{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fdb38bb6-4539-433a-b0b6-0ebe6323f17b",
          "code": "54660-00-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54660-00-3",
          "code_system": "CAS",
          "references": [
            "d6e71c09-26ff-4982-a04b-a07a7c90aba9",
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ]
        },
        {
          "uuid": "b2792139-f90c-4869-9ad7-f67ce97a6abe",
          "code": "5378296",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5378296",
          "code_system": "PUBCHEM",
          "references": [
            "d6e71c09-26ff-4982-a04b-a07a7c90aba9"
          ]
        },
        {
          "uuid": "282cbc85-6115-80c0-2903-7188e9768d67",
          "code": "DTXSID2068971",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2068971",
          "code_system": "EPA CompTox",
          "references": [
            "39649679-6c61-575a-bbd8-008c30dc0209"
          ]
        },
        {
          "uuid": "92e6d742-b14c-421a-9635-da487dfc22e8",
          "code": "5QGL2U8KQA",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "399236ac-ce22-4b71-8832-024cb19652be",
          "name": "1,4-Diketo-3,6-diphenylpyrrolo[3,4-c]pyrrole",
          "stdName": "1,4-DIKETO-3,6-DIPHENYLPYRROLO(3,4-C)PYRROLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "494bf368-6b43-4038-9138-753aaf835a25",
          "name": "2,5-Dihydro-3,6-diphenyl-1,4-diketopyrrolo[3,4-c]pyrrole",
          "stdName": "2,5-DIHYDRO-3,6-DIPHENYL-1,4-DIKETOPYRROLO(3,4-C)PYRROLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "b1bcfe57-7cc7-40cf-a02c-a971a21805a0",
          "name": "3,6-Diphenyl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione",
          "stdName": "3,6-DIPHENYL-2,5-DIHYDROPYRROLO(3,4-C)PYRROLE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "c355dbc4-d140-4506-81a8-f11e5817e43c",
          "name": "3,6-Diphenylpyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione",
          "stdName": "3,6-DIPHENYLPYRROLO(3,4-C)PYRROLE-1,4(2H,5H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "d23f2eab-38a1-419f-9082-68af4f5320a4",
          "name": "C.I. PR 255",
          "stdName": "C.I. PR 255",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "15949ecd-abcc-428d-a2cd-7b2e6bb1f533",
          "name": "Cromophtal DPP Coral Red C",
          "stdName": "CROMOPHTAL DPP CORAL RED C",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "36e172e0-12d6-4933-8d6e-de0244f89fa4",
          "name": "DPP Scarlet 5G",
          "stdName": "DPP SCARLET 5G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "25642c57-24b2-49c6-b4c0-51ff05e6d920",
          "name": "Irgazin DPP Red 5G",
          "stdName": "IRGAZIN DPP RED 5G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        },
        {
          "uuid": "34b31e34-a658-453a-8be1-ebb6a69c279e",
          "name": "Pigment Red 255",
          "stdName": "PIGMENT RED 255",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": true
        },
        {
          "uuid": "70852aa6-cbcb-43de-8a54-0b8c6c20f51d",
          "name": "Pyrrolo[3,4-c]pyrrole-1,4-dione, 2,5-dihydro-3,6-diphenyl-",
          "stdName": "PYRROLO(3,4-C)PYRROLE-1,4-DIONE, 2,5-DIHYDRO-3,6-DIPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a8cf192b-7663-4ef9-b7bd-88fcbb9f2d05",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6e71c09-26ff-4982-a04b-a07a7c90aba9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391995000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39649679-6c61-575a-bbd8-008c30dc0209",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54660-00-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "549f5cde-13f2-4c6b-9c20-84eb5bcb629b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bc75f361-5d35-52fb-4448-9fb29a342898",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9f049a52-9879-4862-9c93-c6e2af0d06dd",
          "id": "9f049a52-9879-4862-9c93-c6e2af0d06dd",
          "molfile": "\n  Marvin  01132108162D          \n\n 22 25  0  0  0  0            999 V2000\n    2.7261    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2456   -0.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0621   -0.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3590   -1.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7247   -1.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5088   -2.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0283   -3.3266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6856   -2.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3887   -1.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0297   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5924   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0054   -2.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2092   -2.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5803   -0.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3765   -0.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1552   -1.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7423   -0.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5385   -1.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7476   -2.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1674   -2.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3712   -2.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 17  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2c3c(C(=NC3=O)c4ccccc4)c([nH]2)O",
          "formula": "C18H12N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b3874f43-9b54-4251-b2b7-d0d2cf2d300a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.3008",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c560e4a-721d-4c23-9703-30d4535aa15b",
      "version": "7",
      "structure": {
        "id": "18c54b16-bc23-454f-a613-17fa81949331",
        "molfile": "\n  Marvin  01132101282D          \n\n 22 25  0  0  0  0            999 V2000\n    3.0297   -1.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7247   -1.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3590   -1.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3887   -1.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2456   -0.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5088   -2.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0621   -0.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6856   -2.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5924   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1552   -1.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7261    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0283   -3.3266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3765   -0.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0054   -2.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7423   -0.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3712   -2.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2092   -2.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5385   -1.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1674   -2.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5803   -0.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7476   -2.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 12  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  1  0  0  0  0\n 10 16  2  0  0  0  0\n 13 20  1  0  0  0  0\n 14 17  2  0  0  0  0\n 15 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 22  2  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C2=C3C(=C(c4ccccc4)NC3=O)C(=O)N2",
        "formula": "C18H12N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "288.3008",
        "optical_activity": "NONE",
        "references": [
          "a8cf192b-7663-4ef9-b7bd-88fcbb9f2d05",
          "549f5cde-13f2-4c6b-9c20-84eb5bcb629b"
        ],
        "stereo_centers": 0
      },
      "unii": "5QGL2U8KQA"
    }
  ]
}