{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c4330cde-f760-4198-a222-d1c5fea06234",
          "code": "5968-70-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5968-70-7",
          "code_system": "CAS",
          "references": [
            "a2213cf8-21b8-40eb-9e0b-a6fd2bc2a539",
            "3d98fd90-9fe8-4327-ad11-577b0d081f6a"
          ]
        },
        {
          "uuid": "63a6c44e-87f1-4b1e-8c4d-c4f91931cb4f",
          "code": "11386458",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11386458",
          "code_system": "PUBCHEM",
          "references": [
            "a2213cf8-21b8-40eb-9e0b-a6fd2bc2a539"
          ]
        },
        {
          "uuid": "f3944b2a-fb4b-8f56-66e7-0fff0cc1fe39",
          "code": "DTXSID7057579",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7057579",
          "code_system": "EPA CompTox",
          "references": [
            "bb44dafe-5a3d-2d9e-8f3e-03cf902147cc"
          ]
        },
        {
          "uuid": "a0b407df-c04e-402f-bc95-33b8e9f48640",
          "code": "5M3483EOU5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19047c64-d011-4be9-9ac6-54f14fc6931a",
          "name": ".BETA.-BOSWELLIC ACID ACETATE",
          "stdName": ".BETA.-BOSWELLIC ACID ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "52106ba4-b9da-4e1c-92b9-edf7717dfd42"
          ],
          "display_name": false
        },
        {
          "uuid": "5f628b3e-9547-4697-b35d-e1efc6f59042",
          "name": "3-ACETYL-.BETA.-BOSWELLIC ACID",
          "stdName": "3-ACETYL-.BETA.-BOSWELLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "10fa3e57-3a5e-4a5e-af8b-e1befce3a90d"
          ],
          "display_name": true
        },
        {
          "uuid": "87c5ca54-cdd6-4d93-b13b-9287748733ae",
          "name": "3-ACETYL-.BETA.-BOSWELLIC ACID (CONSTITUENT OF BOSWELLIA SERRATA) [DSC]",
          "stdName": "3-ACETYL-.BETA.-BOSWELLIC ACID (CONSTITUENT OF BOSWELLIA SERRATA) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "52106ba4-b9da-4e1c-92b9-edf7717dfd42"
          ],
          "display_name": false
        },
        {
          "uuid": "38ae33e0-828f-4901-8f5d-ee02e3db57f3",
          "name": "ACETYL-.BETA.-BOSWELLIC ACID",
          "stdName": "ACETYL-.BETA.-BOSWELLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "52106ba4-b9da-4e1c-92b9-edf7717dfd42"
          ],
          "display_name": false
        },
        {
          "uuid": "9894f6d1-4adc-4bc0-aa13-ddd6faee079f",
          "name": "URS-12-EN-23-OIC ACID, 3-(ACETYLOXY)-, (3.ALPHA.,4.BETA.)-",
          "stdName": "URS-12-EN-23-OIC ACID, 3-(ACETYLOXY)-, (3.ALPHA.,4.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "10fa3e57-3a5e-4a5e-af8b-e1befce3a90d"
          ],
          "display_name": false
        },
        {
          "uuid": "7c9f180c-4286-4dd9-abe6-8332e5c6f887",
          "name": "URS-12-EN-24-OIC ACID, 3.ALPHA.-HYDROXY-, ACETATE",
          "stdName": "URS-12-EN-24-OIC ACID, 3.ALPHA.-HYDROXY-, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a820201-977a-4280-8482-d7163ad66a6f",
            "a0f66fd8-d0c0-4108-bc4d-b4425cd2e673"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "10fa3e57-3a5e-4a5e-af8b-e1befce3a90d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0a820201-977a-4280-8482-d7163ad66a6f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52106ba4-b9da-4e1c-92b9-edf7717dfd42",
          "citation": "USP-DSC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0f66fd8-d0c0-4108-bc4d-b4425cd2e673",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2213cf8-21b8-40eb-9e0b-a6fd2bc2a539",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f70f0fe-3196-4329-a2e7-6447681eabea",
          "citation": "USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73a86222-56a4-4913-86df-ed98765e88cb",
          "citation": "SRS import [5M3483EOU5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5M3483EOU5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb44dafe-5a3d-2d9e-8f3e-03cf902147cc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5968-70-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3d98fd90-9fe8-4327-ad11-577b0d081f6a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f6db6964-3f52-48f8-9d39-d9646ccf55ed",
          "id": "f6db6964-3f52-48f8-9d39-d9646ccf55ed",
          "molfile": "\n  Marvin  01132112482D          \n\n 36 40  0  0  1  0            999 V2000\n   11.4029   -4.5526    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.4029   -3.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1173   -4.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1173   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4028   -6.2026    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.0417   -6.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4028   -7.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6883   -7.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9738   -7.0276    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.0553   -7.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9738   -6.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2593   -5.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5448   -6.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5448   -7.0276    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8303   -7.4400    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.6615   -6.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1158   -7.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4014   -7.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4014   -8.2650    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6433   -7.9135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0599   -8.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2349   -8.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6433   -9.0802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1158   -8.6776    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5047   -9.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4869   -9.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1577   -9.1511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4869   -9.9805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8303   -8.2650    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.5448   -8.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2593   -8.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2593   -7.4401    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.3524   -6.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6883   -5.7901    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.6883   -4.9650    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.9739   -4.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 35  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n 34  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 32  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 34 11  1  6  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  1  0  0  0\n 15 14  1  0  0  0  0\n 14 32  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 29 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 24  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 24 25  1  6  0  0  0\n 24 26  1  0  0  0  0\n 24 29  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 29 30  1  1  0  0  0\n 30 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  1  0  0  0\n 35 34  1  0  0  0  0\n 35 36  1  1  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H]([C@@](C)([C@@H]5CC[C@]43C)C(=O)O)OC(=O)C)[C@@H]2[C@H]1C",
          "formula": "C32H50O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7fbff8d3-d07f-4663-94ab-12be4a576364"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "498.7382",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d1ce5ea-e50f-4ceb-a741-4c372d2920fd",
      "version": "5",
      "structure": {
        "id": "cc6b391b-687b-43a6-90e0-19d5c6cdba79",
        "molfile": "\n  Marvin  01132110332D          \n\n 39 43  0  0  1  0            999 V2000\n    6.4014   -7.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1158   -7.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8303   -7.4400    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8303   -8.2650    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1158   -8.6776    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4014   -8.2650    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5448   -7.0276    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2593   -7.4401    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2593   -8.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5448   -8.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5448   -6.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2593   -5.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9738   -6.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9738   -7.0276    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6883   -5.7901    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.4028   -6.2026    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.4028   -7.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6883   -7.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6883   -4.9650    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4029   -4.5526    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.1173   -4.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1173   -5.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6433   -7.9135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4029   -3.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0553   -7.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5047   -9.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9739   -4.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0417   -6.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3524   -6.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6615   -6.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4869   -9.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1577   -9.1511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4869   -9.9805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9739   -5.3775    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1158   -7.8526    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5448   -7.6846    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0599   -8.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6433   -9.0802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2349   -8.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  5  1  0  0  0  0\n  3  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n  8 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 16 22  1  0  0  0  0\n  6 23  1  6  0  0  0\n 20 24  1  6  0  0  0\n 14 25  1  6  0  0  0\n  5 26  1  6  0  0  0\n 19 27  1  1  0  0  0\n 16 28  1  1  0  0  0\n  8 29  1  1  0  0  0\n  3 30  1  1  0  0  0\n  5 31  1  1  0  0  0\n 31 32  1  0  0  0  0\n 31 33  2  0  0  0  0\n 15 34  1  1  0  0  0\n  4 35  1  6  0  0  0\n  7 36  1  6  0  0  0\n 23 37  1  0  0  0  0\n 37 38  2  0  0  0  0\n 37 39  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@H]([C@@](C)([C@]5([H])CC[C@]43C)C(=O)O)OC(=O)C)[C@]2([H])[C@H]1C",
        "formula": "C32H50O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "498.7382",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "73a86222-56a4-4913-86df-ed98765e88cb",
          "10fa3e57-3a5e-4a5e-af8b-e1befce3a90d"
        ],
        "stereo_centers": 11
      },
      "unii": "5M3483EOU5"
    }
  ]
}