{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "783f26c1-4cf6-4d9b-962b-29c11508e612", "code": "J01DB01", "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER BETA-LACTAM ANTIBACTERIALS|First-generation cephalosporins|cefalexin", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=J01DB01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "7e4da93a-abcb-49dd-abf1-f8f9994ee547", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Hydrocarbons [Chemical/Ingredient]|Hydrocarbons, Cyclic [Chemical/Ingredient]|Bridged Compounds [Chemical/Ingredient]|Bicyclo Compounds [Chemical/Ingredient]|Bicyclo Compounds, Heterocyclic [Chemical/Ingredient]|Azabicyclo Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "9dc445e3-a3c8-4e53-8724-20528f2bd0dd", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "4389910a-fb5b-46dc-8931-7e934173e65c", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazines [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "b4ecb0c6-e157-4c30-8fb2-d563aad9435c", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Amides [Chemical/Ingredient]|Lactams [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "ce078a03-0adc-49b1-a3f6-d7b662633b2e", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Aza Compounds [Chemical/Ingredient]|Azabicyclo Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "0850c7b0-1412-4378-894c-dca7747c6cd0", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 1-Ring [Chemical/Ingredient]|Lactams [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "d08e5b67-5e45-454d-b0c1-1b9cc05a440c", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 1-Ring [Chemical/Ingredient]|Thiazines [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "b1bed4bf-efff-4526-ade1-d130e055dcf1", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, Bridged-Ring [Chemical/Ingredient]|Bicyclo Compounds, Heterocyclic [Chemical/Ingredient]|Azabicyclo Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "959d7aef-1281-4fa3-9d2b-fa4cd618b50a", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "bfe3662d-c737-4e6f-8b39-7b25acb9b4d3", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazines [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "ee193538-46e3-47df-b47e-55616365c027", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Polycyclic Compounds [Chemical/Ingredient]|Bridged Compounds [Chemical/Ingredient]|Bicyclo Compounds [Chemical/Ingredient]|Bicyclo Compounds, Heterocyclic [Chemical/Ingredient]|Azabicyclo Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "66266388-bbb3-4b25-847f-4ad9e7efb2bc", "code": "N0000011161", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Bicyclo Compounds, Heterocyclic [Chemical/Ingredient]|Azabicyclo Compounds [Chemical/Ingredient]|beta-Lactams [Chemical/Ingredient]|Cephalosporins [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000011161", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "e8a601e4-7650-477d-a5bb-a7ae654175a0", "code": "N0000175488", "comments": "Established Pharmacologic Class [EPC]|Cephalosporin Antibacterial [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175488", "code_system": "NDF-RT", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "c3a70204-e4a8-438e-bd2b-4d681e3d8827", "code": "QJ51DB01", "comments": "VATC|ANTIBACTERIALS FOR INTRAMAMMARY USE|OTHER BETA-LACTAM ANTIBACTERIALS FOR INTRAMAMMARY USE|First-generation cephalosporins|cefalexin", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ51DB01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "694abf0f-0d04-4a86-9ae1-084bf9fcfddf", "code": "QJ51RD01", "comments": "VATC|ANTIBACTERIALS FOR INTRAMAMMARY USE|COMBINATION OF ANTIBACTERIALS FOR INTRAMAMMARY USE|Other beta-lactam antibacterials, combinations with other antibacterials|cefalexin, combinations with other antibacterials", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ51RD01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "ddeadfd6-fe00-4c11-a2da-42b1f872a6ac", "code": "QJ01DB01", "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER BETA-LACTAM ANTIBACTERIALS|First-generation cephalosporins|cefalexin", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01DB01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "beef24f8-0f0a-4e3a-8e44-609e9e0061d7", "code": "15686-71-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=15686-71-2", "code_system": "CAS", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8", "be90d3df-0178-4f2c-a301-3db8a7c6c097" ] }, { "uuid": "4bcf2030-b7c2-4533-9701-94c14750e851", "code": "C76180", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76180", "code_system": "NCI_THESAURUS", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "f662b1f9-ef7e-487d-91f8-34edbb405743", "code": "6.2.1", "comments": "WHO ESSENTIAL MEDICINES LIST|Anti-infective medicines|Antibacterials|Beta Lactam medicines", "type": "PRIMARY", "url": "http://prais.paho.org/medicine/69/?section=49#type194", "code_system": "WHO-ESSENTIAL MEDICINES LIST", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "3fd58898-b9ba-45e9-87ac-eb308d1bc602", "code": "CEFALEXIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Cefalexin", "code_system": "WIKIPEDIA", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "1950e611-7fb9-42e8-86c7-3707b9224f49", "code": "SUB06165MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "6d3b2c45-bdd0-47a3-a0af-6e64364aac49", "code": "2400", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2400", "code_system": "INN", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "5a3ecd2c-a601-4ca2-aa39-d71e77d3ef90", "code": "1299782", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1299782/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "c709fe5f-bb79-472c-beb2-24894d51a87b", "code": "m3244", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3244?q=authorize", "code_system": "MERCK INDEX", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "b4961929-4d83-4430-a177-a740af5f1dcc", "code": "DB00567", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00567", "code_system": "DRUG BANK", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "8b477165-af12-4c08-8b98-8df46423b09d", "code": "CHEMBL1727", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1727", "code_system": "ChEMBL", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "6e83bde5-ab83-4987-80f5-b0aebfcd914e", "code": "239-773-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.142", "code_system": "ECHA (EC/EINECS)", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "0045ff9b-05c2-4904-9097-4852ad57057e", "code": "27447", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27447", "code_system": "PUBCHEM", "references": [ "336bc930-9413-4bec-ab38-de2fe34c62e8" ] }, { "uuid": "8cf14ad7-8870-006d-f22c-086a2e371a16", "code": "3022", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3022", "code_system": "HSDB", "references": [ "4a2ad9c3-3592-9f1a-74fe-b5947056d901" ] }, { "uuid": "4b4664f0-486a-70a4-c186-7d97a246565e", "code": "DTXSID9022780", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022780", "code_system": "EPA CompTox", "references": [ "afb07c3a-9357-c58f-b5e5-ed9fd9dcb8d9" ] }, { "uuid": "904ee4a2-9dad-cb67-d8f8-277f8bdbc855", "code": "C357", "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Beta-Lactam Antibiotic[C260]|Cephalosporin Antibiotic", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C357", "code_system": "NCI_THESAURUS", "references": [ "61b67737-4d01-e262-8bae-21abae7480d1" ] }, { "uuid": "4e707419-89f6-4c99-8d2f-5e27a22bbfb3", "code": "5SFF1W6677", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "751d0a59-5959-f38e-4069-3769ac075138", "code": "571", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/571", "code_system": "DRUG CENTRAL", "references": [ "61b67737-4d01-e262-8bae-21abae7480d1" ] }, { "uuid": "5fe9df80-1185-48f6-a0c3-c1f6419e9c36", "code": "3534", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3534", "code_system": "CHEBI", "references": [ "61b67737-4d01-e262-8bae-21abae7480d1" ] }, { "uuid": "4d919508-401b-7287-1e23-e8c8884205cf", "code": "100000091359", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "9912a359-54c4-5ac5-3d98-3c87a1c04c10" ] }, { "uuid": "13259309-d179-1ab0-7d38-a92951100f94", "code": "5SFF1W6677", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5SFF1W6677", "code_system": "DAILYMED", "references": [ "b6c6bae2-5676-27d9-2ea3-c7f2f76c246b" ] }, { "uuid": "b4087c08-69de-4d64-ae1b-2f6dd24595fb", "code": "NBK548666", "comments": "LiverTox|Antimicrobial|Antibacterial|Cephalosporins|1st generation", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548666/", "code_system": "LIVERTOX" }, { "uuid": "1670a303-05fc-e2ac-a343-0fa263314213", "code": "758162", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758162", "code_system": "NSC", "references": [ "9113656d-9e8a-cadc-9901-4f4c80548976" ] } ], "relationships": [ { "uuid": "f0d9df9b-fa90-4078-8683-4fb037837dbb", "amount": { "uuid": "5f50e11f-3f91-4bfd-878b-3c9f7338854c" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "090383ae-5a44-4e14-a369-db4490aac8d4", "refuuid": "a2f6a28f-d145-43e3-a637-cdc5303a0c5c", "name": "CEPHALEXIN ANHYDROUS", "unii": "5SFF1W6677", "linking_id": "5SFF1W6677", "ref_pname": "CEPHALEXIN ANHYDROUS", "substance_class": "reference" } }, { "uuid": "20adbb04-5014-4ce1-8ee4-7d8dc4bab8a4", "amount": { "uuid": "363beefe-8526-48d4-8d10-ba5eedaef725" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "fe0f715b-a194-4c25-8273-2e58d185b82e", "refuuid": "4e1227d6-1222-4b32-b97f-7be6b82aaeb8", "name": "CEPHALEXIN", "unii": "OBN7UDS42Y", "linking_id": "OBN7UDS42Y", "ref_pname": "CEPHALEXIN", "substance_class": "reference" } }, { "uuid": "61886961-c0ea-4683-bf05-71ffd0c6e26f", "amount": { "uuid": "c7a66baf-3f81-4bac-beed-5f1c3d1b7d39" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "ef9cbbb8-5f95-4a7a-aadb-5ce68875f3af", "refuuid": "7910f815-b192-42b2-b0e0-72e160b1a1b9", "name": "CEPHALEXIN DI-DIMETHYLFORMAMIDE", "unii": "MT4YEC9GUQ", "linking_id": "MT4YEC9GUQ", "ref_pname": "CEPHALEXIN DI-DIMETHYLFORMAMIDE", "substance_class": "reference" } }, { "uuid": "7dd91e8e-fa1a-49bd-b76e-4f74e585daae", "amount": { "uuid": "3640c2f7-fa08-489f-9df1-689f2398f627" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "a4df3afd-dc02-4dc6-bcf8-a7451bbd17e8", "refuuid": "71c6e107-28eb-4805-85ad-7a218733327f", "name": "CEPHALEXIN HYDROCHLORIDE", "unii": "6VJE5G3D98", "linking_id": "6VJE5G3D98", "ref_pname": "CEPHALEXIN HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "26677f94-d242-4dae-a9ed-229106e86d9c", "amount": { "uuid": "52a3bd70-c656-4a2d-9fe7-d335c5852802" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "9bd0880a-4edb-441f-8942-2db498b7196a", "refuuid": "68aafa39-616a-4546-9070-296a26e12f0b", "name": "CEPHALEXIN SODIUM", "unii": "F78YJG0WXK", "linking_id": "F78YJG0WXK", "ref_pname": "CEPHALEXIN SODIUM", "substance_class": "reference" } }, { "uuid": "a38c3a7b-9f73-4e41-83d4-86200c8fbc98", "type": "PARENT->IMPURITY", "references": [ "b3b361b8-f525-49d4-8543-6e13ced4f027" ], "related_substance": { "uuid": "7a516535-b7ce-4a4e-9227-1e6bcb0be6a5", "refuuid": "4e1227d6-1222-4b32-b97f-7be6b82aaeb8", "name": "CEPHALEXIN", "unii": "OBN7UDS42Y", "linking_id": "OBN7UDS42Y", "ref_pname": "CEPHALEXIN", "substance_class": "reference" } }, { "uuid": "8331df72-6f29-4a25-8fa8-59abe78aaab8", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "ab4a2ec9-7e1f-46cd-a71b-5424e259740d", "refuuid": "b279cd50-ef4d-40c9-bf41-ba4a27ad74e5", "name": "CEFALEXIN LYSINE", "unii": "Q3LVH22497", "linking_id": "Q3LVH22497", "ref_pname": "CEFALEXIN LYSINE", "substance_class": "reference" } }, { "uuid": "3d5141bf-4469-4b43-ae7c-907409b9cc68", "amount": { "uuid": "0c67433e-9319-4ef5-ad49-c01de9ff201a" }, "type": "PRODRUG->METABOLITE ACTIVE", "references": [ "09456ce7-2477-44f6-ac6e-01e806b272fc", "4d50ef72-c73f-4c09-b893-7bd2b7f8806f" ], "related_substance": { "uuid": "09e54f65-3843-4c2b-938d-57bd5034241f", "refuuid": "2c71d549-985c-4119-893e-83b62c260a95", "name": "PIVCEFALEXIN", "unii": "U6N5QZ6580", "linking_id": "U6N5QZ6580", "ref_pname": "PIVCEFALEXIN" } }, { "uuid": "8f4692c5-a266-4c0c-97f3-703390736760", "type": "SOLVATE->ANHYDROUS", "references": [ "94cb0796-cfc8-495d-9c3b-a1d7215efc26" ], "related_substance": { "uuid": "43b439fc-a2fc-4a78-b76d-dce3b49ed303", "refuuid": "7910f815-b192-42b2-b0e0-72e160b1a1b9", "name": "CEPHALEXIN DI-DIMETHYLFORMAMIDE", "unii": "MT4YEC9GUQ", "linking_id": "MT4YEC9GUQ", "ref_pname": "CEPHALEXIN DI-DIMETHYLFORMAMIDE", "substance_class": "reference" } }, { "uuid": "19ada48a-f38f-7fb9-84f0-f43efc92f1a1", "amount": { "uuid": "25941287-876c-4a30-bc8d-e9e5d5a90044" }, "type": "SOLVATE->ANHYDROUS", "references": [ "f1320826-9af3-4cb6-99af-d998a2ea4075" ], "related_substance": { "uuid": "2d26a0f9-b087-4d2b-996a-e798941a555e", "refuuid": "4e1227d6-1222-4b32-b97f-7be6b82aaeb8", "name": "CEPHALEXIN", "unii": "OBN7UDS42Y", "linking_id": "OBN7UDS42Y", "ref_pname": "CEPHALEXIN" } }, { "uuid": "40b5a211-3d1f-4c55-ac95-bd73ba50b9d4", "amount": { "uuid": "8d1098f2-18e8-4f78-b65a-3805f2ce7b0e" }, "type": "PARENT->IMPURITY", "references": [ "df0e14c3-68ce-461c-901b-392487a28724" ], "related_substance": { "uuid": "cfcc43d3-c1f6-42f7-a9ab-9a439c77915c", "refuuid": "4e1227d6-1222-4b32-b97f-7be6b82aaeb8", "name": "CEPHALEXIN", "unii": "OBN7UDS42Y", "linking_id": "OBN7UDS42Y", "ref_pname": "CEPHALEXIN", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "433797d8-5661-4922-aa11-e0615b3eb3f5", "name": "(6R,7R)-7-((R)-2-AMINO-2-PHENYLACETAMIDO)-3-METHYL-8-OXO-5-THIA-1-AZABICYCLO(4.2.0)OCT-2-ENE-2-CARBOXYLIC ACID", "stdName": "(6R,7R)-7-((R)-2-AMINO-2-PHENYLACETAMIDO)-3-METHYL-8-OXO-5-THIA-1-AZABICYCLO(4.2.0)OCT-2-ENE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "54fe1556-31ed-426e-b514-499d31ea8f4b" ], "display_name": false }, { "uuid": "1ed5d53d-180d-46cd-bfbe-83ddd213d921", "name": "5-THIA-1-AZABICYCLO(4.2.0)OCT-2-ENE-2-CARBOXYLIC ACID, 7-((AMINOPHENYLACETYL)AMINO)-3-METHYL-8-OXO-,(6R-(6.ALPHA.,7.BETA.(R*)))-", "stdName": "5-THIA-1-AZABICYCLO(4.2.0)OCT-2-ENE-2-CARBOXYLIC ACID, 7-((AMINOPHENYLACETYL)AMINO)-3-METHYL-8-OXO-,(6R-(6.ALPHA.,7.BETA.(R*)))-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54fe1556-31ed-426e-b514-499d31ea8f4b" ], "display_name": false }, { "uuid": "aa91075e-dc4b-4eee-8db0-b5505e6989af", "name": "7-(D-.ALPHA.-AMINO-.ALPHA.-PHENYLACETAMIDO)-3-METHYL-3-CEPHEM-4-CARBOXYLIC ACID", "stdName": "7-(D-.ALPHA.-AMINO-.ALPHA.-PHENYLACETAMIDO)-3-METHYL-3-CEPHEM-4-CARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54fe1556-31ed-426e-b514-499d31ea8f4b" ], "display_name": false }, { "uuid": "cbcd2896-1577-4a12-8582-5ae38a4d0bab", "name": "ALSPORIN", "stdName": "ALSPORIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "c245f366-68b6-4137-b7c1-e586a9e93eae", "name": "ANHYDROUS CEPHALEXIN", "stdName": "ANHYDROUS CEPHALEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12f6ef64-e71e-4dc4-bf07-c43397bf4b76", "3ceb0042-d1b0-4e9c-9e0b-c9bcc7054115" ], "display_name": false }, { "uuid": "e1a0defc-7681-46b7-b016-7eadbda047c7", "name": "CARNOSPORIN", "stdName": "CARNOSPORIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "d8bb29a7-7697-4c3e-a7d8-8d8ca9de51f4", "name": "CEFADROS", "stdName": "CEFADROS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "ad68791a-a31e-4eea-a361-7b5a2a3d7c74", "name": "CEFALEKSIN", "stdName": "CEFALEKSIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "62fb159e-0e67-48f8-95fc-2411156ce7fc", "name": "CEFALEXIN", "stdName": "CEFALEXIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "de9dfbf3-f823-463d-8bda-2c4d49d5d4ec", "b59de649-2933-4a32-8188-c0fcf94a995d", "a77c6ed6-f45c-43ee-9682-cf3c6533869d", "9aa6cb50-3f4b-44b5-91de-c860ecb7897c", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false, "domains": [ "drug" ], "name_orgs": [ { "uuid": "0c32016f-d861-4539-b691-e34d979f5e9d", "name_org": "INN" } ] }, { "uuid": "4892c491-e742-4001-8e9a-5f968b78fb21", "name": "CEFALEXIN ANHYDROUS", "stdName": "CEFALEXIN ANHYDROUS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "de9dfbf3-f823-463d-8bda-2c4d49d5d4ec" ], "display_name": false }, { "uuid": "e31a68f1-c658-426f-b39a-ce2c48285514", "name": "CEFALEXIN [JAN]", "stdName": "CEFALEXIN [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4becbab3-9b23-c6e7-f08a-167778a61562" ], "display_name": false }, { "uuid": "99616b0a-c278-453c-bf10-fd1c08c45e0c", "name": "CEPHALEXIN ANHYDROUS", "stdName": "CEPHALEXIN ANHYDROUS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "54fe1556-31ed-426e-b514-499d31ea8f4b" ], "display_name": true }, { "uuid": "01ea161a-5037-4ab3-8de0-a189fc1af06f", "name": "CEPHALEXIN [HSDB]", "stdName": "CEPHALEXIN [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12f6ef64-e71e-4dc4-bf07-c43397bf4b76", "5e435df5-eb09-4540-b7fd-1bab7b172d81" ], "display_name": false }, { "uuid": "d8788fdd-0adf-4092-bbb7-67adea262c8c", "name": "CEPHALEXIN [MI]", "stdName": "CEPHALEXIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bb091f15-4ba3-41cf-818e-1c8359480a49", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "b568af62-5e02-409b-976c-3250f1723060", "name": "CEPHAMASTEN", "stdName": "CEPHAMASTEN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "566d89f6-0330-3e88-5b43-2c541945edeb", "name": "Cefalexin [WHO-DD]", "stdName": "CEFALEXIN [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "38394a3a-66b8-1978-d026-90957d5d3ae0" ], "display_name": false }, { "uuid": "19e204a0-8033-4a85-a0fb-b35ec903f4a2", "name": "DURANTEL", "stdName": "DURANTEL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "2c9379da-9672-4605-af30-bb15ca8781dc", "name": "EFALEXIN", "stdName": "EFALEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "28333779-2d82-4251-8e7d-b0818ccf49b9", "name": "FELEXIN", "stdName": "FELEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "f8d6e659-d307-44cc-8307-eb77fc641812", "name": "GARASIN", "stdName": "GARASIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "8dc9fa7b-5801-476a-957d-f3c24fb56842", "name": "IWALEXIN", "stdName": "IWALEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "345fbc6b-5ba9-42c6-a7e2-b17bac8a1c89", "name": "KEFLORIDINA", "stdName": "KEFLORIDINA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "98e336fb-7d22-4a73-a899-52f1e926e07d", "name": "LILLY-66873", "stdName": "LILLY-66873", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "ed6f836b-c321-47d0-be89-7d06d30b9901", "name": "MAMALEXIN", "stdName": "MAMALEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "080d3c2b-bb2b-0081-392e-901614f6b170", "name": "NSC-758162", "stdName": "NSC-758162", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9113656d-9e8a-cadc-9901-4f4c80548976" ], "display_name": false }, { "uuid": "4fd481ba-ecdd-431a-baf4-301bc2035187", "name": "ORACOCIN", "stdName": "ORACOCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "77c27bfe-fe97-4b54-ada0-23af9493cafa", "name": "PYASSAN", "stdName": "PYASSAN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "9a08fd18-35be-40e9-9742-ea1e72d12aa1", "name": "S-6437", "stdName": "S-6437", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "8404d9e1-443f-4494-aad0-61eceaedaa74", "name": "SINTHECILLIN", "stdName": "SINTHECILLIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "433456e7-85d3-4aef-895c-8d212c44a9a2", "name": "TAICELEXIN", "stdName": "TAICELEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "23fe511e-a58c-4ab4-b851-95c1a282d89a", "name": "UPHALEXIN", "stdName": "UPHALEXIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "314029f1-ce0d-4951-aa84-095297de4228", "12f6ef64-e71e-4dc4-bf07-c43397bf4b76" ], "display_name": false }, { "uuid": "58697c60-28a3-483f-bb53-c75b55ad1413", "name": "cefalexin [INN]", "stdName": "CEFALEXIN [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "de9dfbf3-f823-463d-8bda-2c4d49d5d4ec" ], "display_name": false } ], "references": [ { "uuid": "54fe1556-31ed-426e-b514-499d31ea8f4b", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "de9dfbf3-f823-463d-8bda-2c4d49d5d4ec", "citation": "INN Proposed List 18", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL18.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bb091f15-4ba3-41cf-818e-1c8359480a49", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12f6ef64-e71e-4dc4-bf07-c43397bf4b76", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5e435df5-eb09-4540-b7fd-1bab7b172d81", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9aa6cb50-3f4b-44b5-91de-c860ecb7897c", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3ceb0042-d1b0-4e9c-9e0b-c9bcc7054115", "citation": "SWISS MEDIC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "314029f1-ce0d-4951-aa84-095297de4228", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "336bc930-9413-4bec-ab38-de2fe34c62e8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390599000, "tags": [ "NOMEN" ] }, { "uuid": "b3b361b8-f525-49d4-8543-6e13ced4f027", "citation": "USP-MC", "url": "https://mc.usp.org/monographs/cephalexin-1-0", "doc_type": "USP-MC", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "86e56055-91b1-4a7b-9458-2ca84d665a88", "citation": "SRS import [5SFF1W6677]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5SFF1W6677", "doc_type": "SRS", "public_domain": true, "document_date": 1493390599000, "tags": [ "NOMEN" ] }, { "uuid": "b45c1d9b-5a16-4e3f-846e-4d63800fe82e", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b59de649-2933-4a32-8188-c0fcf94a995d", "citation": "CEFALEXIN [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a77c6ed6-f45c-43ee-9682-cf3c6533869d", "citation": "CEFALEXIN [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4becbab3-9b23-c6e7-f08a-167778a61562", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4a2ad9c3-3592-9f1a-74fe-b5947056d901", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+15686-71-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "afb07c3a-9357-c58f-b5e5-ed9fd9dcb8d9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15686-71-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dae9de98-465b-ffef-4f3e-1d1357086e7a", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+15686-71-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9912a359-54c4-5ac5-3d98-3c87a1c04c10", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "94cb0796-cfc8-495d-9c3b-a1d7215efc26", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "61b67737-4d01-e262-8bae-21abae7480d1", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "be90d3df-0178-4f2c-a301-3db8a7c6c097", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "09456ce7-2477-44f6-ac6e-01e806b272fc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=63836-75-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4d50ef72-c73f-4c09-b893-7bd2b7f8806f", "citation": "Abraham, D.J. and Swaan, P.W. (2010). Drug Transport and Membrane Transport Proteins. In Burger's Medicinal Chemistry and Drug Discovery, D.J. Abraham (Ed.). doi:10.1002/0471266949.bmc027.pub2", "url": "https://onlinelibrary.wiley.com/doi/full/10.1002/0471266949.bmc027.pub2", "doc_type": "BOOK", "public_domain": true }, { "uuid": "9113656d-9e8a-cadc-9901-4f4c80548976", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "b6c6bae2-5676-27d9-2ea3-c7f2f76c246b", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "38394a3a-66b8-1978-d026-90957d5d3ae0", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "ae8035ed-c80e-4b6d-8f85-611869ff0bab", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "df0e14c3-68ce-461c-901b-392487a28724", "citation": "USP-MC", "url": "https://mc.usp.org/monographs/cephalexin-1-0", "doc_type": "USP-MC", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f1320826-9af3-4cb6-99af-d998a2ea4075", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "15c03c2a-fbc9-4380-8e8f-498bea8223a5", "id": "15c03c2a-fbc9-4380-8e8f-498bea8223a5", "molfile": "\n Marvin 01132101202D \n\n 24 26 0 0 1 0 999 V2000\n -1.4625 -1.8333 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -1.4708 -1.0083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7458 -2.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7500 -3.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0333 -1.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6875 -2.2458 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 0.6875 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1000 -3.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5167 -3.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2292 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2250 -4.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5042 -4.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9375 -4.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9417 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6542 -3.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9417 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2292 -1.8333 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5167 -2.2458 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -2.1833 -2.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -3.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -3.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6125 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 19 1 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 1 1 0 0 0\n 7 6 1 0 0 0 0\n 6 18 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 18 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 14 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 1 0 0 0\n 20 19 1 0 0 0 0\n 24 19 2 0 0 0 0\n 21 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CC1=C(C(=O)O)N2C(=O)[C@H]([C@H]2SC1)NC(=O)[C@@H](c3ccccc3)N", "formula": "C16H17N3O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1a4e3737-eb07-411c-883d-7c559d54d92c" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "347.3906", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "a2f6a28f-d145-43e3-a637-cdc5303a0c5c", "version": "30", "structure": { "id": "d463db8b-cfe8-4ef9-9c13-d8031e89e55d", "molfile": "\n Marvin 01132111002D \n\n 25 27 0 0 1 0 999 V2000\n 1.5167 -3.0792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6875 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6875 -2.2458 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.5167 -2.2458 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.2292 -3.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0333 -1.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2292 -1.8333 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7458 -2.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9417 -3.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2250 -4.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4625 -1.8333 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.9417 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1000 -3.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7500 -3.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5042 -4.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -2.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4708 -1.0083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9375 -4.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6542 -3.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -3.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -3.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6125 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5167 -1.4208 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 3 6 1 1 0 0 0\n 7 4 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 5 2 0 0 0 0\n 10 5 1 0 0 0 0\n 11 8 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 2 2 0 0 0 0\n 14 8 2 0 0 0 0\n 15 10 2 0 0 0 0\n 16 11 1 0 0 0 0\n 11 17 1 1 0 0 0\n 18 10 1 0 0 0 0\n 19 9 1 0 0 0 0\n 20 16 2 0 0 0 0\n 21 16 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 20 1 0 0 0 0\n 24 23 2 0 0 0 0\n 4 25 1 6 0 0 0\n 2 3 1 0 0 0 0\n 7 12 1 0 0 0 0\n 22 24 1 0 0 0 0\nM END", "smiles": "CC1=C(C(=O)O)N2C(=O)[C@H]([C@@]2([H])SC1)NC(=O)[C@@H](c3ccccc3)N", "formula": "C16H17N3O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "347.3906", "optical_activity": "UNSPECIFIED", "references": [ "86e56055-91b1-4a7b-9458-2ca84d665a88", "b45c1d9b-5a16-4e3f-846e-4d63800fe82e", "de9dfbf3-f823-463d-8bda-2c4d49d5d4ec" ], "stereo_centers": 3 }, "unii": "5SFF1W6677" } ] }