{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e435134f-f6d9-4a0a-9673-a71a773acf6e",
          "code": "68855-18-5",
          "type": "NON-SPECIFIC SUBSTITUTION",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68855-18-5",
          "code_system": "CAS",
          "references": [
            "00ea2393-4d7d-41e3-b3e7-fa7399f5369f",
            "e294ce84-292c-4ffe-a55b-b5b5e5e62056"
          ]
        },
        {
          "uuid": "cc5c4b6b-b049-4ad9-8271-823b351c72cc",
          "code": "272-469-1",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "00ea2393-4d7d-41e3-b3e7-fa7399f5369f"
          ]
        },
        {
          "uuid": "3917ea43-a54a-4024-a37f-6c76246383b8",
          "code": "1306188",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306188/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "00ea2393-4d7d-41e3-b3e7-fa7399f5369f"
          ]
        },
        {
          "uuid": "209cc7b9-cb4c-4931-a2ee-9c0c9edff6e5",
          "code": "119728",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119728",
          "code_system": "PUBCHEM",
          "references": [
            "00ea2393-4d7d-41e3-b3e7-fa7399f5369f"
          ]
        },
        {
          "uuid": "b57023f4-3c61-4c56-97c0-fd34ad2d609e",
          "code": "27841-04-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27841-04-9",
          "code_system": "CAS",
          "references": [
            "0cf1a993-a52c-50b6-f0cc-917d1ca1c149"
          ]
        },
        {
          "uuid": "65559fcb-45d0-c40c-611b-65ead1576450",
          "code": "248-687-8",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.246",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "396fff8b-3596-5b32-1a6c-05519b266bc1"
          ]
        },
        {
          "uuid": "66e5ab81-3d89-4171-acdc-8ff4cab78bc9",
          "code": "5LKW3C543X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1c99c3de-27d4-d708-2fcd-f301d3a550f4",
          "code": "DTXSID10865400",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10865400",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "cef7db9f-f094-949c-7bcf-f5b0cddc6466",
          "code": "5LKW3C543X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=5LKW3C543X",
          "code_system": "DAILYMED",
          "references": [
            "a73a96fd-f3ec-1f08-3271-f2a83c88c022"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e75b9d35-c0a4-4e8b-abbd-b160e20be142",
          "name": "1,3-PROPANEDIOL, 2,2-DIMETHYL-, DIHEPTANOATE",
          "stdName": "1,3-PROPANEDIOL, 2,2-DIMETHYL-, DIHEPTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7356b41-f52f-4114-9c63-4eedae7937e6",
            "b742ee25-2b06-42ba-a500-42c41d301471"
          ],
          "display_name": false
        },
        {
          "uuid": "fe84cb05-e3a9-476f-8449-e6fcd4a699c6",
          "name": "HEPTANOIC ACID 2,2-DIMETHYLTRIMETHYLENE ESTER",
          "stdName": "HEPTANOIC ACID 2,2-DIMETHYLTRIMETHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7356b41-f52f-4114-9c63-4eedae7937e6",
            "b742ee25-2b06-42ba-a500-42c41d301471"
          ],
          "display_name": false
        },
        {
          "uuid": "cc2afce4-3dfc-4285-8c09-b35badb2865f",
          "name": "HEPTANOIC ACID, 2,2-DIMETHYL-1,3-PROPANEDIYL DIESTER",
          "stdName": "HEPTANOIC ACID, 2,2-DIMETHYL-1,3-PROPANEDIYL DIESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7356b41-f52f-4114-9c63-4eedae7937e6",
            "b742ee25-2b06-42ba-a500-42c41d301471"
          ],
          "display_name": false
        },
        {
          "uuid": "ab7f4ab1-c9bf-45a9-8e87-cb596b85e9eb",
          "name": "NEOPENTYL GLYCOL DIHEPTANOATE",
          "stdName": "NEOPENTYL GLYCOL DIHEPTANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7356b41-f52f-4114-9c63-4eedae7937e6",
            "6ed2fd9f-eade-49bb-afc5-e6cca69d55a3",
            "89f4d034-955d-4362-b083-07f53b0ffc1d",
            "b742ee25-2b06-42ba-a500-42c41d301471"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "695406aa-fb2a-45cc-b6a2-6eded7197c3d",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "b742ee25-2b06-42ba-a500-42c41d301471",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a7356b41-f52f-4114-9c63-4eedae7937e6",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89f4d034-955d-4362-b083-07f53b0ffc1d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00ea2393-4d7d-41e3-b3e7-fa7399f5369f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73ae380c-e77c-4808-a83e-980592278dce",
          "citation": "SRS import [5LKW3C543X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5LKW3C543X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ed2fd9f-eade-49bb-afc5-e6cca69d55a3",
          "citation": "NEOPENTYL GLYCOL DIHEPTANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0cf1a993-a52c-50b6-f0cc-917d1ca1c149",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e294ce84-292c-4ffe-a55b-b5b5e5e62056",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "396fff8b-3596-5b32-1a6c-05519b266bc1",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "a73a96fd-f3ec-1f08-3271-f2a83c88c022",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "37cb0c31-a3bf-4ba7-9568-3a5bc403ca8c",
          "id": "37cb0c31-a3bf-4ba7-9568-3a5bc403ca8c",
          "molfile": "\n  Marvin  01132102582D          \n\n 23 22  0  0  0  0            999 V2000\n   -2.5504   -1.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8978   -2.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1350   -2.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4825   -2.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2805   -2.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9330   -2.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6957   -2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8059   -1.7511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3484   -3.0745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1111   -2.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7674   -3.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3196   -3.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2058   -3.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4205   -2.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1809   -3.0801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8376   -2.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7337   -1.7620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6011   -2.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -2.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0183   -2.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6749   -2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -2.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0912   -2.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCC",
          "formula": "C19H36O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d07ad04-4ef2-44e5-a1ce-3cd9b908b7e3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "328.4875",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d46b9545-4a8e-4ba5-ba53-b273b95036f0",
      "version": "7",
      "structure": {
        "id": "2096c3a8-675c-4dc6-9094-ed30d01d4a12",
        "molfile": "\n  Marvin  01132101512D          \n\n 23 22  0  0  0  0            999 V2000\n   -2.5504   -1.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8978   -2.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1350   -2.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4825   -2.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2805   -2.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9330   -2.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6957   -2.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8059   -1.7511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3484   -3.0745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1111   -2.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7674   -3.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4205   -2.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1809   -3.0801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8376   -2.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7337   -1.7620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6011   -2.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -2.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0183   -2.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6749   -2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -2.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0912   -2.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3196   -3.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2058   -3.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 11 22  1  0  0  0  0\n 11 23  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCC",
        "formula": "C19H36O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "328.4875",
        "optical_activity": "NONE",
        "references": [
          "73ae380c-e77c-4808-a83e-980592278dce",
          "b742ee25-2b06-42ba-a500-42c41d301471"
        ],
        "stereo_centers": 0
      },
      "unii": "5LKW3C543X"
    }
  ]
}