{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5bf7b0dd-258c-47cb-a914-c66c9cc0ef1d", "code": "2804-00-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2804-00-4", "code_system": "CAS", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5", "5b242bfc-2ce5-41d1-b655-e06d78be54b6" ] }, { "uuid": "13154a6f-d839-4e1a-9cd3-b0ff2a40ad5a", "code": "C76446", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76446", "code_system": "NCI_THESAURUS", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5" ] }, { "uuid": "fb33025c-1fc0-4aef-94ce-9f4ba9a82ee9", "code": "SUB10402MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5" ] }, { "uuid": "7b20991e-cd93-4c56-b49e-25ec71a47ff8", "code": "2233", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2233", "code_system": "INN", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5" ] }, { "uuid": "bdedad42-b1d2-4a44-bbe3-905fdbaa398c", "code": "CHEMBL2107081", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107081", "code_system": "ChEMBL", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5" ] }, { "uuid": "1e811052-f699-4462-ae3a-4a85249b3a8a", "code": "71117", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71117", "code_system": "PUBCHEM", "references": [ "93129cf4-38b2-4ea5-9903-5b95033df5d5" ] }, { "uuid": "592b947e-a45c-cc2b-a7a8-9c85a9970267", "code": "DTXSID20182317", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20182317", "code_system": "EPA CompTox", "references": [ "8e1ebcfc-6baf-7bed-2b9a-beabafe41ae0" ] }, { "uuid": "9ed1d6b6-f9e4-27da-7535-b0e2ab01e705", "code": "C28197", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28197", "code_system": "NCI_THESAURUS", "references": [ "63e5f502-1f4b-161f-0687-eb0e9a201f07" ] }, { "uuid": "13c0648d-3966-45ec-aaa3-d2e175b9e487", "code": "5RS1CY853F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d1f0e53c-17bc-52d1-5e22-f8dbfe6e53a3", "code": "100000084368", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3eddb323-10f6-a699-ebe3-b5cc11c76b90" ] }, { "uuid": "0fb6a95a-e9c4-62ca-468d-f9ac5f231c6a", "code": "186062", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=186062", "code_system": "NSC", "references": [ "a23b9bb5-ea78-e173-0c13-2da3108d4395" ] } ], "relationships": [ { "uuid": "7a00a4e2-4678-40cf-82bf-531cc086f7f0", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "c9115ca2-0a49-4f54-babc-20bfacde5ccd", "refuuid": "4837d14c-d328-4f74-b12e-0196c66f24fb", "name": "ROXOPERONE", "unii": "5RS1CY853F", "linking_id": "5RS1CY853F", "ref_pname": "ROXOPERONE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "d3ecd24c-5334-4bea-852d-cfbd1ce198ea", "name": "NSC-186062", "stdName": "NSC-186062", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4914144c-eb87-49d6-9aae-45ad7fe20610", "b783240d-0669-406f-b9a2-9304690f1051" ], "display_name": false }, { "uuid": "39dd69f7-a4a9-4c3c-87a4-f707d06e4ebc", "name": "ROXOPERONE", "stdName": "ROXOPERONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "d22fdbf8-7b82-485b-85c0-a4f31e7f8617", "e97aa09e-d747-47fc-bf8e-8f52a5382254", "402bb221-c5a8-430f-bc6f-d25edd8669ec" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "1a3dcaa2-0a17-4df3-a4d7-804089ee7ca6", "name_org": "INN" } ] }, { "uuid": "e5c83d1b-73fe-4539-91e9-440f1c7f87f7", "name": "roxoperone [INN]", "stdName": "ROXOPERONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d22fdbf8-7b82-485b-85c0-a4f31e7f8617" ], "display_name": false } ], "references": [ { "uuid": "402bb221-c5a8-430f-bc6f-d25edd8669ec", "citation": "USP Dictionary 2007", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d22fdbf8-7b82-485b-85c0-a4f31e7f8617", "citation": "INN Proposed List 17", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL17.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4914144c-eb87-49d6-9aae-45ad7fe20610", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b783240d-0669-406f-b9a2-9304690f1051", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "93129cf4-38b2-4ea5-9903-5b95033df5d5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390689000, "tags": [ "NOMEN" ] }, { "uuid": "67420d5a-ffdc-4abf-97e7-40d0193d33f6", "citation": "SRS import [5RS1CY853F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5RS1CY853F", "doc_type": "SRS", "public_domain": true, "document_date": 1493390689000, "tags": [ "NOMEN" ] }, { "uuid": "961c3d8b-64ee-48b2-9d3f-34087127635b", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e97aa09e-d747-47fc-bf8e-8f52a5382254", "citation": "ROXOPERONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "8e1ebcfc-6baf-7bed-2b9a-beabafe41ae0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2804-00-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3eddb323-10f6-a699-ebe3-b5cc11c76b90", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "63e5f502-1f4b-161f-0687-eb0e9a201f07", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "5b242bfc-2ce5-41d1-b655-e06d78be54b6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a23b9bb5-ea78-e173-0c13-2da3108d4395", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "980752d0-9d8f-4401-9671-5c8c068eb978", "id": "980752d0-9d8f-4401-9671-5c8c068eb978", "molfile": "\n Marvin 01132107542D \n\n 25 27 0 0 0 0 999 V2000\n 6.9928 3.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7821 2.2663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1959 1.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9881 1.3411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6449 0.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8913 1.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8916 0.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1812 0.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4649 0.4459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7524 0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0405 0.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3280 0.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6161 0.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6119 1.2619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9072 0.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9114 -0.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2000 -1.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5167 -0.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2286 -1.2285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5233 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1857 0.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4583 1.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1743 1.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9761 2.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2559 2.5072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 24 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 23 1 0 0 0 0\n 24 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 22 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 21 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 2 0 0 0 0\n 21 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 25 2 0 0 0 0\nM END", "smiles": "CN1C(=O)CC2(CCN(CCCC(=O)c3ccc(cc3)F)CC2)C1=O", "formula": "C19H23FN2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f0531288-35cc-4ac3-b57a-48b596a9fd27" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.3966", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4837d14c-d328-4f74-b12e-0196c66f24fb", "version": "7", "structure": { "id": "3166e7db-9896-4bd1-a302-fa82fd9a27a1", "molfile": "\n Marvin 01132102392D \n\n 25 27 0 0 0 0 999 V2000\n 5.8917 1.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6454 0.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1964 1.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7826 2.2665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9765 2.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2287 -1.2286 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5167 -0.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2000 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9115 -0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9073 0.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1857 0.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5233 0.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6162 0.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6120 1.2620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3282 0.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0407 0.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7527 0.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4652 0.4459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1816 0.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8920 0.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1747 1.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4586 1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2563 2.5074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9933 3.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9887 1.3412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10 13 1 0 0 0 0\n 6 7 1 0 0 0 0\n 13 14 2 0 0 0 0\n 2 3 1 0 0 0 0\n 13 15 1 0 0 0 0\n 7 8 2 0 0 0 0\n 15 16 1 0 0 0 0\n 3 4 1 0 0 0 0\n 16 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 4 5 1 0 0 0 0\n 9 10 2 0 0 0 0\n 5 1 1 0 0 0 0\n 10 11 1 0 0 0 0\n 18 22 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 1 1 0 0 0 0\n 1 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 1 2 1 0 0 0 0\n 5 23 2 0 0 0 0\n 11 12 2 0 0 0 0\n 4 24 1 0 0 0 0\n 12 7 1 0 0 0 0\n 3 25 2 0 0 0 0\nM END", "smiles": "CN1C(=O)CC2(CCN(CCCC(=O)c3ccc(cc3)F)CC2)C1=O", "formula": "C19H23FN2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.3966", "optical_activity": "NONE", "references": [ "67420d5a-ffdc-4abf-97e7-40d0193d33f6", "961c3d8b-64ee-48b2-9d3f-34087127635b", "d22fdbf8-7b82-485b-85c0-a4f31e7f8617" ], "stereo_centers": 0 }, "unii": "5RS1CY853F" } ] }