{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "719463e2-5749-41e0-99d1-6637a4fa7de9", "code": "N0000007542", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Benzazepines [Chemical/Ingredient]|Benzodiazepines [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007542", "code_system": "NDF-RT", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "3351861e-acdf-449c-a1d4-e5f011fa735b", "code": "N03AE01", "comments": "ATC|NERVOUS SYSTEM|ANTIEPILEPTICS|ANTIEPILEPTICS|Benzodiazepine derivatives|clonazepam", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N03AE01&showdescription=yes", "code_system": "WHO-ATC", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "08e423d6-4901-4600-a8b7-b3a4dfe6e9ff", "code": "N0000175694", "comments": "Established Pharmacologic Class [EPC]|Benzodiazepine [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175694", "code_system": "NDF-RT", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "0b2c462e-202c-4de0-a27b-175786913242", "code": "QN03AE01", "comments": "VATC|ANTIEPILEPTICS|ANTIEPILEPTICS|Benzodiazepine derivatives|clonazepam", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN03AE01&showdescription=yes", "code_system": "WHO-VATC", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "5747b347-907f-42ae-9b92-7c3ce888a8bc", "code": "1622-61-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1622-61-3", "code_system": "CAS", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02", "aa518958-0c46-47c7-9c2f-aa662be6370a" ] }, { "uuid": "b432d24f-b141-4958-8b7c-f1c9ae764384", "code": "C28935", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28935", "code_system": "NCI_THESAURUS", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "5e48fe72-8b6b-409a-b536-0d944b577414", "code": "D002998", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68002998", "code_system": "MESH", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "eac19a8b-9745-465a-bb98-258b92cad4ee", "code": "NBK548030", "comments": "LiverTox|CNS|Anticonvulsant|Benzodiazepine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548030/", "code_system": "LIVERTOX", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "0465e0f8-2af4-493e-ba11-a352c6516c19", "code": "CLONAZEPAM", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Clonazepam", "code_system": "WIKIPEDIA", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "b702bc90-ef2e-4038-811d-7e85f7c08b63", "code": "SUB06728MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "aa64d947-41ed-4dcb-ab8b-67dfd1400aad", "code": "2765", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2765", "code_system": "INN", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "99e81a3b-74b9-49b9-a5df-8408171400ba", "code": "216-596-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.088", "code_system": "ECHA (EC/EINECS)", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "cd889b48-ac26-4a06-94e6-acb376ff4609", "code": "2737", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "fde5f739-507b-417f-969b-217a99725054", "code": "6963", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6963", "code_system": "IUPHAR", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "300cf441-c511-47da-a776-a9c3a7ac7fcb", "code": "2598", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2598/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "74fe2d09-f6f0-4f77-a33d-3518fc69bce3", "code": "m3649", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3649?q=authorize", "code_system": "MERCK INDEX", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "544caf06-3b99-41bd-b52b-b51198d15551", "code": "DB01068", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01068", "code_system": "DRUG BANK", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "c26c4cbc-89b4-4e16-944a-24fb052da67f", "code": "CHEMBL452", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL452", "code_system": "ChEMBL", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "0128d8bf-bea5-451b-8ad9-132a17291e03", "code": "2802", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2802", "code_system": "PUBCHEM", "references": [ "50be2abe-95a8-4a9a-bd9c-352b21d3cc02" ] }, { "uuid": "c70c22af-10d0-0b76-e09b-e04ed731bf18", "code": "3265", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3265", "code_system": "HSDB", "references": [ "6ad71533-2aaa-12cd-94ec-fee9276448db" ] }, { "uuid": "a7742f5a-1aab-4aae-723d-07df0cf9ab56", "code": "DTXSID1022845", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022845", "code_system": "EPA CompTox", "references": [ "3ec23eba-2736-bc4f-979b-0b236c3591ea" ] }, { "uuid": "f2405ae2-f233-0739-b617-de850e500046", "code": "82794", "comments": "ORPHAN DRUG|Designated|Treatment of hyperekplexia (startle disease).", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=82794", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "30d8824a-cf90-b060-be62-a7f6eb5f0325", "code": "243507", "comments": "ORPHAN DRUG|Designated|Treatment of recurrent acute repetitive seizures", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=243507", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "a22120dd-210b-d99f-f82a-7329585a38b6", "code": "C1012", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012", "code_system": "NCI_THESAURUS", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "30234e61-9ff2-3247-5229-e8a68a1a8706", "code": "C264", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264", "code_system": "NCI_THESAURUS", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "b56302c3-6f79-48f4-94d2-2f0e43cc674b", "code": "5PE9FDE8GB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4fe24497-829a-6ff7-0db9-af0f0a3f9892", "code": "Clonazepam", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM344/", "code_system": "LACTMED", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "36f4b16b-e3ad-89a6-fe57-6b78f57ceda8", "code": "703", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/703", "code_system": "DRUG CENTRAL", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "744da87f-1701-7c93-e557-7bfecaa5f245", "code": "3756", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3756", "code_system": "CHEBI", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "6d0160e0-0b58-6be4-04bd-bc50154d4232", "code": "1140305", "type": "PRIMARY", "url": "https://store.usp.org/product/1140305", "code_system": "RS_ITEM_NUM", "references": [ "7fc47433-a1fa-5053-697d-086c4e6e5831" ] }, { "uuid": "0906b075-b776-c1c4-697f-2934287208c7", "code": "100000084528", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "32bcb6e8-8bb0-6d5e-d2de-c2eed951956b" ] }, { "uuid": "50a44b2b-d070-2158-a7e3-0b1cbda89662", "code": "5PE9FDE8GB", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5PE9FDE8GB", "code_system": "DAILYMED", "references": [ "0faa7141-9306-958d-ca5d-ce84fbca20ad" ] }, { "uuid": "42f2e1b6-acbd-43e5-d5b1-6421a2855708", "code": "179913", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=179913", "code_system": "NSC", "references": [ "7cb3c228-21a4-d739-affa-ce40e196a0f8" ] } ], "substance_class": "chemical", "references": [ { "uuid": "7168bc7f-9608-4bb3-961e-e2e5e6db4812", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8337c221-12de-4fae-ac00-b30710edde16", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "119e6ebf-d879-478a-ba51-24aa5b80cdca", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5f524c1-4e1b-4365-9bf6-4d684c272581", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "999b0472-a8d4-4b3b-825e-9cb5c69edd71", "citation": "INN Proposed List 22", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL22.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c8a7933e-48e3-4c4d-99fd-ab52e8049f62", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "076844eb-8677-4de6-96b9-8a837896e07a", "citation": "EP 7.2", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c561c97b-e666-4e58-af12-c8ce874f4510", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a52b21a9-cf55-4806-8007-be4ebe8a0b53", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "342b40a9-4e71-483c-aefa-6767c79db5e7", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8bc1d12a-aa0d-4b8f-ae9a-932fb7413036", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8ac0e4f5-80db-43b6-a91e-7f67764286fc", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "30837a5c-5236-4dc7-8276-805335193572", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d6412e7f-6339-4951-90ad-5a2234357e5b", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3c9cc106-8b30-45ed-b1fc-94d650d40fd1", "citation": "USP-RS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96454edd-10c8-4d22-8dfc-9684a0784e6b", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f0e97c8d-7332-44fb-b958-6404d3bcbae8", "citation": "CHEMBL", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "50be2abe-95a8-4a9a-bd9c-352b21d3cc02", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389669000, "tags": [ "NOMEN" ] }, { "uuid": "eca1d9bd-9234-4905-9be5-1fddfce1607b", "citation": "PHARMACOLOGY & THERAPEUTICS\\\\n\\\\nVOLUME 10, ISSUE 1, 1980, PAGES 65?101", "url": "http://www.sciencedirect.com/science/article/pii/0163725880900091", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "98217acb-6a46-43ea-bf1a-a3c0a4e852a9", "citation": "SRS import [5PE9FDE8GB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5PE9FDE8GB", "doc_type": "SRS", "public_domain": true, "document_date": 1493389669000, "tags": [ "NOMEN" ] }, { "uuid": "0d84f3de-d38e-471b-9ca3-3379dc02f909", "citation": "CLONAZEPAM [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "635b6496-4f02-4ced-9404-c50e04ad7750", "citation": "CLONAZEPAM [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c064bb65-6126-4e1b-8a88-6b2c19ed8fbf", "citation": "CLONAZEPAM [EP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "56a82e09-93e1-4650-91e7-7f9cdee7845d", "citation": "CLONAZEPAM [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ff7b4623-9119-41c8-8538-fa7cf2309da0", "citation": "CLONAZEPAM [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "8e9f01bb-b76e-4be1-aa57-40b29390611a", "citation": "CLONAZEPAM [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5cadf916-914f-4b1b-80ae-2c740889426e", "citation": "CLONAZEPAM [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c7a87d4d-02d5-4bfe-a14d-f787c04ec7aa", "citation": "CLONAZEPAM [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d0010529-9476-4bab-aa36-59959f57cf1d", "citation": "CLONAZEPAM [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "50d91ff2-4225-4735-8f2d-45e9aa4ae741", "citation": "CLONAZEPAM [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d7438058-d24a-47f0-906a-3d4c451f0944", "citation": "CLONAZEPAM CIV [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d83cdc87-685f-b335-5566-543834d29f88", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6ad71533-2aaa-12cd-94ec-fee9276448db", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1622-61-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3ec23eba-2736-bc4f-979b-0b236c3591ea", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1622-61-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9e039c70-0a97-ade0-81f9-7eba74bef81f", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+1622-61-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "45241fae-1f17-db8a-d987-c74c878d6edd", "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549280#f_pharmacokinetics", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "32bcb6e8-8bb0-6d5e-d2de-c2eed951956b", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392", "citation": "CLONAZEPAM", "doc_type": "MICROMEDEX", "public_domain": true }, { "uuid": "7fc47433-a1fa-5053-697d-086c4e6e5831", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "e4fa5fd2-9774-4f83-ab8e-e78637f6c862", "citation": "https://www.uniprot.org/uniprot/P11245", "url": "https://www.uniprot.org/uniprot/P11245", "doc_type": "UNIPROT", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "aa518958-0c46-47c7-9c2f-aa662be6370a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6cd1d3b2-70d6-4ab1-9949-01f79290cc28", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d2432954-9aed-2380-2869-380b960d9dff", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "25548215-8a8e-43ad-8aea-6adb9e1e8fb3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d9300893-ba46-f02a-c4aa-0859bf6bc467", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "7cb3c228-21a4-d739-affa-ce40e196a0f8", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "0faa7141-9306-958d-ca5d-ce84fbca20ad", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "1ff8352d-281b-40e2-9fa0-2403f468cc25", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "37e1da5f-bb7e-4731-b876-39474c9f68c9", "citation": "Basit, Hajira, and Chadi I. Kahwaji. \"Clonazepam.\" (2020).", "url": "https://europepmc.org/article/MED/32310470/NBK556010#free-full-text", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "33e55b3b-552b-7f8c-5a93-0640db4d8f2b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "7f697dd4-6700-4501-a892-a1a8ea36160d", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "4676a3c1-bbb1-4930-b34a-71e2b5b0ddde", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c200e4f9-d41b-434b-8363-19a41fd643c7", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "0dcce7f2-4ea8-4a11-b188-176327653d24", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "9b31b2b6-33e2-4254-8dcf-264d206ad68a", "citation": "USP-NF", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "26aef04f-bbdd-4499-9c99-dd2fd6908438", "id": "26aef04f-bbdd-4499-9c99-dd2fd6908438", "molfile": "\n Marvin 01132102082D \n\n 22 24 0 0 0 0 999 V2000\n 4.0955 -3.0775 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.1059 -2.2408 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 4.8183 -1.8444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3832 -1.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3962 -1.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6734 -0.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9507 -1.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3134 -0.4818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5233 -0.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1476 -1.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4896 -2.1398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3134 -2.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4792 -3.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2719 -3.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4506 -4.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8444 -4.7588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0595 -4.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8704 -3.6941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0803 -3.4532 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9507 -1.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6604 -2.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 22 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 3 0 0 0\n 7 21 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 21 13 2 3 0 0 0\n 15 14 1 0 0 0 0\n 19 14 2 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 22 21 1 0 0 0 0\nM CHG 2 1 -1 2 1\nM END", "smiles": "c1ccc(c(c1)C2=c3cc(ccc3=NC(=O)CN2)[N+](=O)[O-])Cl", "formula": "C15H10ClN3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b7213142-9792-454b-83f2-05823eb4da83" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.7117", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "47042fc5-f0d2-4285-8e16-8bf517b95ded", "version": "78", "structure": { "id": "acd5ec21-3785-4c84-a3aa-64e03f35349c", "molfile": "\n JSDraw208122415142D\n\n 22 24 0 0 0 0 0 V2000\n 21.3020 -7.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5071 -6.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7443 -7.2429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5824 -7.4339 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 22.5071 -5.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3020 -4.1078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6156 -9.1386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8491 -7.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2158 -6.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8080 -4.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5627 -9.0160 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 27.9295 -6.6844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0976 -5.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4644 -10.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8737 -4.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2404 -5.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8185 -3.1968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9704 -9.7264 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1145 -9.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8219 -11.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4524 -11.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3061 -12.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 9 1 0 0 0 0\n 5 2 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 13 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 4 2 0 0 0 0\n 13 3 1 0 0 0 0\n 14 7 2 0 0 0 0\n 15 5 1 0 0 0 0\n 16 9 1 0 0 0 0\n 17 10 2 0 0 0 0\n 18 14 1 0 0 0 0\n 19 7 1 0 0 0 0\n 20 14 1 0 0 0 0\n 21 19 2 0 0 0 0\n 22 21 1 0 0 0 0\n 6 10 1 0 0 0 0\n 20 22 2 0 0 0 0\n 15 16 2 0 0 0 0\nM CHG 2 4 1 11 -1\nM END", "smiles": "c1ccc(c(c1)C2=NCC(=O)Nc3ccc(cc32)[N+](=O)[O-])Cl", "formula": "C15H10ClN3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.7117", "optical_activity": "NONE", "references": [ "7168bc7f-9608-4bb3-961e-e2e5e6db4812", "98217acb-6a46-43ea-bf1a-a3c0a4e852a9", "999b0472-a8d4-4b3b-825e-9cb5c69edd71" ], "stereo_centers": 0 }, "unii": "5PE9FDE8GB", "relationships": [ { "uuid": "f135b63e-5365-4421-b0a2-43267d6ef938", "amount": { "uuid": "9bed8598-cc65-420c-8caf-0a77a90514f6" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "fa516cf3-4e9b-42a7-975d-81f5fd5e38f4", "refuuid": "47042fc5-f0d2-4285-8e16-8bf517b95ded", "name": "Clonazepam", "unii": "5PE9FDE8GB", "linking_id": "5PE9FDE8GB", "ref_pname": "Clonazepam", "substance_class": "reference" } }, { "uuid": "61e7d08e-436e-4f59-838c-d6f0d5fe8803", "amount": { "uuid": "2ae34158-43b4-48fb-a975-4c77fab2d505" }, "type": "METABOLITE INACTIVE->PARENT", "mediator_substance": { "uuid": "b44bafad-da22-4c82-b671-aa301077e849", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" }, "references": [ "eca1d9bd-9234-4905-9be5-1fddfce1607b" ], "related_substance": { "uuid": "164053ec-f5e7-4ca7-991b-e48273f8bc52", "refuuid": "20370e4c-daba-4548-9d3c-a266632eb282", "name": "7-AMINOCLONAZEPAM", "unii": "17D6640Q7Y", "linking_id": "17D6640Q7Y", "ref_pname": "7-AMINOCLONAZEPAM", "substance_class": "reference" } }, { "uuid": "0002d25f-88ae-424f-ba1f-76c1b58d9763", "amount": { "uuid": "4afaf0c4-a615-4018-8fd6-2a2893c9edee" }, "type": "METABOLITE INACTIVE->PARENT", "references": [ "eca1d9bd-9234-4905-9be5-1fddfce1607b" ], "related_substance": { "uuid": "d404af43-4cd6-4d1c-a1ae-7f5587dea26e", "refuuid": "86870998-a5ac-4704-98cf-708df80218db", "name": "7-ACETAMINOCLONAZEPAM", "unii": "6431E305BB", "linking_id": "6431E305BB", "ref_pname": "7-ACETAMINOCLONAZEPAM", "substance_class": "reference" } }, { "uuid": "bcca3cb6-6db3-4adf-9a84-e57d0450c242", "amount": { "uuid": "4bf6d013-80b1-49ec-968c-47ece055fe0d", "average": 85, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "45241fae-1f17-db8a-d987-c74c878d6edd" ], "related_substance": { "uuid": "13375e50-3c22-4618-a4d4-5084dcaaa9bf", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "bcf80f2d-dfea-468f-9f45-b866b2833aae", "amount": { "uuid": "f6eb27ef-cba4-4d4f-841e-f30539233926" }, "type": "IMPURITY->PARENT", "references": [ "0dcce7f2-4ea8-4a11-b188-176327653d24" ], "related_substance": { "uuid": "394315a2-9273-4fbb-8b66-0b89d82cb546", "refuuid": "47a3bb1b-bf2e-4ea0-9f3a-8931c9cac49a", "name": "3-Amino-4-(2-chlorophenyl)-6-nitrocarbostyril", "unii": "3M63K08UEY", "linking_id": "3M63K08UEY", "ref_pname": "3-Amino-4-(2-chlorophenyl)-6-nitrocarbostyril" } }, { "uuid": "7cfbcf96-a7fc-4d55-ba17-3c27610378af", "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "e4fa5fd2-9774-4f83-ab8e-e78637f6c862" ], "related_substance": { "uuid": "8d266b4d-30b9-43be-82d0-946601be5d60", "refuuid": "463ea1a6-dc7e-4a42-b799-8e2852d34a78", "name": "ARYLAMINE N-ACETYLTRANSFERASE 2", "unii": "R17Q1X3RGX", "linking_id": "R17Q1X3RGX", "ref_pname": "ARYLAMINE N-ACETYLTRANSFERASE 2" } }, { "uuid": "49568a85-1e1d-4811-83e2-e1e4a0073328", "amount": { "uuid": "12525df3-e931-4faf-a029-0549b9b130f7" }, "type": "IMPURITY->PARENT", "references": [ "9b31b2b6-33e2-4254-8dcf-264d206ad68a" ], "related_substance": { "uuid": "3be430e3-1b5c-4b1c-9aaa-1e5ab7234cc5", "refuuid": "68740dd1-a89a-473a-8503-2a8686db0c3f", "name": "2-Amino-2'-chloro-5-nitrobenzophenone", "unii": "RL4AJ2Z1GR", "linking_id": "RL4AJ2Z1GR", "ref_pname": "2-Amino-2'-chloro-5-nitrobenzophenone" } }, { "uuid": "9fe56f85-5ac2-47c4-889d-88488ac3cfe3", "amount": { "uuid": "22d8d928-44ff-4036-99e6-b2b031fb16d6" }, "type": "SALT/SOLVATE->PARENT", "references": [ "25548215-8a8e-43ad-8aea-6adb9e1e8fb3" ], "related_substance": { "uuid": "d86faf0d-1f5c-4277-89ce-286898d6e682", "refuuid": "0f828156-032b-4ddc-99d1-5f72a92b31a9", "name": "CLONAZEPAM HYDROCHLORIDE", "unii": "XXQ3A82WUX", "linking_id": "XXQ3A82WUX", "ref_pname": "CLONAZEPAM HYDROCHLORIDE" } }, { "uuid": "27df4e5f-4826-4bc2-a93e-807a297a6437", "amount": { "uuid": "dd6ba999-4b91-4237-ae2c-4e22ebd97017" }, "type": "TARGET->POSITIVE ALLOSTERIC MODULATOR (PAM)", "references": [ "37e1da5f-bb7e-4731-b876-39474c9f68c9" ], "related_substance": { "uuid": "768cd863-ef74-4c4f-9aea-f9faf7fe0dea", "refuuid": "45411db4-378d-416f-a8ad-88c8ddb55cdd", "name": "GABAA RECEPTOR", "unii": "RU3465V8V1", "linking_id": "RU3465V8V1", "ref_pname": "GABAA RECEPTOR", "substance_class": "reference" } } ], "names": [ { "uuid": "3fcad51b-c997-4e2f-888d-766fe2389236", "name": "2H-1,4-Benzodiazepin-2-one, 5-(2-chlorophenyl)-1,3-dihydro-7-nitro-", "stdName": "2H-1,4-BENZODIAZEPIN-2-ONE, 5-(2-CHLOROPHENYL)-1,3-DIHYDRO-7-NITRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8337c221-12de-4fae-ac00-b30710edde16" ], "display_name": false }, { "uuid": "6cf623cd-f572-4c28-8036-ec7b92970137", "name": "5-(o-Chlorophenyl)-1,3-dihydro-7-nitro-2H-1,4-benzodiazepin-2-one", "stdName": "5-(O-CHLOROPHENYL)-1,3-DIHYDRO-7-NITRO-2H-1,4-BENZODIAZEPIN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7168bc7f-9608-4bb3-961e-e2e5e6db4812" ], "display_name": false }, { "uuid": "a8381fb7-b2e8-4b74-aede-397c386d8a7c", "name": "Clonazepam", "stdName": "CLONAZEPAM", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0d84f3de-d38e-471b-9ca3-3379dc02f909", "635b6496-4f02-4ced-9404-c50e04ad7750", "999b0472-a8d4-4b3b-825e-9cb5c69edd71", "c561c97b-e666-4e58-af12-c8ce874f4510", "a52b21a9-cf55-4806-8007-be4ebe8a0b53", "50d91ff2-4225-4735-8f2d-45e9aa4ae741", "c8a7933e-48e3-4c4d-99fd-ab52e8049f62", "8bc1d12a-aa0d-4b8f-ae9a-932fb7413036", "c064bb65-6126-4e1b-8a88-6b2c19ed8fbf", "8ac0e4f5-80db-43b6-a91e-7f67764286fc", "076844eb-8677-4de6-96b9-8a837896e07a", "c7a87d4d-02d5-4bfe-a14d-f787c04ec7aa", "5cadf916-914f-4b1b-80ae-2c740889426e", "30837a5c-5236-4dc7-8276-805335193572", "d6412e7f-6339-4951-90ad-5a2234357e5b", "ff7b4623-9119-41c8-8538-fa7cf2309da0", "d0010529-9476-4bab-aa36-59959f57cf1d", "7168bc7f-9608-4bb3-961e-e2e5e6db4812", "342b40a9-4e71-483c-aefa-6767c79db5e7", "56a82e09-93e1-4650-91e7-7f9cdee7845d", "8e9f01bb-b76e-4be1-aa57-40b29390611a" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "bbcf21fa-f979-49c7-9250-8cb6d7c077fe", "name_org": "INN" }, { "uuid": "77b5942b-4989-4cbb-8609-94a16a02eecd", "name_org": "USAN" } ] }, { "uuid": "e2a6a3a0-1da2-4828-84e1-c08758232fa0", "name": "Clonazepam CIV", "stdName": "CLONAZEPAM CIV", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d7438058-d24a-47f0-906a-3d4c451f0944", "3c9cc106-8b30-45ed-b1fc-94d650d40fd1" ], "display_name": false }, { "uuid": "d685c011-4c4c-4953-adcd-96aa8f8f2aed", "name": "Clonazepam CIV [USP-RS]", "stdName": "CLONAZEPAM CIV [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3c9cc106-8b30-45ed-b1fc-94d650d40fd1" ], "display_name": false }, { "uuid": "911055f3-35fe-7e70-bf5f-db8924f1f937", "name": "Clonazepam [EP MONOGRAPH]", "stdName": "CLONAZEPAM [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d9300893-ba46-f02a-c4aa-0859bf6bc467" ], "display_name": false }, { "uuid": "da28d86c-4c75-4e7a-b93c-5a75d487af93", "name": "Clonazepam [HSDB]", "stdName": "CLONAZEPAM [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8ac0e4f5-80db-43b6-a91e-7f67764286fc" ], "display_name": false }, { "uuid": "9d883494-7cf7-4328-b68c-89b76802814a", "name": "Clonazepam [INN]", "stdName": "CLONAZEPAM [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "999b0472-a8d4-4b3b-825e-9cb5c69edd71" ], "display_name": false }, { "uuid": "02d9721b-db40-4ef0-beaf-0d6faa006cfc", "name": "Clonazepam [JAN]", "stdName": "CLONAZEPAM [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d83cdc87-685f-b335-5566-543834d29f88" ], "display_name": false }, { "uuid": "2f6d77c7-8ac5-4128-9567-522c5d62ba7c", "name": "Clonazepam [MART.]", "stdName": "CLONAZEPAM [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "342b40a9-4e71-483c-aefa-6767c79db5e7" ], "display_name": false }, { "uuid": "6d9b1801-0e0c-4a8e-b268-0dac8fa3d0aa", "name": "Clonazepam [MI]", "stdName": "CLONAZEPAM [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8bc1d12a-aa0d-4b8f-ae9a-932fb7413036" ], "display_name": false }, { "uuid": "558e556d-bcc9-4b57-a5fc-a1d4c651f049", "name": "Clonazepam [ORANGE BOOK]", "stdName": "CLONAZEPAM [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a52b21a9-cf55-4806-8007-be4ebe8a0b53" ], "display_name": false }, { "uuid": "f0ee6096-cd33-461f-92bd-c42d04208ac6", "name": "Clonazepam [USAN]", "stdName": "CLONAZEPAM [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c8a7933e-48e3-4c4d-99fd-ab52e8049f62" ], "display_name": false }, { "uuid": "fe2c2f1d-e0eb-d201-370e-56e7f85794ef", "name": "Clonazepam [USP MONOGRAPH]", "stdName": "CLONAZEPAM [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d2432954-9aed-2380-2869-380b960d9dff" ], "display_name": false }, { "uuid": "ae53674a-09af-4ac9-a541-ff85acff1649", "name": "Clonazepam [VANDF]", "stdName": "CLONAZEPAM [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d6412e7f-6339-4951-90ad-5a2234357e5b" ], "display_name": false }, { "uuid": "54b02301-eff6-8166-1bd7-0183ae172826", "name": "Clonazepam [WHO-DD]", "stdName": "CLONAZEPAM [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "33e55b3b-552b-7f8c-5a93-0640db4d8f2b" ], "display_name": false }, { "uuid": "781aa044-ccf1-4fb6-a1ed-917800553a5f", "name": "KLONOPIN", "stdName": "KLONOPIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "8337c221-12de-4fae-ac00-b30710edde16" ], "display_name": false }, { "uuid": "018fe2ad-3799-4cd9-bffd-5e91705a0312", "name": "NSC-179913", "stdName": "NSC-179913", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "96454edd-10c8-4d22-8dfc-9684a0784e6b" ], "display_name": false }, { "uuid": "a152c8ae-4c43-4dc5-bf68-fc7d5ba81bb6", "name": "RAVOTRIL", "stdName": "RAVOTRIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a5f524c1-4e1b-4365-9bf6-4d684c272581" ], "display_name": false }, { "uuid": "3d90dc7c-4481-47ba-a824-14ea88548af8", "name": "RIVATRIL", "stdName": "RIVATRIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a5f524c1-4e1b-4365-9bf6-4d684c272581" ], "display_name": false }, { "uuid": "077d55ce-46c6-4acd-a73d-acb4dc74c500", "name": "RIVOTRIL", "stdName": "RIVOTRIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a5f524c1-4e1b-4365-9bf6-4d684c272581" ], "display_name": false }, { "uuid": "22bb27d7-4b98-424f-8f53-fac36e09364a", "name": "RO-5-4023", "stdName": "RO-5-4023", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "119e6ebf-d879-478a-ba51-24aa5b80cdca" ], "display_name": false }, { "uuid": "91416dcb-648b-493e-b9a7-c1bfe988dd88", "name": "RO-54023", "stdName": "RO-54023", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f0e97c8d-7332-44fb-b958-6404d3bcbae8" ], "display_name": false }, { "uuid": "3e9ca63f-46bf-447c-ad7d-33ab81c34c6b", "name": "RO5-4023", "stdName": "RO5-4023", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "8337c221-12de-4fae-ac00-b30710edde16" ], "display_name": false } ], "properties": [ { "uuid": "71f8c27b-ae05-42b9-8451-76958805e19d", "name": "ORAL BIOAVAILABILITY", "value": { "uuid": "ae98a4a2-ea32-42e3-854e-b4a21c7bdfcb", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "average": 90, "units": "%" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] }, { "uuid": "d7fe74ed-df10-4a23-991f-0cfa0dbcfcea", "name": "PROTEIN BINDING", "value": { "uuid": "db957ce6-1a2c-423a-8805-8aee3cdfc141", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "average": 90.5, "units": "%" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] }, { "uuid": "db408db5-be98-4343-9218-e62562356842", "name": "Route of Elimination", "value": { "uuid": "15adac6f-d9b7-4c31-bcf8-cfc4c72de32d", "type": "MOLE PERCENT OF AMOUNT EXCRETED", "high": 2, "units": "%", "non_numeric_value": "RENAL, EXCRETED UNCHANGED" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] }, { "uuid": "e5419803-db3f-48c1-b958-89c3717d9b6c", "name": "Biological Half-life", "value": { "uuid": "42396a69-0d95-4ddc-971d-9e1b2b374ec9", "high": 40, "low": 30, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] }, { "uuid": "577cdf40-4814-445f-8b84-3d2ac8d6d7a4", "name": "Biological Half-life", "value": { "uuid": "e8534ef2-5fb3-4f8b-b86a-29c9ae036f58", "high": 33, "low": 22, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "45241fae-1f17-db8a-d987-c74c878d6edd" ] }, { "uuid": "9b94d46f-e319-45d4-947d-7177a51ad584", "name": "Volume of Distribution", "value": { "uuid": "99b80314-f208-4988-a58f-4a921e5f9874", "high": 3, "low": 1.5, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "45241fae-1f17-db8a-d987-c74c878d6edd" ] }, { "uuid": "42761d4b-63af-4008-b791-d70df3c736a4", "name": "MAXIMUM TOLERATED DOSE", "value": { "uuid": "d809735b-5b5a-4a55-952f-a0a0bf7e1c0d", "average": 20, "units": "mg/day" }, "defining": false, "property_type": "TOXICITY", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] }, { "uuid": "a04b9eab-2d8b-45f0-8697-ac5e196b3cd3", "name": "Tmax", "value": { "uuid": "821255e8-dcd1-48bd-b0af-d1b4a456a635", "high": 4, "low": 1, "units": "hours", "non_numeric_value": "ORAL" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "1dc5f8a5-09e3-e76b-e5fa-90ccffd0c392" ] } ], "modifications": { "uuid": "1523bc10-45f9-4763-b7ad-9e979b89a3c2" } } ] }