{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6bf7149e-2af5-46d3-91d6-d22926f52310",
          "code": "129319-15-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129319-15-9",
          "code_system": "CAS",
          "references": [
            "0f0c86cb-ea5c-4430-81f3-ed42a655166b",
            "913b77e2-ff34-41a0-8d36-ca8b67e5e660"
          ]
        },
        {
          "uuid": "f75bb934-8dc0-494f-a3ac-2491f7e129bf",
          "code": "C542051",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67542051",
          "code_system": "MESH",
          "references": [
            "0f0c86cb-ea5c-4430-81f3-ed42a655166b"
          ]
        },
        {
          "uuid": "8f7c3fdd-b964-4f42-8268-0a3186cb7571",
          "code": "DIHYDROGALANGAL ACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=6006",
          "code_system": "JECFA EVALUATION",
          "references": [
            "0f0c86cb-ea5c-4430-81f3-ed42a655166b"
          ]
        },
        {
          "uuid": "30dcf3db-9464-472f-8d8c-354ae66b9104",
          "code": "14638401",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14638401",
          "code_system": "PUBCHEM",
          "references": [
            "0f0c86cb-ea5c-4430-81f3-ed42a655166b"
          ]
        },
        {
          "uuid": "5f26dba3-9263-4c21-9776-3ec7051d8122",
          "code": "5NKX5Z17DY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0efdbaaf-5ee1-7136-3dcf-2c68f64dbdf2",
          "code": "DTXSID90926381",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90926381",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "4d728098-9642-aaad-0e5f-97256a1211d4",
          "code": "2023",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2023/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "f9d9679e-ade1-eb8f-2996-078c2c8ff88b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "976f8435-8efd-43f4-913d-73511229cf2c",
          "name": "4-(ACETYLOXY)-.ALPHA.ETHYLBENZENEMETHANOL ACETATE",
          "stdName": "4-(ACETYLOXY)-.ALPHA.ETHYLBENZENEMETHANOL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7418e730-6704-4949-a367-1ec7017097c6",
            "7dab46b9-88a3-4747-93a2-fa6ecdbe27fa"
          ],
          "display_name": false
        },
        {
          "uuid": "e193027f-e5a5-4e3d-a068-ff486551bcb5",
          "name": "BENZENEMETHANOL, 4-(ACETYLOXY)-.ALPHA.-ETHYL-, 1-ACETATE",
          "stdName": "BENZENEMETHANOL, 4-(ACETYLOXY)-.ALPHA.-ETHYL-, 1-ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7418e730-6704-4949-a367-1ec7017097c6",
            "6cbb2072-f894-4f15-8525-389ab320a7c9"
          ],
          "display_name": false
        },
        {
          "uuid": "cfbcd997-84e3-453b-ae0e-08b8c21124cf",
          "name": "BENZENEMETHANOL, 4-(ACETYLOXY)-.ALPHA.-ETHYL-, ACETATE",
          "stdName": "BENZENEMETHANOL, 4-(ACETYLOXY)-.ALPHA.-ETHYL-, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7418e730-6704-4949-a367-1ec7017097c6",
            "6cbb2072-f894-4f15-8525-389ab320a7c9"
          ],
          "display_name": false
        },
        {
          "uuid": "da574302-1800-4ae5-8c27-529a2c7014cb",
          "name": "DIHYDROGALANGAL ACETATE",
          "stdName": "DIHYDROGALANGAL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eba3efb9-9f6e-481a-aaf3-22f3f4e98c21",
            "7418e730-6704-4949-a367-1ec7017097c6"
          ],
          "display_name": true
        },
        {
          "uuid": "7a92e1e1-5dfc-4fdb-ab67-b3fb6a63a59f",
          "name": "FEMA NO. 4555",
          "stdName": "FEMA NO. 4555",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7418e730-6704-4949-a367-1ec7017097c6",
            "7dab46b9-88a3-4747-93a2-fa6ecdbe27fa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "eba3efb9-9f6e-481a-aaf3-22f3f4e98c21",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7418e730-6704-4949-a367-1ec7017097c6",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dab46b9-88a3-4747-93a2-fa6ecdbe27fa",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cbb2072-f894-4f15-8525-389ab320a7c9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f0c86cb-ea5c-4430-81f3-ed42a655166b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc6b7790-2011-46f2-93a1-3ca96d770b30",
          "citation": "SRS import [5NKX5Z17DY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5NKX5Z17DY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "913b77e2-ff34-41a0-8d36-ca8b67e5e660",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f9d9679e-ade1-eb8f-2996-078c2c8ff88b",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1ead9c76-a6cd-4c23-90b2-d0d4f358e050",
          "id": "1ead9c76-a6cd-4c23-90b2-d0d4f358e050",
          "molfile": "\n  Marvin  01132101452D          \n\n 17 17  0  0  0  0            999 V2000\n   10.8362   -3.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1218   -4.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1218   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.8362   -5.5558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5507   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2651   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5507   -4.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4073   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6928   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9784   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9784   -6.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2639   -6.7933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2639   -7.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5494   -8.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9784   -8.0308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6928   -6.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4073   -6.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 17  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCC(c1ccc(cc1)OC(=O)C)OC(=O)C",
          "formula": "C13H16O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96f5a96c-d6e1-48fd-93ec-a6d43b0d1bff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "236.2642",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "74587d35-e818-42bf-b7ee-9663aca74c88",
      "version": "4",
      "structure": {
        "id": "c0418f11-dd92-446e-a30f-dea2a6e3fbe0",
        "molfile": "\n  Marvin  01132109562D          \n\n 17 17  0  0  0  0            999 V2000\n    7.9784   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6928   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4073   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4073   -6.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6928   -6.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9784   -6.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2639   -6.7933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2639   -7.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5494   -8.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9784   -8.0308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1218   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1218   -4.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8362   -3.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8362   -5.5558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5507   -5.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2651   -5.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5507   -4.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
        "smiles": "CCC(c1ccc(cc1)OC(=O)C)OC(=O)C",
        "formula": "C13H16O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "236.2642",
        "optical_activity": "( + / - )",
        "references": [
          "6cbb2072-f894-4f15-8525-389ab320a7c9",
          "bc6b7790-2011-46f2-93a1-3ca96d770b30"
        ],
        "stereo_centers": 1
      },
      "unii": "5NKX5Z17DY"
    }
  ]
}