{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3bd0c5b8-9254-4e00-8d9e-09cda72de656",
          "code": "PHENETHYL PHENYLACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=3593",
          "code_system": "JECFA EVALUATION",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a"
          ]
        },
        {
          "uuid": "db7f8448-74e3-49e7-a666-13d71dd0dff4",
          "code": "102-20-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102-20-5",
          "code_system": "CAS",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a",
            "0c4e02b9-75fe-43f5-88da-79fe6820c551"
          ]
        },
        {
          "uuid": "6d4ca462-df2a-493a-b092-84e2d34730b4",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a"
          ]
        },
        {
          "uuid": "686e4315-a2b4-4a3c-81c9-09fdebc6454a",
          "code": "SUB59506",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a"
          ]
        },
        {
          "uuid": "3a404b07-9ef2-43a0-8ea2-25deda2a3281",
          "code": "203-013-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.740",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a"
          ]
        },
        {
          "uuid": "815c5714-9e73-4587-8954-cf8b538edfbf",
          "code": "7601",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7601",
          "code_system": "PUBCHEM",
          "references": [
            "19f1a796-b1d4-4b9e-ae3c-412439a5491a"
          ]
        },
        {
          "uuid": "f7aad722-0cd1-910d-507e-2162ac0705aa",
          "code": "DTXSID0044494",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044494",
          "code_system": "EPA CompTox",
          "references": [
            "6c3da60c-bd62-200c-fee3-ea55cf3ea72f"
          ]
        },
        {
          "uuid": "e7a8840d-a7fd-46ed-b849-33f17be8bdbf",
          "code": "5J5OJ7GH15",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8e75807a-b1ab-bba6-cf0d-9a4e91192b35",
          "code": "100000134069",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f46dfed0-564a-ad08-2099-b8fda5028418"
          ]
        },
        {
          "uuid": "15444749-194b-ea63-337c-1fa96239c64d",
          "code": "6676",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6676",
          "code_system": "NSC",
          "references": [
            "0ea642c9-379e-decc-e8be-b14faf9a15e1"
          ]
        },
        {
          "uuid": "9f06dd2a-fdcc-bc5b-65eb-d6b72ba0b91d",
          "code": "932",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/932/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "497162a9-a1e0-fcb8-f409-a33448751a74"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "41bb3857-e6c7-4549-9420-133b6ac56d1b",
          "name": ".BETA.-PHENYLETHYL PHENYLACETATE",
          "stdName": ".BETA.-PHENYLETHYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25dd55fb-e35b-4bfd-a4de-f84ba736ea45",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "fb4b4c34-0cbc-4e8a-839a-196d184089b6",
          "name": "2-PHENYLETHYL PHENYLACETATE",
          "stdName": "2-PHENYLETHYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "386e7d72-bf4e-4f18-972b-c4d4eafc5634",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "ee7b8328-de82-4e06-8aad-1f308f5c2705",
          "name": "ACETIC ACID, PHENYL-, PHENETHYL ESTER",
          "stdName": "ACETIC ACID, PHENYL-, PHENETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbc7a2a0-c7bf-432b-a2e9-c555376fe7ad",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "1d6215ce-af70-4e1f-8941-24edc230aa89",
          "name": "BENZENEACETIC ACID, 2-PHENYLETHYL ESTER",
          "stdName": "BENZENEACETIC ACID, 2-PHENYLETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "329082af-40a7-42ff-bfc4-5344cab52fd6",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "5f9d2b68-f8df-4af8-93c8-3f2959771e20",
          "name": "FEMA NO. 2866",
          "stdName": "FEMA NO. 2866",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25dd55fb-e35b-4bfd-a4de-f84ba736ea45",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "6be37fd3-5c5d-4987-aab3-3dad4c393e90",
          "name": "NSC-6676",
          "stdName": "NSC-6676",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbc7a2a0-c7bf-432b-a2e9-c555376fe7ad",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "4db55cc2-21f4-449e-8305-797b77e80d62",
          "name": "PHENETHYL PHENYLACETATE",
          "stdName": "PHENETHYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "489337d0-019b-4351-8b7d-bfc138aa7c47",
            "875c1464-5ce6-42e0-a185-eb2eae2c970b",
            "7034d94c-5e29-4c94-aadd-71d9ac9c053f",
            "11b8e3d9-3a0b-4a7c-ae84-1012bd056508",
            "7753a282-af8c-4cad-be68-1caafcbe863d",
            "dddb6b6b-fbc5-48cc-8673-c51bed07f98d"
          ],
          "display_name": true
        },
        {
          "uuid": "abcc6a83-b645-4bb9-a11f-cd9211fbadaa",
          "name": "PHENETHYL PHENYLACETATE [FCC]",
          "stdName": "PHENETHYL PHENYLACETATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11b8e3d9-3a0b-4a7c-ae84-1012bd056508",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "357f91a2-0680-47da-9c7e-330ce4056466",
          "name": "PHENETHYL PHENYLACETATE [FHFI]",
          "stdName": "PHENETHYL PHENYLACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7753a282-af8c-4cad-be68-1caafcbe863d",
            "dddb6b6b-fbc5-48cc-8673-c51bed07f98d"
          ],
          "display_name": false
        },
        {
          "uuid": "3347332f-6ee9-46d1-8d5d-a7834a5e8aea",
          "name": "PHENYLACETIC ACID, PHENETHYL ESTER",
          "stdName": "PHENYLACETIC ACID, PHENETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25dd55fb-e35b-4bfd-a4de-f84ba736ea45",
            "7753a282-af8c-4cad-be68-1caafcbe863d"
          ],
          "display_name": false
        },
        {
          "uuid": "4b6692bc-5e43-405a-9889-7db5a7002b92",
          "name": "PHENYLETHYL PHENYLACETATE",
          "stdName": "PHENYLETHYL PHENYLACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7124ce18-7287-4ec9-a6f5-a52b7f89ba5b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "25dd55fb-e35b-4bfd-a4de-f84ba736ea45",
          "citation": "SAX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7753a282-af8c-4cad-be68-1caafcbe863d",
          "citation": "SAX DANGEROUS PROPERTIES",
          "doc_type": "SAX DANGEROUS PROPERTIES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7034d94c-5e29-4c94-aadd-71d9ac9c053f",
          "citation": "SAXS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "329082af-40a7-42ff-bfc4-5344cab52fd6",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dddb6b6b-fbc5-48cc-8673-c51bed07f98d",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11b8e3d9-3a0b-4a7c-ae84-1012bd056508",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbc7a2a0-c7bf-432b-a2e9-c555376fe7ad",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "386e7d72-bf4e-4f18-972b-c4d4eafc5634",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19f1a796-b1d4-4b9e-ae3c-412439a5491a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390825000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d6b46c2-17af-42d2-8492-f0c794196875",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a6524f4-b57f-429d-977f-7581e116cc1e",
          "citation": "SRS import [5J5OJ7GH15]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5J5OJ7GH15",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390825000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "875c1464-5ce6-42e0-a185-eb2eae2c970b",
          "citation": "PHENETHYL PHENYLACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "489337d0-019b-4351-8b7d-bfc138aa7c47",
          "citation": "PHENETHYL PHENYLACETATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c3da60c-bd62-200c-fee3-ea55cf3ea72f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=102-20-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f46dfed0-564a-ad08-2099-b8fda5028418",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "0c4e02b9-75fe-43f5-88da-79fe6820c551",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0ea642c9-379e-decc-e8be-b14faf9a15e1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "497162a9-a1e0-fcb8-f409-a33448751a74",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "7124ce18-7287-4ec9-a6f5-a52b7f89ba5b",
          "citation": "MHRA",
          "doc_type": "MHRSA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ba9278a5-bc42-4d0f-9e5e-4e3c2da5c09a",
          "id": "ba9278a5-bc42-4d0f-9e5e-4e3c2da5c09a",
          "molfile": "\n  Marvin  01132109392D          \n\n 18 19  0  0  0  0            999 V2000\n    6.3597   -2.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3597   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0742   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7887   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5032   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2177   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2177   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5032   -1.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7887   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6453   -3.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9308   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2163   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5019   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5018   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7874   -1.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0729   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0729   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7874   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 18  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CCOC(=O)Cc2ccccc2",
          "formula": "C16H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7901a054-d327-4fb7-8c6c-ee0bd94a5510"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2976",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba3f3e57-7a39-44a2-988f-1ecce63f9e7e",
      "version": "10",
      "structure": {
        "id": "183fb8b8-e754-4b11-9807-a9fbdd104797",
        "molfile": "\n  Marvin  01132101272D          \n\n 18 19  0  0  0  0            999 V2000\n    8.5032   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7887   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2177   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2177   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5032   -1.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7887   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0742   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3597   -2.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3597   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6453   -3.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9308   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2163   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0729   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7874   -1.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5018   -2.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5019   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7874   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0729   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 12  1  0  0  0  0\n 18 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n  2  7  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CCOC(=O)Cc2ccccc2",
        "formula": "C16H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2976",
        "optical_activity": "NONE",
        "references": [
          "329082af-40a7-42ff-bfc4-5344cab52fd6",
          "0a6524f4-b57f-429d-977f-7581e116cc1e"
        ],
        "stereo_centers": 0
      },
      "unii": "5J5OJ7GH15"
    }
  ]
}