{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4e7ddd4c-0c47-4400-90fa-951f51ba93a4",
          "code": "76-22-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76-22-2",
          "code_system": "CAS",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5",
            "31bbda60-31ab-4ee8-ab3d-94510ee609f6"
          ]
        },
        {
          "uuid": "a87d2476-f79e-471e-b9b6-3ff75feaad4c",
          "code": "C28136",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28136",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "78d0312a-6c29-46b1-be69-14dd36cdd847",
          "code": "1371994",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1371994/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "fc926e96-9f3f-4b9d-afb2-70660ad27e61",
          "code": "m3004",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3004?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "3f55cf85-1f14-405f-8ce2-107eba381f28",
          "code": "DB01744",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01744",
          "code_system": "DRUG BANK",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "982ad4a6-50aa-46ed-9b19-c6ecb3213b44",
          "code": "SUB11780MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "7dc21621-9ff6-4132-b8e2-9026b96847e1",
          "code": "CHEMBL504760",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL504760",
          "code_system": "ChEMBL",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "43bf7431-3165-40af-bb68-4d7a5c681f09",
          "code": "200-945-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.860",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5"
          ]
        },
        {
          "uuid": "5f25c249-b8b5-eed3-8327-760b89bb9efa",
          "code": "37",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/37",
          "code_system": "HSDB",
          "references": [
            "b67e35bd-8c30-8d95-79bd-e30af0741f98"
          ]
        },
        {
          "uuid": "60ef6713-a8e3-e6d5-ef0c-6bbf68932818",
          "code": "DTXSID5030955",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5030955",
          "code_system": "EPA CompTox",
          "references": [
            "28c405b3-79b6-d87a-1758-db8e5ff78400"
          ]
        },
        {
          "uuid": "d0a391d3-eb5d-45f0-8350-78edd7872af2",
          "code": "5TJD82A1ET",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a35f2057-a23b-96d6-6f26-978ac00c6c23",
          "code": "36773",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36773",
          "code_system": "CHEBI",
          "references": [
            "6a725412-175a-f70b-75bf-ff6f96e931f3"
          ]
        },
        {
          "uuid": "1566702b-dd76-3908-f9b7-a84882d32811",
          "code": "5TJD82A1ET",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5TJD82A1ET",
          "code_system": "DAILYMED",
          "references": [
            "1e5a5d76-2334-36f7-82e5-bd8f23676012"
          ]
        },
        {
          "uuid": "8c2d6bb4-44f1-68d7-7541-027a25fcd14a",
          "code": "2172",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2172/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "9b49ab13-a30e-abbc-e28b-d4f9b6006a3b"
          ]
        },
        {
          "uuid": "4cc6e146-7a95-92cd-6686-60abf73678ca",
          "code": "100000090737",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cbbf547e-61fb-706a-fd46-da1da78e8ceb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "311c310e-b1c5-4a60-97da-9ab2c7abc13a",
          "amount": {
            "uuid": "b72fb9ed-c81b-4c27-8c8c-b056b93627b5"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "af638397-ef8c-4987-bfae-2ff5e2f61a8c",
            "refuuid": "c4891d18-b4de-4ba3-a844-7c296e6feb02",
            "name": "CAMPHOR (SYNTHETIC)",
            "unii": "5TJD82A1ET",
            "linking_id": "5TJD82A1ET",
            "ref_pname": "CAMPHOR (SYNTHETIC)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "524210e5-fe9a-42a3-b5f0-690e4c6bb68b",
          "amount": {
            "uuid": "3c01fc31-b341-47b8-ad97-a3048c81c972",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.02
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "5dd07d77-1d1e-40f6-ab0e-f449e4cafa58"
          ],
          "related_substance": {
            "uuid": "4e179495-f4ca-425e-b462-7aac1d83da77",
            "refuuid": "81421ca5-8a51-48fe-b932-59ab97e67ca5",
            "name": "ENZACAMENE",
            "unii": "8I3XWY40L9",
            "linking_id": "8I3XWY40L9",
            "ref_pname": "ENZACAMENE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2fd1e36e-7fc6-4fb9-98c8-e57e1aee3ea5",
          "name": "(1RS,4RS)-1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "stdName": "(1RS,4RS)-1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c084511-ab1a-40e3-946a-890f7333081d",
            "85870c7c-b7e1-4cbb-9d39-d4b1830c21b2"
          ],
          "display_name": false
        },
        {
          "uuid": "18981668-8830-4d6a-a778-c07e09633b85",
          "name": "(±)-CAMPHOR",
          "stdName": "(+/-)-CAMPHOR",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b14cfa1f-ac57-43af-a262-cb06a946c91d",
            "eb7d11d2-c7d8-4bf5-8385-d92536fabb08"
          ],
          "display_name": false
        },
        {
          "uuid": "2652a7d4-272c-48ad-a227-f5c7b8a82759",
          "name": "1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "stdName": "1,7,7-TRIMETHYLBICYCLO(2.2.1)HEPTAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85870c7c-b7e1-4cbb-9d39-d4b1830c21b2",
            "5b9f98e9-9cc3-4eb6-8deb-baa6bee59555"
          ],
          "display_name": false
        },
        {
          "uuid": "02cda1ca-2b17-467a-ac9f-ceb1b164f917",
          "name": "2-BORNANONE",
          "stdName": "2-BORNANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11c41f7c-c413-4a45-845d-e21ce348b1fd"
          ],
          "display_name": false
        },
        {
          "uuid": "b5ab03de-6803-486a-a7fe-565484d14460",
          "name": "2-CAMPHANONE",
          "stdName": "2-CAMPHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b14cfa1f-ac57-43af-a262-cb06a946c91d",
            "eb7d11d2-c7d8-4bf5-8385-d92536fabb08"
          ],
          "display_name": false
        },
        {
          "uuid": "3a34d904-c375-47eb-b622-ae7210e757e5",
          "name": "BICYCLO(2.2.1)HEPTANE-2-ONE, 1,7,7-TRIMETHYL-",
          "stdName": "BICYCLO(2.2.1)HEPTANE-2-ONE, 1,7,7-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11c41f7c-c413-4a45-845d-e21ce348b1fd"
          ],
          "display_name": false
        },
        {
          "uuid": "85a073bc-6118-4197-bb81-fc07bcfa6eb9",
          "name": "CAMPHOR (SYNTHETIC)",
          "stdName": "CAMPHOR (SYNTHETIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52497ec8-09d4-4c0a-9a72-bef635f6e0e2",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": true
        },
        {
          "uuid": "cdd97bbc-2cf0-426e-b25e-a172dff8f318",
          "name": "CAMPHOR [HSDB]",
          "stdName": "CAMPHOR [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec158bf7-5252-4f89-bc79-555fa30207f0",
            "135bfa89-579e-4581-977e-5aecd2008ea9"
          ],
          "display_name": false
        },
        {
          "uuid": "cb6819ed-ed46-46a5-93de-d8c292a1d690",
          "name": "CAMPHOR [MI]",
          "stdName": "CAMPHOR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94c04ce6-a338-434d-b5a9-ebbe4e74ce85",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": false
        },
        {
          "uuid": "1a71f5e0-288a-4818-ac85-394d4e374e7a",
          "name": "CAMPHOR, (±)-",
          "stdName": "CAMPHOR, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52497ec8-09d4-4c0a-9a72-bef635f6e0e2",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": false
        },
        {
          "uuid": "01f45785-3fe7-4dc8-9a3e-7e9ef9fd3e02",
          "name": "CAMPHOR, DL-",
          "stdName": "CAMPHOR, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52497ec8-09d4-4c0a-9a72-bef635f6e0e2",
            "db8496bb-c814-4f35-bd1f-65ac2eb7c867"
          ],
          "display_name": false
        },
        {
          "uuid": "1856d94d-1cd3-455c-b75d-3938e103ae19",
          "name": "CAMPHOR, RACEMIC",
          "stdName": "CAMPHOR, RACEMIC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9f3b83c-efe7-4ef8-9fee-c7bae222df61",
            "52497ec8-09d4-4c0a-9a72-bef635f6e0e2",
            "99f35b56-9125-4383-a9d3-378887509b83",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": false
        },
        {
          "uuid": "8adc4640-7e16-b9ce-bcba-b84605fc2549",
          "name": "CAMPHOR, RACEMIC [EP MONOGRAPH]",
          "stdName": "CAMPHOR, RACEMIC [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b410fb2-6b66-6674-5f63-a88a422a4817"
          ],
          "display_name": false
        },
        {
          "uuid": "c579e4a0-df59-ef78-df4a-057548f519d2",
          "name": "Camphor [WHO-DD]",
          "stdName": "CAMPHOR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e884a5c-87b2-f6a3-65dd-b94b79588a14"
          ],
          "display_name": false
        },
        {
          "uuid": "0f345a92-1b74-4b1e-b8fc-5b1fb3d29b11",
          "name": "DL-CAMPHOR",
          "stdName": "DL-CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b14cfa1f-ac57-43af-a262-cb06a946c91d",
            "eb7d11d2-c7d8-4bf5-8385-d92536fabb08"
          ],
          "display_name": false
        },
        {
          "uuid": "c4876799-aed5-4e9a-919a-1cd1d5827e8e",
          "name": "DL-CAMPHOR [JAN]",
          "stdName": "DL-CAMPHOR [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a034f8f8-9b96-b5cf-6472-fd2556f0c429"
          ],
          "display_name": false
        },
        {
          "uuid": "2d699722-b4d0-40d2-bd2f-d2354dcae34f",
          "name": "FEMA NO. 4513",
          "stdName": "FEMA NO. 4513",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec158bf7-5252-4f89-bc79-555fa30207f0",
            "ace3c7fa-671e-4c2e-8021-08bac8b0f489"
          ],
          "display_name": false
        },
        {
          "uuid": "6d3517e9-98a3-4ab5-9acd-cfdbe6d1e9ce",
          "name": "GUM CAMPHOR",
          "stdName": "GUM CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fc42f27-3da2-4720-bb98-68acfd749914",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": false
        },
        {
          "uuid": "c64fe367-517b-4c7a-9bef-5cdd5987d8a9",
          "name": "SYNTHETIC CAMPHOR",
          "stdName": "SYNTHETIC CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8bb9f8ff-40c5-46ba-adbd-4a7b02ce2079",
            "ec158bf7-5252-4f89-bc79-555fa30207f0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "52497ec8-09d4-4c0a-9a72-bef635f6e0e2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "db8496bb-c814-4f35-bd1f-65ac2eb7c867",
          "citation": "DL",
          "doc_type": "SAX DANGEROUS PROPERTIES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11c41f7c-c413-4a45-845d-e21ce348b1fd",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b14cfa1f-ac57-43af-a262-cb06a946c91d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb7d11d2-c7d8-4bf5-8385-d92536fabb08",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fc42f27-3da2-4720-bb98-68acfd749914",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec158bf7-5252-4f89-bc79-555fa30207f0",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bb9f8ff-40c5-46ba-adbd-4a7b02ce2079",
          "citation": "USP 32",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85870c7c-b7e1-4cbb-9d39-d4b1830c21b2",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c084511-ab1a-40e3-946a-890f7333081d",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b9f98e9-9cc3-4eb6-8deb-baa6bee59555",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ace3c7fa-671e-4c2e-8021-08bac8b0f489",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9f3b83c-efe7-4ef8-9fee-c7bae222df61",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94c04ce6-a338-434d-b5a9-ebbe4e74ce85",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4be0b946-df60-4e13-82d4-0eb062dc3ee8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "135bfa89-579e-4581-977e-5aecd2008ea9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fa89040-0986-4ab6-8202-384346efa0a5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0de9caa5-aa48-4c6d-83ee-dc7ae1100dd5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e96cde59-d917-4c95-b8c2-36121162098d",
          "citation": "SRS import [5TJD82A1ET]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5TJD82A1ET",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9587a81d-4b55-4b3d-8f6b-9bb21594e50a",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99f35b56-9125-4383-a9d3-378887509b83",
          "citation": "CAMPHOR, RACEMIC [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b67e35bd-8c30-8d95-79bd-e30af0741f98",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+76-22-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a034f8f8-9b96-b5cf-6472-fd2556f0c429",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "28c405b3-79b6-d87a-1758-db8e5ff78400",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76-22-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7bfa1a85-4e42-c4bf-72be-c7daa4a0663f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5dd07d77-1d1e-40f6-ab0e-f449e4cafa58",
          "citation": "USP43-NF38 - 1639, Enzacamene Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31bbda60-31ab-4ee8-ab3d-94510ee609f6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1b410fb2-6b66-6674-5f63-a88a422a4817",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "6a725412-175a-f70b-75bf-ff6f96e931f3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1e5a5d76-2334-36f7-82e5-bd8f23676012",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6e884a5c-87b2-f6a3-65dd-b94b79588a14",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9b49ab13-a30e-abbc-e28b-d4f9b6006a3b",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "7ac40bf2-3d2b-880d-acba-e712fb6c9302",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "cbbf547e-61fb-706a-fd46-da1da78e8ceb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "32b6a52b-002b-489f-a20e-9d02e2c259f0",
          "id": "32b6a52b-002b-489f-a20e-9d02e2c259f0",
          "molfile": "\n  Marvin  01132102432D          \n\n 11 12  0  0  0  0            999 V2000\n   14.1774  -13.3434    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.8882  -12.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8882  -12.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1774  -11.6960    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.1774  -10.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4714  -12.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7418  -11.6960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4714  -12.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5587  -12.4868    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.3542  -12.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3542  -12.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  8  1  0  0  0  0\n  1  9  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2",
          "formula": "C10H16O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fca57a80-3402-4d8d-8608-0ff5c7fe6701"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "152.2338",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4891d18-b4de-4ba3-a844-7c296e6feb02",
      "version": "21",
      "structure": {
        "id": "99e3747b-bd13-4cb7-aec6-8ab4e0b10800",
        "molfile": "\n  Marvin  01132108002D          \n\n 11 12  0  0  0  0            999 V2000\n   14.1774  -11.6960    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.5587  -12.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4714  -12.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1774  -13.3434    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.4714  -12.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8882  -12.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8882  -12.9340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7418  -11.6960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1774  -10.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3542  -12.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3542  -12.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  2  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2",
        "formula": "C10H16O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "152.2338",
        "optical_activity": "( + / - )",
        "references": [
          "9587a81d-4b55-4b3d-8f6b-9bb21594e50a",
          "e96cde59-d917-4c95-b8c2-36121162098d"
        ],
        "stereo_centers": 2
      },
      "unii": "5TJD82A1ET"
    }
  ]
}