{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "44bca300-441f-422b-9517-6546f36bab5e",
          "code": "79277-27-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79277-27-3",
          "code_system": "CAS",
          "references": [
            "561ce214-c5ae-47b7-825f-4ef704995605",
            "30838fb8-2d61-4d1c-8535-b08d2e7436de"
          ]
        },
        {
          "uuid": "f39a2863-01a1-43b1-b0ef-82cd5cbe9c25",
          "code": "C414314",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67414314",
          "code_system": "MESH",
          "references": [
            "561ce214-c5ae-47b7-825f-4ef704995605"
          ]
        },
        {
          "uuid": "8edeeaf2-2334-4ec4-a724-c48002f87e86",
          "code": "m10738",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10738?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "561ce214-c5ae-47b7-825f-4ef704995605"
          ]
        },
        {
          "uuid": "5943635b-72a0-4187-a281-02efd892ef98",
          "code": "73674",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73674",
          "code_system": "PUBCHEM",
          "references": [
            "561ce214-c5ae-47b7-825f-4ef704995605"
          ]
        },
        {
          "uuid": "4cd1d242-dfde-fb7f-f787-950a2a0ee0e8",
          "code": "7354",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7354",
          "code_system": "HSDB",
          "references": [
            "55716a1d-add3-b128-a1e4-2b0be23d4e9e"
          ]
        },
        {
          "uuid": "c091a63f-0cc9-7666-0803-c255a7cd553a",
          "code": "DTXSID1024124",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1024124",
          "code_system": "EPA CompTox",
          "references": [
            "2bba19b8-2778-af4d-130f-7843f5e58c7b"
          ]
        },
        {
          "uuid": "67eb4a1a-6b9c-42c7-bce0-0fc5fda55df6",
          "code": "5VFH25ES6F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f503377d-1221-f348-7c6f-cdfe5c8bd370",
          "code": "thifensulfuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/thifensulfuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "590cd1eb-47c8-62b1-99e9-da95bd16ee1e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c7c3af33-3639-4ec8-bddc-f98db15e5606",
          "name": "METHYL 3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)THIOPHENE-2-CARBOXYLATE",
          "stdName": "METHYL 3-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YLCARBAMOYLSULFAMOYL)THIOPHENE-2-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98fd3cb3-8aa8-4012-b3f9-fa15a2d902a8",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        },
        {
          "uuid": "f1dbd8b7-4041-426d-91d1-a4c0153ad329",
          "name": "THIAMETURON-METHYL",
          "stdName": "THIAMETURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98fd3cb3-8aa8-4012-b3f9-fa15a2d902a8",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        },
        {
          "uuid": "2e65a44c-b818-4c4f-8437-2aa5599785c0",
          "name": "THIFENSULFURON METHYL ESTER",
          "stdName": "THIFENSULFURON METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07a43cbf-a6be-49bd-aabf-3e80ff164a73",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        },
        {
          "uuid": "10885b87-f292-4dc1-b306-6be85b99a696",
          "name": "THIFENSULFURON-METHYL",
          "stdName": "THIFENSULFURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "973dc803-6efa-49e2-a52c-e97778bd3339",
            "2910b50e-3aeb-4639-b6cc-7d989ce9fcee",
            "c4ad20ac-f262-4b75-944f-dfdc62ad3461",
            "add50ffb-2fcc-4b3f-9119-475772928480",
            "c185635d-330f-47dc-8fd6-5aa76178078b",
            "30d164ff-f50b-4d34-8126-389fa38c8575",
            "905e8d75-1923-410d-8ca8-573d723c562f",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": true
        },
        {
          "uuid": "5ad1aae4-6691-4c66-bc41-230a928fff0e",
          "name": "THIFENSULFURON-METHYL [HSDB]",
          "stdName": "THIFENSULFURON-METHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30d164ff-f50b-4d34-8126-389fa38c8575",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        },
        {
          "uuid": "ea3abfb4-11b8-4dc6-a548-b756f531114a",
          "name": "THIFENSULFURON-METHYL [ISO]",
          "stdName": "THIFENSULFURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4ad20ac-f262-4b75-944f-dfdc62ad3461",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        },
        {
          "uuid": "1320efe2-def8-4609-9e43-14e76b901b9a",
          "name": "THIFENSULFURON-METHYL [MI]",
          "stdName": "THIFENSULFURON-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "973dc803-6efa-49e2-a52c-e97778bd3339",
            "d0aeda25-437e-4f22-90ea-4affd275223b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "add50ffb-2fcc-4b3f-9119-475772928480",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "98fd3cb3-8aa8-4012-b3f9-fa15a2d902a8",
          "citation": "http://www.alanwood.net/pesticides/derivatives/thifensulfuron-methyl.html",
          "url": "http://www.alanwood.net/pesticides/derivatives/thifensulfuron-methyl.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0aeda25-437e-4f22-90ea-4affd275223b",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "973dc803-6efa-49e2-a52c-e97778bd3339",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30d164ff-f50b-4d34-8126-389fa38c8575",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07a43cbf-a6be-49bd-aabf-3e80ff164a73",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4ad20ac-f262-4b75-944f-dfdc62ad3461",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "561ce214-c5ae-47b7-825f-4ef704995605",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c095a3ce-2099-440f-8dad-fca1f2720971",
          "citation": "SRS import [5VFH25ES6F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5VFH25ES6F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "975184f5-59c1-4133-a475-df6074a57428",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2910b50e-3aeb-4639-b6cc-7d989ce9fcee",
          "citation": "THIFENSULFURON-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "905e8d75-1923-410d-8ca8-573d723c562f",
          "citation": "THIFENSULFURON-METHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c185635d-330f-47dc-8fd6-5aa76178078b",
          "citation": "THIFENSULFURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55716a1d-add3-b128-a1e4-2b0be23d4e9e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+79277-27-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2bba19b8-2778-af4d-130f-7843f5e58c7b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79277-27-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "590cd1eb-47c8-62b1-99e9-da95bd16ee1e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "30838fb8-2d61-4d1c-8535-b08d2e7436de",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "254512fd-270e-4410-95e1-d0561388547d",
          "id": "254512fd-270e-4410-95e1-d0561388547d",
          "molfile": "\n  Marvin  01132102042D          \n\n 25 26  0  0  0  0            999 V2000\n   11.1889   -3.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5196   -3.3497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7674   -3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0982   -3.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6842   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2966   -5.0594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9683   -5.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1448   -5.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9681   -4.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1506   -4.4505    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8770   -5.2224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4635   -3.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4358   -4.0468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7257   -4.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7257   -5.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0062   -4.0632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2962   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5773   -4.0757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8685   -4.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1507   -4.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8685   -5.3192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5913   -5.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5913   -6.5545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8853   -6.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2962   -5.3129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  9  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 25 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccsc2C(=O)OC)nc(n1)OC",
          "formula": "C12H13N5O6S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7656b4c7-9ed7-481a-8ab2-af17e7899ec5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "387.3942",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9989adc2-715d-416f-872b-81b6f654eb1f",
      "version": "5",
      "structure": {
        "id": "b8e52c56-f7bf-4c8f-ba33-a4c403a1b759",
        "molfile": "\n  Marvin  01132109342D          \n\n 25 26  0  0  0  0            999 V2000\n    3.8685   -4.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5773   -4.0757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2962   -4.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0062   -4.0632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7257   -4.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4358   -4.0468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1506   -4.4505    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8770   -5.2224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9681   -4.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6842   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2966   -5.0594    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9683   -5.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1448   -5.7335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7674   -3.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5196   -3.3497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1889   -3.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0982   -3.2036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4635   -3.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7257   -5.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2962   -5.3129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5913   -5.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8685   -5.3192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5913   -6.5545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8853   -6.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1507   -4.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  9  1  0  0  0  0\n 10 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  2  0  0  0  0\n  7 18  2  0  0  0  0\n  5 19  2  0  0  0  0\n 20  3  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n  1 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n  1 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccsc2C(=O)OC)nc(n1)OC",
        "formula": "C12H13N5O6S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "387.3942",
        "optical_activity": "NONE",
        "references": [
          "975184f5-59c1-4133-a475-df6074a57428",
          "c095a3ce-2099-440f-8dad-fca1f2720971"
        ],
        "stereo_centers": 0
      },
      "unii": "5VFH25ES6F"
    }
  ]
}