{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40c6abe3-58bb-475f-af2a-434a9b82812f",
          "code": "943632-91-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=943632-91-5",
          "code_system": "CAS",
          "references": [
            "7c4345f6-7a2d-4200-bd75-e41fd66ef401",
            "ca6fd15c-3212-4c00-a6a6-2e028afe4984"
          ]
        },
        {
          "uuid": "547e85cf-2ddc-46ea-9d26-54c67a90e8c2",
          "code": "16737097",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16737097",
          "code_system": "PUBCHEM",
          "references": [
            "7c4345f6-7a2d-4200-bd75-e41fd66ef401"
          ]
        },
        {
          "uuid": "d0b9645f-58ff-4698-95fa-0ef2b4866096",
          "code": "5SUP568U6Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b30cf302-7fec-4139-bc2e-bfd02810aab9",
          "name": "(±)-CYATHUSAL B",
          "stdName": "(+/-)-CYATHUSAL B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4edc5a34-3cc8-4d9d-90a7-a437852bb4d4",
            "7bde4d15-9661-4b11-b405-2de986872206"
          ],
          "display_name": false
        },
        {
          "uuid": "79ad4ea7-3d52-4fca-a1a4-51569a669a99",
          "name": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 6,9,10-TRIHYDROXY-8-METHOXY-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "stdName": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 6,9,10-TRIHYDROXY-8-METHOXY-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bde4d15-9661-4b11-b405-2de986872206",
            "77ef50fa-e7a2-4436-995e-c373daa552cf"
          ],
          "display_name": false
        },
        {
          "uuid": "d053bdcd-195b-4785-b657-3799b94fb03c",
          "name": "CYATHUSAL B",
          "stdName": "CYATHUSAL B",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bde4d15-9661-4b11-b405-2de986872206",
            "e386836e-00c2-4a0d-99ba-76c082da8d1d",
            "77ef50fa-e7a2-4436-995e-c373daa552cf"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ef3c1a0b-f717-426d-bf18-0056094c2c55",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ceea1e87-a34c-492a-a46a-762034c6272e",
          "name": "CYATHUSAL B, (±)-",
          "stdName": "CYATHUSAL B, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4edc5a34-3cc8-4d9d-90a7-a437852bb4d4",
            "7bde4d15-9661-4b11-b405-2de986872206"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "77ef50fa-e7a2-4436-995e-c373daa552cf",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7bde4d15-9661-4b11-b405-2de986872206",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4edc5a34-3cc8-4d9d-90a7-a437852bb4d4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c4345f6-7a2d-4200-bd75-e41fd66ef401",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbf89732-e0f4-443b-9e46-e0d76fdf6471",
          "citation": "SRS import [5SUP568U6Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5SUP568U6Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db8aad77-58a5-4f26-9cf3-8253608f0336",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e386836e-00c2-4a0d-99ba-76c082da8d1d",
          "citation": "CYATHUSAL B [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca6fd15c-3212-4c00-a6a6-2e028afe4984",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0916cfd0-ee2e-4c5d-9305-6ef350c01cc4",
          "id": "0916cfd0-ee2e-4c5d-9305-6ef350c01cc4",
          "molfile": "\n  Marvin  01132100442D          \n\n 25 27  0  0  0  0            999 V2000\n    4.2385   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9532   -6.5594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9532   -4.9103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -4.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7841   -6.5594    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7841   -7.3840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4988   -6.1471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4988   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2134   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2134   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9280   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6426   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3572   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4988   -3.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -3.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -6.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -7.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -7.7963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 23  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n 22  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 23  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
          "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(O)O2)c(=O)o1",
          "formula": "C17H14O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2b554746-fa83-49fd-a727-fcb0a0dcb6c3"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "346.2889",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "538d8b9d-a9b9-4f1c-a038-3697f5cb3669",
      "version": "3",
      "structure": {
        "id": "328439f0-34a2-4ed8-b46f-4fc81fc39b2d",
        "molfile": "\n  Marvin  01132102422D          \n\n 25 27  0  0  0  0            999 V2000\n    8.4988   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7841   -6.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4988   -6.1471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7841   -7.3840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -6.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -5.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -4.0857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9532   -4.9103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9532   -6.5594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2385   -6.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3824   -7.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6678   -7.7963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8116   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4988   -3.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2134   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2134   -4.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9280   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6426   -4.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3572   -3.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -3.6735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  3 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n  1 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 18 25  2  0  0  0  0\nM  END",
        "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(O)O2)c(=O)o1",
        "formula": "C17H14O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "346.2889",
        "optical_activity": "( + / - )",
        "references": [
          "bbf89732-e0f4-443b-9e46-e0d76fdf6471",
          "db8aad77-58a5-4f26-9cf3-8253608f0336"
        ],
        "stereo_centers": 1
      },
      "unii": "5SUP568U6Z"
    }
  ]
}