{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ea73b22f-77ad-4325-8475-b7135a51a88e", "code": "52286-74-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52286-74-5", "code_system": "CAS", "references": [ "461d5b10-075f-422b-99b4-bb44e6bae8e5", "c8831881-9903-4514-bf14-dfa70128f416" ] }, { "uuid": "247f77bf-e682-4a45-9db0-3fa7dcd2db43", "code": "21599924", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21599924", "code_system": "PUBCHEM", "references": [ "461d5b10-075f-422b-99b4-bb44e6bae8e5" ] }, { "uuid": "af82831e-f38f-4628-b2c8-0024467f6bc3", "code": "5R89LAS235", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "afa2e3ba-86e0-9e7b-8645-ced26543e78b", "code": "77151", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:77151", "code_system": "CHEBI", "references": [ "a0f897a5-3d8d-a44c-faad-8e9a626f9417" ] }, { "uuid": "68d12ff0-ff57-e862-90b6-d68a3942f2c4", "code": "DTXSID901317065", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901317065", "code_system": "EPA CompTox", "references": [ "18bf2b95-6a3f-d540-8528-083e6907a942" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b6d3c0b5-dc22-4450-9cb2-c7bf7f9555a5", "name": ".BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,6.ALPHA.,12.BETA.)-3,12,20-TRIHYDROXYDAMMAR-24-EN-6-YL 2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,6.ALPHA.,12.BETA.)-3,12,20-TRIHYDROXYDAMMAR-24-EN-6-YL 2-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "e0f5e6a7-bf74-41f2-aeca-c533086edc08", "name": "20(S)-GINSENOSIDE RG2", "stdName": "20(S)-GINSENOSIDE RG2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "6d191882-eb0a-4331-91cf-c0a552a28ac8", "name": "CHIKUSETSUSAPONIN I", "stdName": "CHIKUSETSUSAPONIN I", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "11bbef29-d111-4d5f-9328-9c890bb61b38", "name": "GF VI", "stdName": "GF VI", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "fa1060b4-bac5-449c-9112-bcee8045ef47", "name": "GINSENOSIDE 20-RG2", "stdName": "GINSENOSIDE 20-RG2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "a6a5188e-3eac-48da-b119-0c084dbbb9bb", "name": "GINSENOSIDE RG2", "stdName": "GINSENOSIDE RG2", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "67768796-1d25-4928-8003-f30dae306132", "27af6648-bb52-49a3-947e-b99f877e8c35" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f2ad3494-6158-4138-b003-5365bfadf31f", "name_org": "INCI" } ] }, { "uuid": "ec8a6873-8ea3-41f2-a97c-48dab5ae28da", "name": "GINSENOSIDE RG2 (CONSTITUENT OF AMERICAN GINSENG, ASIAN GINSENG, AND TIENCHI GINSENG) [DSC]", "stdName": "GINSENOSIDE RG2 (CONSTITUENT OF AMERICAN GINSENG, ASIAN GINSENG, AND TIENCHI GINSENG) [DSC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "4b8177c3-e17e-47f3-bf0b-fbee3e7d67d2" ], "display_name": false }, { "uuid": "8a4fc985-c8f3-458b-ac0a-5213dd5b2d55", "name": "PANAXOSIDE RG2", "stdName": "PANAXOSIDE RG2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "ce18e7cb-6db5-4bf9-8dab-8dfd5cbd9768", "name": "PROSAPOGENIN C2", "stdName": "PROSAPOGENIN C2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false }, { "uuid": "a888319f-e73c-46c1-bd19-fa0300da30fa", "name": "S-GINSENOSIDE RG2", "stdName": "S-GINSENOSIDE RG2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27af6648-bb52-49a3-947e-b99f877e8c35", "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a" ], "display_name": false } ], "references": [ { "uuid": "67768796-1d25-4928-8003-f30dae306132", "citation": "USP-DSC, VOL.2, 2015", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "27af6648-bb52-49a3-947e-b99f877e8c35", "citation": "USP DIETARY SUPPLEMENTS COMPENDIUM", "doc_type": "USP DIETARY SUPPLEMENTS COMPENDIUM", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "395b3fc3-3731-43cf-8018-7ce1e3b8bb4a", "citation": "USP-DSC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4b8177c3-e17e-47f3-bf0b-fbee3e7d67d2", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "461d5b10-075f-422b-99b4-bb44e6bae8e5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392542000, "tags": [ "NOMEN" ] }, { "uuid": "c5aeac5f-29e1-4331-bed6-ce55c3f60045", "citation": "USP-DSC", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "53899cb1-9c37-4a46-bdbe-e6f984c547b0", "citation": "SRS import [5R89LAS235]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5R89LAS235", "doc_type": "SRS", "public_domain": true, "document_date": 1493392542000, "tags": [ "NOMEN" ] }, { "uuid": "c4880c06-0d19-435e-99c9-4ffc03b301bd", "citation": "SIGMA-ALDRICH", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c8831881-9903-4514-bf14-dfa70128f416", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a0f897a5-3d8d-a44c-faad-8e9a626f9417", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "18bf2b95-6a3f-d540-8528-083e6907a942", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e8538762-99ee-496c-96eb-221d75e7028d", "id": "e8538762-99ee-496c-96eb-221d75e7028d", "molfile": "\n Marvin 01132112012D \n\n 55 60 0 0 1 0 999 V2000\n 8.5169 -7.9273 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.0018 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5169 -9.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7322 -9.0072 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.8185 -9.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7322 -8.1821 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.0177 -7.7697 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.0177 -6.9447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -8.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -9.0072 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.5888 -9.4197 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.5888 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8743 -9.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1598 -9.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1598 -10.2448 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.4453 -10.6572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8743 -10.6572 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.2867 -11.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3440 -11.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5888 -10.2448 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.3032 -10.6572 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.0177 -10.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0177 -9.4197 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.0177 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -11.4823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0786 -11.7645 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.9036 -11.7645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3161 -12.4790 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 9.1411 -12.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5535 -13.1935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9036 -13.1935 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.3161 -13.9079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0786 -13.1935 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.6660 -13.9079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6660 -12.4790 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.8410 -12.4790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5589 -13.2542 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.8444 -12.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1298 -13.2542 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.4153 -12.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1298 -14.0792 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.4153 -14.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8444 -14.4918 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.8444 -15.3168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5589 -14.0792 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.2733 -14.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2314 -7.5147 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.0564 -7.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6439 -8.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2314 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9459 -6.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6604 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3749 -6.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3749 -5.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0894 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 6 1 1 0 0 0 0\n 1 47 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 4 1 6 0 0 0\n 4 23 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 1 0 0 0\n 10 11 1 0 0 0 0\n 23 10 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 13 1 0 0 0 0\n 11 20 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 20 17 1 1 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 25 1 6 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 1 0 0 0\n 26 25 1 6 0 0 0\n 26 27 1 0 0 0 0\n 35 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 6 0 0 0\n 31 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 1 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 6 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 1 0 0 0\n 37 36 1 1 0 0 0\n 37 38 1 0 0 0 0\n 45 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 39 40 1 6 0 0 0\n 41 39 1 0 0 0 0\n 41 42 1 1 0 0 0\n 41 43 1 0 0 0 0\n 43 44 1 6 0 0 0\n 43 45 1 0 0 0 0\n 45 46 1 6 0 0 0\n 47 48 1 0 0 0 0\n 47 49 1 6 0 0 0\n 47 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 2 0 0 0 0\n 53 54 1 0 0 0 0\n 53 55 1 0 0 0 0\nM END", "smiles": "CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]3[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4[C@H](C[C@]32C)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@H](C)O6)O)O)O)O)O)O)C", "formula": "C42H72O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "01b44803-45c5-472d-a96c-92b41e3ad697" }, "defined_stereo": 21, "ez_centers": 0, "molecular_weight": "785.0149", "optical_activity": "UNSPECIFIED", "stereo_centers": 21 } ], "definition_level": "COMPLETE", "uuid": "d4313891-2083-4149-998f-05a273c39ea6", "version": "7", "structure": { "id": "2de50c56-47b9-4fbe-8333-faae329b2525", "molfile": "\n Marvin 01132102282D \n\n 61 66 0 0 1 0 999 V2000\n 7.0177 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0177 -9.4197 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0177 -10.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -10.6572 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3032 -11.4823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0786 -11.7645 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2218 -10.9520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9036 -11.7645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3161 -12.4790 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1411 -12.4790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5535 -13.1935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9036 -13.1935 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.3161 -13.9079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0786 -13.1935 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.6660 -13.9079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6660 -12.4790 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.8410 -12.4790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5589 -13.2542 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3713 -13.3974 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8444 -12.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1298 -13.2542 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.4153 -12.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1298 -14.0792 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.4153 -14.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8444 -14.4918 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.8444 -15.3168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5589 -14.0792 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.2733 -14.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5888 -10.2448 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5888 -11.0698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8743 -10.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1598 -10.2448 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.4453 -10.6572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1598 -9.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8743 -9.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5888 -9.4197 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.5888 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -9.0072 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.3033 -9.8322 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -8.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0177 -7.7697 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0177 -6.9447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7322 -8.1821 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.6747 -7.3591 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5169 -7.9273 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.1813 -7.1735 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2314 -7.5147 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6439 -8.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0564 -7.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2314 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9459 -6.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6604 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3749 -6.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3749 -5.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0894 -6.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0018 -8.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5169 -9.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7322 -9.0072 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8185 -9.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2867 -11.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3440 -11.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 6 0 0 0\n 10 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 6 0 0 0\n 16 14 1 0 0 0 0\n 6 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 6 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 1 0 0 0\n 25 23 1 0 0 0 0\n 25 26 1 6 0 0 0\n 27 25 1 0 0 0 0\n 18 27 1 0 0 0 0\n 27 28 1 6 0 0 0\n 4 29 1 0 0 0 0\n 29 30 1 6 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 1 0 0 0\n 34 32 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 29 1 0 0 0 0\n 36 37 1 1 0 0 0\n 38 36 1 0 0 0 0\n 2 38 1 0 0 0 0\n 38 39 1 6 0 0 0\n 38 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 1 0 0 0\n 43 41 1 0 0 0 0\n 43 44 1 1 0 0 0\n 43 45 1 0 0 0 0\n 45 46 1 6 0 0 0\n 45 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 47 49 1 1 0 0 0\n 47 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 2 0 0 0 0\n 53 54 1 0 0 0 0\n 53 55 1 0 0 0 0\n 45 56 1 0 0 0 0\n 57 56 1 0 0 0 0\n 58 57 1 0 0 0 0\n 58 43 1 0 0 0 0\n 2 58 1 0 0 0 0\n 58 59 1 6 0 0 0\n 31 60 1 0 0 0 0\n 31 61 1 0 0 0 0\nM END", "smiles": "CC(=CCC[C@@](C)([C@@]1([H])CC[C@]2(C)[C@]1([H])[C@@H](C[C@]3([H])[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])[C@H](C[C@]32C)O[C@@]5([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O[C@@]6([H])[C@@H]([C@@H]([C@H]([C@H](C)O6)O)O)O)O)O)O)C", "formula": "C42H72O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 21, "ez_centers": 0, "molecular_weight": "785.0149", "optical_activity": "UNSPECIFIED", "references": [ "53899cb1-9c37-4a46-bdbe-e6f984c547b0", "c4880c06-0d19-435e-99c9-4ffc03b301bd" ], "stereo_centers": 21 }, "unii": "5R89LAS235" } ] }