{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ff80b1f-db6f-4f56-b05e-69c232ba3302",
          "code": "OXPHENERIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Oxpheneridine",
          "code_system": "WIKIPEDIA",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "dcc6232e-5d38-4839-b80e-15e305320d6b",
          "code": "SUB09553MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "5dabb898-2091-49a2-9f60-c83664e4a0aa",
          "code": "598",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=598",
          "code_system": "INN",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "029d2916-05fc-473e-9a76-a56f4ae8686c",
          "code": "CHEMBL2106540",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106540",
          "code_system": "ChEMBL",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "b06acdfc-d03b-42c7-8d01-566a36b5de7e",
          "code": "56863",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56863",
          "code_system": "PUBCHEM",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "9489d77d-5fc0-4c53-becc-ae3ab02af387",
          "code": "546-32-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=546-32-7",
          "code_system": "CAS",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f",
            "dd1650f7-4f62-4700-ab8f-7142d6538abb"
          ]
        },
        {
          "uuid": "fb4a7429-f288-47da-9d75-ded2a807d086",
          "code": "C76844",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76844",
          "code_system": "NCI_THESAURUS",
          "references": [
            "13c3592d-7b73-4137-b2d2-6d689070ec1f"
          ]
        },
        {
          "uuid": "a15b1c67-8000-cb2d-72e7-f00e07569893",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ae39b939-1383-cc89-70e3-d669455ab9d1"
          ]
        },
        {
          "uuid": "e6e88a78-94bd-4683-9451-9df622ce00e7",
          "code": "5OO7RKH9WL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c0ff1502-a4eb-5be1-2df3-2906929c10aa",
          "code": "DTXSID80862163",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80862163",
          "code_system": "EPA CompTox",
          "references": [
            "ae39b939-1383-cc89-70e3-d669455ab9d1"
          ]
        },
        {
          "uuid": "925a1f6a-3a17-e111-3479-1da002f59184",
          "code": "100000083075",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ea13ca03-f8ba-db23-408e-58433f71928c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7775ad1b-c425-46d4-a595-eb838bf9af63",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "23efbd55-c363-423b-9be2-4f035b2d8793",
            "refuuid": "bbce8df7-41f3-4c85-ac81-afc1770b79ff",
            "name": "OXPHENERIDINE",
            "unii": "5OO7RKH9WL",
            "linking_id": "5OO7RKH9WL",
            "ref_pname": "OXPHENERIDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c715f8c5-2230-4001-ac6b-f3ccbb52d5d8",
          "name": "1-(.BETA.-HYDROXYPHENETHYL)-4-PHENYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER",
          "stdName": "1-(.BETA.-HYDROXYPHENETHYL)-4-PHENYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c123534f-ebb3-4a5f-b047-79c756fbefd7"
          ],
          "display_name": false
        },
        {
          "uuid": "9fed3fee-0016-4614-9caf-81b5511da483",
          "name": "OXPHENERIDINE",
          "stdName": "OXPHENERIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90affbba-dc9f-44cd-be22-a8af98172387",
            "c123534f-ebb3-4a5f-b047-79c756fbefd7",
            "3b1fca3f-15d1-441f-b39b-c07ba9d4c05a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "207bd3d9-6c65-463d-ad38-208d4059b411",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c5c9fc12-7894-43e6-8036-b0a5396a8896",
          "name": "oxpheneridine [INN]",
          "stdName": "OXPHENERIDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90affbba-dc9f-44cd-be22-a8af98172387"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c123534f-ebb3-4a5f-b047-79c756fbefd7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "90affbba-dc9f-44cd-be22-a8af98172387",
          "citation": "INN Proposed List 5",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL05.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13c3592d-7b73-4137-b2d2-6d689070ec1f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31221743-1822-40ad-be0f-333b2a761e56",
          "citation": "SRS import [5OO7RKH9WL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5OO7RKH9WL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390742000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c23ab81b-7119-4849-a04b-4cad2c415f6d",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b1fca3f-15d1-441f-b39b-c07ba9d4c05a",
          "citation": "OXPHENERIDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ea13ca03-f8ba-db23-408e-58433f71928c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ae39b939-1383-cc89-70e3-d669455ab9d1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dd1650f7-4f62-4700-ab8f-7142d6538abb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d0027128-0828-46ee-8672-f8202a82f311",
          "id": "d0027128-0828-46ee-8672-f8202a82f311",
          "molfile": "\n  Marvin  01132110452D          \n\n 26 28  0  0  0  0            999 V2000\n    9.1077   -1.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5121   -1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6377   -1.5367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9255   -1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9171   -0.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2171   -1.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5055   -1.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5055   -2.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2171   -3.1900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2092   -4.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9505   -4.3352    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.9505   -5.1140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8001   -4.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3842   -4.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1789   -4.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3897   -3.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7996   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0071   -3.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9287   -2.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9287   -1.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4971   -1.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4970   -0.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7779    0.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0599   -0.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0655   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7852   -1.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 20  6  1  0  0  0  0\n  6 21  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 19  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 26 21  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C1(CCN(CC1)CC(c2ccccc2)O)c3ccccc3",
          "formula": "C22H27NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9bf34e23-65ef-4f5f-9dbc-3a4f43a17751"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "353.4555",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bbce8df7-41f3-4c85-ac81-afc1770b79ff",
      "version": "6",
      "structure": {
        "id": "00391632-c34d-4d4d-a333-3e778ce757b0",
        "molfile": "\n  Marvin  01132100192D          \n\n 26 28  0  0  0  0            999 V2000\n    5.5055   -1.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5055   -2.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2171   -3.1900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9287   -2.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9287   -1.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2171   -1.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2092   -4.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9505   -4.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8001   -4.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9505   -5.1140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9255   -1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6377   -1.5367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5121   -1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4971   -1.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1077   -1.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4970   -0.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7779    0.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0599   -0.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0655   -1.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7852   -1.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3842   -4.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1789   -4.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3897   -3.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7996   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0071   -3.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9171   -0.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 12 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  3  7  1  0  0  0  0\n 13 15  1  0  0  0  0\n  1  2  1  0  0  0  0\n 14 16  2  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1  6  1  0  0  0  0\n 17 18  2  0  0  0  0\n  8  9  1  0  0  0  0\n 18 19  1  0  0  0  0\n  2  3  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 14  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 21  2  0  0  0  0\n  3  4  1  0  0  0  0\n 21 22  1  0  0  0  0\n  6 11  1  0  0  0  0\n 22 23  2  0  0  0  0\n  4  5  1  0  0  0  0\n 23 24  1  0  0  0  0\n 11 12  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11 26  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C1(CCN(CC1)CC(c2ccccc2)O)c3ccccc3",
        "formula": "C22H27NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "353.4555",
        "optical_activity": "( + / - )",
        "references": [
          "c23ab81b-7119-4849-a04b-4cad2c415f6d",
          "31221743-1822-40ad-be0f-333b2a761e56",
          "90affbba-dc9f-44cd-be22-a8af98172387"
        ],
        "stereo_centers": 1
      },
      "unii": "5OO7RKH9WL"
    }
  ]
}