{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88533b47-2e04-4a92-8c26-8be82500537d",
          "code": "612-82-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=612-82-8",
          "code_system": "CAS",
          "references": [
            "2b3070b7-e18f-48e8-8384-ae13431ac1d8",
            "37c14992-22ab-4bb4-9c66-d21156624e50"
          ]
        },
        {
          "uuid": "2331426d-dad8-46e3-b559-c78af71d1364",
          "code": "m10944",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10944?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2b3070b7-e18f-48e8-8384-ae13431ac1d8"
          ]
        },
        {
          "uuid": "89780579-a976-4e5a-9e77-536945876e51",
          "code": "210-322-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.385",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2b3070b7-e18f-48e8-8384-ae13431ac1d8"
          ]
        },
        {
          "uuid": "707869b2-801c-9524-0725-0db0e31314f7",
          "code": "DTXSID6020511",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020511",
          "code_system": "EPA CompTox",
          "references": [
            "9895c9e3-bac1-b3b0-5972-d6694bdfb6d6"
          ]
        },
        {
          "uuid": "f84e5eb9-4e24-5c95-e2aa-4cb14e36d48e",
          "code": "11932",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11932",
          "code_system": "PUBCHEM",
          "references": [
            "aeeac0b6-2cf5-c116-7de7-11a5f904f463"
          ]
        },
        {
          "uuid": "a25426af-7fbc-4755-b2bb-2696e302b55d",
          "code": "5MSK350KD8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "092316f6-f747-93ae-0d88-6426b6070a64",
          "code": "11223",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=11223",
          "code_system": "NSC",
          "references": [
            "88c18f79-13d9-0edf-4c2a-048b64c75476"
          ]
        },
        {
          "uuid": "226b1157-7892-3512-5b39-b13403c415ff",
          "code": "300000053536",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "96f4f57d-fade-30f7-962c-0e89e9b4c359"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28d4385a-efb0-44ae-9b87-941d92a3d9f1",
          "name": "(1,1'-BIPHENYL)-4,4'-DIAMINE, 3,3'-DIMETHYL-, DIHYDROCHLORIDE",
          "stdName": "(1,1'-BIPHENYL)-4,4'-DIAMINE, 3,3'-DIMETHYL-, DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a082583-a2c7-45f9-9868-59d7573b2bdc",
            "4ed4e102-bd0c-48f8-8675-213f27074bda"
          ],
          "display_name": false
        },
        {
          "uuid": "99341620-54c8-40ec-9951-45cd7ef36378",
          "name": "(1,1'-BIPHENYL)-4,4'-DIAMINE, 3,3'-DIMETHYL-, HYDROCHLORIDE (1:2)",
          "stdName": "(1,1'-BIPHENYL)-4,4'-DIAMINE, 3,3'-DIMETHYL-, HYDROCHLORIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a082583-a2c7-45f9-9868-59d7573b2bdc",
            "4ed4e102-bd0c-48f8-8675-213f27074bda"
          ],
          "display_name": false
        },
        {
          "uuid": "147feede-a2ee-4715-aa79-fc3b45e579b6",
          "name": "3,3'-DIMETHYLBENZIDINE DIHYDROCHLORIDE",
          "stdName": "3,3'-DIMETHYLBENZIDINE DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b4fc9b8-d3fe-46b9-98f3-f1afaa2137ca",
            "8a082583-a2c7-45f9-9868-59d7573b2bdc"
          ],
          "display_name": false
        },
        {
          "uuid": "31e64209-db90-4658-aced-20465d6c463a",
          "name": "BENZIDINE, 3,3'-DIMETHYL-, DIHYDROCHLORIDE",
          "stdName": "BENZIDINE, 3,3'-DIMETHYL-, DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a082583-a2c7-45f9-9868-59d7573b2bdc",
            "4ed4e102-bd0c-48f8-8675-213f27074bda"
          ],
          "display_name": false
        },
        {
          "uuid": "0393056d-a88a-4d7c-a310-fd254e5df59c",
          "name": "NSC-11223",
          "stdName": "NSC-11223",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b4fc9b8-d3fe-46b9-98f3-f1afaa2137ca",
            "8a082583-a2c7-45f9-9868-59d7573b2bdc"
          ],
          "display_name": false
        },
        {
          "uuid": "23e09bed-9ff3-430d-abd3-c2ed0cc7dd46",
          "name": "O-TOLIDINE DIHYDROCHLORIDE",
          "stdName": "O-TOLIDINE DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b4fc9b8-d3fe-46b9-98f3-f1afaa2137ca",
            "8a082583-a2c7-45f9-9868-59d7573b2bdc",
            "11c66554-fc03-4a40-896b-dfa4d88b82a7",
            "1078b1c3-6952-4f93-952f-92705550a0d2"
          ],
          "display_name": true
        },
        {
          "uuid": "ca644fac-f182-40c1-a4fa-e8512f777a45",
          "name": "O-TOLIDINE DIHYDROCHLORIDE [MI]",
          "stdName": "O-TOLIDINE DIHYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a082583-a2c7-45f9-9868-59d7573b2bdc",
            "1078b1c3-6952-4f93-952f-92705550a0d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9b4fc9b8-d3fe-46b9-98f3-f1afaa2137ca",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a082583-a2c7-45f9-9868-59d7573b2bdc",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ed4e102-bd0c-48f8-8675-213f27074bda",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1078b1c3-6952-4f93-952f-92705550a0d2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b3070b7-e18f-48e8-8384-ae13431ac1d8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5dad55a8-48d7-46c1-894a-b912e025169d",
          "citation": "SRS import [5MSK350KD8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5MSK350KD8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edfd9f22-5c01-43d0-983f-7d7f304d1391",
          "citation": "CHEMID RECORD 612-82-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11c66554-fc03-4a40-896b-dfa4d88b82a7",
          "citation": "O-TOLIDINE DIHYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9895c9e3-bac1-b3b0-5972-d6694bdfb6d6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=612-82-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aeeac0b6-2cf5-c116-7de7-11a5f904f463",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "37c14992-22ab-4bb4-9c66-d21156624e50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "88c18f79-13d9-0edf-4c2a-048b64c75476",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "96f4f57d-fade-30f7-962c-0e89e9b4c359",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "516148a6-4e9a-418b-9622-8cc3ccf6336e",
          "id": "516148a6-4e9a-418b-9622-8cc3ccf6336e",
          "molfile": "\n  Marvin  01132104142D          \n\n  1  0  0  0  0  0            999 V2000\n   10.5809   -5.1430    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "f6bbd8f9-dbbd-4276-aa0d-617d753da1d3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8505afa6-4c6c-408b-a29e-bf98cd8f6029",
          "id": "8505afa6-4c6c-408b-a29e-bf98cd8f6029",
          "molfile": "\n  Marvin  01132106542D          \n\n 16 17  0  0  0  0            999 V2000\n    6.9414   -3.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5248   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2832   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5248   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9414   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7574   -5.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4777   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0679   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2489   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8429   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0240   -5.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2489   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8429   -3.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0679   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 16  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(ccc1N)-c2ccc(c(C)c2)N",
          "formula": "C14H16N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ea34a5eb-5b0c-4189-ae61-b1e7f6350b1b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.2908",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fad103d7-9711-4951-ac9f-6e06a458179c",
      "version": "6",
      "structure": {
        "id": "c2b53816-c99a-40ac-b528-29fabab7c0f0",
        "molfile": "\n  Marvin  01132110042D          \n\n 18 17  0  0  0  0            999 V2000\n    4.4777   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2832   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5248   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9414   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7574   -5.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5248   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6998   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9414   -3.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0679   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2489   -4.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8429   -5.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0240   -5.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2489   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0679   -6.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8429   -3.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5809   -5.1430    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.5809   -5.1430    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  1 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  17  18\nM  SPA   1  1  17\nM  SDI   1  4   10.1609   -5.5630   10.1609   -4.7230\nM  SDI   1  4   11.0009   -4.7230   11.0009   -5.5630\nM  SMT   1 2\nM  END",
        "smiles": "Cc1cc(ccc1N)-c2ccc(c(C)c2)N.Cl.Cl",
        "formula": "C14H16N2.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "285.2125",
        "optical_activity": "NONE",
        "references": [
          "5dad55a8-48d7-46c1-894a-b912e025169d",
          "edfd9f22-5c01-43d0-983f-7d7f304d1391"
        ],
        "stereo_centers": 0
      },
      "unii": "5MSK350KD8"
    }
  ]
}