{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a8bd5bed-d2de-4349-8da3-f81e3724af36",
          "code": "5905-52-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5905-52-2",
          "code_system": "CAS",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772",
            "0a471fee-72ce-44a1-8f9f-cc0d64ecc18a"
          ]
        },
        {
          "uuid": "afba48b5-5b17-4528-b861-77f2cf4c8a05",
          "code": "C76078",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76078",
          "code_system": "NCI_THESAURUS",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "56f97b88-c7e3-48b3-b1ad-0d9730e81fe4",
          "code": "C101012",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67101012",
          "code_system": "MESH",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "1d04b249-45c8-43ad-897c-bbe73aafb733",
          "code": "IRON(II) LACTATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Iron(II)_lactate",
          "code_system": "WIKIPEDIA",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "de03f2ec-fe60-4885-b178-aab931bfa89b",
          "code": "21 CFR 184.1311",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1311 Ferrous lactate",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1311",
          "code_system": "CFR",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "90efd9cf-423c-48e5-b15f-c4cd0063339f",
          "code": "INS-585",
          "comments": "Codex Alimentarius|Functional Classification|Colour retention agent",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=278",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "a794fc3c-7250-42e6-9248-1d738634e010",
          "code": "INS-585",
          "comments": "JECFA|Functional Classification|COLOUR RETENTION AGENT|NUTRIENT SUPPLEMENT",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=585",
          "code_system": "JECFA EVALUATION",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "22abfb41-e4c4-4edf-9d49-c3758b7997db",
          "code": "136034",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/136034/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "1e4f9893-035e-4eea-9096-e3ddd1b6fdc7",
          "code": "m5347",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5347?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "09c1979a-4710-4b01-b9e2-8d08e22741b6",
          "code": "SUB13871MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "e8c6fd9f-19b7-4cbd-9ec7-f13d5efe19e7",
          "code": "227-608-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.098",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "a305f6bc-235e-4779-8695-ac2f7d8f6bbf",
          "code": "22197",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22197",
          "code_system": "PUBCHEM",
          "references": [
            "311803e1-a2bc-4bc1-943e-5eaea5cc3772"
          ]
        },
        {
          "uuid": "5b673104-e8eb-048b-886a-223624ebba5f",
          "code": "462",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/462",
          "code_system": "HSDB",
          "references": [
            "09a7a832-50c4-3004-ce08-0d6fb6f08640"
          ]
        },
        {
          "uuid": "be71552a-6858-4ecf-4eb1-92ac0f6a96ce",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "861b227b-d5d2-b797-257f-bbc75cd08b15"
          ]
        },
        {
          "uuid": "22b87d52-4ca1-480a-b0da-24a7eaea9e80",
          "code": "5JU4C2L5A0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4ae53621-51ad-e065-b715-76944e669dc0",
          "code": "DTXSID501018671",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501018671",
          "code_system": "EPA CompTox",
          "references": [
            "861b227b-d5d2-b797-257f-bbc75cd08b15"
          ]
        },
        {
          "uuid": "e97b061a-1bd6-199a-e7dd-39fe1af46782",
          "code": "100000078471",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "611a71d7-4817-3c63-1ebc-ecd4a3e647ef"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1d919226-3326-4f8b-8875-8ea9758a3aff",
          "amount": {
            "uuid": "ac02a3c6-6770-42b2-8e16-7cfcf2dfb9b8"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "71845613-82ad-46d6-b80e-29f0d89ab848",
            "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d",
            "name": "FERROUS CATION",
            "unii": "GW89581OWR",
            "linking_id": "GW89581OWR",
            "ref_pname": "FERROUS CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4050e55b-1176-41da-aa9a-ae028a96fdd6",
          "amount": {
            "uuid": "5ba37f7a-13e5-49e1-a745-6bda13ca7b09"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "1078b5d8-e24e-443b-8579-5e4e88b6d7cd"
          ],
          "related_substance": {
            "uuid": "67568faa-f133-43f9-92af-fd958e80cc07",
            "refuuid": "3dc30993-9f33-4492-9ed3-d04aa1476329",
            "name": "FERROUS LACTATE TRIHYDRATE",
            "unii": "IEP40B1R5X",
            "linking_id": "IEP40B1R5X",
            "ref_pname": "FERROUS LACTATE TRIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c1db0c0-7abd-0514-550e-31475cf51c44",
          "amount": {
            "uuid": "ca870580-0a48-4eab-a42b-0302874aa0cc"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "0a471fee-72ce-44a1-8f9f-cc0d64ecc18a"
          ],
          "related_substance": {
            "uuid": "716a83bf-72f0-4db4-9477-d8dc7d693f71",
            "refuuid": "b94716f5-7338-4bfb-830c-57870275ff59",
            "name": "FERROUS LACTATE DIHYDRATE",
            "unii": "YLN5X5UL5X",
            "linking_id": "YLN5X5UL5X",
            "ref_pname": "FERROUS LACTATE DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "646aeca6-3044-419c-983a-f8684af69e69",
          "name": "E 585",
          "stdName": "E 585",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb59fe09-8c81-4ace-b2d3-74cc5a560ec4",
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9"
          ],
          "display_name": false
        },
        {
          "uuid": "1b14654a-f821-4e92-802f-b94a9cce59ea",
          "name": "E-585",
          "stdName": "E-585",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "d6dfd661-402e-414c-b8fc-3862ea25f414"
          ],
          "display_name": false
        },
        {
          "uuid": "1b760e6c-5b4c-4b8e-9531-322a137fba96",
          "name": "FERROUS LACTATE",
          "stdName": "FERROUS LACTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27d19f44-5158-40dc-87bb-d0a8cb3b7227",
            "3fb1d05e-1b46-412e-9819-a7f36bb4e327",
            "59a5f187-b3f7-415b-89df-0723f27e43fb",
            "e072957f-50aa-4682-9fee-cba29f256eea",
            "ab179691-e6be-4954-9c2a-ba3419423152",
            "be95e0af-5e17-4916-8cf6-0e4b092917c7",
            "4dba3555-592e-4cc3-926f-0b8a0386a08d",
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "886b4b10-9709-49a9-8a38-23a336d5bdb4",
            "5d20a0b9-67de-489f-aa32-0ae30280ad68",
            "81729ade-564b-4fa7-ba57-af17aadc427d",
            "25ab31e9-f162-41fe-bf57-39907e43c4dd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a72b29bd-01ac-4b61-80c6-9b249b0a1f34",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f2152d1c-0543-42bb-8072-158b1062ef24",
          "name": "FERROUS LACTATE [FCC]",
          "stdName": "FERROUS LACTATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "81729ade-564b-4fa7-ba57-af17aadc427d"
          ],
          "display_name": false
        },
        {
          "uuid": "5a0a2cb0-cfeb-48f7-9c16-20330ee90de6",
          "name": "FERROUS LACTATE [HSDB]",
          "stdName": "FERROUS LACTATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fb1d05e-1b46-412e-9819-a7f36bb4e327",
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9"
          ],
          "display_name": false
        },
        {
          "uuid": "e285f19d-fccc-4af8-a193-db05173b433f",
          "name": "FERROUS LACTATE [MI]",
          "stdName": "FERROUS LACTATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "886b4b10-9709-49a9-8a38-23a336d5bdb4"
          ],
          "display_name": false
        },
        {
          "uuid": "39b515d0-ca36-7602-df2f-45d07a490939",
          "name": "Ferrous lactate [WHO-DD]",
          "stdName": "FERROUS LACTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4511863-94a0-6833-4493-4c97ba34e5bc"
          ],
          "display_name": false
        },
        {
          "uuid": "0d257e2c-49e7-4679-8b5a-9c3aa5b34eb0",
          "name": "INS NO.585",
          "stdName": "INS NO.585",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "d6dfd661-402e-414c-b8fc-3862ea25f414"
          ],
          "display_name": false
        },
        {
          "uuid": "4b376821-a7f9-4877-993f-0436fd083e7f",
          "name": "INS-585",
          "stdName": "INS-585",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
            "d6dfd661-402e-414c-b8fc-3862ea25f414"
          ],
          "display_name": false
        },
        {
          "uuid": "32e911be-47c8-4457-a0bc-769bedbfc674",
          "name": "IRON DILACTATE",
          "stdName": "IRON DILACTATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
            "34b47f08-a9f2-4f21-a0eb-9574556c9b00"
          ],
          "display_name": false
        },
        {
          "uuid": "54a8d013-4aae-47f9-be8f-84a8cf8aceea",
          "name": "IRON(II) 2-HYDROXYPROPANOATE",
          "stdName": "IRON(II) 2-HYDROXYPROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
            "34b47f08-a9f2-4f21-a0eb-9574556c9b00"
          ],
          "display_name": false
        },
        {
          "uuid": "d1b8a120-473c-4335-b9ce-1d6d53352594",
          "name": "IRON(II) LACTATE",
          "stdName": "IRON(II) LACTATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
            "34b47f08-a9f2-4f21-a0eb-9574556c9b00"
          ],
          "display_name": false
        },
        {
          "uuid": "070b4593-4446-40fb-b82e-9ac2e2add5d0",
          "name": "IRON, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "stdName": "IRON, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb59fe09-8c81-4ace-b2d3-74cc5a560ec4",
            "1c0d407b-314e-4d50-b9d1-5e066f94d0c9"
          ],
          "display_name": false
        },
        {
          "uuid": "eb771d1c-ac08-4926-acc2-8ff0e00ff9ce",
          "name": "LACTIC ACID, IRON(II) SALT (2:1)",
          "stdName": "LACTIC ACID, IRON(II) SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
            "34b47f08-a9f2-4f21-a0eb-9574556c9b00"
          ],
          "display_name": false
        },
        {
          "uuid": "94002bdf-d75f-4639-8314-5b9b40faddca",
          "name": "PROPANOIC ACID, 2-HYDROXY-, IRON(2+) SALT (2:1)",
          "stdName": "PROPANOIC ACID, 2-HYDROXY-, IRON(2+) SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
            "34b47f08-a9f2-4f21-a0eb-9574556c9b00"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d20a0b9-67de-489f-aa32-0ae30280ad68",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "34b47f08-a9f2-4f21-a0eb-9574556c9b00",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1d120bc-fb20-4efd-bfbd-fb7e0dda4b6e",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "886b4b10-9709-49a9-8a38-23a336d5bdb4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c0d407b-314e-4d50-b9d1-5e066f94d0c9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81729ade-564b-4fa7-ba57-af17aadc427d",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be95e0af-5e17-4916-8cf6-0e4b092917c7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fb1d05e-1b46-412e-9819-a7f36bb4e327",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e072957f-50aa-4682-9fee-cba29f256eea",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6dfd661-402e-414c-b8fc-3862ea25f414",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=278",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=278",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb59fe09-8c81-4ace-b2d3-74cc5a560ec4",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "311803e1-a2bc-4bc1-943e-5eaea5cc3772",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390741000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5472639b-b2fa-4c28-a1f8-badea4d2c639",
          "citation": "SRS import [5JU4C2L5A0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5JU4C2L5A0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390741000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08136416-3f41-4b2d-ade1-cca28759dcf4",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dba3555-592e-4cc3-926f-0b8a0386a08d",
          "citation": "FERROUS LACTATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59a5f187-b3f7-415b-89df-0723f27e43fb",
          "citation": "FERROUS LACTATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "27d19f44-5158-40dc-87bb-d0a8cb3b7227",
          "citation": "FERROUS LACTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "25ab31e9-f162-41fe-bf57-39907e43c4dd",
          "citation": "FERROUS LACTATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab179691-e6be-4954-9c2a-ba3419423152",
          "citation": "FERROUS LACTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09a7a832-50c4-3004-ce08-0d6fb6f08640",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+5905-52-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "611a71d7-4817-3c63-1ebc-ecd4a3e647ef",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1078b5d8-e24e-443b-8579-5e4e88b6d7cd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "861b227b-d5d2-b797-257f-bbc75cd08b15",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0a471fee-72ce-44a1-8f9f-cc0d64ecc18a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d4511863-94a0-6833-4493-4c97ba34e5bc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "96997ac4-a3a9-471b-a2cb-887f93718102",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6855fd0d-e120-4a52-bd86-1fd2db5cfae2",
          "id": "6855fd0d-e120-4a52-bd86-1fd2db5cfae2",
          "molfile": "\n  Marvin  01132105262D          \n\n  1  0  0  0  0  0            999 V2000\n    5.3486   -2.8559    0.0000 Fe  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Fe+2]",
          "formula": "Fe",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8775a088-f0a0-4e34-bbb3-e3d5ecaace69"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "55.8451",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "809600c2-3a02-42b2-a0ed-d53a472dc148",
          "id": "809600c2-3a02-42b2-a0ed-d53a472dc148",
          "molfile": "\n  Marvin  01132106402D          \n\n  6  5  0  0  0  0            999 V2000\n    1.3152   -2.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0292   -2.8517    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.0250   -3.6784    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7432   -2.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -2.8559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7390   -1.6158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(C(=O)O)[O-]",
          "formula": "C3H5O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "006d5c42-8131-490d-9165-d55cf66fa701"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "89.0701",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "43b713b9-b727-464c-b3d7-7ab9f3872807",
      "version": "17",
      "structure": {
        "id": "a908ee34-7448-4fbf-8589-0ea9e3779348",
        "molfile": "\n   JSDraw206272409572D\n\n 13 10  0  0  0  0              0 V2000\n   21.1348   -7.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4821   -8.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8294   -7.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1767   -8.1873    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   22.4742   -9.7394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8215   -5.8472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.7458   -8.1873    0.0000 Fe  0  2  0  0  0  0  0  0  0  0  0  0\n   21.1348   -7.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4821   -8.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8294   -7.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1767   -8.1873    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   22.4742   -9.7394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8215   -5.8472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  1  2  1  0  0  0  0\n  3  6  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 13  2  0  0  0  0\n  9 10  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  8   1   2   3   4   5   6   8   9\nM  SAL   1  4  10  11  12  13\nM  SPA   1  6   1   2   3   4   5   6\nM  SDI   1  4   20.3422  -10.5319   20.3422   -5.0547\nM  SDI   1  4   25.9692   -5.0547   25.9692  -10.5319\nM  SMT   1 2\nM  CHG  3   4  -1   7   2  11  -1\nM  END",
        "smiles": "CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Fe+2]",
        "formula": "2C3H5O3.Fe",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "233.9854",
        "optical_activity": "( + / - )",
        "references": [
          "08136416-3f41-4b2d-ade1-cca28759dcf4",
          "5472639b-b2fa-4c28-a1f8-badea4d2c639"
        ],
        "stereo_centers": 2
      },
      "unii": "5JU4C2L5A0"
    }
  ]
}