{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "180b38cc-8d63-4d4d-9171-55b65ef53a42",
          "code": "3493-12-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3493-12-7",
          "code_system": "CAS",
          "references": [
            "13a674ac-2064-4eed-86fc-e6b2eafa71f0",
            "dfe21027-97fa-45fb-b048-47c4e68f0bf4"
          ]
        },
        {
          "uuid": "a583ab90-c655-4579-9ed3-78f094399539",
          "code": "m7440",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7440?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "13a674ac-2064-4eed-86fc-e6b2eafa71f0"
          ]
        },
        {
          "uuid": "b56685ff-1b76-478f-9529-d27bfeb72b69",
          "code": "14220",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14220",
          "code_system": "PUBCHEM",
          "references": [
            "13a674ac-2064-4eed-86fc-e6b2eafa71f0"
          ]
        },
        {
          "uuid": "9c508569-b970-df5d-2d0c-f9ba8a752040",
          "code": "DTXSID6046713",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046713",
          "code_system": "EPA CompTox",
          "references": [
            "777d6f5f-b356-4275-5abc-f3ef08a69d3c"
          ]
        },
        {
          "uuid": "b9160329-214b-4638-8319-ec2a0267b81c",
          "code": "5Q59I6H55O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d17a13d8-defe-9aa9-1a43-65f656b13c0f",
          "code": "1417",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1417/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "7e3cb846-ede3-9042-c130-92b97fbb519a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "59a88e14-0b10-4420-a0b9-ebcb4adf80d1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "56757408-8533-45da-97f6-01f4b39c0d08",
            "refuuid": "5bcbe43c-79a9-4277-ab08-ba417bc3b098",
            "name": "METHYLMETHIONINE, DL-",
            "unii": "417CIJ6KXC",
            "linking_id": "417CIJ6KXC",
            "ref_pname": "METHYLMETHIONINE, DL-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9c097916-2978-4d56-9f4d-f44d3b978e10",
          "name": ".GAMMA.-DIMETHYLSULFONIUM-.ALPHA.-AMINOBUTYRIC ACID CHLORIDE",
          "stdName": ".GAMMA.-DIMETHYLSULFONIUM-.ALPHA.-AMINOBUTYRIC ACID CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd"
          ],
          "display_name": false
        },
        {
          "uuid": "466e089a-8837-4a79-69d0-13fea3681f45",
          "name": "CABAGIN-U",
          "stdName": "CABAGIN-U",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30da84c7-9054-1096-1666-391fcbe2d732"
          ],
          "display_name": false
        },
        {
          "uuid": "37fc74bd-8e5a-4443-9d41-fc26fe1479b1",
          "name": "DL-(3-AMINO-3-CARBOXYPROPYL)DIMETHYLSULFONIUM CHLORIDE [FHFI]",
          "stdName": "DL-(3-AMINO-3-CARBOXYPROPYL)DIMETHYLSULFONIUM CHLORIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16b12086-772f-4c7e-b72a-08a6e3813412"
          ],
          "display_name": false
        },
        {
          "uuid": "f9b57ecb-e49e-4e21-8d12-04515294bdca",
          "name": "DL-METHIONINE METHYLSULFONIUM CHLORIDE",
          "stdName": "DL-METHIONINE METHYLSULFONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd"
          ],
          "display_name": false
        },
        {
          "uuid": "8ab4ba48-74b4-49b7-a9fc-de969063eb23",
          "name": "DL-METHIONINE METHYLSULPHONIUM CHLORIDE",
          "stdName": "DL-METHIONINE METHYLSULPHONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd"
          ],
          "display_name": false
        },
        {
          "uuid": "6c1b5874-1b48-41c7-a2d6-eb9ddb759f99",
          "name": "FEMA NO. 3445",
          "stdName": "FEMA NO. 3445",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eaa85cd-7209-4b3a-8d45-f9334a006e30"
          ],
          "display_name": false
        },
        {
          "uuid": "aa35a377-d0eb-45e7-b0e9-7265eeec6882",
          "name": "METHYLMETHIONINE CHLORIDE, DL-",
          "stdName": "METHYLMETHIONINE CHLORIDE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff72c0e3-97a8-422f-a167-69451d8595b4"
          ],
          "display_name": true
        },
        {
          "uuid": "da5cd6f7-9cea-4c79-99a5-c7e5bdb956a3",
          "name": "METHYLMETHIONINE SULFONIUM CHLORIDE, DL-",
          "stdName": "METHYLMETHIONINE SULFONIUM CHLORIDE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9811e092-8ff2-492b-99f3-f81c54ff8f50"
          ],
          "display_name": false
        },
        {
          "uuid": "04609651-6477-4aaa-a05e-65a35d6c182c",
          "name": "S-METHYLMETHIONINE DL-FORM CHLORIDE [MI]",
          "stdName": "S-METHYLMETHIONINE DL-FORM CHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a6177cf-a56f-40da-804f-4da425acdd43"
          ],
          "display_name": false
        },
        {
          "uuid": "46f75700-acb0-4258-804a-aa44bbc7b0ea",
          "name": "SULFONIUM, (3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, CHLORIDE, (±)-",
          "stdName": "SULFONIUM, (3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, CHLORIDE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd"
          ],
          "display_name": false
        },
        {
          "uuid": "271fb6c0-85ad-0e00-c1db-7bcc6dff0ffa",
          "name": "VITAS-U",
          "stdName": "VITAS-U",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30da84c7-9054-1096-1666-391fcbe2d732"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9811e092-8ff2-492b-99f3-f81c54ff8f50",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ff72c0e3-97a8-422f-a167-69451d8595b4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16b12086-772f-4c7e-b72a-08a6e3813412",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eaa85cd-7209-4b3a-8d45-f9334a006e30",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a6177cf-a56f-40da-804f-4da425acdd43",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13a674ac-2064-4eed-86fc-e6b2eafa71f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392305000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78fbbd98-77ad-4b56-a68f-68f3f501b818",
          "citation": "SRS import [5Q59I6H55O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5Q59I6H55O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392305000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "777d6f5f-b356-4275-5abc-f3ef08a69d3c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3493-12-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30da84c7-9054-1096-1666-391fcbe2d732",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dfe21027-97fa-45fb-b048-47c4e68f0bf4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7e3cb846-ede3-9042-c130-92b97fbb519a",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d322a078-c233-4fda-9341-772f3e2be520",
          "id": "d322a078-c233-4fda-9341-772f3e2be520",
          "molfile": "\n  Marvin  01132110552D          \n\n  1  0  0  0  0  0            999 V2000\n   17.2180   -9.0735    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5995016d-9b86-4b41-93da-1b1832fc299b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a1d5f6ae-d23e-45f6-970c-ccc2d3f55058",
          "id": "a1d5f6ae-d23e-45f6-970c-ccc2d3f55058",
          "molfile": "\n  Marvin  01132108242D          \n\n 10  9  0  0  0  0            999 V2000\n   11.6077   -8.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3563   -9.0268    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n   12.3563   -9.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9950   -8.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7257   -9.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4246   -8.6223    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   14.4246   -7.6878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1238   -9.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8151   -8.6330    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.1238   -9.9222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  2   2   1   9  -1\nM  END",
          "smiles": "C[S+](C)CCC(C(=O)[O-])N",
          "formula": "C6H13NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ddc5f39a-8c53-4321-a82f-5548ba61245d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "163.2392",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f55bd541-26ba-49b0-89c3-7a18aa0d8838",
      "version": "5",
      "structure": {
        "id": "46d9fe20-5dbf-487a-ba30-face6062e7be",
        "molfile": "\n  Marvin  01132103432D          \n\n 11  9  0  0  0  0            999 V2000\n   14.4246   -8.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7257   -9.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9950   -8.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3563   -9.0268    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n   11.6077   -8.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3563   -9.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1238   -9.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8151   -8.6330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1238   -9.9222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4246   -7.6878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2180   -9.0735    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  1 10  1  0  0  0  0\nM  CHG  2   4   1  11  -1\nM  END",
        "smiles": "C[S+](C)CCC(C(=O)O)N.[Cl-]",
        "formula": "C6H14NO2S.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.7001",
        "optical_activity": "( + / - )",
        "references": [
          "78fbbd98-77ad-4b56-a68f-68f3f501b818",
          "e0568d21-7f6d-4b1c-a2e1-ddb2397441fd"
        ],
        "stereo_centers": 1
      },
      "unii": "5Q59I6H55O"
    }
  ]
}