{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3c55da06-05b3-493a-9b13-8ccb549c4d26",
          "code": "2307-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2307-68-8",
          "code_system": "CAS",
          "references": [
            "b75f9934-d581-404e-a8e2-64522a96ea10",
            "b295823f-92ac-44c7-9bff-1c543eca367b"
          ]
        },
        {
          "uuid": "665e976f-7b7a-4736-97fa-17026a521a34",
          "code": "m10099",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10099?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b75f9934-d581-404e-a8e2-64522a96ea10"
          ]
        },
        {
          "uuid": "f8a514c9-1311-457d-b738-dbb2c5b57691",
          "code": "218-988-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.263",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b75f9934-d581-404e-a8e2-64522a96ea10"
          ]
        },
        {
          "uuid": "4b455cf2-b0d1-4174-a63c-582e9040ff39",
          "code": "16826",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16826",
          "code_system": "PUBCHEM",
          "references": [
            "b75f9934-d581-404e-a8e2-64522a96ea10"
          ]
        },
        {
          "uuid": "09515bb6-53a6-e78e-9a03-8db67534aa9c",
          "code": "DTXSID3042265",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3042265",
          "code_system": "EPA CompTox",
          "references": [
            "bbe2ccdc-7d3a-998d-4807-76380d8fe388"
          ]
        },
        {
          "uuid": "74dff509-246f-4d49-af80-ea14ffe9f83f",
          "code": "5U5R396S8D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "433a2ea2-6fb7-25ad-f546-06b1723d5281",
          "code": "pentanochlor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pentanochlor.html",
          "code_system": "ALANWOOD",
          "references": [
            "fed9eaae-79af-18b1-cd68-563db579083f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c192b7bc-dbab-479b-ae53-e12846c78797",
          "name": "3'-CHLORO-2,4'-DIMETHYLVALERANILIDE",
          "stdName": "3'-CHLORO-2,4'-DIMETHYLVALERANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "b3a7c696-127f-44fa-a3a2-af4f4065768d"
          ],
          "display_name": false
        },
        {
          "uuid": "fe5c725f-1df6-4e75-a238-0c664a90563f",
          "name": "3'-CHLORO-2-METHYL-P-VALEROTOLUIDIDE",
          "stdName": "3'-CHLORO-2-METHYL-P-VALEROTOLUIDIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "b3a7c696-127f-44fa-a3a2-af4f4065768d"
          ],
          "display_name": false
        },
        {
          "uuid": "87367493-9c36-4009-92ac-6fc5bb98b966",
          "name": "CMMP",
          "stdName": "CMMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "b3a7c696-127f-44fa-a3a2-af4f4065768d"
          ],
          "display_name": false
        },
        {
          "uuid": "5016f489-2010-4380-8b5e-2f1fd7ff4ffa",
          "name": "PENTANAMIDE, N-(3-CHLORO-4-METHYLPHENYL)-2-METHYL-",
          "stdName": "PENTANAMIDE, N-(3-CHLORO-4-METHYLPHENYL)-2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "b3a7c696-127f-44fa-a3a2-af4f4065768d"
          ],
          "display_name": false
        },
        {
          "uuid": "e1e41e52-24ef-4c75-a930-6e46b3e1a7b9",
          "name": "PENTANOCHLOR",
          "stdName": "PENTANOCHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "b3f6bf8e-e1b8-465c-9968-3e9c807d30a6",
            "c220aa0b-dbac-48e7-8a81-f8e01165fc3c",
            "ad8b0f6b-bdde-4bb5-91e4-2c14053f2e3f"
          ],
          "display_name": true
        },
        {
          "uuid": "9d501417-517f-45e7-92d1-035ca4313331",
          "name": "PENTANOCHLOR [ISO]",
          "stdName": "PENTANOCHLOR [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "ad8b0f6b-bdde-4bb5-91e4-2c14053f2e3f"
          ],
          "display_name": false
        },
        {
          "uuid": "0a18956d-1e22-4ab6-8ebb-0fdbadbce634",
          "name": "SOLAN",
          "stdName": "SOLAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e23315b-a023-4853-88f0-00bb0644dcd0",
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "5032f1e0-0b61-4977-80b0-cb9017d094b0",
            "090788f5-b31c-49cb-a1bb-6ab4c6011216"
          ],
          "display_name": false
        },
        {
          "uuid": "37c87b12-fed0-452f-b269-b64deabe3922",
          "name": "SOLAN [MI]",
          "stdName": "SOLAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a0b9b89-b480-4449-9249-debe90e28409",
            "090788f5-b31c-49cb-a1bb-6ab4c6011216"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ad8b0f6b-bdde-4bb5-91e4-2c14053f2e3f",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6a0b9b89-b480-4449-9249-debe90e28409",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e23315b-a023-4853-88f0-00bb0644dcd0",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3f6bf8e-e1b8-465c-9968-3e9c807d30a6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3a7c696-127f-44fa-a3a2-af4f4065768d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "090788f5-b31c-49cb-a1bb-6ab4c6011216",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b75f9934-d581-404e-a8e2-64522a96ea10",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4a167eb-7e5a-4684-a5bc-8f8083892d0a",
          "citation": "SRS import [5U5R396S8D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5U5R396S8D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c220aa0b-dbac-48e7-8a81-f8e01165fc3c",
          "citation": "PENTANOCHLOR [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5032f1e0-0b61-4977-80b0-cb9017d094b0",
          "citation": "SOLAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbe2ccdc-7d3a-998d-4807-76380d8fe388",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2307-68-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fed9eaae-79af-18b1-cd68-563db579083f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b295823f-92ac-44c7-9bff-1c543eca367b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e0ec4bd8-b96c-4d05-8085-b0b28584618f",
          "id": "e0ec4bd8-b96c-4d05-8085-b0b28584618f",
          "molfile": "\n  Marvin  01132111392D          \n\n 16 16  0  0  0  0            999 V2000\n    5.7293   -1.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0246   -1.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3027   -1.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5865   -1.2662    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8761   -1.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5865   -0.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3027    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -0.0172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -0.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -0.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7333   -0.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7333   -1.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -1.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -2.4980    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -1.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 16  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CCCC(C)C(=O)Nc1ccc(C)c(c1)Cl",
          "formula": "C13H18ClNO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6928c30c-e785-4a19-b24d-2cd9184de738"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "239.7415",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6bda134a-8409-4874-806e-a6b81c8a1c5b",
      "version": "4",
      "structure": {
        "id": "9e79e513-3657-4489-ac64-cb7f39f71761",
        "molfile": "\n  Marvin  01132108142D          \n\n 16 16  0  0  0  0            999 V2000\n    3.5865   -0.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -0.0172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -1.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -1.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -0.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3027    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7333   -1.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7333   -0.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5865   -1.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -2.4980    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4495   -0.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3027   -1.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -1.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0246   -1.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7293   -1.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  2  0  0  0  0\n  1  9  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 10  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "CCCC(C)C(=O)Nc1ccc(C)c(c1)Cl",
        "formula": "C13H18ClNO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "239.7415",
        "optical_activity": "( + / - )",
        "references": [
          "b4a167eb-7e5a-4684-a5bc-8f8083892d0a",
          "8e23315b-a023-4853-88f0-00bb0644dcd0"
        ],
        "stereo_centers": 1
      },
      "unii": "5U5R396S8D"
    }
  ]
}