{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "175f865a-c83c-4c1a-a994-8bdcdc05b4d0",
          "code": "20846-91-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20846-91-7",
          "code_system": "CAS",
          "references": [
            "426b849d-94de-4854-84f4-58c52dcc7783",
            "f9b8b663-6baa-4c05-9797-1a9e8e8be006"
          ]
        },
        {
          "uuid": "d68ca483-5073-4678-a994-74201ceddeaa",
          "code": "186459-75-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=186459-75-6",
          "code_system": "CAS",
          "references": [
            "426b849d-94de-4854-84f4-58c52dcc7783",
            "5a5c24c8-25a8-41c0-86ec-129684e92591"
          ]
        },
        {
          "uuid": "cd23ed66-53ba-416a-a79b-50e024016e2a",
          "code": "m4826",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4826?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "426b849d-94de-4854-84f4-58c52dcc7783"
          ]
        },
        {
          "uuid": "6489bfa0-20cd-4a79-bf95-90b4557f3b19",
          "code": "497266",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/497266",
          "code_system": "PUBCHEM",
          "references": [
            "426b849d-94de-4854-84f4-58c52dcc7783"
          ]
        },
        {
          "uuid": "4e957338-b383-bb86-5854-460dc2cc29a8",
          "code": "DTXSID1051852",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1051852",
          "code_system": "EPA CompTox",
          "references": [
            "ee53b175-b2d8-8685-8a33-6e06ce8899b0"
          ]
        },
        {
          "uuid": "9407390f-155d-42b2-9f7e-12386f5cb2e0",
          "code": "5WK2FGJ113",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a2d1fd8d-c383-5109-a052-44135227127b",
          "code": "EDDS",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/EDDS",
          "code_system": "WIKIPEDIA",
          "references": [
            "d93e076b-4378-a36f-5261-623b75e8b756"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "33a01839-3f73-4b65-a14a-9eea37a36b14",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6408c6de-174f-4300-a589-090e8f57ebd4",
            "refuuid": "5fadcbe6-ccf3-49b3-8b3f-ef0d07f0b69e",
            "name": "TRISODIUM ETHYLENEDIAMINE DISUCCINATE",
            "unii": "YA22H34H9Q",
            "linking_id": "YA22H34H9Q",
            "ref_pname": "TRISODIUM ETHYLENEDIAMINE DISUCCINATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a5a4bd2-fd5f-48a9-8aac-941be3381172",
          "name": "(S,S)-EDDS",
          "stdName": "(S,S)-EDDS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887"
          ],
          "display_name": false
        },
        {
          "uuid": "1099043b-1f6d-44a2-967f-289da1c1069d",
          "name": "(S,S)-ETHYLENEDIAMINE-N,N'-DISUCCINIC ACID",
          "stdName": "(S,S)-ETHYLENEDIAMINE-N,N'-DISUCCINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887"
          ],
          "display_name": false
        },
        {
          "uuid": "49f887dc-1aee-477f-a169-4837cacee2f0",
          "name": "(S,S)-ETHYLENEDIAMINEDISUCCINIC ACID",
          "stdName": "(S,S)-ETHYLENEDIAMINEDISUCCINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887"
          ],
          "display_name": false
        },
        {
          "uuid": "08d964da-6b94-4f5c-966f-e827e48c32e5",
          "name": "EDDS",
          "stdName": "EDDS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "41999425-c236-4e89-90b9-36be7e953e85",
            "7ae78723-3307-4ed8-9ddc-eb01baff83f2"
          ],
          "display_name": false
        },
        {
          "uuid": "e4922007-f135-4d15-ac77-65e23f59434c",
          "name": "EDDS S,S-FORM [MI]",
          "stdName": "EDDS S,S-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "41999425-c236-4e89-90b9-36be7e953e85"
          ],
          "display_name": false
        },
        {
          "uuid": "3bc5cadd-71b5-4b6a-a092-ecf30e57189f",
          "name": "EDDS [MI]",
          "stdName": "EDDS [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "41999425-c236-4e89-90b9-36be7e953e85"
          ],
          "display_name": false
        },
        {
          "uuid": "18f58fde-d040-4017-bf03-bfd60c852f92",
          "name": "ENVIOMET C 265",
          "stdName": "ENVIOMET C 265",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887"
          ],
          "display_name": false
        },
        {
          "uuid": "25cb5322-e8cc-404f-9a96-a037c06df3d3",
          "name": "ENVIOMET C-265",
          "stdName": "ENVIOMET C-265",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "3195ba30-b272-4aed-a789-331df1210702"
          ],
          "display_name": false
        },
        {
          "uuid": "99e2848c-9d6d-4d82-9791-57cc72b97b33",
          "name": "ENVIOMET C265",
          "stdName": "ENVIOMET C265",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62444222-2e6f-4904-b935-30fc28ae26f7",
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf"
          ],
          "display_name": false
        },
        {
          "uuid": "ddc25070-70a3-4c16-9fed-78f753ddfa3d",
          "name": "ETHYLENEDIAMINEDISUCCINIC ACID",
          "stdName": "ETHYLENEDIAMINEDISUCCINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62444222-2e6f-4904-b935-30fc28ae26f7",
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf"
          ],
          "display_name": false
        },
        {
          "uuid": "1ca5b0d4-d77d-4731-a5f2-04922a8576a7",
          "name": "ETHYLENEDIAMINEDISUCCINIC ACID, (S,S)-",
          "stdName": "ETHYLENEDIAMINEDISUCCINIC ACID, (S,S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62444222-2e6f-4904-b935-30fc28ae26f7",
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf"
          ],
          "display_name": true
        },
        {
          "uuid": "86794146-f817-435a-ade0-74f3d725e166",
          "name": "L-ASPARTIC ACID, N,N'-1,2-ETHANEDIYLBIS-",
          "stdName": "L-ASPARTIC ACID, N,N'-1,2-ETHANEDIYLBIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
            "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0ae1a2b5-15e5-4b03-b1ee-1acb02cb18cf",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3195ba30-b272-4aed-a789-331df1210702",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62444222-2e6f-4904-b935-30fc28ae26f7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41999425-c236-4e89-90b9-36be7e953e85",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "426b849d-94de-4854-84f4-58c52dcc7783",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7d9cb17-3cee-4037-a4e0-02447ed4413a",
          "citation": "SRS import [5WK2FGJ113]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5WK2FGJ113",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391948000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ae78723-3307-4ed8-9ddc-eb01baff83f2",
          "citation": "EDDS [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ee53b175-b2d8-8685-8a33-6e06ce8899b0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20846-91-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d93e076b-4378-a36f-5261-623b75e8b756",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "5a5c24c8-25a8-41c0-86ec-129684e92591",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f9b8b663-6baa-4c05-9797-1a9e8e8be006",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4a0c2117-2285-4282-888c-6a8167fafdde",
          "id": "4a0c2117-2285-4282-888c-6a8167fafdde",
          "molfile": "\n  Marvin  01132103522D          \n\n 20 19  0  0  1  0            999 V2000\n    5.3833   -6.8462    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.3833   -7.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1385   -8.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8368   -7.6129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9582   -8.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0811   -6.4061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8082   -6.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5060   -6.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2375   -6.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9308   -6.3064    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.9308   -5.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1796   -5.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4772   -5.5350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1796   -4.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6622   -6.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6622   -7.5130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3556   -6.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6518   -6.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9540   -6.8962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6518   -5.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n 18  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  END",
          "smiles": "C(CN[C@@H](CC(=O)O)C(=O)O)N[C@@H](CC(=O)O)C(=O)O",
          "formula": "C10H16N2O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "76c62468-6b0c-4cbe-8711-2fc7fe9ed136"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "292.2431",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1151ad4d-957e-4df4-9f1c-7a3a1c627dbd",
      "version": "5",
      "structure": {
        "id": "cab45b9b-66ea-418c-ba2f-c3dde4b56981",
        "molfile": "\n  Marvin  01132110282D          \n\n 20 19  0  0  1  0            999 V2000\n    4.6518   -6.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9540   -6.8962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6518   -5.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3833   -6.8462    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0811   -6.4061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8082   -6.7963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5060   -6.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2375   -6.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9308   -6.3064    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.6622   -6.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6622   -7.5130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3556   -6.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9308   -5.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1796   -5.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4772   -5.5350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1796   -4.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3833   -7.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1385   -8.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8368   -7.6129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9582   -8.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n  4 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "C(CN[C@@H](CC(=O)O)C(=O)O)N[C@@H](CC(=O)O)C(=O)O",
        "formula": "C10H16N2O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "292.2431",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ed4bdb0f-58d6-4bd2-8301-26b0ea70b887",
          "f7d9cb17-3cee-4037-a4e0-02447ed4413a"
        ],
        "stereo_centers": 2
      },
      "unii": "5WK2FGJ113"
    }
  ]
}