{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8994c104-1960-4fdf-8400-989a5e38f821", "code": "532-87-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=532-87-6", "code_system": "CAS", "references": [ "4876411e-5f48-44ea-bd33-6108e7efe426", "e1f93365-8370-4a08-ad44-7a9b0c4e778b" ] }, { "uuid": "1d524af0-1a73-41f8-872a-6d05e2df7d10", "code": "208-546-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.771", "code_system": "ECHA (EC/EINECS)", "references": [ "4876411e-5f48-44ea-bd33-6108e7efe426" ] }, { "uuid": "39dab541-1928-48a9-99d1-33a6518dcae3", "code": "101750", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101750", "code_system": "PUBCHEM", "references": [ "4876411e-5f48-44ea-bd33-6108e7efe426" ] }, { "uuid": "9bcb1335-a984-4c66-b946-224cedf82d1d", "code": "DTXSID0052172", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0052172", "code_system": "EPA CompTox", "references": [ "45bb870c-6beb-30e0-8aad-6083cfbc9e04" ] }, { "uuid": "fb8bfcbd-e4dc-4557-8af7-28087e69af7e", "code": "5RJO31754N", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "63aa441d-02fe-4faa-9d0f-5f51f997557b", "name": ".ALPHA.-CAMPHORENE", "stdName": ".ALPHA.-CAMPHORENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d445f5f-0069-4581-bd00-56737780d702" ], "display_name": true }, { "uuid": "fdd48b6a-6590-44ed-9f42-5dd03e564af9", "name": "4-(5-METHYL-1-METHYLENE-4-HEXEN-1-YL)-1-(4-METHYL-3-PENTEN-1-YL)CYCLOHEXENE", "stdName": "4-(5-METHYL-1-METHYLENE-4-HEXEN-1-YL)-1-(4-METHYL-3-PENTEN-1-YL)CYCLOHEXENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d2713184-bed3-44e9-8b4a-544bba72277b" ], "display_name": false }, { "uuid": "673b5abd-de8a-4c81-8693-149ea9683c38", "name": "CYCLOHEXENE, 4-(5-METHYL-1-METHYLENE-4-HEXEN-1-YL)-1-(4-METHYL-3-PENTEN-1-YL)-", "stdName": "CYCLOHEXENE, 4-(5-METHYL-1-METHYLENE-4-HEXEN-1-YL)-1-(4-METHYL-3-PENTEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d2713184-bed3-44e9-8b4a-544bba72277b" ], "display_name": false } ], "references": [ { "uuid": "2d445f5f-0069-4581-bd00-56737780d702", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d2713184-bed3-44e9-8b4a-544bba72277b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4876411e-5f48-44ea-bd33-6108e7efe426", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392719000, "tags": [ "NOMEN" ] }, { "uuid": "bb2f2d33-d7bc-4ed4-a77f-977ceaeeb4bc", "citation": "SRS import [5RJO31754N]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5RJO31754N", "doc_type": "SRS", "public_domain": true, "document_date": 1493392719000, "tags": [ "NOMEN" ] }, { "uuid": "45bb870c-6beb-30e0-8aad-6083cfbc9e04", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=532-87-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e1f93365-8370-4a08-ad44-7a9b0c4e778b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "67ff1c5a-6fcd-48d4-beff-2ddfd71c7582", "id": "67ff1c5a-6fcd-48d4-beff-2ddfd71c7582", "molfile": "\n Marvin 01132105252D \n\n 20 20 0 0 0 0 999 V2000\n 13.2444 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5299 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5299 -3.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8154 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1009 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3864 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6720 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6720 -3.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9575 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.9575 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2430 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5286 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8141 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0996 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3852 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6707 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9562 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6707 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5286 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2430 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 20 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 19 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CC(=CCCC(=C)C1CC=C(CCC=C(C)C)CC1)C", "formula": "C20H32", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "88000578-f563-47d9-b2a3-2b20dafe07cb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "272.4688", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "6f4b7895-8e55-4494-b901-accae8f9f4e9", "version": "4", "structure": { "id": "6246e1fb-8aeb-4ddf-917b-24ccec8a15f3", "molfile": "\n Marvin 01132105062D \n\n 20 20 0 0 0 0 999 V2000\n 7.5286 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2430 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9575 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6720 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3864 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1009 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8154 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5299 -3.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2444 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5299 -3.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6720 -3.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9575 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2430 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5286 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8141 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0996 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3852 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6707 -5.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9562 -5.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6707 -4.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 4 11 2 0 0 0 0\n 12 3 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 1 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\nM END", "smiles": "CC(=CCCC(=C)C1CC=C(CCC=C(C)C)CC1)C", "formula": "C20H32", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "272.4688", "optical_activity": "( + / - )", "references": [ "2d445f5f-0069-4581-bd00-56737780d702", "bb2f2d33-d7bc-4ed4-a77f-977ceaeeb4bc" ], "stereo_centers": 1 }, "unii": "5RJO31754N" } ] }