{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3ed87951-e5a4-49bf-8a3d-0bbc4a3e7c9b",
          "code": "26761-45-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26761-45-5",
          "code_system": "CAS",
          "references": [
            "c8493d58-949a-4605-a540-9916eb64cc99",
            "ba60660e-a134-4f3e-88a8-495081491bb0"
          ]
        },
        {
          "uuid": "c5393998-6f6d-4a04-88f4-ecbd3d7d51d1",
          "code": "33600",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33600",
          "code_system": "PUBCHEM",
          "references": [
            "c8493d58-949a-4605-a540-9916eb64cc99"
          ]
        },
        {
          "uuid": "04a6355e-e255-4a3b-b883-bc349a8912ed",
          "code": "247-979-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.603",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c8493d58-949a-4605-a540-9916eb64cc99"
          ]
        },
        {
          "uuid": "aedb426e-37a3-28f8-335e-8e08c537f671",
          "code": "DTXSID8025705",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8025705",
          "code_system": "EPA CompTox",
          "references": [
            "d3db30cf-a8e6-cc16-f129-08f972bac10d"
          ]
        },
        {
          "uuid": "a3fb2f86-85c4-44a5-886d-2a1f58ba8eed",
          "code": "5V72X484L7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "47bb24f7-517b-3b8e-43f3-e618e7e2c89d",
          "code": "300000053337",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4a10fa29-2650-3f65-3cc1-8fdb4f6499f5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "281057cc-a78f-44d2-b798-0b11a859c0d3",
          "name": "1-PROPANOL, 2,3-EPOXY-, NEODECANOATE",
          "stdName": "1-PROPANOL, 2,3-EPOXY-, NEODECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2732571c-269e-49a4-b3bf-91513909551d"
          ],
          "display_name": false
        },
        {
          "uuid": "321353b1-edef-4afe-bdab-a819f68a4ade",
          "name": "GLYCIDYL NEODECANOATE",
          "stdName": "GLYCIDYL NEODECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6948b1d1-c622-4c31-ab76-7555ce2196da"
          ],
          "display_name": true
        },
        {
          "uuid": "68b6f491-7ac4-40c3-93a7-e020c6d1489c",
          "name": "NEODECANOIC ACID, 2,3-EPOXYPROPYL ESTER",
          "stdName": "NEODECANOIC ACID, 2,3-EPOXYPROPYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2732571c-269e-49a4-b3bf-91513909551d"
          ],
          "display_name": false
        },
        {
          "uuid": "648c7680-7cfe-4b49-aefe-aced3d64d93f",
          "name": "NEODECANOIC ACID, 2-OXIRANYLMETHYL ESTER",
          "stdName": "NEODECANOIC ACID, 2-OXIRANYLMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2732571c-269e-49a4-b3bf-91513909551d"
          ],
          "display_name": false
        },
        {
          "uuid": "1da93613-766f-416e-807b-a207611b0a2e",
          "name": "NEODECANOIC ACID, OXIRANYLMETHYL ESTER",
          "stdName": "NEODECANOIC ACID, OXIRANYLMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2732571c-269e-49a4-b3bf-91513909551d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6948b1d1-c622-4c31-ab76-7555ce2196da",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2732571c-269e-49a4-b3bf-91513909551d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8493d58-949a-4605-a540-9916eb64cc99",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89702f72-3811-4c45-b482-fdcbb90c38b8",
          "citation": "SRS import [5V72X484L7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5V72X484L7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3db30cf-a8e6-cc16-f129-08f972bac10d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26761-45-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba60660e-a134-4f3e-88a8-495081491bb0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a10fa29-2650-3f65-3cc1-8fdb4f6499f5",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a4e5abf7-8177-458f-95a4-ecefbc65614e",
          "id": "a4e5abf7-8177-458f-95a4-ecefbc65614e",
          "molfile": "\n  Marvin  01132108342D          \n\n 16 16  0  0  0  0            999 V2000\n   13.4932   -6.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7763   -6.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0643   -6.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3473   -6.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6354   -6.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9183   -6.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2064   -6.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6233   -7.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7983   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4895   -6.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4844   -5.3959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7775   -6.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0605   -6.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0555   -5.4046    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.4636   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6386   -4.6926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCC(C)(C)C(=O)OCC1CO1",
          "formula": "C13H24O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7bf91ef8-6b8b-43f0-8380-4f013e3c0287"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.3284",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "9860dcec-d1d4-429a-8a4e-a1a1b049b56f",
      "version": "4",
      "structure": {
        "id": "0ece154d-6cd6-499c-b6f2-0b1fcacb42cf",
        "molfile": "\n  Marvin  01132101002D          \n\n 16 16  0  0  0  0            999 V2000\n    7.0605   -6.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7775   -6.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4895   -6.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2064   -6.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6233   -7.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7983   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9183   -6.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6354   -6.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3473   -6.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0643   -6.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7763   -6.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4932   -6.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4844   -5.3959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0555   -5.4046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4636   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6386   -4.6926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  3 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCC(C)(C)C(=O)OCC1CO1",
        "formula": "C13H24O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.3284",
        "optical_activity": "( + / - )",
        "references": [
          "89702f72-3811-4c45-b482-fdcbb90c38b8",
          "6948b1d1-c622-4c31-ab76-7555ce2196da"
        ],
        "stereo_centers": 1
      },
      "unii": "5V72X484L7"
    }
  ]
}