{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "badbe33f-9026-4bcb-89e9-6adb09044e35",
          "code": "333432-71-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=333432-71-6",
          "code_system": "CAS",
          "references": [
            "a1bc8aa0-0f5e-42b8-91c3-0cdba00dd738",
            "16e11317-295d-4def-9292-07290f73a727"
          ]
        },
        {
          "uuid": "5270be25-9833-46cd-95d6-ab3540b94083",
          "code": "785868",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/785868",
          "code_system": "PUBCHEM",
          "references": [
            "a1bc8aa0-0f5e-42b8-91c3-0cdba00dd738"
          ]
        },
        {
          "uuid": "2f0aba16-3137-9584-c7ff-e9893bb81697",
          "code": "DTXSID10186965",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10186965",
          "code_system": "EPA CompTox",
          "references": [
            "2964561a-8d53-a7dd-6fb0-9e88320f7edd"
          ]
        },
        {
          "uuid": "50a22066-8979-4dc8-af43-ab35ffea7243",
          "code": "5U05P81M8W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "464c147f-819f-4dfb-ac7b-2082f9813aed",
          "name": "BENZOIC ACID, 4-((1,3-BENZODIOXOL-5-YLCARBONYL)AMINO)-, ETHYL ESTER",
          "stdName": "BENZOIC ACID, 4-((1,3-BENZODIOXOL-5-YLCARBONYL)AMINO)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7def5689-1adb-4527-81f9-e85539ba1ef8",
            "82cf443a-5a29-44bc-9935-f94a94118c89"
          ],
          "display_name": false
        },
        {
          "uuid": "f7a9065d-c661-4de6-8c0a-37fa6ae2c10c",
          "name": "FORETIN AP-1",
          "stdName": "FORETIN AP-1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7def5689-1adb-4527-81f9-e85539ba1ef8",
            "04568302-23df-442a-9687-ca314357e84c"
          ],
          "display_name": false
        },
        {
          "uuid": "5cb6c8e1-a172-42e7-9ad6-cbdca3f020d3",
          "name": "METHYLENEDIOXYBENZOYL ETHYL PABA",
          "stdName": "METHYLENEDIOXYBENZOYL ETHYL PABA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7def5689-1adb-4527-81f9-e85539ba1ef8",
            "82cf443a-5a29-44bc-9935-f94a94118c89",
            "04568302-23df-442a-9687-ca314357e84c",
            "855e784b-1941-4692-b927-f8844deccc2e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8601462d-8809-4698-a58c-425078f96bf8",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "04568302-23df-442a-9687-ca314357e84c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7def5689-1adb-4527-81f9-e85539ba1ef8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82cf443a-5a29-44bc-9935-f94a94118c89",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1bc8aa0-0f5e-42b8-91c3-0cdba00dd738",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a76e781-ec18-4d52-8d0e-7a1774eaf5b0",
          "citation": "SRS import [5U05P81M8W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5U05P81M8W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "855e784b-1941-4692-b927-f8844deccc2e",
          "citation": "METHYLENEDIOXYBENZOYL ETHYL PABA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2964561a-8d53-a7dd-6fb0-9e88320f7edd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=333432-71-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "16e11317-295d-4def-9292-07290f73a727",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "61d7c903-f513-45de-b7f6-68f3230152f4",
          "id": "61d7c903-f513-45de-b7f6-68f3230152f4",
          "molfile": "\n  Marvin  01132105042D          \n\n 23 25  0  0  0  0            999 V2000\n    9.3070   -5.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0216   -4.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7360   -5.0198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4505   -4.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4507   -3.7826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1649   -5.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1646   -5.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8790   -6.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5936   -5.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3080   -6.2584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3077   -7.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0220   -7.4961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5931   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5928   -8.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8783   -8.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1639   -8.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3792   -8.5749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8945   -7.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3796   -7.2401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1642   -7.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8788   -7.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5938   -5.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8795   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 23  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 22  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 21  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 20 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)c1ccc(cc1)NC(=O)c2ccc3c(c2)OCO3",
          "formula": "C17H15NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31ca20cd-9e04-4a05-80f7-561f98f4a113"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "313.3053",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "35955b77-ea44-4e13-905e-e040bf403d38",
      "version": "4",
      "structure": {
        "id": "7189b11b-ce31-41c1-b424-891d9431aaec",
        "molfile": "\n  Marvin  01132105532D          \n\n 23 25  0  0  0  0            999 V2000\n   11.4505   -4.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1649   -5.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1646   -5.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8790   -6.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5936   -5.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5938   -5.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8795   -4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3080   -6.2584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3077   -7.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7360   -5.0198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0216   -4.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4507   -3.7826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3070   -5.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0220   -7.4961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5931   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5928   -8.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8783   -8.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1639   -8.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1642   -7.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8788   -7.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3796   -7.2401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3792   -8.5749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8945   -7.9074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n 12  1  2  0  0  0  0\n  8  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  1  1  0  0  0  0\n  2  1  1  0  0  0  0\n 11 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n  9 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 15 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 21  1  0  0  0  0\n 19 21  1  0  0  0  0\n 18 22  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)c1ccc(cc1)NC(=O)c2ccc3c(c2)OCO3",
        "formula": "C17H15NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "313.3053",
        "optical_activity": "NONE",
        "references": [
          "6a76e781-ec18-4d52-8d0e-7a1774eaf5b0",
          "82cf443a-5a29-44bc-9935-f94a94118c89"
        ],
        "stereo_centers": 0
      },
      "unii": "5U05P81M8W"
    }
  ]
}