{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2da10de0-8f1a-49ad-bcc3-7bd2b6b839e0",
          "code": "B01AA02",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|phenindione",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "9dd9c3f6-8452-4e3f-9397-daeb7499a9b1",
          "code": "QB01AA02",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|phenindione",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "870c9218-942e-45d8-91c4-d1bdadac6725",
          "code": "83-12-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=83-12-5",
          "code_system": "CAS",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a",
            "fd5f1417-01a8-4a5e-80f1-e63f54a28a22"
          ]
        },
        {
          "uuid": "20d42219-d640-4083-aa8d-e5dde40bfa22",
          "code": "C66371",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66371",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "415386ce-c9fb-4105-8022-1affa64ae24f",
          "code": "D010630",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010630",
          "code_system": "MESH",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "2a064d36-f5a3-4b28-ba2f-e20abf7ebaad",
          "code": "PHENINDIONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenindione",
          "code_system": "WIKIPEDIA",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "25ae8685-6111-4d71-b7d2-bb51a4f97467",
          "code": "SUB09765MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "59274ad3-0a88-4488-80f2-5818fdf63345",
          "code": "23",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=23",
          "code_system": "INN",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "fa95aa06-5ec5-4ed8-a03a-2e88f3a15160",
          "code": "6838",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6838",
          "code_system": "IUPHAR",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "0c883eab-f12c-43b0-9932-28bb8eb64c75",
          "code": "8130",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8130/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "f5b0db76-59ea-4bd7-b8a5-26f338e2f8c4",
          "code": "m8618",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8618?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "541365e2-0e04-4e50-a6d0-15f946b9e92b",
          "code": "DB00498",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00498",
          "code_system": "DRUG BANK",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "92e2caa4-01ce-45d4-801d-829b50856128",
          "code": "CHEMBL711",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL711",
          "code_system": "ChEMBL",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "529e464c-3f5d-4b94-a8ca-99be988e2a8d",
          "code": "201-454-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.323",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "c41058c5-dc4f-498d-8f17-4a5898b6f93d",
          "code": "4760",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4760",
          "code_system": "PUBCHEM",
          "references": [
            "f2ce5bf7-1389-4698-80b4-f000dc624b9a"
          ]
        },
        {
          "uuid": "cd19f87d-a669-ad0c-1bfd-6a0f6059e130",
          "code": "3155",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3155",
          "code_system": "HSDB",
          "references": [
            "ae96aad7-6c2e-1790-1438-8151081730e7"
          ]
        },
        {
          "uuid": "dcac8400-4208-14d2-6bcb-afc326a46263",
          "code": "DTXSID5023453",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023453",
          "code_system": "EPA CompTox",
          "references": [
            "2f81de5e-ccba-4197-15cf-266a43a50c11"
          ]
        },
        {
          "uuid": "a5958c2b-c64d-dcb6-2831-a80022eb275e",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8462f0bb-6e47-484d-062b-2feef6380e9a"
          ]
        },
        {
          "uuid": "95af7f11-2456-4101-b1ff-e172c07e720f",
          "code": "5M7Y6274ZE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d88c1fae-ee15-454e-316b-967724a45801",
          "code": "2130",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2130",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8462f0bb-6e47-484d-062b-2feef6380e9a"
          ]
        },
        {
          "uuid": "f290cb8e-7175-9309-29be-fcf757f51226",
          "code": "8066",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8066",
          "code_system": "CHEBI",
          "references": [
            "8462f0bb-6e47-484d-062b-2feef6380e9a"
          ]
        },
        {
          "uuid": "6496ecd1-d438-3522-cd40-286f3c47f4fd",
          "code": "100000082255",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "161578ff-4d75-228b-40cb-68365c9c4764"
          ]
        },
        {
          "uuid": "2ef041c8-a65e-738f-a558-dbfa04b11119",
          "code": "41693",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=41693",
          "code_system": "NSC",
          "references": [
            "b2af0997-3342-a772-e280-4bb7f8d5fc23"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4c3cdc1c-2548-4145-8342-26c91cdf9c39",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c300f3d9-b770-4955-863f-6fef464d0591",
            "refuuid": "5c43188b-6ab7-4431-98e5-b243110049be",
            "name": "PHENINDIONE",
            "unii": "5M7Y6274ZE",
            "linking_id": "5M7Y6274ZE",
            "ref_pname": "PHENINDIONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6cb065e7-3bfa-48fc-b117-df7584b59190",
          "name": "1H-INDENE-1,3(2H)-DIONE, 2-PHENYL-",
          "stdName": "1H-INDENE-1,3(2H)-DIONE, 2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32923592-4ca9-4151-b324-9bdd027e1b73"
          ],
          "display_name": false
        },
        {
          "uuid": "88344448-4623-495a-a433-baaa96de36b0",
          "name": "2-Phenyl-1,3-indandione",
          "stdName": "2-PHENYL-1,3-INDANDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32923592-4ca9-4151-b324-9bdd027e1b73"
          ],
          "display_name": false
        },
        {
          "uuid": "b56675cc-fb67-4c6d-a86d-990e226329d8",
          "name": "DANILONE",
          "stdName": "DANILONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4be057a5-2205-41d6-954c-2f63a4d87a97"
          ],
          "display_name": false
        },
        {
          "uuid": "3b34cf46-163f-49c9-b244-ede4d05f2e8f",
          "name": "HEDULIN",
          "stdName": "HEDULIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1bc4286-38b3-46af-8fba-496e08b950ee"
          ],
          "display_name": false
        },
        {
          "uuid": "5cbf63a8-4e02-4cbe-a4b3-557bcea2dfb1",
          "name": "NSC-41693",
          "stdName": "NSC-41693",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4af11b61-afca-432a-a07e-187a7d621eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "1ee3d580-a6dd-4c37-9095-891444c1ac1a",
          "name": "PHENINDIONE",
          "stdName": "PHENINDIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2c0a442-ea4c-46af-899a-c83aa18aeca7",
            "2ffc1890-74fb-4975-84ae-88231cba6ac2",
            "a3c43f08-67f4-440b-838f-af2a5aca058b",
            "b8e5546b-aff1-48d2-b4b6-4053e0652148",
            "ea0983b2-e909-43f6-b67e-3cb736a18121",
            "31346b48-e022-42a7-a176-5c79c34577da",
            "5eb8002d-8182-4bcc-b59c-d9cc60b866c3",
            "32923592-4ca9-4151-b324-9bdd027e1b73",
            "78ad8e1a-7c5a-4316-ba62-c4b776ffaf00",
            "cd0c91ed-b70f-401a-bddc-e697036da86a",
            "49216388-efea-4e96-8241-c5e904b4e6d0",
            "e415062d-c044-4420-b45b-fcbe4333e96e",
            "8c4d136d-1bde-4bc0-aee4-4692a925b32b",
            "6b8be099-d497-48b3-a29d-b2719fd92aab",
            "47b37a4f-718e-424b-9598-3c81fe597976"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "670d4df6-539c-4995-b44b-e8ff04764f35",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "1a4c3a82-2958-4f75-9254-c08871e8ba77",
          "name": "PHENINDIONE [HSDB]",
          "stdName": "PHENINDIONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5eb8002d-8182-4bcc-b59c-d9cc60b866c3"
          ],
          "display_name": false
        },
        {
          "uuid": "95f36803-6c36-4c8c-877a-bc02d245ab68",
          "name": "PHENINDIONE [MART.]",
          "stdName": "PHENINDIONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c4d136d-1bde-4bc0-aee4-4692a925b32b"
          ],
          "display_name": false
        },
        {
          "uuid": "1483c7bd-172c-4b24-a525-dd9cfe787f45",
          "name": "PHENINDIONE [MI]",
          "stdName": "PHENINDIONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ffc1890-74fb-4975-84ae-88231cba6ac2"
          ],
          "display_name": false
        },
        {
          "uuid": "9374f0da-4f5a-4ec2-ac7b-e982052705b8",
          "name": "PHENINDIONE [ORANGE BOOK]",
          "stdName": "PHENINDIONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e415062d-c044-4420-b45b-fcbe4333e96e"
          ],
          "display_name": false
        },
        {
          "uuid": "f9e1bd1e-424c-2e13-9181-83c45a4dfcbd",
          "name": "Phenindione [WHO-DD]",
          "stdName": "PHENINDIONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c51cf384-4603-1f17-9f2f-09e5f4e66ea8"
          ],
          "display_name": false
        },
        {
          "uuid": "eeb7570e-888e-4e4a-b457-348d11acfc41",
          "name": "phenindione [INN]",
          "stdName": "PHENINDIONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49216388-efea-4e96-8241-c5e904b4e6d0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "32923592-4ca9-4151-b324-9bdd027e1b73",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d1bc4286-38b3-46af-8fba-496e08b950ee",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49216388-efea-4e96-8241-c5e904b4e6d0",
          "citation": "INN Proposed List 41",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL41.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e415062d-c044-4420-b45b-fcbe4333e96e",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c4d136d-1bde-4bc0-aee4-4692a925b32b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ffc1890-74fb-4975-84ae-88231cba6ac2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5eb8002d-8182-4bcc-b59c-d9cc60b866c3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b8be099-d497-48b3-a29d-b2719fd92aab",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47b37a4f-718e-424b-9598-3c81fe597976",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4be057a5-2205-41d6-954c-2f63a4d87a97",
          "citation": "http://www.flexyx.com/D/Danilone.html",
          "url": "http://www.flexyx.com/D/Danilone.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4af11b61-afca-432a-a07e-187a7d621eb7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2ce5bf7-1389-4698-80b4-f000dc624b9a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59130a6f-9b66-4d31-8685-7c9c3eba6c96",
          "citation": "SRS import [5M7Y6274ZE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5M7Y6274ZE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2c0a442-ea4c-46af-899a-c83aa18aeca7",
          "citation": "PHENINDIONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3c43f08-67f4-440b-838f-af2a5aca058b",
          "citation": "PHENINDIONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ea0983b2-e909-43f6-b67e-3cb736a18121",
          "citation": "PHENINDIONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd0c91ed-b70f-401a-bddc-e697036da86a",
          "citation": "PHENINDIONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "31346b48-e022-42a7-a176-5c79c34577da",
          "citation": "PHENINDIONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8e5546b-aff1-48d2-b4b6-4053e0652148",
          "citation": "PHENINDIONE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78ad8e1a-7c5a-4316-ba62-c4b776ffaf00",
          "citation": "PHENINDIONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2f81de5e-ccba-4197-15cf-266a43a50c11",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=83-12-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ae96aad7-6c2e-1790-1438-8151081730e7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+83-12-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "161578ff-4d75-228b-40cb-68365c9c4764",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8462f0bb-6e47-484d-062b-2feef6380e9a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd5f1417-01a8-4a5e-80f1-e63f54a28a22",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b2af0997-3342-a772-e280-4bb7f8d5fc23",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c51cf384-4603-1f17-9f2f-09e5f4e66ea8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fadc6390-fa0f-4d03-b9af-64b51dcb71fc",
          "id": "fadc6390-fa0f-4d03-b9af-64b51dcb71fc",
          "molfile": "\n  Marvin  01132113002D          \n\n 17 19  0  0  0  0            999 V2000\n    2.6991    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9529   -0.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4815   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9529   -2.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6991   -2.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7482   -1.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4630   -2.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1858   -1.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1858   -1.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4630   -0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7482   -1.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6578   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2433   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -0.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2433   -0.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C2C(=O)c3ccccc3C2=O",
          "formula": "C15H10O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c50c0163-c526-4376-872e-02c6774a2f11"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "222.2393",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c43188b-6ab7-4431-98e5-b243110049be",
      "version": "16",
      "structure": {
        "id": "6fbcb3b1-cc8c-4e32-925e-73fe481300d1",
        "molfile": "\n  Marvin  01132105482D          \n\n 17 19  0  0  0  0            999 V2000\n    2.9529   -0.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9529   -2.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4815   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7482   -1.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7482   -1.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6991    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6991   -2.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6578   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4630   -0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4630   -2.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2433   -0.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2433   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1858   -1.8676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1858   -1.0439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -0.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  2  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  2  0  0  0  0\n 15 12  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 15  1  0  0  0  0\n  5  2  1  0  0  0  0\n 13 10  2  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C2C(=O)c3ccccc3C2=O",
        "formula": "C15H10O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "222.2393",
        "optical_activity": "NONE",
        "references": [
          "32923592-4ca9-4151-b324-9bdd027e1b73",
          "59130a6f-9b66-4d31-8685-7c9c3eba6c96",
          "49216388-efea-4e96-8241-c5e904b4e6d0"
        ],
        "stereo_centers": 0
      },
      "unii": "5M7Y6274ZE"
    }
  ]
}