{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f288932a-49c7-4eba-8480-6057660f84b2",
          "code": "207-677-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.980",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "7b574225-07c7-4dec-b781-81fd48fdf622",
          "code": "452501",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/452501",
          "code_system": "PUBCHEM",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "934d90c9-adcb-40e0-baf0-dd4d799ef210",
          "code": "488-43-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=488-43-7",
          "code_system": "CAS",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09",
            "6ee1aa7a-7486-440a-abad-0a9a9cf546f1"
          ]
        },
        {
          "uuid": "520d8826-d3b7-48ee-8599-2d662650030b",
          "code": "C119561",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67119561",
          "code_system": "MESH",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "bfc29d1c-9d98-487b-8f30-c739a38ca643",
          "code": "1313187",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313187/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "79f9e95a-dd82-4ab6-b203-a452164bd192",
          "code": "m5754",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5754?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "7d5b4dca-58e6-4893-b870-c7d699b4224c",
          "code": "SUB33805",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7596b3ec-1976-4353-8670-734934b43a09"
          ]
        },
        {
          "uuid": "cac57643-928e-4a4c-afe3-910b68309d70",
          "code": "5QN16UUF80",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "38aa4cb2-0476-5069-a34d-d9bc360cfe39",
          "code": "100000127718",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cfa04010-1ac8-a7f0-babc-c546f8196fda"
          ]
        },
        {
          "uuid": "4ed738b0-afa4-746b-04a9-0d5af14fe55d",
          "code": "DTXSID901032334",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901032334",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "65ed3869-d280-f5c6-9a59-6bcefbea871d",
          "code": "5QN16UUF80",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5QN16UUF80",
          "code_system": "DAILYMED",
          "references": [
            "fcf0530c-d0ee-82a4-98ba-22c1a8488aac"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "11884a37-d274-4ba8-b051-296df8e713a9",
          "name": "1-AMINO-1-DEOXY-D-GLUCITOL",
          "stdName": "1-AMINO-1-DEOXY-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
            "20ffcbe5-8875-4ec4-82d4-1597752b9d0b"
          ],
          "display_name": false
        },
        {
          "uuid": "b4be219d-9172-4c78-8f4c-6b5daaad66ef",
          "name": "1-AMINO-1-DEOXYSORBITOL",
          "stdName": "1-AMINO-1-DEOXYSORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
            "20ffcbe5-8875-4ec4-82d4-1597752b9d0b"
          ],
          "display_name": false
        },
        {
          "uuid": "29ba17d9-002e-4788-85b8-03f788af6d10",
          "name": "D-GLUCAMINE",
          "stdName": "D-GLUCAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
            "20ffcbe5-8875-4ec4-82d4-1597752b9d0b"
          ],
          "display_name": false
        },
        {
          "uuid": "69976971-a910-417f-9a55-bb69ecc03da7",
          "name": "GLUCAMINE",
          "stdName": "GLUCAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
            "20ffcbe5-8875-4ec4-82d4-1597752b9d0b",
            "020d0f99-b30e-474e-a0fa-5a07ee6c59d5",
            "56fc66da-7f62-4bc2-bf7e-5def9fd95d61",
            "4e89833c-55ba-4504-aa2f-13bf59a8f4fa",
            "bc9b4036-f01b-4358-a728-766b55b4d950"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7c76271d-a4b5-4114-bf89-1a253331c8e7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "076abc2f-7b98-40a8-a7d7-9a6acf4b68fa",
          "name": "GLUCAMINE [MI]",
          "stdName": "GLUCAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20ffcbe5-8875-4ec4-82d4-1597752b9d0b",
            "56fc66da-7f62-4bc2-bf7e-5def9fd95d61"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "20ffcbe5-8875-4ec4-82d4-1597752b9d0b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56fc66da-7f62-4bc2-bf7e-5def9fd95d61",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "020d0f99-b30e-474e-a0fa-5a07ee6c59d5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7596b3ec-1976-4353-8670-734934b43a09",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbcb96cc-ae34-4a2f-8eae-6604b8679530",
          "citation": "SRS import [5QN16UUF80]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5QN16UUF80",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc9b4036-f01b-4358-a728-766b55b4d950",
          "citation": "GLUCAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e89833c-55ba-4504-aa2f-13bf59a8f4fa",
          "citation": "GLUCAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfa04010-1ac8-a7f0-babc-c546f8196fda",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6ee1aa7a-7486-440a-abad-0a9a9cf546f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fcf0530c-d0ee-82a4-98ba-22c1a8488aac",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9a656647-5561-4524-84b7-9f57b8b1d4d5",
          "id": "9a656647-5561-4524-84b7-9f57b8b1d4d5",
          "molfile": "\n  Marvin  01132108012D          \n\n 12 11  0  0  1  0            999 V2000\n    7.0103   -2.3633    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0020   -1.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7243   -2.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4383   -2.3633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2963   -2.7766    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.2880   -3.6034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5823   -2.3633    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5740   -1.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8684   -2.7766    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.8601   -3.6034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1544   -2.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4404   -2.7766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)N",
          "formula": "C6H15NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b12410b4-9326-4b65-aa71-c6389728d595"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "181.1873",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c0056fc0-2391-4dbc-8e00-c33f4c566749",
      "version": "6",
      "structure": {
        "id": "315b1cff-b45b-4216-977a-f662c7ef1847",
        "molfile": "\n  Marvin  01132102392D          \n\n 12 11  0  0  1  0            999 V2000\n    5.5823   -2.3633    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2963   -2.7766    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0103   -2.3633    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8684   -2.7766    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2880   -3.6034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5740   -1.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0020   -1.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8601   -3.6034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4383   -2.3633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7243   -2.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4404   -2.7766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1544   -2.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  2  5  1  1  0  0  0\n  1  6  1  1  0  0  0\n  3  7  1  1  0  0  0\n  4  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  4  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)N",
        "formula": "C6H15NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "181.1873",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b7c1f6c9-3912-4f9d-8ef2-fa3f93cd16bf",
          "dbcb96cc-ae34-4a2f-8eae-6604b8679530"
        ],
        "stereo_centers": 4
      },
      "unii": "5QN16UUF80"
    }
  ]
}