{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ca047ad-f3b0-423b-87fc-ed5624dd1916",
          "code": "m2309",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2309?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "7f26a42c-17ea-46af-b5ad-da7a863ce159",
          "code": "DB00436",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00436",
          "code_system": "DRUG BANK",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "6c40035b-18d2-4d80-99c9-24f03947ad45",
          "code": "SUB20550",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "76f43045-5a90-43c8-a582-77934e2c2d64",
          "code": "CHEMBL1684",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1684",
          "code_system": "ChEMBL",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "99192768-dda2-47e9-8256-5d2010038f29",
          "code": "2315",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2315",
          "code_system": "PUBCHEM",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "8df5ce1a-3b82-4cc8-89b4-361867f49818",
          "code": "N0000166469",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazides [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000166469",
          "code_system": "NDF-RT",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "c0a9a726-43c6-47c4-8cfb-611e35d8b156",
          "code": "N0000166469",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Thiazides [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000166469",
          "code_system": "NDF-RT",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "e04cacf1-4c5c-4930-bd40-434a73522b2a",
          "code": "C03AA01",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, plain|bendroflumethiazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03AA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "b2347d7b-de88-4c30-9861-c8c7ca708963",
          "code": "N0000175419",
          "comments": "Established Pharmacologic Class [EPC]|Thiazide Diuretic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175419",
          "code_system": "NDF-RT",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "1e45aec4-4e80-41ba-b6b9-1a2d6a4eb35d",
          "code": "N0000175359",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175359",
          "code_system": "NDF-RT",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "c98822c1-76b7-46fc-9469-39d8a1a363aa",
          "code": "QC03AA01",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides, plain|bendroflumethiazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03AA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "fc27e20d-573b-4984-936a-671c39562644",
          "code": "QC03AB01",
          "comments": "VATC|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides and potassium in combination|bendroflumethiazide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03AB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "606e4b0a-315f-4166-8869-05b35dd340f0",
          "code": "QC03EA13",
          "comments": "VATC|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|Low-ceiling diuretics and potassium-sparing agents|bendroflumethiazide and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03EA13&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "1e8f4477-f559-46d4-8259-98c01318bd02",
          "code": "73-48-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=73-48-3",
          "code_system": "CAS",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c",
            "2b626052-d8a6-46f6-a495-d486738cbcb4"
          ]
        },
        {
          "uuid": "4f0f6068-1569-4d7a-8b34-0b36dc84b476",
          "code": "C47410",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47410",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "9c3cabf0-0312-4248-b307-96d79e20eaf2",
          "code": "D001539",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001539",
          "code_system": "MESH",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "c1bc8b98-a717-45f4-88c2-cc3a3ad397cb",
          "code": "95",
          "comments": "LiverTox|Cardiac|Diuretic|Thiazide",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/ThiazideDiuretics.htm",
          "code_system": "LIVERTOX",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "a03977bb-b965-4b11-8c97-2d733563f3fc",
          "code": "BENDROFLUMETHIAZIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bendroflumethiazide",
          "code_system": "WIKIPEDIA",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "ffdb80e1-61b6-491e-a4c1-ec35df6bf2d8",
          "code": "C03AB01",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|LOW-CEILING DIURETICS, THIAZIDES|Thiazides and potassium in combination|bendroflumethiazide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03AB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "a4d12713-67f2-456f-b887-04c2359933a9",
          "code": "C03EA13",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|Low-ceiling diuretics and potassium-sparing agents|bendroflumethiazide and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03EA13&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "bc9c5b87-2b8e-4927-8727-a482e0cb6795",
          "code": "SUB05711MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "46029ffa-b427-448e-944c-9f39c41b6921",
          "code": "994",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=994",
          "code_system": "INN",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "6abea81f-8efe-4147-a6a2-22126a52f900",
          "code": "200-800-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.728",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "1341600e-d3bb-433d-b693-7a8925095f38",
          "code": "7122",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7122",
          "code_system": "IUPHAR",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "c2c55b09-312f-4bbe-bdbb-e3b55bf7b781",
          "code": "1369",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1369/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c"
          ]
        },
        {
          "uuid": "2c69a4dd-9db8-024b-816e-f3a6dd629a97",
          "code": "3293",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3293",
          "code_system": "HSDB",
          "references": [
            "93f6713d-3fcc-4806-230f-00031f5b9898"
          ]
        },
        {
          "uuid": "edf04509-67bc-aa0a-053c-b0ed514a2d3b",
          "code": "DTXSID5022647",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5022647",
          "code_system": "EPA CompTox",
          "references": [
            "de333f41-4cd5-8c3b-4dc9-414bd30da3a4"
          ]
        },
        {
          "uuid": "5b81721d-1af0-0541-9f13-9348faa85922",
          "code": "C49185",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Thiazide Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49185",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "3ec0ba6c-4687-4d20-bf27-baa49f4dea06",
          "code": "5Q52X6ICJI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e6572edd-3acb-863f-5e43-9fbaf1158a5b",
          "code": "Bendroflumethiazide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM27/",
          "code_system": "LACTMED",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "e21e34d1-103d-0eee-8028-735d51a963bc",
          "code": "305",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/305",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "d5f05f51-5b54-95f9-f5ef-9afd7250e315",
          "code": "3013",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3013",
          "code_system": "CHEBI",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "7aaa6b23-4cf4-a068-d3c7-d427fac2bf34",
          "code": "59243",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:59243",
          "code_system": "CHEBI",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "8e290864-f9da-ff1b-709a-627b90a21d8c",
          "code": "1049000",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1049000",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e30fbd00-9008-4c7e-a343-e734385a3cd0"
          ]
        },
        {
          "uuid": "5d9cd19f-c370-9513-ccd1-6447e72c99a1",
          "code": "100000092763",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "73f29784-799f-e07f-d68b-b476bce66768"
          ]
        },
        {
          "uuid": "f97e91d2-9058-16c1-3ef6-a242a26fb22c",
          "code": "5Q52X6ICJI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5Q52X6ICJI",
          "code_system": "DAILYMED",
          "references": [
            "345022f7-f251-985b-df36-34873e0b831c"
          ]
        },
        {
          "uuid": "f0dc7ffe-7230-6df9-143d-8389753aeb4b",
          "code": "758229",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758229",
          "code_system": "NSC",
          "references": [
            "6eb09427-a2b9-1119-1fe8-d785d0cacda8"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e5ddfcf0-a829-4285-abdb-6cdd2b0edcd7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e44dd157-2c59-47bb-a738-6ff43d2f0402",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2997996-24ec-4e77-acb8-247471287ac4",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8560485-63d4-4da3-b548-6c547f5b28c0",
          "citation": "INN Proposed List 11",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL11.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5b5cb436-28ec-4dd9-8f67-aa7523ef6b58",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "506f511b-10c3-40d4-8352-69e9b0d35fb0",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72da8e7e-9068-4b39-bbb6-3b43ce8ced96",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2b20936-7b59-4be7-b206-2d57d705ca03",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78b49239-49c7-416d-8f59-36a7ddb300c5",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0b9e7d3-e871-4c38-a596-7c5962265a6d",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa0f7574-c13c-4b51-9a0f-8f5c40de3ce5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5de0359-185d-4176-9ecf-bcbfdfcc0d58",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b7bcbdc-a506-4151-9eae-fcc7c770eff6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "618d5d23-b0b8-42e9-b340-5c85e7ee5aa9",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f565a3c9-9c16-41a8-9870-38d64318e9bf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1c412f3-a565-4ae2-b14f-8bb33b1ce312",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6b1b06e-bd8d-4c3c-a2d4-540e0247d42c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390988000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9c2c2c0-0e65-4b4f-adab-2c54a26ef525",
          "citation": "SRS import [5Q52X6ICJI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5Q52X6ICJI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390988000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfc20223-f6ad-4609-8408-85dfe8b69e41",
          "citation": "BENDROFLUMETHIAZIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f72864e8-6359-4298-9e2a-18abcd28b956",
          "citation": "BENDROFLUMETHIAZIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ee9d484-5b55-42ac-ab56-83f30b4fb111",
          "citation": "BENDROFLUMETHIAZIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "88a54b3e-dc38-46db-9635-97d486f670b9",
          "citation": "BENDROFLUMETHIAZIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1bd6f77c-68aa-47ef-9713-5527f4e3718f",
          "citation": "BENDROFLUMETHIAZIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0368ef60-8ae0-4f80-896e-528eefe94dc1",
          "citation": "BENDROFLUMETHIAZIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc705497-537f-4c19-be74-3b41e8f221c8",
          "citation": "BENDROFLUMETHIAZIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fc11c0e4-c160-409a-a937-c036ccf321f8",
          "citation": "BENDROFLUMETHIAZIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70791a84-ed4b-441d-83fc-71d462b66377",
          "citation": "BENDROFLUMETHIAZIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15772978-c625-4fe5-b512-70fda554d748",
          "citation": "BENDROFLUMETHIAZIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87e95cc0-fb94-40e5-b55d-7164990ac91d",
          "citation": "BENDROFLUMETHIAZIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93f6713d-3fcc-4806-230f-00031f5b9898",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+73-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "de333f41-4cd5-8c3b-4dc9-414bd30da3a4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=73-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "abe6ab5f-0221-7f39-f971-e917db4a1cec",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+73-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8abf438a-c22c-6e0f-8c7e-392c71e5fc01",
          "citation": "https://www.drugbank.ca/drugs/DB00436",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "73f29784-799f-e07f-d68b-b476bce66768",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "0a4e3927-c6d7-f72f-3fd5-63782c5bac4b",
          "citation": "https://www.drugbank.ca/drugs/DB00436",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "e30fbd00-9008-4c7e-a343-e734385a3cd0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2b626052-d8a6-46f6-a495-d486738cbcb4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "330b3b0e-5864-4ee9-9236-49b96dc3dc66",
          "citation": "USP43-NF38 - 496, Bendroflumethiazide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a947b1d-b250-532d-4ad2-82a47f3b803d",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "6eb09427-a2b9-1119-1fe8-d785d0cacda8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "07b11156-05c8-d5ef-366f-654cae6cd169",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fd625571-f194-edcb-3f03-9ff501bbd52d",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "345022f7-f251-985b-df36-34873e0b831c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b7f2b42b-126b-4f68-8d59-d8a70d58fc49",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "173453ea-27ba-4b28-bc85-0cc632068992",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "095168f1-8e8b-4967-b14e-65dd2323de90",
          "id": "095168f1-8e8b-4967-b14e-65dd2323de90",
          "molfile": "\n  Marvin  01132100452D          \n\n 27 29  0  0  0  0            999 V2000\n    5.8748   -4.8685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1643   -4.4598    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7526   -3.7464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5732   -3.7464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394   -4.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7232   -4.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0128   -4.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0128   -5.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3024   -6.0806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5861   -5.6660    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8612   -6.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1566   -5.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5712   -6.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2758   -5.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2527   -4.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5248   -4.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1769   -4.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5861   -4.8598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3024   -4.4424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8906   -3.7290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7112   -3.7290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7232   -6.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394   -5.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1644   -6.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8748   -5.6515    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1615   -6.8839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8748   -6.4721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 23  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 22  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 18  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CC2Nc3cc(c(cc3S(=O)(=O)N2)S(=O)(=O)N)C(F)(F)F",
          "formula": "C15H14F3N3O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3396c75f-f8a0-4ff1-bb4e-f43a266eee9a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "421.4173",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9cf8f038-36e5-421f-82f6-e27f209a0beb",
      "version": "39",
      "structure": {
        "id": "7aaf4ee0-456b-425f-a6ad-c29a5c91d4c3",
        "molfile": "\n  Marvin  01132106222D          \n\n 27 29  0  0  0  0            999 V2000\n    2.3024   -4.4424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0128   -4.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5861   -4.8598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1643   -4.4598    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394   -5.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4394   -4.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0128   -5.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1644   -6.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7232   -4.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3024   -6.0806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5861   -5.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7232   -6.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8612   -6.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1566   -5.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1769   -4.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5712   -6.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2758   -5.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5248   -4.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2527   -4.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8906   -3.7290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7112   -3.7290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8748   -4.8685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7526   -3.7464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5732   -3.7464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8748   -5.6515    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1615   -6.8839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8748   -6.4721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  9  2  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  7  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 15  2  0  0  0  0\n 19 18  1  0  0  0  0\n  7 10  1  0  0  0  0\n  5 12  2  0  0  0  0\n 17 19  2  0  0  0  0\n  1 20  2  0  0  0  0\n  2  1  1  0  0  0  0\n  1 21  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4 22  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4 23  2  0  0  0  0\n  5  6  1  0  0  0  0\n  4 24  2  0  0  0  0\n  6  9  2  0  0  0  0\n  8 25  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8 26  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8 27  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CC2Nc3cc(c(cc3S(=O)(=O)N2)S(=O)(=O)N)C(F)(F)F",
        "formula": "C15H14F3N3O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "421.4173",
        "optical_activity": "( + / - )",
        "references": [
          "f9c2c2c0-0e65-4b4f-adab-2c54a26ef525",
          "e5ddfcf0-a829-4285-abdb-6cdd2b0edcd7",
          "c8560485-63d4-4da3-b548-6c547f5b28c0"
        ],
        "stereo_centers": 1
      },
      "unii": "5Q52X6ICJI",
      "relationships": [
        {
          "uuid": "7ab50dfa-39af-4eed-8c9b-5a055d8f8aa3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0b049207-936f-4fe1-a653-8c8859fc23f8",
            "refuuid": "9cf8f038-36e5-421f-82f6-e27f209a0beb",
            "name": "BENDROFLUMETHIAZIDE",
            "unii": "5Q52X6ICJI",
            "linking_id": "5Q52X6ICJI",
            "ref_pname": "BENDROFLUMETHIAZIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3e237e2d-e6f3-4f7a-b57e-b5d6c881c43a",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "70c78ae5-bf62-4c76-8d97-b5992b90cb69",
            "refuuid": "3d610d50-4f4a-4a41-b7a1-f0b17637b5f9",
            "name": "BENDROFLUMETHIAZIDE, (S)-",
            "unii": "8G2L3JUW5S",
            "linking_id": "8G2L3JUW5S",
            "ref_pname": "BENDROFLUMETHIAZIDE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4a5cb333-170a-47db-a160-c4c0e78ce57e",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "9e069bdc-e919-46fd-928b-f27c2dbd7b25",
            "refuuid": "636afa39-fa0a-4514-8a93-92df68cba3c8",
            "name": "BENDROFLUMETHIAZIDE, (R)-",
            "unii": "VNN1HL1LXR",
            "linking_id": "VNN1HL1LXR",
            "ref_pname": "BENDROFLUMETHIAZIDE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2f3248b6-f7c0-48b8-b74b-96515187e2a1",
          "amount": {
            "uuid": "70faacb4-1685-41f1-9b39-979b30f82154"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "3f872ac8-1c8e-4b51-aea1-7256383120e4",
            "refuuid": "8fa0b735-3029-4fdf-ac9b-8de18ac25e80",
            "name": "SOLUTE CARRIER FAMILY 12 MEMBER 3",
            "unii": "X8CS9QK0G8",
            "linking_id": "X8CS9QK0G8",
            "ref_pname": "SOLUTE CARRIER FAMILY 12 MEMBER 3",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eacf5096-9456-4f57-a651-75e548072f4b",
          "amount": {
            "uuid": "5a933e1c-5f25-43a0-ae35-dfa68ab0c978",
            "average": 96,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "8abf438a-c22c-6e0f-8c7e-392c71e5fc01"
          ],
          "related_substance": {
            "uuid": "93ac6640-98a7-4536-8e91-d724ee5cce03",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "35c58628-7df3-4243-9722-0919bd4bcc7a",
          "amount": {
            "uuid": "4ef27539-e01c-43db-a5b1-45e8d58d9114",
            "units": "PERCENT PEAK AREA",
            "high_limit": 1.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "330b3b0e-5864-4ee9-9236-49b96dc3dc66"
          ],
          "related_substance": {
            "uuid": "4d8be535-54eb-48e1-8c43-07e4a6b8943a",
            "refuuid": "dee71f9e-fd6a-4167-b076-ab5e7fa55c19",
            "name": "2,4-DISULFAMOYL-5-TRIFLUOROMETHYLANILINE",
            "unii": "YBN90877RI",
            "linking_id": "YBN90877RI",
            "ref_pname": "2,4-DISULFAMOYL-5-TRIFLUOROMETHYLANILINE"
          }
        },
        {
          "uuid": "82a4e062-eb29-4851-b365-042a0065f912",
          "amount": {
            "uuid": "62c15c54-5955-4d1d-8529-d16d92fc06ff"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "173453ea-27ba-4b28-bc85-0cc632068992"
          ],
          "related_substance": {
            "uuid": "8ed96913-6e10-4eb0-bfed-45d0d12e0f0d",
            "refuuid": "5cff3859-ec68-45f4-bec2-978c61d5eacc",
            "name": "N-nitroso-bendroflumethiazide",
            "unii": "7EC33HYF85",
            "linking_id": "7EC33HYF85",
            "ref_pname": "N-nitroso-bendroflumethiazide",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "da4d5387-9607-4b6d-bdfb-014efb89ff3d",
          "name": "(±)-3-BENZYL-3,4-DIHYDRO-6-(TRIFLUOROMETHYL)-2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE 1,1-DIOXIDE",
          "stdName": "(+/-)-3-BENZYL-3,4-DIHYDRO-6-(TRIFLUOROMETHYL)-2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE 1,1-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e44dd157-2c59-47bb-a738-6ff43d2f0402"
          ],
          "display_name": false
        },
        {
          "uuid": "d6461947-6c2b-429d-abaa-a187b75cc92b",
          "name": "2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE, 3,4-DIHYDRO-3-(PHENYLMETHYL)-6-(TRIFLUOROMETHYL)-, 1,1-DIOXIDE, (±)-",
          "stdName": "2H-1,2,4-BENZOTHIADIAZINE-7-SULFONAMIDE, 3,4-DIHYDRO-3-(PHENYLMETHYL)-6-(TRIFLUOROMETHYL)-, 1,1-DIOXIDE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e44dd157-2c59-47bb-a738-6ff43d2f0402"
          ],
          "display_name": false
        },
        {
          "uuid": "0778635a-b5ce-464e-b133-f20acfb1c0d8",
          "name": "BENDROFLUAZIDE",
          "stdName": "BENDROFLUAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2997996-24ec-4e77-acb8-247471287ac4"
          ],
          "display_name": false
        },
        {
          "uuid": "e462dc30-7d8c-4101-8f01-1492462344ae",
          "name": "BENDROFLUMETHIAZIDE",
          "stdName": "BENDROFLUMETHIAZIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1bd6f77c-68aa-47ef-9713-5527f4e3718f",
            "fa0f7574-c13c-4b51-9a0f-8f5c40de3ce5",
            "5b5cb436-28ec-4dd9-8f67-aa7523ef6b58",
            "e5ddfcf0-a829-4285-abdb-6cdd2b0edcd7",
            "0b7bcbdc-a506-4151-9eae-fcc7c770eff6",
            "f565a3c9-9c16-41a8-9870-38d64318e9bf",
            "dfc20223-f6ad-4609-8408-85dfe8b69e41",
            "618d5d23-b0b8-42e9-b340-5c85e7ee5aa9",
            "72da8e7e-9068-4b39-bbb6-3b43ce8ced96",
            "70791a84-ed4b-441d-83fc-71d462b66377",
            "b1c412f3-a565-4ae2-b14f-8bb33b1ce312",
            "c8560485-63d4-4da3-b548-6c547f5b28c0",
            "f72864e8-6359-4298-9e2a-18abcd28b956",
            "87e95cc0-fb94-40e5-b55d-7164990ac91d",
            "506f511b-10c3-40d4-8352-69e9b0d35fb0",
            "9ee9d484-5b55-42ac-ab56-83f30b4fb111",
            "cc705497-537f-4c19-be74-3b41e8f221c8",
            "fc11c0e4-c160-409a-a937-c036ccf321f8",
            "c5de0359-185d-4176-9ecf-bcbfdfcc0d58",
            "88a54b3e-dc38-46db-9635-97d486f670b9",
            "0368ef60-8ae0-4f80-896e-528eefe94dc1",
            "15772978-c625-4fe5-b512-70fda554d748",
            "a2b20936-7b59-4be7-b206-2d57d705ca03"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bd6a7ebb-2f81-4211-8127-925c09ee6f54",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3ea8e259-582e-d5f2-653d-50260b05707c",
          "name": "BENDROFLUMETHIAZIDE [EP IMPURITY]",
          "stdName": "BENDROFLUMETHIAZIDE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b5cb436-28ec-4dd9-8f67-aa7523ef6b58"
          ],
          "display_name": false
        },
        {
          "uuid": "9687570e-7204-41e2-3ed6-5820c38b2693",
          "name": "BENDROFLUMETHIAZIDE [EP MONOGRAPH]",
          "stdName": "BENDROFLUMETHIAZIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a947b1d-b250-532d-4ad2-82a47f3b803d"
          ],
          "display_name": false
        },
        {
          "uuid": "168f45d0-a931-4555-8b94-2d89179569ea",
          "name": "BENDROFLUMETHIAZIDE [HSDB]",
          "stdName": "BENDROFLUMETHIAZIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b7bcbdc-a506-4151-9eae-fcc7c770eff6"
          ],
          "display_name": false
        },
        {
          "uuid": "ee666326-b6da-4f20-88a7-5da9e173dbbf",
          "name": "BENDROFLUMETHIAZIDE [JAN]",
          "stdName": "BENDROFLUMETHIAZIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72da8e7e-9068-4b39-bbb6-3b43ce8ced96"
          ],
          "display_name": false
        },
        {
          "uuid": "d0304c92-038c-43f7-8e52-5dec54a7950a",
          "name": "BENDROFLUMETHIAZIDE [MART.]",
          "stdName": "BENDROFLUMETHIAZIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa0f7574-c13c-4b51-9a0f-8f5c40de3ce5"
          ],
          "display_name": false
        },
        {
          "uuid": "04637883-041d-4fd7-ac34-9cc4605faf68",
          "name": "BENDROFLUMETHIAZIDE [MI]",
          "stdName": "BENDROFLUMETHIAZIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5de0359-185d-4176-9ecf-bcbfdfcc0d58"
          ],
          "display_name": false
        },
        {
          "uuid": "7e2ab651-2cbb-4584-ac5b-a97dfb92b9d9",
          "name": "BENDROFLUMETHIAZIDE [ORANGE BOOK]",
          "stdName": "BENDROFLUMETHIAZIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2b20936-7b59-4be7-b206-2d57d705ca03"
          ],
          "display_name": false
        },
        {
          "uuid": "bccd067b-5652-833c-b8e9-17f357187a3d",
          "name": "BENDROFLUMETHIAZIDE [USP MONOGRAPH]",
          "stdName": "BENDROFLUMETHIAZIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd625571-f194-edcb-3f03-9ff501bbd52d"
          ],
          "display_name": false
        },
        {
          "uuid": "6767d818-1515-4dfc-a866-6c294d9b76db",
          "name": "BENDROFLUMETHIAZIDE [USP-RS]",
          "stdName": "BENDROFLUMETHIAZIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618d5d23-b0b8-42e9-b340-5c85e7ee5aa9"
          ],
          "display_name": false
        },
        {
          "uuid": "3ebd390c-cc95-4cd1-a798-722d6a9267b3",
          "name": "BENDROFLUMETHIAZIDE [VANDF]",
          "stdName": "BENDROFLUMETHIAZIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1c412f3-a565-4ae2-b14f-8bb33b1ce312"
          ],
          "display_name": false
        },
        {
          "uuid": "28668d8e-4f53-6ba9-c35f-3be38cbeea4b",
          "name": "Bendroflumethiazide [WHO-DD]",
          "stdName": "BENDROFLUMETHIAZIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "07b11156-05c8-d5ef-366f-654cae6cd169"
          ],
          "display_name": false
        },
        {
          "uuid": "f6888ba4-420d-483e-bc86-900fcb7a9266",
          "name": "CORZIDE COMPONENT BENDROFLUMETHIAZIDE",
          "stdName": "CORZIDE COMPONENT BENDROFLUMETHIAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0b9e7d3-e871-4c38-a596-7c5962265a6d",
            "78b49239-49c7-416d-8f59-36a7ddb300c5"
          ],
          "display_name": false
        },
        {
          "uuid": "912af3bd-94ae-40cf-bfd3-86656d9f2d2b",
          "name": "NATURETIN",
          "stdName": "NATURETIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e44dd157-2c59-47bb-a738-6ff43d2f0402"
          ],
          "display_name": false
        },
        {
          "uuid": "75f6efbf-1e3b-e2ed-4855-2ed7c67eda68",
          "name": "NSC-758229",
          "stdName": "NSC-758229",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eb09427-a2b9-1119-1fe8-d785d0cacda8"
          ],
          "display_name": false
        },
        {
          "uuid": "4f164dea-3209-4cc0-94c3-89ce9c746058",
          "name": "bendroflumethiazide [INN]",
          "stdName": "BENDROFLUMETHIAZIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8560485-63d4-4da3-b548-6c547f5b28c0"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "149f3092-545d-42b1-afec-87cf23524584",
          "name": "Biological Half-life",
          "value": {
            "uuid": "f36d0978-d16e-42bd-9270-8d8b396bc73f",
            "average": 8.5,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "8abf438a-c22c-6e0f-8c7e-392c71e5fc01"
          ]
        }
      ]
    }
  ]
}