{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8c11c239-1155-4a50-94e6-cab5be68f2b0",
          "code": "99105-77-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99105-77-8",
          "code_system": "CAS",
          "references": [
            "073b8a6e-f539-4ddd-90f0-443f22958570",
            "7a19dded-8c33-444e-bb71-da7d26ec89f4"
          ]
        },
        {
          "uuid": "d43d3788-6e7a-4dba-b278-58f95c2f5908",
          "code": "m10296",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10296?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "073b8a6e-f539-4ddd-90f0-443f22958570"
          ]
        },
        {
          "uuid": "890c5724-81af-48a7-840e-e7aa2b8fec66",
          "code": "91760",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91760",
          "code_system": "PUBCHEM",
          "references": [
            "073b8a6e-f539-4ddd-90f0-443f22958570"
          ]
        },
        {
          "uuid": "cfb25810-1952-5b27-0eb0-64f5c0834e87",
          "code": "DTXSID9058230",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058230",
          "code_system": "EPA CompTox",
          "references": [
            "8283012c-9d42-1207-884f-a5521b75a5c1"
          ]
        },
        {
          "uuid": "f54d95d5-9058-4493-b5b9-595fee65066c",
          "code": "5UEH9SXW7V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f7cf1f21-a871-741e-41a2-5570a0ed5537",
          "code": "sulcotrione",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/sulcotrione.html",
          "code_system": "ALANWOOD",
          "references": [
            "59c282c4-fb92-0655-f8ad-face420e4fa6"
          ]
        },
        {
          "uuid": "2242e55a-e81a-4d4d-84a9-6ae79a2c257e",
          "code": "129233-47-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129233-47-2",
          "code_system": "CAS",
          "references": [
            "7a19dded-8c33-444e-bb71-da7d26ec89f4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0984b65f-3fe2-404c-8b49-eafb11a47aef",
          "name": "2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-1,3-CYCLOHEXANEDIONE",
          "stdName": "2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-1,3-CYCLOHEXANEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "250e3ec1-f3c5-4a77-ba81-6ce09429a954",
            "7a892879-0476-435e-9945-0c72fa73354a"
          ],
          "display_name": false
        },
        {
          "uuid": "b644bf58-c173-457b-978f-3ae7836d7f71",
          "name": "2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-3-HYDROXY-2-CYCLOHEXEN-1-ONE",
          "stdName": "2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-3-HYDROXY-2-CYCLOHEXEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a19dded-8c33-444e-bb71-da7d26ec89f4"
          ],
          "display_name": false
        },
        {
          "uuid": "0b4b314c-68fc-4bb6-9334-9f686d6bc081",
          "name": "2-(2-CHLORO-4-MESYLBENZOYL)CYCLOHEXANE-1,3-DIONE",
          "stdName": "2-(2-CHLORO-4-MESYLBENZOYL)CYCLOHEXANE-1,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "250e3ec1-f3c5-4a77-ba81-6ce09429a954",
            "ca55f6fd-a698-4d56-842c-d9e763c68eaa"
          ],
          "display_name": false
        },
        {
          "uuid": "1846d22e-8183-4d33-8af8-87e1a8063ba6",
          "name": "2-CYCLOHEXEN-1-ONE, 2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-3-HYDROXY-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-(2-CHLORO-4-(METHYLSULFONYL)BENZOYL)-3-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a19dded-8c33-444e-bb71-da7d26ec89f4"
          ],
          "display_name": false
        },
        {
          "uuid": "b6982cc4-4ab8-43a5-8777-c31ca7157848",
          "name": "3-HYDROXY-2-(4-(METHYLSULFONYL)-2-CHLOROBENZOYL)-2-CYCLOHEXEN-1-ONE",
          "stdName": "3-HYDROXY-2-(4-(METHYLSULFONYL)-2-CHLOROBENZOYL)-2-CYCLOHEXEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a19dded-8c33-444e-bb71-da7d26ec89f4"
          ],
          "display_name": false
        },
        {
          "uuid": "4aae4856-7432-4519-afa9-cc6afe00e38e",
          "name": "ICI-A-0051",
          "stdName": "ICI-A-0051",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3983cce2-58e9-470d-95b6-27b3b59d6b9d",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf"
          ],
          "display_name": false
        },
        {
          "uuid": "abe32d8b-0dee-4823-aa09-65ef4622c6c2",
          "name": "MIKADO",
          "stdName": "MIKADO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3983cce2-58e9-470d-95b6-27b3b59d6b9d",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf"
          ],
          "display_name": false
        },
        {
          "uuid": "6cf3b84c-bf84-4dda-a80a-ddc212a49992",
          "name": "SC-0051",
          "stdName": "SC-0051",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3983cce2-58e9-470d-95b6-27b3b59d6b9d",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf"
          ],
          "display_name": false
        },
        {
          "uuid": "38356bad-a65d-4dbe-98bb-09d9f6ca7517",
          "name": "SULCOTRIONE",
          "stdName": "SULCOTRIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d80003-7da9-4d89-9424-7cba23de9cd2",
            "8da6188f-a702-43df-aa33-da7ed01e97f0",
            "fd7639dd-20ac-4f0b-a66e-3a184444e635",
            "cbb0bd86-31b4-42d8-9072-71bc0a00efd3",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf",
            "09b7f7fd-0c3f-4ead-b4c6-c7a9982a5360"
          ],
          "display_name": true
        },
        {
          "uuid": "d0b4da6e-8912-4b45-98ce-58c4e27383ff",
          "name": "SULCOTRIONE [ISO]",
          "stdName": "SULCOTRIONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd7639dd-20ac-4f0b-a66e-3a184444e635",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf"
          ],
          "display_name": false
        },
        {
          "uuid": "9e4b24d0-2a95-4b28-8179-4fe3305929d1",
          "name": "SULCOTRIONE [MI]",
          "stdName": "SULCOTRIONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8da6188f-a702-43df-aa33-da7ed01e97f0",
            "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "90d80003-7da9-4d89-9424-7cba23de9cd2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "250e3ec1-f3c5-4a77-ba81-6ce09429a954",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca55f6fd-a698-4d56-842c-d9e763c68eaa",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a892879-0476-435e-9945-0c72fa73354a",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8da6188f-a702-43df-aa33-da7ed01e97f0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "557c5574-f2b9-4f20-a2e0-4ace29c1c7bf",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3983cce2-58e9-470d-95b6-27b3b59d6b9d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd7639dd-20ac-4f0b-a66e-3a184444e635",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "073b8a6e-f539-4ddd-90f0-443f22958570",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390898000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e41ce988-0d8b-4777-a47f-7228dd9ff98e",
          "citation": "SRS import [5UEH9SXW7V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5UEH9SXW7V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390898000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1971494e-0f9f-4159-9285-bf3e84bc0b7d",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09b7f7fd-0c3f-4ead-b4c6-c7a9982a5360",
          "citation": "SULCOTRIONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cbb0bd86-31b4-42d8-9072-71bc0a00efd3",
          "citation": "SULCOTRIONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8283012c-9d42-1207-884f-a5521b75a5c1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=99105-77-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "59c282c4-fb92-0655-f8ad-face420e4fa6",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7a19dded-8c33-444e-bb71-da7d26ec89f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1d73b1f9-d5c1-4e57-962b-301db9c9e393",
          "id": "1d73b1f9-d5c1-4e57-962b-301db9c9e393",
          "molfile": "\n  Marvin  01132101422D          \n\n 21 22  0  0  0  0            999 V2000\n    8.1511   -3.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6243   -4.1959    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2076   -4.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2562   -3.6656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9097   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -4.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4809   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4809   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -6.6709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0518   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3374   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3374   -6.6709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6229   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6229   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3374   -4.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0518   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -4.1959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -6.6709    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9097   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 21  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 19  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "CS(=O)(=O)c1ccc(c(c1)Cl)C(=O)C2C(=O)CCCC2=O",
          "formula": "C14H13ClO5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bded7acb-b16c-4ab7-a211-57320acf9153"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "328.7696",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "90567601-fcaa-49ad-84fb-1b93ab4b3ed8",
      "version": "5",
      "structure": {
        "id": "c80111ed-0eb1-4df2-8999-7cb9d976653d",
        "molfile": "\n  Marvin  01132110202D          \n\n 21 22  0  0  0  0            999 V2000\n    4.3374   -6.6709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3374   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6229   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6229   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3374   -4.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0518   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -4.1959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0518   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7663   -6.6709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4809   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4809   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -4.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9097   -4.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6243   -4.1959    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2076   -4.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2562   -3.6656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1511   -3.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9097   -5.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -5.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1953   -6.6709    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  2  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 14 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 11  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "CS(=O)(=O)c1ccc(c(c1)Cl)C(=O)C2C(=O)CCCC2=O",
        "formula": "C14H13ClO5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "328.7696",
        "optical_activity": "NONE",
        "references": [
          "1971494e-0f9f-4159-9285-bf3e84bc0b7d",
          "e41ce988-0d8b-4777-a47f-7228dd9ff98e"
        ],
        "stereo_centers": 0
      },
      "unii": "5UEH9SXW7V"
    }
  ]
}