{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "98569202-a3e7-4889-b566-fe1147570dbf",
          "code": "3590-16-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3590-16-7",
          "code_system": "CAS",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b",
            "08e55267-ebca-4be2-bb14-c911d8731794"
          ]
        },
        {
          "uuid": "98af4403-a8f2-4284-b6a4-d2bbf44b4b94",
          "code": "C65630",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65630",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "d3179d9a-92b4-4b4b-a298-95983d5112d1",
          "code": "SUB07522MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "105c9d9d-99b6-470f-b65a-999b566dcba5",
          "code": "4505",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4505",
          "code_system": "INN",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "76541858-60c9-4034-8ec8-8a2960ec562a",
          "code": "m181",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m181?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "4491e35f-e70a-47c5-a4ff-0b58fa8f4b85",
          "code": "CHEMBL2106137",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106137",
          "code_system": "ChEMBL",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "2252b96d-29f9-430d-98d0-c5db006f30cc",
          "code": "3030835",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3030835",
          "code_system": "PUBCHEM",
          "references": [
            "e4a8278d-5798-4526-a9f2-4aa786c18c1b"
          ]
        },
        {
          "uuid": "82134266-24ac-9306-6e15-1efdbfa5d9aa",
          "code": "C29698",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antispasmodic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29698",
          "code_system": "NCI_THESAURUS",
          "references": [
            "269ed2fd-0e7f-c1de-2230-ac514996b9c2"
          ]
        },
        {
          "uuid": "9696058c-ef4a-48fb-b6cd-7eb09d0ae597",
          "code": "5P7U986QGO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f346796-247a-46f5-67ba-bfbf515dc447",
          "code": "3744",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3744",
          "code_system": "DRUG CENTRAL",
          "references": [
            "269ed2fd-0e7f-c1de-2230-ac514996b9c2"
          ]
        },
        {
          "uuid": "2cf4a362-3b61-fb1d-4367-d126ff9ce9a3",
          "code": "100000081768",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e1f58eda-2119-4c8d-9f7a-99c2894a4a88"
          ]
        },
        {
          "uuid": "88653302-c00f-5b8c-1781-c927e838e0e7",
          "code": "DTXSID80863211",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80863211",
          "code_system": "EPA CompTox",
          "references": [
            "269ed2fd-0e7f-c1de-2230-ac514996b9c2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "19d528f9-2687-4c77-95ac-225f7d953fdd",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6df46ae1-a555-4636-b588-aa5cdd15ee0a",
            "refuuid": "90a4fdee-f75b-4190-baf9-338713286112",
            "name": "FECLEMINE",
            "unii": "5P7U986QGO",
            "linking_id": "5P7U986QGO",
            "ref_pname": "FECLEMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4694b766-85f4-4ba2-98fb-f6b2ab453c86",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "4aff0c08-ff5d-4c36-9290-6fb92b8e15ff",
            "refuuid": "f3177304-bbc2-4889-bd24-b347b35add73",
            "name": "FECLEMINE, (R)-",
            "unii": "M0FFX7Q0IS",
            "linking_id": "M0FFX7Q0IS",
            "ref_pname": "FECLEMINE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d1ae7579-fc2d-4495-a4ba-dabfa9ae9ee2",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "cce60420-7974-457d-9817-9196ae909589",
            "refuuid": "07928484-a7fe-417e-b893-0a6cbc0c7917",
            "name": "FECLEMINE, (S)-",
            "unii": "G01WPV5IG0",
            "linking_id": "G01WPV5IG0",
            "ref_pname": "FECLEMINE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5150d619-8a0d-4081-bcde-af9e3ad402a7",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "a463189f-a2b4-4d6a-9dcd-685e30edc7f6"
          ],
          "related_substance": {
            "uuid": "466d5256-d681-43bb-9bc7-ba22b48ecb84",
            "refuuid": "0192c70d-0071-490a-8970-a07cdf8a9d72",
            "name": "FECLEMINE DIHYDROCHLORIDE",
            "unii": "OVP1IDY2SW",
            "linking_id": "OVP1IDY2SW",
            "ref_pname": "FECLEMINE DIHYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "17a96029-4663-4523-857c-f15feb428063",
          "name": "1,3-PROPANEDIAMINE, 2-(CYCLOHEXYLPHENYLMETHYL)-N,N,N',N'-TETRAETHYL-",
          "stdName": "1,3-PROPANEDIAMINE, 2-(CYCLOHEXYLPHENYLMETHYL)-N,N,N',N'-TETRAETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "1df81001-63d8-4323-bbcf-11e185d73800",
          "name": "1-PHENYL-1-CYCLOHEXYL-2,2-BIS(DIETHYLAMINOMETHYL)-ETHANE",
          "stdName": "1-PHENYL-1-CYCLOHEXYL-2,2-BIS(DIETHYLAMINOMETHYL)-ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "c20f86df-df80-454a-b1fa-13acb497a8ad",
          "name": "2-(.ALPHA.-CYCLOHEXYLBENZYL)-1,3-DI(DIETHYLAMINO)PROPANE",
          "stdName": "2-(.ALPHA.-CYCLOHEXYLBENZYL)-1,3-DI(DIETHYLAMINO)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "51cc0ff6-d4ea-4420-bb03-90e1ade32e2c",
          "name": "2-(.ALPHA.-CYCLOHEXYLBENZYL)-N,N,N',N'-TETRAETHYL-1,3-PROPANEDIAMINE",
          "stdName": "2-(.ALPHA.-CYCLOHEXYLBENZYL)-N,N,N',N'-TETRAETHYL-1,3-PROPANEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9ad90c9-6d65-43a2-b6a1-c2bba7405e22"
          ],
          "display_name": false
        },
        {
          "uuid": "5ebf5a95-6f5f-4de2-a84a-817c312b4242",
          "name": "FECLEMINE",
          "stdName": "FECLEMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38625823-3ef7-4099-b686-1557bc31dc70",
            "aa2adec7-ca7e-4da7-a4d2-4ccc18078116",
            "c1be4dc1-0a2c-4b91-b5fd-ae64467f7f14",
            "31e58e13-fe95-437a-be7e-515ad4cb8074",
            "be5d55d4-a243-4304-8112-9e1a8d53415a",
            "eaa03418-e63a-458e-8494-ff845b937df4",
            "65a37285-c538-47e4-be3b-4e4afb13c1b4",
            "f9ad90c9-6d65-43a2-b6a1-c2bba7405e22"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d3e02771-6fec-4859-ad0d-4fc821f31460",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "80dec2ed-011f-4b55-88e8-763b29f61023",
          "name": "FECLEMINE [MI]",
          "stdName": "FECLEMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa03418-e63a-458e-8494-ff845b937df4",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "b805fa89-e82f-05b5-9cb9-29485dac59f6",
          "name": "Feclemine [WHO-DD]",
          "stdName": "FECLEMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b17f5e77-9e2d-d4d3-975b-30ff341cf371"
          ],
          "display_name": false
        },
        {
          "uuid": "92bce40d-72c2-4d67-83a9-6a5e8c4507de",
          "name": "GIACOSIL",
          "stdName": "GIACOSIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "c40bb634-cf8d-409e-8a69-f6ca4f136a64",
          "name": "LICARAN",
          "stdName": "LICARAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "b6d11b09-1f46-44ec-9ecc-01b868e06168",
          "name": "PHENETAMINE",
          "stdName": "PHENETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "65495011-c4dc-4677-8d56-b96629ae8f7e",
          "name": "PHENETHAMINE",
          "stdName": "PHENETHAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "68561911-21b1-4d6e-a3d9-ddfb6bb1e65d",
          "name": "SPASMEXAN",
          "stdName": "SPASMEXAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "b698baca-756f-4254-a26e-154d2c1bc504",
          "name": "UCB-1545",
          "stdName": "UCB-1545",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1aae8674-4f1b-4e14-8600-1801c10dce5e",
            "31e58e13-fe95-437a-be7e-515ad4cb8074"
          ],
          "display_name": false
        },
        {
          "uuid": "fc948f55-1545-4179-bad9-e13614ebd226",
          "name": "feclemine [INN]",
          "stdName": "FECLEMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65a37285-c538-47e4-be3b-4e4afb13c1b4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f9ad90c9-6d65-43a2-b6a1-c2bba7405e22",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "65a37285-c538-47e4-be3b-4e4afb13c1b4",
          "citation": "INN Proposed List 40",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL40.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa2adec7-ca7e-4da7-a4d2-4ccc18078116",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31e58e13-fe95-437a-be7e-515ad4cb8074",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1aae8674-4f1b-4e14-8600-1801c10dce5e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaa03418-e63a-458e-8494-ff845b937df4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4a8278d-5798-4526-a9f2-4aa786c18c1b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390002000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96b8c202-19aa-4524-a4df-9a5d2f71c791",
          "citation": "SRS import [5P7U986QGO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5P7U986QGO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390002000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a463189f-a2b4-4d6a-9dcd-685e30edc7f6",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be5d55d4-a243-4304-8112-9e1a8d53415a",
          "citation": "FECLEMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38625823-3ef7-4099-b686-1557bc31dc70",
          "citation": "FECLEMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1be4dc1-0a2c-4b91-b5fd-ae64467f7f14",
          "citation": "FECLEMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1f58eda-2119-4c8d-9f7a-99c2894a4a88",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "269ed2fd-0e7f-c1de-2230-ac514996b9c2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "08e55267-ebca-4be2-bb14-c911d8731794",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b17f5e77-9e2d-d4d3-975b-30ff341cf371",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bf05e3bd-fedb-4781-934d-e38249a4a974",
          "id": "bf05e3bd-fedb-4781-934d-e38249a4a974",
          "molfile": "\n  Marvin  01132109522D          \n\n 26 27  0  0  0  0            999 V2000\n    4.8296    1.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0816    0.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4054    1.1436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485    1.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9150    2.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6063    0.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1527   -0.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6063   -1.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4054   -1.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0816   -0.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0097    0.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485   -2.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3251   -2.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273   -0.0391    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.9131    0.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877    0.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3236    1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273    1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131   -0.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273   -1.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131   -2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877   -2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3236   -1.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877   -0.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 14  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 21  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CC(CN(CC)CC)C(c1ccccc1)C2CCCCC2",
          "formula": "C24H42N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "611cf7b2-94cf-4919-95db-28fd4bc5fd70"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.6046",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "90a4fdee-f75b-4190-baf9-338713286112",
      "version": "10",
      "structure": {
        "id": "4e30efa7-cfbf-4018-8745-a71b4a4e2431",
        "molfile": "\n  Marvin  01132104052D          \n\n 26 27  0  0  0  0            999 V2000\n    2.6063   -1.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1527   -0.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6063    0.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4054   -1.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4054    1.1436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0816    0.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8296    1.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485    1.9532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9150    2.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0816   -0.7504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0097    0.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5485   -2.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3251   -2.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273   -0.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131   -0.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273   -1.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131   -2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877   -2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3236   -1.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877   -0.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131    0.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877    0.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3236    1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0877    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9131    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3273    1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  5  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n  4 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n  4 12  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 20  2  0  0  0  0\n 14 15  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 21 26  1  0  0  0  0\n 14 21  1  0  0  0  0\n  2 14  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CC(CN(CC)CC)C(c1ccccc1)C2CCCCC2",
        "formula": "C24H42N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.6046",
        "optical_activity": "( + / - )",
        "references": [
          "96b8c202-19aa-4524-a4df-9a5d2f71c791",
          "a463189f-a2b4-4d6a-9dcd-685e30edc7f6",
          "65a37285-c538-47e4-be3b-4e4afb13c1b4"
        ],
        "stereo_centers": 1
      },
      "unii": "5P7U986QGO"
    }
  ]
}