{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c368e2ad-1c7e-400e-97d8-6a61f6d140cd",
          "code": "5852-99-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5852-99-3",
          "code_system": "CAS",
          "references": [
            "41a1678b-79c9-4978-a329-abfda698647d",
            "7b0a4033-91de-4426-8002-c0cffddcbdd4"
          ]
        },
        {
          "uuid": "7d88d8e8-5d6f-4b69-8381-5e865ed47821",
          "code": "1370593",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1370593/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "41a1678b-79c9-4978-a329-abfda698647d"
          ]
        },
        {
          "uuid": "d433a58e-42a8-47b8-b743-e22884db91f1",
          "code": "m3121",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3121?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "41a1678b-79c9-4978-a329-abfda698647d"
          ]
        },
        {
          "uuid": "098fccdd-ff0d-4b4b-a6a2-b7a38e103ae5",
          "code": "71586822",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71586822",
          "code_system": "PUBCHEM",
          "references": [
            "41a1678b-79c9-4978-a329-abfda698647d"
          ]
        },
        {
          "uuid": "90d9ef9d-3c69-7d2e-9871-468b6fd32341",
          "code": "DTXSID40207238",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40207238",
          "code_system": "EPA CompTox",
          "references": [
            "79953475-b0e6-1a77-bc27-5ab5d24fdde8"
          ]
        },
        {
          "uuid": "0db8a4b9-5323-0d06-bea6-15ff94eecee3",
          "code": "DBSALT002049",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT002049",
          "code_system": "DRUG BANK",
          "references": [
            "35e06121-740c-0ec5-a99f-fb57017a896c"
          ]
        },
        {
          "uuid": "b2460f60-60b1-49ee-8208-54300ce4ade8",
          "code": "5II09M0I3L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "4aa5724b-19ff-4c04-9ad3-3ae8939cd5ab",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "9055ce04-d2a5-4823-bd72-d30eec700878",
            "refuuid": "7ff66355-bec3-4845-81fa-c903b57e119f",
            "name": "CARNOSINE",
            "unii": "8HO6PVN24W",
            "linking_id": "8HO6PVN24W",
            "ref_pname": "CARNOSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "20d31fec-fc90-44ba-a7c6-942dd1cb51dd",
          "name": "CARNOSINE HYDROCHLORIDE",
          "stdName": "CARNOSINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0963bf4-e087-419d-bb4f-c7482279c2c5",
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228",
            "cb9a846c-4ce6-414d-880a-2f3ec8eaa247",
            "730b5858-d8ce-4489-aa4c-8c47b49aea74"
          ],
          "display_name": true
        },
        {
          "uuid": "c0839058-7947-4eab-be5d-9183c2b79c93",
          "name": "CARNOSINE HYDROCHLORIDE [MI]",
          "stdName": "CARNOSINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228",
            "730b5858-d8ce-4489-aa4c-8c47b49aea74"
          ],
          "display_name": false
        },
        {
          "uuid": "5b743c52-315b-0013-64a5-97f220f08bd9",
          "name": "Carnosine hydrochloride [WHO-DD]",
          "stdName": "CARNOSINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f21e1c41-0212-3174-67a6-a6973708c5be"
          ],
          "display_name": false
        },
        {
          "uuid": "3d672924-a237-42b6-b037-9dfc14d888f6",
          "name": "L-CARNOSINE HYDROCHLORIDE",
          "stdName": "L-CARNOSINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a717ffb-449c-4581-b11a-6531ae04c91e",
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228"
          ],
          "display_name": false
        },
        {
          "uuid": "4352ce02-2c45-46f3-abdf-47268d31148b",
          "name": "L-HISTIDINE, .BETA.-ALANYL-, HYDROCHLORIDE (1:1)",
          "stdName": "L-HISTIDINE, .BETA.-ALANYL-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a717ffb-449c-4581-b11a-6531ae04c91e",
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228"
          ],
          "display_name": false
        },
        {
          "uuid": "42f38db2-1b2f-441f-9179-eb2847d87ba6",
          "name": "L-HISTIDINE, .BETA.-ALANYL-, MONOHYDROCHLORIDE",
          "stdName": "L-HISTIDINE, .BETA.-ALANYL-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a717ffb-449c-4581-b11a-6531ae04c91e",
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228"
          ],
          "display_name": false
        },
        {
          "uuid": "50c461fe-939f-4f71-aab5-202d075e541b",
          "name": "L-HISTIDINE, N-.BETA.-ALANYL-, MONOHYDROCHLORIDE, L-",
          "stdName": "L-HISTIDINE, N-.BETA.-ALANYL-, MONOHYDROCHLORIDE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a717ffb-449c-4581-b11a-6531ae04c91e",
            "cbebe7e1-a55e-491a-8e3d-139fb4e2d228"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d0963bf4-e087-419d-bb4f-c7482279c2c5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbebe7e1-a55e-491a-8e3d-139fb4e2d228",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a717ffb-449c-4581-b11a-6531ae04c91e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "730b5858-d8ce-4489-aa4c-8c47b49aea74",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41a1678b-79c9-4978-a329-abfda698647d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26bfd6ac-fe20-451a-85b6-12225a0bed21",
          "citation": "SRS import [5II09M0I3L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5II09M0I3L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391402000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc60d83e-5fcc-4cc9-8483-e20614293fb1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb9a846c-4ce6-414d-880a-2f3ec8eaa247",
          "citation": "CARNOSINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79953475-b0e6-1a77-bc27-5ab5d24fdde8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5852-99-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f21e1c41-0212-3174-67a6-a6973708c5be",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "35e06121-740c-0ec5-a99f-fb57017a896c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7b0a4033-91de-4426-8002-c0cffddcbdd4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a6ee041d-126c-4834-852c-d15a4dcb4f7e",
          "id": "a6ee041d-126c-4834-852c-d15a4dcb4f7e",
          "molfile": "\n  Marvin  01132108402D          \n\n  1  0  0  0  1  0            999 V2000\n    1.9561   -4.7668    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eb1094f1-fb74-427a-9a22-0e68e3398fb8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "33dbe618-409d-478d-8116-9de214baf721",
          "id": "33dbe618-409d-478d-8116-9de214baf721",
          "molfile": "\n  Marvin  01132102462D          \n\n 16 16  0  0  1  0            999 V2000\n    7.5676   -5.6839    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.5676   -4.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8432   -4.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0987   -4.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5467   -4.1772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9544   -3.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7673   -3.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8584   -6.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1367   -5.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1367   -5.1141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4328   -6.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -5.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0044   -6.1119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2917   -6.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2917   -6.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9932   -5.6814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  8  1  1  0  0  0\n 14  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  7  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  END",
          "smiles": "C(CN)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O",
          "formula": "C9H14N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90e20d6a-4a0a-46b2-bd29-b4f1572fde45"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "226.2328",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d7b6f2c-246b-4117-8a11-0ae7c15f33d2",
      "version": "8",
      "structure": {
        "id": "99252de7-6f52-4e4d-bb01-659c877ceedc",
        "molfile": "\n  Marvin  01132107572D          \n\n 17 16  0  0  1  0            999 V2000\n    5.5467   -4.1772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5676   -5.6839    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2917   -6.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8584   -6.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8432   -4.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1367   -5.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5676   -4.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7673   -3.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9544   -3.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0987   -4.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2917   -6.9096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4328   -6.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1367   -5.1141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9932   -5.6814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0044   -6.1119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -5.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9563   -4.7672    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11  3  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  3  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 12  1  0  0  0  0\n  8  5  1  0  0  0  0\nM  END",
        "smiles": "C(CN)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O.Cl",
        "formula": "C9H14N4O3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "262.6937",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "26bfd6ac-fe20-451a-85b6-12225a0bed21",
          "fc60d83e-5fcc-4cc9-8483-e20614293fb1"
        ],
        "stereo_centers": 1
      },
      "unii": "5II09M0I3L"
    }
  ]
}