{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "415208cb-f3f6-406a-aed9-2c88208be686", "code": "21018-84-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=21018-84-8", "code_system": "CAS", "references": [ "7bd89855-4f18-4b17-b98b-8ad0ca74263d", "6bd95980-3030-44a1-a9b2-59a59143aebe" ] }, { "uuid": "8ca33664-d855-43b8-8dd9-7e44e3c380b9", "code": "C102609", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67102609", "code_system": "MESH", "references": [ "7bd89855-4f18-4b17-b98b-8ad0ca74263d" ] }, { "uuid": "fc7aa113-7ee8-4b6b-a879-486890bc8d7e", "code": "AMAROGENTIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Amarogentin", "code_system": "WIKIPEDIA", "references": [ "7bd89855-4f18-4b17-b98b-8ad0ca74263d" ] }, { "uuid": "7dd5fdeb-2044-4504-b465-70ad06ad51bd", "code": "m1641", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m1641?q=authorize", "code_system": "MERCK INDEX", "references": [ "7bd89855-4f18-4b17-b98b-8ad0ca74263d" ] }, { "uuid": "fc7c1b58-104b-4d15-bbb5-a60761b20d91", "code": "115149", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115149", "code_system": "PUBCHEM", "references": [ "7bd89855-4f18-4b17-b98b-8ad0ca74263d" ] }, { "uuid": "b440c633-255e-4e73-9746-eb550f2fbc38", "code": "5L82GT5I0W", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "16380dfe-3da9-3262-6f50-13c9c2c4e6f4", "code": "2622", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2622", "code_system": "CHEBI", "references": [ "751cc510-0873-3788-5717-26b8aa1d70db" ] }, { "uuid": "95491c5c-c0cb-55b4-54b9-20162349efb5", "code": "DTXSID501029787", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501029787", "code_system": "EPA CompTox", "references": [ "751cc510-0873-3788-5717-26b8aa1d70db" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ac351d86-697c-49a3-86d0-a75155d5ce81", "name": "AMAROGENTIN", "stdName": "AMAROGENTIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12042196-dc68-4b43-afa5-f518250dd525", "8589b210-57d4-4042-9fd6-c0d5482c63d7", "16459fda-525b-4349-903e-c210bc6664d6", "5fdc5710-04c4-44e7-8d9a-f1de5cba73d1" ], "display_name": true }, { "uuid": "56338db7-ebf4-4db2-ada7-824c25b605fb", "name": "AMAROGENTIN [MI]", "stdName": "AMAROGENTIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8589b210-57d4-4042-9fd6-c0d5482c63d7", "16459fda-525b-4349-903e-c210bc6664d6" ], "display_name": false } ], "references": [ { "uuid": "5fdc5710-04c4-44e7-8d9a-f1de5cba73d1", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8589b210-57d4-4042-9fd6-c0d5482c63d7", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "16459fda-525b-4349-903e-c210bc6664d6", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7bd89855-4f18-4b17-b98b-8ad0ca74263d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391019000, "tags": [ "NOMEN" ] }, { "uuid": "fba76770-b43e-4f47-a020-8c2ca322b82e", "citation": "SRS import [5L82GT5I0W]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5L82GT5I0W", "doc_type": "SRS", "public_domain": true, "document_date": 1493391019000, "tags": [ "NOMEN" ] }, { "uuid": "a900ca75-f3f0-4531-9684-5a905402ac5a", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12042196-dc68-4b43-afa5-f518250dd525", "citation": "AMAROGENTIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6bd95980-3030-44a1-a9b2-59a59143aebe", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "751cc510-0873-3788-5717-26b8aa1d70db", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7fc1431f-9091-499b-aa11-613da0271183", "id": "7fc1431f-9091-499b-aa11-613da0271183", "molfile": "\n Marvin 01132106382D \n\n 42 46 0 0 1 0 999 V2000\n 8.0650 -8.1685 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.0650 -8.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -9.3947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3536 -7.7564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3536 -6.9289 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.6386 -6.5215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9259 -6.9361 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.9259 -7.7635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2132 -8.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5015 -7.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -8.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -9.0040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0720 -7.7655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0720 -6.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -6.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5015 -6.9398 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.2120 -6.5298 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.2120 -5.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9228 -5.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0633 -6.5142 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.0633 -4.7332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8121 -4.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8121 -3.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5224 -4.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5224 -5.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8031 -5.9621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2322 -5.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9499 -5.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6681 -5.9668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9499 -4.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2330 -4.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2330 -3.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9495 -3.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9495 -2.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2332 -1.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5084 -2.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7924 -1.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5084 -3.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7750 -6.9275 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.4973 -6.5149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7750 -7.7550 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.4977 -8.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 41 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 20 5 1 0 0 0 0\n 7 6 1 6 0 0 0\n 7 8 1 0 0 0 0\n 7 17 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 16 10 1 1 0 0 0\n 11 12 2 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 1 0 0 0\n 18 19 2 0 0 0 0\n 20 21 1 6 0 0 0\n 20 39 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 31 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 38 32 2 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 39 40 1 1 0 0 0\n 39 41 1 0 0 0 0\n 41 42 1 6 0 0 0\nM END", "smiles": "C=C[C@@H]1[C@@H]2CCOC(=O)C2=CO[C@H]1O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)OC(=O)c4c(cc(cc4O)O)-c5cccc(c5)O", "formula": "C29H30O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "40f52ecc-3ffa-4939-9818-7420aab3dfb1" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "586.5418", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "4ce934b0-20f7-4b06-b5e1-217ff1f14bd4", "version": "4", "structure": { "id": "8f5ab03a-65b5-40ad-a8ba-664bf81be4e0", "molfile": "\n Marvin 01132107262D \n\n 44 48 0 0 1 0 999 V2000\n 3.0720 -6.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0720 -7.7655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -8.1730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -9.0040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5015 -7.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5015 -6.9398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.2120 -6.5298 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.2120 -5.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9228 -5.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9259 -6.9361 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.6386 -6.5215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3536 -6.9289 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.3536 -6.1087 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3536 -7.7564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0650 -8.1685 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0650 -8.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -9.3947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7750 -7.7550 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.4977 -8.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7750 -6.9275 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.0633 -6.5142 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.0633 -4.7332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8121 -4.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5224 -4.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5224 -5.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2322 -5.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9499 -5.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9499 -4.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2330 -4.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2330 -3.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9495 -3.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9495 -2.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2332 -1.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5084 -2.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5084 -3.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7924 -1.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6681 -5.9668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8031 -5.9621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8121 -3.4832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4973 -6.5149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9259 -7.7635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2132 -8.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5015 -6.1194 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7873 -6.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 8 9 2 0 0 0 0\n 10 7 1 0 0 0 0\n 10 11 1 6 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 1 0 0 0\n 16 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 6 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 24 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 30 1 0 0 0 0\n 34 36 1 0 0 0 0\n 27 37 1 0 0 0 0\n 25 38 1 0 0 0 0\n 23 39 2 0 0 0 0\n 12 21 1 0 0 0 0\n 20 40 1 1 0 0 0\n 41 10 1 0 0 0 0\n 42 41 1 0 0 0 0\n 5 42 2 0 0 0 0\n 6 43 1 6 0 0 0\n 6 44 1 0 0 0 0\n 1 44 1 0 0 0 0\nM END", "smiles": "C=C[C@@H]1[C@]2([H])CCOC(=O)C2=CO[C@H]1O[C@@]3([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)OC(=O)c4c(cc(cc4O)O)-c5cccc(c5)O", "formula": "C29H30O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "586.5418", "optical_activity": "UNSPECIFIED", "references": [ "fba76770-b43e-4f47-a020-8c2ca322b82e", "a900ca75-f3f0-4531-9684-5a905402ac5a" ], "stereo_centers": 8 }, "unii": "5L82GT5I0W" } ] }