          "stdName": "DROMETRIZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d2fd6fb-a02d-4fb0-ba4f-77d36310db60",
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca"
          ],
          "display_name": false
        },
        {
          "uuid": "c71fcd41-4ed5-4ad8-8289-511ab5ebf2f9",
          "name": "DROMETRIZOLE [USAN]",
          "stdName": "DROMETRIZOLE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1c18d47-097c-4796-81d5-ea560b2f6011"
          ],
          "display_name": false
        },
        {
          "uuid": "09ef0e26-903b-4a8a-931b-1c72530b0fbd",
          "name": "DROMETRIZOLE [USP-RS]",
          "stdName": "DROMETRIZOLE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1da2cfa-44d1-4fa0-b6f2-a8b92460e687",
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca"
          ],
          "display_name": false
        },
        {
          "uuid": "03168220-62e0-b636-3eae-c1583d402c42",
          "name": "Drometrizole [WHO-DD]",
          "stdName": "DROMETRIZOLE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a75a885-83db-876b-bf17-8be329d44cdc"
          ],
          "display_name": false
        },
        {
          "uuid": "14046fc1-071c-4198-aaf4-81afd88f57d8",
          "name": "NSC-91885",
          "stdName": "NSC-91885",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39867556-87fa-4ea5-b35b-80c933f1bd78",
            "c14a2a94-f265-49a7-b7af-acff50a8b3ca"
          ],
          "display_name": false
        },
        {
          "uuid": "7d623d0e-1caa-4311-88be-1250449326f3",
          "name": "drometrizole [INN]",
          "stdName": "DROMETRIZOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8cbd0f8-b7c6-4a5e-a318-fee97c34b68a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "39b14f28-7bcf-47b5-964e-318605ac072b",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a8cbd0f8-b7c6-4a5e-a318-fee97c34b68a",
          "citation": "INN Proposed List 42",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL42.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f1c18d47-097c-4796-81d5-ea560b2f6011",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb0833b9-ea90-414c-8f47-6cc633132f57",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d2fd6fb-a02d-4fb0-ba4f-77d36310db60",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c14a2a94-f265-49a7-b7af-acff50a8b3ca",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "170bc6a4-4d88-4ca3-9768-35775dd9e388",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1da2cfa-44d1-4fa0-b6f2-a8b92460e687",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54f41d4b-bfd2-4d5f-ae74-20a8cd9c6ccc",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51ec1ce2-b1d2-48b5-a586-4e59ec25a436",
          "citation": "NLM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "712cac2b-15c9-4f19-af5a-38b05325af20",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14d848fc-ed99-4b59-8722-f4dc8958949e",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39867556-87fa-4ea5-b35b-80c933f1bd78",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e6ede31-02c0-482d-9b1e-ba160ee737f1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390008000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "971506ff-f9f7-451f-80da-b2d1a3d689fc",
          "citation": "SRS import [5X93W9OFZL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5X93W9OFZL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390008000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74f34b32-2d75-4f0f-8304-02bd34e44cd8",
          "citation": "DROMETRIZOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85c54b8c-542f-4f41-b577-f063a912f714",
          "citation": "DROMETRIZOLE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "279297b9-aed0-475e-bc35-4e6370bc4c89",
          "citation": "DROMETRIZOLE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd2f9583-10f6-4d3e-b215-609e7609dbb4",
          "citation": "DROMETRIZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "31422419-46ec-476c-801a-72634c9e4ad3",
          "citation": "DROMETRIZOLE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9beed2c7-6767-4879-928b-d9e52e5325aa",
          "citation": "DROMETRIZOLE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5825e891-db1a-b399-8c6c-b5b896f03d64",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2440-22-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "639be97b-86a0-278c-236e-e55435db64b3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "793f367c-7eda-ce6b-1f81-12378e9ebb61",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5046aa5f-f2b9-35db-6ccc-994beaed6ca6",
          "citation": "who",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f35570a9-4cc4-4ff9-ba7f-7f644d138320",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7ca7f0a6-6a17-4c00-de78-cb948bfe111e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6c423803-86f6-b126-7139-0cf4d0c52450",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8a75a885-83db-876b-bf17-8be329d44cdc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22ac3f97-721d-4761-8cdc-dddacfc4ca0c",
          "id": "22ac3f97-721d-4761-8cdc-dddacfc4ca0c",
          "molfile": "\n  Marvin  01132101572D          \n\n 17 19  0  0  0  0            999 V2000\n    5.0634   -2.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7141   -2.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1798   -1.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8305   -0.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9896   -0.7400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6404    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5188   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8991   -2.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6934   -1.3661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2148   -2.0285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4386   -1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7296   -2.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7296   -0.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4386   -0.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2148   -0.6986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 17  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(c(c1)-n2nc3ccccc3n2)O",
          "formula": "C13H11N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9362afe0-b018-4912-ac45-6c46cc59a9d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "225.2464",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "44316b86-b382-4d72-81ec-d5a46cde51ea",
      "version": "17",
      "structure": {
        "id": "21c24371-df3a-488d-a786-281006f509b7",
        "molfile": "\n  Marvin  01132101542D          \n\n 17 19  0  0  0  0            999 V2000\n    2.6934   -1.3661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2148   -0.6986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2148   -2.0285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5188   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4386   -1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4386   -0.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9896   -0.7400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8991   -2.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7296   -0.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7296   -2.1992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8305   -0.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7141   -2.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1798   -1.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6404    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0634   -2.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12  9  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14  8  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 14  1  0  0  0  0\n  6  5  1  0  0  0  0\n 15 13  2  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(c(c1)-n2nc3ccccc3n2)O",
        "formula": "C13H11N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "225.2464",
        "optical_activity": "NONE",
        "references": [
          "39b14f28-7bcf-47b5-964e-318605ac072b",
          "971506ff-f9f7-451f-80da-b2d1a3d689fc",
          "a8cbd0f8-b7c6-4a5e-a318-fee97c34b68a"
        ],
        "stereo_centers": 0
      },
      "unii": "5X93W9OFZL"
    }
  ]
}