{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "be6ba7bf-0da0-456d-8ab7-6712042680fa",
          "code": "77-89-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-89-4",
          "code_system": "CAS",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62",
            "26a65f84-9d70-42b6-9e2e-90ec2285355a"
          ]
        },
        {
          "uuid": "2a553f3d-4df2-45c5-857b-da6b0ed7a449",
          "code": "C473838",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67473838",
          "code_system": "MESH",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "024f331c-ef4e-47d2-a979-c02142df8d72",
          "code": "21 CFR 175.320",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart C--Substances for Use as Components of Coatings|Sec. 175.320 Resinous and polymeric coatings for polyolefin films.|(ii) Plasticizers",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=175.320",
          "code_system": "CFR",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "5987a5fa-2bdc-4551-bbb3-3223e495753d",
          "code": "201-066-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.970",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "3c31e181-bd1d-4d5f-90fb-602723d37844",
          "code": "1311603",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311603/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "4f99f870-002e-4f9a-b38f-8bcac056e6b2",
          "code": "SUB39846",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "21c54fed-336e-479b-91a5-31cdac304e59",
          "code": "CHEMBL2105928",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105928",
          "code_system": "ChEMBL",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "9fd3bcf7-5fad-4520-8428-8df2414f83d8",
          "code": "6504",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6504",
          "code_system": "PUBCHEM",
          "references": [
            "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62"
          ]
        },
        {
          "uuid": "fd60e766-5362-22fe-929b-8a3f0418f8fa",
          "code": "DTXSID5044576",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5044576",
          "code_system": "EPA CompTox",
          "references": [
            "c4922f15-64dc-783b-8369-6ab1e1ed5af5"
          ]
        },
        {
          "uuid": "492f3612-0102-441a-b877-f68280ef748f",
          "code": "5WBR36T90E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d8ca41b9-300d-38ab-f6c7-9a7bb5bc580c",
          "code": "1009923",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1009923",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2a2353ea-b69c-bd86-0b6f-1118b7988c15"
          ]
        },
        {
          "uuid": "0307cc70-9bd0-d133-11c3-c98752d5d897",
          "code": "100000129667",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "caa677da-a8fc-e325-4dce-6b19c0537cfc"
          ]
        },
        {
          "uuid": "b2237659-4a09-6120-48d5-2715567dea00",
          "code": "3887",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3887",
          "code_system": "NSC",
          "references": [
            "00b2832f-b084-adfb-da45-964b204cff22"
          ]
        },
        {
          "uuid": "53805859-543f-79bc-c3cd-26b28b5acd9d",
          "code": "5WBR36T90E",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5WBR36T90E",
          "code_system": "DAILYMED",
          "references": [
            "95adb8af-c6bf-4681-e518-a41bbceb130e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f00e55a0-1749-4d8d-bb2d-b7c76e782ddf",
          "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-(ACETYLOXY)-, TRIETHYL ESTER",
          "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-(ACETYLOXY)-, TRIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "768cc492-ea04-40ae-9bf4-0e42f99374b3"
          ],
          "display_name": false
        },
        {
          "uuid": "20fa8f8f-bba9-4c61-ac0d-4d127a485d9b",
          "name": "2-(ACETYLOXY)-1,2,3-PROPANETRICARBOXYLIC ACID, TRIETHYL ESTER",
          "stdName": "2-(ACETYLOXY)-1,2,3-PROPANETRICARBOXYLIC ACID, TRIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "768cc492-ea04-40ae-9bf4-0e42f99374b3"
          ],
          "display_name": false
        },
        {
          "uuid": "89b6cb7a-265d-4a42-8b08-fdc2819a1742",
          "name": "ACETYL TRIETHYL CITRATE",
          "stdName": "ACETYL TRIETHYL CITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f75f37f6-4f8b-4b3a-8d91-4f1fdcd47fe2",
            "768cc492-ea04-40ae-9bf4-0e42f99374b3",
            "35926670-8021-4594-94f7-b2e43b87a4b1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "025b106d-22ce-446d-a3d6-0883484c41d3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "37c5786f-9aa6-4375-8657-57877f72dd6e",
          "name": "ACETYLTRIETHYL CITRATE",
          "stdName": "ACETYLTRIETHYL CITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f23f124-8f57-45a0-85c9-f5f7426376c7",
            "2b36ac47-2f35-43b0-9a1a-b4c54490d80a",
            "4f526ce7-ae4a-4f7f-958e-9e1dd5532b46",
            "f5a4f67e-0291-414c-9110-1fb6d8be1008",
            "02603f21-8d77-4b3e-bc6f-f324f7512cd5",
            "f732a6b9-cc5e-4852-9cd8-2c045b74557e"
          ],
          "display_name": true
        },
        {
          "uuid": "14af054d-ea4d-48b6-8d76-1904632356f6",
          "name": "ACETYLTRIETHYL CITRATE [MART.]",
          "stdName": "ACETYLTRIETHYL CITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f23f124-8f57-45a0-85c9-f5f7426376c7"
          ],
          "display_name": false
        },
        {
          "uuid": "285538d9-670d-4e0b-8948-fe15bc2523df",
          "name": "ACETYLTRIETHYL CITRATE [NF]",
          "stdName": "ACETYLTRIETHYL CITRATE [NF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b36ac47-2f35-43b0-9a1a-b4c54490d80a"
          ],
          "display_name": false
        },
        {
          "uuid": "5add8de8-c8aa-44fd-8854-a85eb601fdaa",
          "name": "ACETYLTRIETHYL CITRATE [USP-RS]",
          "stdName": "ACETYLTRIETHYL CITRATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b36ac47-2f35-43b0-9a1a-b4c54490d80a"
          ],
          "display_name": false
        },
        {
          "uuid": "261a61bb-a10e-4732-8142-a9eb40ed5020",
          "name": "CITRIC ACID, O-ACETYLTRIETHYL ESTER",
          "stdName": "CITRIC ACID, O-ACETYLTRIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f526ce7-ae4a-4f7f-958e-9e1dd5532b46"
          ],
          "display_name": false
        },
        {
          "uuid": "711f579f-6c4b-4011-a71a-eb1f2e738e45",
          "name": "NSC-3887",
          "stdName": "NSC-3887",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa58ed93-49d2-427e-94c6-6658a2f7c0f3"
          ],
          "display_name": false
        },
        {
          "uuid": "abdfae36-eb90-495f-b99c-2b2d215ff685",
          "name": "Triethyl 2-acetoxypropane-1,2,3-tricarboxylate",
          "stdName": "TRIETHYL 2-ACETOXYPROPANE-1,2,3-TRICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f526ce7-ae4a-4f7f-958e-9e1dd5532b46"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4f526ce7-ae4a-4f7f-958e-9e1dd5532b46",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "768cc492-ea04-40ae-9bf4-0e42f99374b3",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f23f124-8f57-45a0-85c9-f5f7426376c7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f75f37f6-4f8b-4b3a-8d91-4f1fdcd47fe2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b36ac47-2f35-43b0-9a1a-b4c54490d80a",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa58ed93-49d2-427e-94c6-6658a2f7c0f3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45cfc3d5-d1ee-47b9-8f64-b33f236c8f62",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390312000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "baf2d99e-34d5-434c-aa67-8a56aa870971",
          "citation": "SRS import [5WBR36T90E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5WBR36T90E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390312000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5a4f67e-0291-414c-9110-1fb6d8be1008",
          "citation": "ACETYLTRIETHYL CITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35926670-8021-4594-94f7-b2e43b87a4b1",
          "citation": "ACETYL TRIETHYL CITRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02603f21-8d77-4b3e-bc6f-f324f7512cd5",
          "citation": "ACETYLTRIETHYL CITRATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f732a6b9-cc5e-4852-9cd8-2c045b74557e",
          "citation": "ACETYLTRIETHYL CITRATE [NF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4922f15-64dc-783b-8369-6ab1e1ed5af5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77-89-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "caa677da-a8fc-e325-4dce-6b19c0537cfc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "26a65f84-9d70-42b6-9e2e-90ec2285355a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2a2353ea-b69c-bd86-0b6f-1118b7988c15",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "00b2832f-b084-adfb-da45-964b204cff22",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "95adb8af-c6bf-4681-e518-a41bbceb130e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f9ded149-79ac-4d4c-bb58-de1c5a67c8bb",
          "id": "f9ded149-79ac-4d4c-bb58-de1c5a67c8bb",
          "molfile": "\n  Marvin  01132112572D          \n\n 22 21  0  0  0  0            999 V2000\n    7.0167   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7292   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4417   -4.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1542   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1542   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8667   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5792   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0042   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0000   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7167   -4.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4292   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1417   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5792   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5750   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2875   -1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8542   -1.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5792   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8625   -4.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -4.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0042   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7167   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 14  7  1  0  0  0  0\n 18  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)OC(=O)C",
          "formula": "C14H22O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d7f4d577-4e80-41da-9055-ef9882b70486"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.3202",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "be0a6504-a519-4956-944f-d8b6ac2867f1",
      "version": "11",
      "structure": {
        "id": "42c5364c-1462-408c-805b-5d9c80a530d3",
        "molfile": "\n  Marvin  01132103312D          \n\n 22 21  0  0  0  0            999 V2000\n   10.5792   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8667   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5792   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5792   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1542   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0042   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5750   -2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8625   -4.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1542   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0000   -2.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8542   -1.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -4.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4417   -4.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7167   -4.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2875   -1.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0042   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4292   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7292   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0167   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1417   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7167   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  6  2  0  0  0  0\n 11  7  2  0  0  0  0\n 12  8  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 17  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)OC(=O)C",
        "formula": "C14H22O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.3202",
        "optical_activity": "NONE",
        "references": [
          "4f526ce7-ae4a-4f7f-958e-9e1dd5532b46",
          "baf2d99e-34d5-434c-aa67-8a56aa870971"
        ],
        "stereo_centers": 0
      },
      "unii": "5WBR36T90E"
    }
  ]
}