{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc6a8653-cc8e-4dd5-9884-82999f87987d",
          "code": "CINNAMYL ISOVALERATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4765",
          "code_system": "JECFA EVALUATION",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734"
          ]
        },
        {
          "uuid": "0075e557-ec74-4000-87ae-2d9ae032f2b0",
          "code": "140-27-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=140-27-2",
          "code_system": "CAS",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734",
            "9fae48a5-793b-4388-afa1-70204d8d0899"
          ]
        },
        {
          "uuid": "841d7dd8-1947-4da7-9c0e-7fcee4b2db0d",
          "code": "C526337",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67526337",
          "code_system": "MESH",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734"
          ]
        },
        {
          "uuid": "dc36b35b-6ef6-4b81-959d-c232b33a2573",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734"
          ]
        },
        {
          "uuid": "9638e2ec-ca93-4296-9293-dc09e5b1e967",
          "code": "205-407-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.917",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734"
          ]
        },
        {
          "uuid": "7680b226-a39d-4ed3-a99d-532aeb586f69",
          "code": "5355855",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5355855",
          "code_system": "PUBCHEM",
          "references": [
            "997f8f70-8e69-483d-9286-862bde01e734"
          ]
        },
        {
          "uuid": "59fd3449-c29d-ba3b-8d40-2d7991735b45",
          "code": "DTXSID7059694",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7059694",
          "code_system": "EPA CompTox",
          "references": [
            "b8d9f6db-7444-1358-fdff-1c5d49e7f22c"
          ]
        },
        {
          "uuid": "36e9abfe-0f08-493f-b65a-2d7e9497e2af",
          "code": "5JHK9Y2XRM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2346df25-1bae-7711-05c5-e26997486b77",
          "code": "100000164318",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "29a7434d-12b8-6109-6f04-4e206b20b46b"
          ]
        },
        {
          "uuid": "47c3a8da-6747-12ab-cf51-6be875e27422",
          "code": "46141",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=46141",
          "code_system": "NSC",
          "references": [
            "83e94808-365f-3e61-893f-c316f423e108"
          ]
        },
        {
          "uuid": "806de9e7-f8d1-007e-8881-0dca229cf9c2",
          "code": "185",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/185/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "4eccce94-8f90-cf6b-5cbb-47ddb8d32950"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5fd4376b-229b-4cfe-8c9e-523f6620186b",
          "name": "BUTANOIC ACID, 3-METHYL-, 3-PHENYL-2-PROPEN-1-YL ESTER",
          "stdName": "BUTANOIC ACID, 3-METHYL-, 3-PHENYL-2-PROPEN-1-YL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a0f1279-326d-4de8-b312-441dee5148d6",
            "25853ab1-5146-4a56-a0a7-d727067a7ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "3ed1ccba-7025-491b-ba41-eb41215cadb8",
          "name": "BUTANOIC ACID, 3-METHYL-, 3-PHENYL-2-PROPENYL ESTER",
          "stdName": "BUTANOIC ACID, 3-METHYL-, 3-PHENYL-2-PROPENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a0f1279-326d-4de8-b312-441dee5148d6",
            "25853ab1-5146-4a56-a0a7-d727067a7ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "889622a8-2402-4f17-aa20-fe2faa9b9a13",
          "name": "CINNAMYL ISOVALERATE",
          "stdName": "CINNAMYL ISOVALERATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb7b508-30c9-4a8e-9503-296cdf0a4c7f",
            "45e1d9cc-35d6-449f-b2e5-19e26b170b1b",
            "25853ab1-5146-4a56-a0a7-d727067a7ddc",
            "7b58762a-65d2-4e24-b87d-38280345a8d7",
            "f108a139-db71-42fd-aa7b-c596a14e00f2"
          ],
          "display_name": true
        },
        {
          "uuid": "127cf18e-b1dc-4743-952e-9fbcf32b3d6d",
          "name": "CINNAMYL ISOVALERATE [FCC]",
          "stdName": "CINNAMYL ISOVALERATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25853ab1-5146-4a56-a0a7-d727067a7ddc",
            "7b58762a-65d2-4e24-b87d-38280345a8d7"
          ],
          "display_name": false
        },
        {
          "uuid": "2fec9a75-dc08-45db-ab52-959a9bb37e79",
          "name": "CINNAMYL ISOVALERATE [FHFI]",
          "stdName": "CINNAMYL ISOVALERATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25853ab1-5146-4a56-a0a7-d727067a7ddc",
            "f108a139-db71-42fd-aa7b-c596a14e00f2"
          ],
          "display_name": false
        },
        {
          "uuid": "d7d4eb60-3db8-48ab-8074-2a153b9ef145",
          "name": "FEMA NO. 2302",
          "stdName": "FEMA NO. 2302",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25853ab1-5146-4a56-a0a7-d727067a7ddc",
            "7b58762a-65d2-4e24-b87d-38280345a8d7"
          ],
          "display_name": false
        },
        {
          "uuid": "3ec65b68-d437-4874-849b-ba2790e5cc96",
          "name": "ISOVALERIC ACID, CINNAMYL ESTER",
          "stdName": "ISOVALERIC ACID, CINNAMYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a0f1279-326d-4de8-b312-441dee5148d6",
            "25853ab1-5146-4a56-a0a7-d727067a7ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "23cf7962-9de4-40e9-8a37-3bb04b9a7191",
          "name": "NSC-46141",
          "stdName": "NSC-46141",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87ec14ce-e919-46e7-8bfc-eeac9dcb3346",
            "25853ab1-5146-4a56-a0a7-d727067a7ddc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7b58762a-65d2-4e24-b87d-38280345a8d7",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "25853ab1-5146-4a56-a0a7-d727067a7ddc",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a0f1279-326d-4de8-b312-441dee5148d6",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f108a139-db71-42fd-aa7b-c596a14e00f2",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87ec14ce-e919-46e7-8bfc-eeac9dcb3346",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "997f8f70-8e69-483d-9286-862bde01e734",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390833000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed3ecce4-9be1-4245-ac34-527a64bb59a9",
          "citation": "SRS import [5JHK9Y2XRM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5JHK9Y2XRM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390833000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "feb7b508-30c9-4a8e-9503-296cdf0a4c7f",
          "citation": "CINNAMYL ISOVALERATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45e1d9cc-35d6-449f-b2e5-19e26b170b1b",
          "citation": "CINNAMYL ISOVALERATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8d9f6db-7444-1358-fdff-1c5d49e7f22c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=140-27-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "29a7434d-12b8-6109-6f04-4e206b20b46b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9fae48a5-793b-4388-afa1-70204d8d0899",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "83e94808-365f-3e61-893f-c316f423e108",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4eccce94-8f90-cf6b-5cbb-47ddb8d32950",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9817867a-cdb7-4f04-a5de-155357af26f9",
          "id": "9817867a-cdb7-4f04-a5de-155357af26f9",
          "molfile": "\n  Marvin  01132107542D          \n\n 16 16  0  0  0  0            999 V2000\n   -3.2616    0.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473    1.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473    2.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8329    0.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8329    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473   -0.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1157   -0.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4013    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3131   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0274    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7418   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4562    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1706   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1706   -1.1612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4562   -1.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7418   -1.1612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(=O)OC/C=C/c1ccccc1",
          "formula": "C14H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65836450-85d1-40fc-af4f-ff4aebe1ff68"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "218.292",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f921176f-397f-4054-9205-7ed3927f7608",
      "version": "7",
      "structure": {
        "id": "c936e1f6-78ab-436a-a45b-1c78c6d1173c",
        "molfile": "\n  Marvin  01132110242D          \n\n 16 16  0  0  0  0            999 V2000\n    1.7418   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0274    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4562    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7418   -1.1612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3131   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1706   -0.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4562   -1.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4013    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1706   -1.1612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1157   -0.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8329    0.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8329    0.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473   -0.3358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473    1.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2616    0.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5473    2.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  6  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n  7  9  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(=O)OC/C=C/c1ccccc1",
        "formula": "C14H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "218.292",
        "optical_activity": "NONE",
        "references": [
          "ed3ecce4-9be1-4245-ac34-527a64bb59a9",
          "7b58762a-65d2-4e24-b87d-38280345a8d7"
        ],
        "stereo_centers": 0
      },
      "unii": "5JHK9Y2XRM"
    }
  ]
}