{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f4ee2406-a6ee-4010-bb74-0f276762ab7d", "code": "87539-19-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=87539-19-3", "code_system": "CAS", "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ] }, { "uuid": "446b6338-206d-43ae-85a0-511d72871578", "code": "119146", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119146", "code_system": "PUBCHEM", "references": [ "ba1cabd5-a2fd-be93-71a7-a34d189424cf" ] }, { "uuid": "c8e998a4-e339-4933-b90f-c8b2ed506b0c", "code": "5U54JM2T8G", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "749d76de-80a8-17c4-90e4-a2b2d5ba37b0", "code": "N-Methylspiperone", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/N-Methylspiperone", "code_system": "WIKIPEDIA", "references": [ "c4b28563-4f7c-7385-ec70-9d878ffd91eb" ] }, { "uuid": "3de7af85-fff3-8f70-dec3-54c411fb9727", "code": "DTXSID70236379", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70236379", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "d7509fb3-ee89-4953-8795-21eee1b70d1e", "amount": { "uuid": "82b671ff-be3b-4a14-a663-ba290e2c7788" }, "type": "LABELED->NON-LABELED", "related_substance": { "uuid": "6a50032a-964e-4ece-9acc-90415021d9ce", "refuuid": "45deb297-4e98-4b19-a0c7-635d5fff05eb", "name": "MESPIPERONE C-11", "unii": "703G4LHV4V", "linking_id": "703G4LHV4V", "ref_pname": "MESPIPERONE C-11", "substance_class": "reference" } }, { "uuid": "38ab6cb6-eb9e-4d67-bfd4-e43d376bd8fb", "amount": { "uuid": "1f819482-d388-4a40-a721-8af96a996ff9" }, "type": "LABELED->NON-LABELED", "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ], "related_substance": { "uuid": "3c139ffa-cac0-4673-b9d5-35ac563c9fc0", "refuuid": "d7979dff-7db6-4613-9ee8-294c2081155c", "name": "MESPIPERONE F-18", "unii": "R08XJD5849", "linking_id": "R08XJD5849", "ref_pname": "MESPIPERONE F-18", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "861ef38e-b87b-194e-9f8a-b42ef79a0818", "name": "1,3,8-TRIAZASPIRO(4.5)DECAN-4-ONE, 8-(4-(4-FLUOROPHENYL)-4-OXOBUTYL)-3-METHYL-1-PHENYL-", "stdName": "1,3,8-TRIAZASPIRO(4.5)DECAN-4-ONE, 8-(4-(4-FLUOROPHENYL)-4-OXOBUTYL)-3-METHYL-1-PHENYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ], "display_name": false }, { "uuid": "64b44efe-d9ea-29b3-eef2-407f9f02d1a4", "name": "3-N-METHYLSPIPERONE", "stdName": "3-N-METHYLSPIPERONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ], "display_name": false }, { "uuid": "31c3ce9d-880f-cb14-4a37-a89e0e351dda", "name": "8-(4-(4-FLUOROPHENYL)-4-OXOBUTYL)-3-METHYL-1-PHENYL-1,3,8-TRIAZASPIRO(4.5)DECAN-4-ONE", "stdName": "8-(4-(4-FLUOROPHENYL)-4-OXOBUTYL)-3-METHYL-1-PHENYL-1,3,8-TRIAZASPIRO(4.5)DECAN-4-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ], "display_name": false }, { "uuid": "2420b466-16f0-ecdd-d6e4-f1f9e6857d85", "name": "MESPIPERONE", "stdName": "MESPIPERONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e4df0b73-5d58-590b-8a63-9ef118c8ea44" ], "display_name": true }, { "uuid": "4e20f760-457e-8bba-e23b-ddf046bfc638", "name": "N-METHYLSPIROPERIDOL", "stdName": "N-METHYLSPIROPERIDOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "805cd263-3c8e-ac8c-8228-d2cc820b383e" ], "display_name": false }, { "uuid": "965490f3-b3c0-4155-8d7e-1b0f9195c05d", "name": "NMSP", "stdName": "NMSP", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c4b28563-4f7c-7385-ec70-9d878ffd91eb" ], "display_name": false } ], "references": [ { "uuid": "805cd263-3c8e-ac8c-8228-d2cc820b383e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e4df0b73-5d58-590b-8a63-9ef118c8ea44", "citation": "FDA_SRS", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "66f5127f-513b-462b-9bb7-c858af1107c9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b4f6ef28-bfca-40b9-a08f-739985a4c1e0", "citation": "eurofinsdiscovery", "url": "https://www.eurofinsdiscoveryservices.com/catalogmanagement/viewItem/1405", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7ac7c2de-e480-4db8-a3b5-0f35612bbf5c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ba1cabd5-a2fd-be93-71a7-a34d189424cf", "citation": "PUBCHEM", "doc_type": "NLM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c4b28563-4f7c-7385-ec70-9d878ffd91eb", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4e59cbfe-ede1-a32a-3604-66ebc5e3a229", "id": "4e59cbfe-ede1-a32a-3604-66ebc5e3a229", "molfile": "\n Marvin 01132104052D \n\n 30 33 0 0 0 0 999 V2000\n 20.0310 -3.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1969 -3.6956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7727 -2.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9431 -3.1643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2720 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5588 -3.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8365 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8365 -1.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5403 -1.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2720 -1.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9431 -4.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9431 -4.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2160 -5.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4751 -4.8700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7900 -5.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0676 -4.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3685 -5.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6601 -4.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6601 -4.1290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9563 -5.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2200 -4.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5395 -5.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5395 -6.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8311 -6.6829 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2432 -6.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9563 -6.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4751 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1741 -3.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6561 -4.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8520 -5.1123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 29 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 11 1 0 0 0 0\n 6 5 1 0 0 0 0\n 10 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 28 11 1 0 0 0 0\n 29 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 27 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 26 20 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 30 29 2 0 0 0 0\nM END", "smiles": "CN1CN(c2ccccc2)C3(CCN(CCCC(=O)c4ccc(cc4)F)CC3)C1=O", "formula": "C24H28FN3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a6bbca68-4c8b-4f5c-9946-7df9cc0ca6f3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "409.4973", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "580522af-7e47-44b5-b9be-e00387f5bd05", "version": "10", "structure": { "id": "f76c91e9-80ef-700d-8683-93599298aad3", "molfile": "MESPIPERONE C-11\n Marvin 01132112492D \n\n 30 33 0 0 0 0 999 V2000\n 17.9431 -4.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9431 -3.1643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7727 -2.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1969 -3.6956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0310 -3.6956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6561 -4.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8520 -5.1123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2720 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5588 -3.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8365 -2.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8365 -1.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5403 -1.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2720 -1.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9431 -4.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2160 -5.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4751 -4.8700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7900 -5.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0676 -4.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3685 -5.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6601 -4.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9563 -5.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2200 -4.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5395 -5.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5395 -6.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2432 -6.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9563 -6.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8311 -6.6829 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6601 -4.1290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4751 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1741 -3.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 2 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 8 2 0 0 0 0\n 14 1 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 21 1 0 0 0 0\n 27 24 1 0 0 0 0\n 28 20 2 0 0 0 0\n 16 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 1 1 0 0 0 0\nM END", "smiles": "CN1CN(c2ccccc2)C3(CCN(CCCC(=O)c4ccc(cc4)F)CC3)C1=O", "formula": "C24H28FN3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "409.4973", "optical_activity": "NONE", "references": [ "e4df0b73-5d58-590b-8a63-9ef118c8ea44" ], "stereo_centers": 0 }, "unii": "5U54JM2T8G" } ] }