{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "06eab4f1-9c93-4adb-a86a-b6eeec5f1df0",
          "code": "A11HA06",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|pyridoxal phosphate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A11HA06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "4693cce3-b9a1-4845-9b29-c2e4e18f7d49",
          "code": "QA11HA06",
          "comments": "VATC|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|pyridoxal phosphate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA11HA06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "d76022f9-712b-4a40-9423-a017885c2a30",
          "code": "41468-25-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41468-25-1",
          "code_system": "CAS",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2",
            "79463eca-c0d2-43f0-851d-b817866830a6"
          ]
        },
        {
          "uuid": "5b60f4b5-d4b8-4ad8-9e75-28f1d73228a7",
          "code": "C81627",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81627",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "b9621b45-42d0-40a7-970b-656c339d7bae",
          "code": "PYRIDOXAL PHOSPHATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pyridoxal_phosphate",
          "code_system": "WIKIPEDIA",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "f6ac0f47-e4f4-4fd1-bfd7-82dfd22389a7",
          "code": "D011732",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011732",
          "code_system": "MESH",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "9f31c07f-6175-46b9-b1b2-25822ea5350f",
          "code": "9004",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/9004/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "85e2d3ed-f166-4b71-b66f-ce28c6398fd9",
          "code": "SUB33484",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "52bea9e4-9fb5-47c5-965b-8bb5845acbc1",
          "code": "CHEMBL82202",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL82202",
          "code_system": "ChEMBL",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "376c7a68-b6a7-482f-a7dc-b80d73c063fd",
          "code": "SUB04137MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "18f5439f-e326-496b-8292-4f0d16f2f391",
          "code": "38882",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38882",
          "code_system": "PUBCHEM",
          "references": [
            "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2"
          ]
        },
        {
          "uuid": "46b36ee9-c7d4-ad42-b03b-7954ce2125f1",
          "code": "DTXSID7046594",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7046594",
          "code_system": "EPA CompTox",
          "references": [
            "394acdfd-399d-5948-4a67-4b3d9c75d30a"
          ]
        },
        {
          "uuid": "f95b7a85-8a28-ecd3-c721-0d080d05a829",
          "code": "557116",
          "comments": "ORPHAN DRUG|Designated|Treatment of seizures associated with pyridox(am)ine 5'-phosphate oxidase (PNPO) deficiency",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=557116",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "956c7dc2-44ae-67fb-a7b6-641f11332b0f",
          "code": "C45812",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Water-Soluble Vitamin[C1551]|B Vitamin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45812",
          "code_system": "NCI_THESAURUS",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "046eea3c-5d17-48f9-b906-a18d503604c4",
          "code": "SUB33483",
          "type": "ALTERNATIVE",
          "code_system": "EVMPD"
        },
        {
          "uuid": "03c6d911-657d-11e6-fc2c-7b830339981b",
          "code": "75056-2",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Pyridoxal phosphate [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/75056-2/",
          "code_system": "LOINC",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "4d4e683c-4f62-effb-f5c7-cc2035bc4c33",
          "code": "62236-5",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Pyridoxal phosphate [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/62236-5/",
          "code_system": "LOINC",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "d5de05f9-ef05-3944-748c-fff9cf641ef4",
          "code": "30552-4",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Pyridoxal phosphate [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/30552-4/",
          "code_system": "LOINC",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "8bb7848c-1a0f-8494-a9e2-a1c7160744c1",
          "code": "74442-5",
          "comments": "LOINC|ACTIVE|CHEM|Bld|Pyridoxal phosphate [Moles/volume] in Blood",
          "type": "PRIMARY",
          "url": "https://loinc.org/74442-5/",
          "code_system": "LOINC",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "9713c058-0d7d-ceee-d165-0d336550a1d7",
          "code": "DB00114",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB00114",
          "code_system": "DRUG BANK",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "8faef9bb-e649-a7c1-609a-c8dab9d2a28e",
          "code": "3506",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3506",
          "code_system": "DRUG CENTRAL",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "d1ddba57-a9b2-4db8-ae36-1d77537c4081",
          "code": "5V5IOJ8338",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9481c256-db9c-f64a-0feb-272b862e5c56",
          "code": "18405",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18405",
          "code_system": "CHEBI",
          "references": [
            "173ae12b-f49e-1428-a5de-1d272038da58"
          ]
        },
        {
          "uuid": "d432f8dd-bb45-c680-a431-2087d284e941",
          "code": "5V5IOJ8338",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5V5IOJ8338",
          "code_system": "DAILYMED",
          "references": [
            "f792b8f1-9ab7-8533-5f67-85c0c949b97d"
          ]
        },
        {
          "uuid": "4be165c3-8971-ca56-5ff4-2040aa4a3261",
          "code": "100000127438",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c58d91e0-50b3-b992-15c7-d53990ea02f3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e67e608f-a302-48b3-9c7c-733be39c453c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1b555259-6922-4209-9961-715899394fc9",
            "refuuid": "9e793b80-da77-4029-9c81-722feab9a7f4",
            "name": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "unii": "F06SGE49M6",
            "linking_id": "F06SGE49M6",
            "ref_pname": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "162b738a-f0df-4ca7-aa5f-28dd4d840524",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "4448c0c6-a8a5-4f51-994a-5f9f68835640",
            "refuuid": "9e793b80-da77-4029-9c81-722feab9a7f4",
            "name": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "unii": "F06SGE49M6",
            "linking_id": "F06SGE49M6",
            "ref_pname": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5d848dd1-2390-4f70-9ab0-50fc56fcccb2",
          "amount": {
            "uuid": "5b089538-abb3-4b2e-b83a-606d8a10e610"
          },
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "caa79418-97d8-4a21-85d2-819485fad7e4"
          ],
          "related_substance": {
            "uuid": "dd991c0d-d92e-4909-8a57-aff77bed4f1b",
            "refuuid": "9e793b80-da77-4029-9c81-722feab9a7f4",
            "name": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "unii": "F06SGE49M6",
            "linking_id": "F06SGE49M6",
            "ref_pname": "PYRIDOXAL PHOSPHATE ANHYDROUS",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "60d4f6d7-fe44-43ce-8678-49754f5fb5f3",
          "name": "3-HYDROXY-2-METHYL-5-((PHOSPHONOXY)METHYL)-4-PYRIDINECARBOXALDEHYDE HYDRATE",
          "stdName": "3-HYDROXY-2-METHYL-5-((PHOSPHONOXY)METHYL)-4-PYRIDINECARBOXALDEHYDE HYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac73687b-8e5e-4b2a-ad1c-e493f6971e01"
          ],
          "display_name": false
        },
        {
          "uuid": "eef8ab94-2f3f-4dac-9dcb-ef9ca915c1f1",
          "name": "4-PYRIDINECARBOXALDEHYDE, 3-HYDROXY-2-METHYL-5-((PHOSPHONOOXY)METHYL)-, HYDRATE (1:1)",
          "stdName": "4-PYRIDINECARBOXALDEHYDE, 3-HYDROXY-2-METHYL-5-((PHOSPHONOOXY)METHYL)-, HYDRATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "41187d1f-c67a-4aef-a245-219264e3f81c"
          ],
          "display_name": false
        },
        {
          "uuid": "7576c455-d409-4049-a8bd-ba8748602873",
          "name": "PYRIDOXAL 5'-PHOSPHATE MONOHYDRATE",
          "stdName": "PYRIDOXAL 5'-PHOSPHATE MONOHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "41187d1f-c67a-4aef-a245-219264e3f81c"
          ],
          "display_name": false
        },
        {
          "uuid": "f35c2892-81ed-4429-87c3-4dd1705af9a1",
          "name": "PYRIDOXAL 5-PHOSPHATE MONOHYDRATE",
          "stdName": "PYRIDOXAL 5-PHOSPHATE MONOHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e435d53-119f-45e8-bb34-38818c71a6b9",
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "8971ab6b-fa71-4462-afd9-6b3f29b31376"
          ],
          "display_name": false
        },
        {
          "uuid": "6de0277d-142d-4ad8-92f1-45bcbd01a9f8",
          "name": "PYRIDOXAL PHOSPHATE",
          "stdName": "PYRIDOXAL PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac73687b-8e5e-4b2a-ad1c-e493f6971e01",
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "2be649ef-50c6-4773-ab85-1066d865ea96",
            "dbcb259c-be90-470a-b7e9-c7273b668d4f"
          ],
          "display_name": true
        },
        {
          "uuid": "19341648-d727-4876-84a4-d95cd7610b81",
          "name": "PYRIDOXAL PHOSPHATE HYDRATE",
          "stdName": "PYRIDOXAL PHOSPHATE HYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "c9518520-68cb-40af-bbf8-1954250353ab",
            "0918af0f-48b9-44d3-9b81-61179b426446"
          ],
          "display_name": false
        },
        {
          "uuid": "e5f6201f-29a5-4679-8ef4-9a9e813ba6da",
          "name": "PYRIDOXAL PHOSPHATE HYDRATE [JAN]",
          "stdName": "PYRIDOXAL PHOSPHATE HYDRATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "c9518520-68cb-40af-bbf8-1954250353ab"
          ],
          "display_name": false
        },
        {
          "uuid": "4f0a7651-da3d-49cf-bcca-7c4a1ae634d2",
          "name": "PYRIDOXAL PHOSPHATE MONOHYDRATE",
          "stdName": "PYRIDOXAL PHOSPHATE MONOHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "b0700689-680d-4e28-bb24-b7d8a5246bb0"
          ],
          "display_name": false
        },
        {
          "uuid": "100cf98e-3db7-4ed7-aa0a-1f8db2053401",
          "name": "PYRIDOXAL PHOSPHATE [MART.]",
          "stdName": "PYRIDOXAL PHOSPHATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c494c149-627e-40bb-8fa3-ad6d07292c42",
            "2be649ef-50c6-4773-ab85-1066d865ea96"
          ],
          "display_name": false
        },
        {
          "uuid": "271ff274-9190-644d-8f78-cb8c1595f51e",
          "name": "Pyridoxal 5-phosphate monohydrate [WHO-DD]",
          "stdName": "PYRIDOXAL 5-PHOSPHATE MONOHYDRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "439cf036-98be-1d87-409c-cf5bad6dc198"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac73687b-8e5e-4b2a-ad1c-e493f6971e01",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2be649ef-50c6-4773-ab85-1066d865ea96",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c494c149-627e-40bb-8fa3-ad6d07292c42",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41187d1f-c67a-4aef-a245-219264e3f81c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0700689-680d-4e28-bb24-b7d8a5246bb0",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9518520-68cb-40af-bbf8-1954250353ab",
          "citation": "http://www.kegg.jp/dbget-bin/www_bget?dr:D00006",
          "url": "http://www.kegg.jp/dbget-bin/www_bget?dr:D00006",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e435d53-119f-45e8-bb34-38818c71a6b9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc27a4f7-ce87-46bb-81a4-26cdeefd76d2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "563d86ea-3912-415f-ac0b-24b18f01dbf0",
          "citation": "SRS import [5V5IOJ8338]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5V5IOJ8338",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbcb259c-be90-470a-b7e9-c7273b668d4f",
          "citation": "PYRIDOXAL PHOSPHATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0918af0f-48b9-44d3-9b81-61179b426446",
          "citation": "PYRIDOXAL PHOSPHATE HYDRATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8971ab6b-fa71-4462-afd9-6b3f29b31376",
          "citation": "PYRIDOXAL 5-PHOSPHATE MONOHYDRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "394acdfd-399d-5948-4a67-4b3d9c75d30a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41468-25-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c58d91e0-50b3-b992-15c7-d53990ea02f3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "173ae12b-f49e-1428-a5de-1d272038da58",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "79463eca-c0d2-43f0-851d-b817866830a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "439cf036-98be-1d87-409c-cf5bad6dc198",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f792b8f1-9ab7-8533-5f67-85c0c949b97d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0c20a51d-f744-42c9-b8f0-8b4dfc1b9f32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "caa79418-97d8-4a21-85d2-819485fad7e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "64884c39-ca66-4c39-b100-34068afa3827",
          "id": "64884c39-ca66-4c39-b100-34068afa3827",
          "molfile": "\n  Marvin  01132105142D          \n\n  1  0  0  0  0  0            999 V2000\n    6.2352   -1.1702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0bce478b-4657-4d2d-8b3d-e7b601f068d9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8d90b8c9-758e-47d7-82a9-5c470deeb774",
          "id": "8d90b8c9-758e-47d7-82a9-5c470deeb774",
          "molfile": "\n  Marvin  01132107212D          \n\n 16 16  0  0  0  0            999 V2000\n    4.7637   -0.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -0.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -0.2440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6163   -0.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6163   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9118   -1.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3039   -1.3705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5476   -0.6660    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1301   -1.3472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2413    0.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1301    0.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -2.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -3.0887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7637   -1.8872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 15  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(C=O)c(cn1)COP(=O)(O)O)O",
          "formula": "C8H10NO6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3877986e-71c2-4c8b-8908-50dad4a114db"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "247.1422",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9616e981-309f-4f56-9a7e-a1c921c4770e",
      "version": "23",
      "structure": {
        "id": "59616576-9909-47ab-a384-387d6dfe4925",
        "molfile": "\n  Marvin  01132104382D          \n\n 17 16  0  0  0  0            999 V2000\n    2.6163   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6163   -0.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9118   -1.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -2.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3315   -0.2440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3039   -1.3705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -0.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7637   -1.8872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0288   -3.0887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5476   -0.6660    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7637   -0.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1301   -1.3472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2413    0.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1301    0.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2352   -1.1702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 12 16  2  0  0  0  0\n  7  9  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(C=O)c(cn1)COP(=O)(O)O)O.O",
        "formula": "C8H10NO6P.H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "265.1575",
        "optical_activity": "NONE",
        "references": [
          "ac73687b-8e5e-4b2a-ad1c-e493f6971e01",
          "563d86ea-3912-415f-ac0b-24b18f01dbf0"
        ],
        "stereo_centers": 0
      },
      "unii": "5V5IOJ8338"
    }
  ]
}