{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3401dcac-05c4-4815-b9b0-eddaedcfe1fe",
          "code": "17387-01-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17387-01-8",
          "code_system": "CAS",
          "references": [
            "7589a14b-2480-4ddb-be5f-7c0a4a74f34d",
            "49da5749-af47-402b-a9f7-90222b4af8f5"
          ]
        },
        {
          "uuid": "92e7746a-599e-470a-b14b-1aeb1bec119f",
          "code": "1541742",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1541742/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7589a14b-2480-4ddb-be5f-7c0a4a74f34d"
          ]
        },
        {
          "uuid": "2e1d4044-a74b-4a48-8793-1d88780fec31",
          "code": "71587018",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587018",
          "code_system": "PUBCHEM",
          "references": [
            "7589a14b-2480-4ddb-be5f-7c0a4a74f34d"
          ]
        },
        {
          "uuid": "02c8f64b-7eb7-3674-645b-a788618f82b4",
          "code": "DTXSID30169674",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30169674",
          "code_system": "EPA CompTox",
          "references": [
            "6f751c73-ad79-170b-5eee-9a5f5694266e"
          ]
        },
        {
          "uuid": "885b8fe3-9463-4e07-a3a7-3797cae7e671",
          "code": "5MPS47D679",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e97130f2-e3fc-065d-819e-b351c4b5fdcf",
          "code": "5MPS47D679",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5MPS47D679",
          "code_system": "DAILYMED",
          "references": [
            "16a39d4d-df94-854d-a0e7-92dffb7370ec"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7f82d72c-4060-42cd-b1d2-b3442ec7844f",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "dd8f66d0-83e9-4e76-a234-23335430c10c",
            "refuuid": "919b860c-133b-4c8e-819b-a8bbb4823fcd",
            "name": ".BETA.-THUJAPLICIN",
            "unii": "U5335D6EBI",
            "linking_id": "U5335D6EBI",
            "ref_pname": ".BETA.-THUJAPLICIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7471f5c7-6c61-4308-83f2-2aa6d8120eb3",
          "name": "2,4,6-CYCLOHEPTATRIEN-1-ONE, 2-HYDROXY-4-(1-METHYLETHYL)-, SODIUM SALT",
          "stdName": "2,4,6-CYCLOHEPTATRIEN-1-ONE, 2-HYDROXY-4-(1-METHYLETHYL)-, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "605b338a-5c93-47a9-8b9b-2ee056bee0ba",
            "7b34e750-927e-4bf0-ac76-4a9e8a657051"
          ],
          "display_name": false
        },
        {
          "uuid": "7819a8e3-c869-4366-9ebb-f6a598754a2a",
          "name": "2,4,6-CYCLOHEPTATRIEN-1-ONE, 2-HYDROXY-4-(1-METHYLETHYL)-, SODIUM SALT (1:1)",
          "stdName": "2,4,6-CYCLOHEPTATRIEN-1-ONE, 2-HYDROXY-4-(1-METHYLETHYL)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77a7f320-4870-4bca-8353-afd46668afc4",
            "7b34e750-927e-4bf0-ac76-4a9e8a657051"
          ],
          "display_name": false
        },
        {
          "uuid": "00220893-dcfc-49ec-8577-acb0e6160829",
          "name": "HINOKITIOL SODIUM",
          "stdName": "HINOKITIOL SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77a7f320-4870-4bca-8353-afd46668afc4",
            "7b34e750-927e-4bf0-ac76-4a9e8a657051"
          ],
          "display_name": false
        },
        {
          "uuid": "6f04fc18-6b07-4ffb-913a-1e23ce84c8d4",
          "name": "HINOKITIOL SODIUM SALT",
          "stdName": "HINOKITIOL SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "605b338a-5c93-47a9-8b9b-2ee056bee0ba",
            "7b34e750-927e-4bf0-ac76-4a9e8a657051"
          ],
          "display_name": false
        },
        {
          "uuid": "7044f2ec-8f31-435d-9dc4-35fbac3191e4",
          "name": "SODIUM HINOKITIOL",
          "stdName": "SODIUM HINOKITIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4f0d614-a6c8-42c4-8a4d-252bec5e8176",
            "605b338a-5c93-47a9-8b9b-2ee056bee0ba",
            "7b34e750-927e-4bf0-ac76-4a9e8a657051"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b1f45ed5-487d-44d5-a243-d3fcd3ec2f9f",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "605b338a-5c93-47a9-8b9b-2ee056bee0ba",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7b34e750-927e-4bf0-ac76-4a9e8a657051",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77a7f320-4870-4bca-8353-afd46668afc4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7589a14b-2480-4ddb-be5f-7c0a4a74f34d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391602000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ea209a9-ece5-43df-a1f6-5d97c6134550",
          "citation": "SRS import [5MPS47D679]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5MPS47D679",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391602000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4f0d614-a6c8-42c4-8a4d-252bec5e8176",
          "citation": "SODIUM HINOKITIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f751c73-ad79-170b-5eee-9a5f5694266e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17387-01-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "49da5749-af47-402b-a9f7-90222b4af8f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "16a39d4d-df94-854d-a0e7-92dffb7370ec",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9ba25c37-d085-4e69-bcf2-00b885ab1f27",
          "id": "9ba25c37-d085-4e69-bcf2-00b885ab1f27",
          "molfile": "\n  Marvin  01132108052D          \n\n  1  0  0  0  0  0            999 V2000\n   12.2551  -11.3529    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b831d8a-ed2c-4135-b2fc-cb3cd37569fe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "801e4f36-6124-4ca7-9ccd-46b1f0a0fb02",
          "id": "801e4f36-6124-4ca7-9ccd-46b1f0a0fb02",
          "molfile": "\n  Marvin  01132106392D          \n\n 12 12  0  0  0  0            999 V2000\n   14.0099   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5988   -9.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0099   -9.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7736   -9.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4003   -8.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6229   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9634   -8.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9634   -9.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2237   -9.7951    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.5877   -9.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4123  -10.7430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4003   -9.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "CC(C)c1cccc(c(=O)c1)[O-]",
          "formula": "C10H11O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "86e66a63-ac12-41c9-ad1e-148a4fc11abd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "163.1935",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba604d90-6960-43b0-af9b-7eb59dd43e1e",
      "version": "6",
      "structure": {
        "id": "66836198-721d-41d1-8050-3f6525814546",
        "molfile": "\n  Marvin  01132105202D          \n\n 13 12  0  0  0  0            999 V2000\n   12.7736   -9.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4003   -9.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5877   -9.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9634   -9.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2237   -9.7951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9634   -8.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6229   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4003   -8.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4123  -10.7430    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.5988   -9.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0099   -8.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0099   -9.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2551  -11.3529    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  1  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  CHG  2   9  -1  13   1\nM  END",
        "smiles": "CC(C)c1cccc(=O)c(c1)[O-].[Na+]",
        "formula": "C10H11O2.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "186.1833",
        "optical_activity": "NONE",
        "references": [
          "77a7f320-4870-4bca-8353-afd46668afc4",
          "6ea209a9-ece5-43df-a1f6-5d97c6134550"
        ],
        "stereo_centers": 0
      },
      "unii": "5MPS47D679"
    }
  ]
}