{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3782ba39-08c3-4d19-9cf0-8cf18c9ceb0f",
          "code": "24413-04-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24413-04-5",
          "code_system": "CAS",
          "references": [
            "87654a4e-1de6-4a95-b2bc-a12955166900",
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ]
        },
        {
          "uuid": "6132d003-1203-413a-8b49-d77ceedbb0d6",
          "code": "246-235-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.017",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "87654a4e-1de6-4a95-b2bc-a12955166900"
          ]
        },
        {
          "uuid": "4935b5da-45a1-449a-a5d8-a940e1b88670",
          "code": "90492",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90492",
          "code_system": "PUBCHEM",
          "references": [
            "87654a4e-1de6-4a95-b2bc-a12955166900"
          ]
        },
        {
          "uuid": "9facf8a2-29c7-92d4-a704-53f55f113b06",
          "code": "DTXSID7066984",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7066984",
          "code_system": "EPA CompTox",
          "references": [
            "279e6f6e-a76d-d322-b7d1-fb162dbdea31"
          ]
        },
        {
          "uuid": "5fb9237f-c13c-4565-954b-219a7ab5a915",
          "code": "5NQ6H22HUK",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "61d66c02-699c-43eb-bbf2-7de9fd8afce8",
          "name": "1-(Chloromethyl)-4-(trimethoxysilyl)benzene",
          "stdName": "1-(CHLOROMETHYL)-4-(TRIMETHOXYSILYL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ],
          "display_name": false
        },
        {
          "uuid": "775fdccc-bf92-49ce-a685-c0cb70e39c4e",
          "name": "4-(Chloromethyl)phenyltrimethoxysilane",
          "stdName": "4-(CHLOROMETHYL)PHENYLTRIMETHOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f26d677-d6e7-45ed-a39f-8dea5abdd554"
          ],
          "display_name": true
        },
        {
          "uuid": "c4648771-7dcc-443b-b65d-4a81e34255dc",
          "name": "Benzene, 1-(chloromethyl)-4-(trimethoxysilyl)-",
          "stdName": "BENZENE, 1-(CHLOROMETHYL)-4-(TRIMETHOXYSILYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ],
          "display_name": false
        },
        {
          "uuid": "965c801d-ad1a-4820-a9ea-f9704a68129d",
          "name": "Silane, [4-(chloromethyl)phenyl]trimethoxy-",
          "stdName": "SILANE, (4-(CHLOROMETHYL)PHENYL)TRIMETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24bba5c1-d29e-4d22-a1b7-da8ee726972d",
            "33681197-8792-4284-8316-b721f445a449"
          ],
          "display_name": false
        },
        {
          "uuid": "215bf4d1-f089-4d3e-ad46-614dcee90736",
          "name": "[4-(Chloromethyl)phenyl]trimethoxysilane",
          "stdName": "(4-(CHLOROMETHYL)PHENYL)TRIMETHOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ],
          "display_name": false
        },
        {
          "uuid": "c4b2d648-3427-46f7-a068-45c12644c748",
          "name": "[p-(Chloromethyl)phenyl]trimethoxysilane",
          "stdName": "(P-(CHLOROMETHYL)PHENYL)TRIMETHOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "859d9783-46f1-4cfa-bd2a-19ed0577bb87"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "24bba5c1-d29e-4d22-a1b7-da8ee726972d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33681197-8792-4284-8316-b721f445a449",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87654a4e-1de6-4a95-b2bc-a12955166900",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394342000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "279e6f6e-a76d-d322-b7d1-fb162dbdea31",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24413-04-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "859d9783-46f1-4cfa-bd2a-19ed0577bb87",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3f26d677-d6e7-45ed-a39f-8dea5abdd554",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90492",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35e02074-3f22-4c57-8e45-742439dc21cb",
          "id": "35e02074-3f22-4c57-8e45-742439dc21cb",
          "molfile": "\n  Marvin  01132102522D          \n\n 15 15  0  0  0  0            999 V2000\n    2.1828   -4.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9563   -4.5091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6227   -3.8988    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    3.1617   -3.1446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4154   -3.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0900   -4.5352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8617   -4.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3378   -3.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3378   -2.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0473   -2.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7651   -2.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4792   -2.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1941   -2.6610    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7651   -3.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0473   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CO[Si](c1ccc(cc1)CCl)(OC)OC",
          "formula": "C10H15ClO3Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c2f0976a-babf-45e4-a118-07af4bde1a15"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "246.763",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f26ff768-30ff-49dd-a48d-b0cbe49677ba",
      "version": "5",
      "structure": {
        "id": "608dbbd8-e3c0-43fa-954f-efebcf5fb548",
        "molfile": "\n   JSDraw209052317382D\n\n 15 15  0  0  0  0              0 V2000\n   25.6619  -11.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8820  -10.0359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220  -10.0359    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   21.7620  -10.0359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9821   -8.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220  -11.5959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9710  -12.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220   -5.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3220   -3.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6730   -3.0161    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   21.9710   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9710   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n  8 15  1  0  0  0  0\nM  END",
        "smiles": "CO[Si](c1ccc(cc1)CCl)(OC)OC",
        "formula": "C10H15ClO3Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "246.763",
        "optical_activity": "NONE",
        "references": [
          "24bba5c1-d29e-4d22-a1b7-da8ee726972d"
        ],
        "stereo_centers": 0
      },
      "unii": "5NQ6H22HUK"
    }
  ]
}