{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "62df20d8-6b21-4f7e-850f-38195fbc4a51",
          "code": "69777-71-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69777-71-5",
          "code_system": "CAS",
          "references": [
            "1434e1c8-ac1e-41f2-ba6b-7cb4aff241fb",
            "997cf655-0b95-4c5e-80f8-51c89b6a6b08"
          ]
        },
        {
          "uuid": "2749de1f-3b35-4062-b790-cb40f0bbf667",
          "code": "274-116-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.067.357",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1434e1c8-ac1e-41f2-ba6b-7cb4aff241fb"
          ]
        },
        {
          "uuid": "52b3e759-a3d0-4c1c-89b6-6afe60be6b7e",
          "code": "21118875",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21118875",
          "code_system": "PUBCHEM",
          "references": [
            "1434e1c8-ac1e-41f2-ba6b-7cb4aff241fb"
          ]
        },
        {
          "uuid": "99d67f19-d657-412f-b63d-1f20d97ffbc1",
          "code": "5Q8EJN5495",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2bf002c0-755d-62dc-971c-94393e474b3b",
          "code": "DTXSID60887672",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60887672",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf2b9df2-2a01-41cb-8216-a1d9290b2d04",
          "name": "(1,1'-BIPHENYL)-4-CARBOXYLIC ACID, 4'-HEPTYL-, 4-((2S)-2-METHYLBUTYL)PHENYL ESTER",
          "stdName": "(1,1'-BIPHENYL)-4-CARBOXYLIC ACID, 4'-HEPTYL-, 4-((2S)-2-METHYLBUTYL)PHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "756c0f85-fd7e-42ab-96de-2bf5155b4d9b",
            "48a0eb46-42c7-4778-b12d-f756c113dd08"
          ],
          "display_name": false
        },
        {
          "uuid": "07abf20e-e6b8-4c61-b9a3-1a26c87c3f7a",
          "name": "(1,1'-BIPHENYL)-4-CARBOXYLIC ACID, 4'-HEPTYL-, 4-(2-METHYLBUTYL)PHENYL ESTER, (S)-",
          "stdName": "(1,1'-BIPHENYL)-4-CARBOXYLIC ACID, 4'-HEPTYL-, 4-(2-METHYLBUTYL)PHENYL ESTER, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5142ea59-4d40-4af1-a251-d69741e6a6ff",
            "48a0eb46-42c7-4778-b12d-f756c113dd08"
          ],
          "display_name": false
        },
        {
          "uuid": "65bd7ac0-4705-4f06-8bb8-c39b28d03ffc",
          "name": "METHYLBUTYLPHENYL HEPTYLBIPHENYLCARBOXYLATE",
          "stdName": "METHYLBUTYLPHENYL HEPTYLBIPHENYLCARBOXYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "756c0f85-fd7e-42ab-96de-2bf5155b4d9b",
            "48a0eb46-42c7-4778-b12d-f756c113dd08",
            "51089b39-c7a9-48ce-a3e1-65404aa88850"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d5c8b254-0c2c-4df5-acf5-8467203e8f6a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5cfed94b-610a-416a-902b-5ef7d8082c55",
          "name": "METHYLBUTYLPHENYL HEPTYLBIPHENYLCARBOXYLATE, (2S)-",
          "stdName": "METHYLBUTYLPHENYL HEPTYLBIPHENYLCARBOXYLATE, (2S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "407282a7-ce3c-41a8-84eb-f22da9329ece",
            "48a0eb46-42c7-4778-b12d-f756c113dd08"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "756c0f85-fd7e-42ab-96de-2bf5155b4d9b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "48a0eb46-42c7-4778-b12d-f756c113dd08",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5142ea59-4d40-4af1-a251-d69741e6a6ff",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "407282a7-ce3c-41a8-84eb-f22da9329ece",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1434e1c8-ac1e-41f2-ba6b-7cb4aff241fb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391526000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c009d82d-9176-476f-8ee8-17eaf11b3160",
          "citation": "SRS import [5Q8EJN5495]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5Q8EJN5495",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391526000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51089b39-c7a9-48ce-a3e1-65404aa88850",
          "citation": "METHYLBUTYLPHENYL HEPTYLBIPHENYLCARBOXYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "997cf655-0b95-4c5e-80f8-51c89b6a6b08",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5b01ea9a-9ca1-483e-a410-9a1bbfb1ce2e",
          "id": "5b01ea9a-9ca1-483e-a410-9a1bbfb1ce2e",
          "molfile": "\n  Marvin  01132104432D          \n\n 33 35  0  0  1  0            999 V2000\n   10.6508   -7.4830    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.9365   -7.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6505   -8.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9359   -8.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3654   -7.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3657   -6.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6514   -5.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6517   -5.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3662   -4.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3665   -3.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6521   -3.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6524   -2.5330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9376   -3.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9373   -4.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2227   -5.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5084   -4.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5087   -3.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -3.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7937   -5.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7935   -5.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0788   -6.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3645   -5.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6499   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6496   -7.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9350   -7.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9347   -8.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2201   -8.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2198   -9.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5052   -9.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3647   -5.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0794   -4.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0806   -5.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0803   -5.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 33  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 32  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 19 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 31  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 30 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCc1ccc(cc1)-c2ccc(cc2)C(=O)Oc3ccc(cc3)C[C@@H](C)CC",
          "formula": "C31H38O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b906af36-26b5-453f-8ee3-0da780d6d178"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "442.6334",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "834be268-e80b-4e72-9234-7223b9d52223",
      "version": "4",
      "structure": {
        "id": "7c4f9e4a-9af2-49ef-af07-add2bd520244",
        "molfile": "\n  Marvin  01132106272D          \n\n 33 35  0  0  1  0            999 V2000\n    7.7937   -5.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5084   -4.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2227   -5.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9373   -4.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9376   -3.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6521   -3.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6524   -2.5330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3665   -3.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3662   -4.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6517   -5.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6514   -5.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3657   -6.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3654   -7.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6508   -7.4830    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6505   -8.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9359   -8.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9365   -7.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0803   -5.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0806   -5.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2232   -3.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5087   -3.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7935   -5.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0788   -6.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3645   -5.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3647   -5.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0794   -4.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5052   -9.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2198   -9.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2201   -8.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9347   -8.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9350   -7.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6496   -7.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6499   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  1  6  0  0  0\n 18 12  2  0  0  0  0\n 19 18  1  0  0  0  0\n  9 19  2  0  0  0  0\n  5 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n  2 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 22  1  2  0  0  0  0\n  1 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 24 33  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCc1ccc(cc1)-c2ccc(cc2)C(=O)Oc3ccc(cc3)C[C@@H](C)CC",
        "formula": "C31H38O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "442.6334",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c009d82d-9176-476f-8ee8-17eaf11b3160",
          "5142ea59-4d40-4af1-a251-d69741e6a6ff"
        ],
        "stereo_centers": 1
      },
      "unii": "5Q8EJN5495"
    }
  ]
}