{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5a673bdb-2890-4f3d-a374-b928b72e4c6e",
          "code": "55566-30-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55566-30-8",
          "code_system": "CAS",
          "references": [
            "899349a3-e893-43ea-bca4-53e32b6f2cb8",
            "122fcb42-3a44-4c09-a7c6-72a17c8a18be"
          ]
        },
        {
          "uuid": "7e127e9b-52b7-463a-a96c-3572c0ed9440",
          "code": "FCN NO. 955",
          "comments": "FCN|COATING PRESERVATIVE|PAPER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=955",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "899349a3-e893-43ea-bca4-53e32b6f2cb8"
          ]
        },
        {
          "uuid": "a1431abf-414c-4699-97a2-966b4fed443c",
          "code": "129058",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4021",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "899349a3-e893-43ea-bca4-53e32b6f2cb8"
          ]
        },
        {
          "uuid": "79a59e2b-7f71-4018-b1b9-442884a1dd64",
          "code": "259-709-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.263",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "899349a3-e893-43ea-bca4-53e32b6f2cb8"
          ]
        },
        {
          "uuid": "32266bc4-0746-4066-9b1d-e7408500562b",
          "code": "41478",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41478",
          "code_system": "PUBCHEM",
          "references": [
            "899349a3-e893-43ea-bca4-53e32b6f2cb8"
          ]
        },
        {
          "uuid": "6a0a777c-db6b-6200-cf80-22566f75ce08",
          "code": "4215",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4215",
          "code_system": "HSDB",
          "references": [
            "db5d79f6-93b1-0187-bbd0-fac30e332bdd"
          ]
        },
        {
          "uuid": "d0279ab1-8077-6ad1-1f6a-f50c80d3437e",
          "code": "DTXSID0021331",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021331",
          "code_system": "EPA CompTox",
          "references": [
            "871e49c5-5fc5-3f28-7a70-2b9f1ea15332"
          ]
        },
        {
          "uuid": "46fc287b-8179-c074-1396-3e355d0c7ddd",
          "code": "21 CFR 176.300",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.300",
          "code_system": "CFR",
          "references": [
            "34e78a8f-47e9-06c7-c7ba-03931603b60a"
          ]
        },
        {
          "uuid": "91e16131-8b63-431f-9d78-3d545b09a79e",
          "code": "5I8RSL9E6S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c19173b9-4e88-a71a-61bf-842904d412f5",
          "code": "300000053646",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "68927375-5535-5d3e-cf12-786baf4fec9f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a593d9af-35e6-40a7-8aec-eb4443eb361b",
          "name": "BIS(TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM)SULFATE (SALT)",
          "stdName": "BIS(TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM)SULFATE (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": false
        },
        {
          "uuid": "6c23a52b-7c38-4781-9189-ed4983b7e01c",
          "name": "OCTAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE",
          "stdName": "OCTAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": false
        },
        {
          "uuid": "5c841862-e38f-4e71-a6ab-a69119f5c346",
          "name": "PHOSPHONIUM, TETRAKIS(HYDROXYMETHYL)-, SULFATE (2:1)",
          "stdName": "PHOSPHONIUM, TETRAKIS(HYDROXYMETHYL)-, SULFATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": false
        },
        {
          "uuid": "f7d6c422-9b9e-49e5-b55d-c3e0e978ee7d",
          "name": "TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE",
          "stdName": "TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "f12d3079-865e-422c-93c4-da3e63252e5e",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": true
        },
        {
          "uuid": "71c67267-3d75-4f05-a855-69fb42592f50",
          "name": "TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE [HSDB]",
          "stdName": "TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": false
        },
        {
          "uuid": "3fef1594-50ae-469c-882a-7a48735672dc",
          "name": "THPS",
          "stdName": "THPS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24ee01aa-f8b5-405e-bf59-93a78937ad78",
            "c39ee809-4516-4cbd-9a3a-9bf1741c4050"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c39ee809-4516-4cbd-9a3a-9bf1741c4050",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "24ee01aa-f8b5-405e-bf59-93a78937ad78",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "899349a3-e893-43ea-bca4-53e32b6f2cb8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9f8334f-786a-408c-bd4c-157ac1311a2f",
          "citation": "SRS import [5I8RSL9E6S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5I8RSL9E6S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a396105-11c1-4c26-abf2-04ede0563198",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f12d3079-865e-422c-93c4-da3e63252e5e",
          "citation": "TETRAKIS(HYDROXYMETHYL)PHOSPHONIUM SULFATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db5d79f6-93b1-0187-bbd0-fac30e332bdd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+55566-30-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "871e49c5-5fc5-3f28-7a70-2b9f1ea15332",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55566-30-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34e78a8f-47e9-06c7-c7ba-03931603b60a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "122fcb42-3a44-4c09-a7c6-72a17c8a18be",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "68927375-5535-5d3e-cf12-786baf4fec9f",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e6a38cdc-594f-488c-8677-540adf6f5936",
          "id": "e6a38cdc-594f-488c-8677-540adf6f5936",
          "molfile": "\n  Marvin  01132111562D          \n\n  5  4  0  0  0  0            999 V2000\n    2.0168    0.0375    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.8418    0.0375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6668    0.0375    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.8418   -0.7875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8418    0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  CHG  2   1  -1   3  -1\nM  END",
          "smiles": "O=S(=O)([O-])[O-]",
          "formula": "O4S",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "02ccc191-b981-4f90-9adf-502aec49f7d3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "96.0637",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1edc9bf2-d13d-4c19-b309-f68156534e11",
          "id": "1edc9bf2-d13d-4c19-b309-f68156534e11",
          "molfile": "\n  Marvin  01132101462D          \n\n  9  8  0  0  0  0            999 V2000\n   -0.8089   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5233   -0.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2378   -0.1481    0.0000 P   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.8253    0.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0003    0.5664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9523    0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6668   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6503   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4753   -0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "C(O)[P+](CO)(CO)CO",
          "formula": "C4H12O4P",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "aefbf82f-30e1-4c00-85ea-2a67c5410253"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "155.1096",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "14956d8f-c129-4238-ae32-e70423a5274f",
      "version": "6",
      "structure": {
        "id": "6bef2cef-fc38-42d2-acd9-1a22987ea2ef",
        "molfile": "\n  Marvin  01132105362D          \n\n 23 20  0  0  0  0            999 V2000\n   -2.2378   -0.1481    0.0000 P   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.5233   -0.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8089   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8253    0.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0003    0.5664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9523    0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6668   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6503   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4753   -0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8418    0.0375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8418   -0.7875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8418    0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0168    0.0375    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.6668    0.0375    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.2378   -0.1481    0.0000 P   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.5233   -0.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8089   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8253    0.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0003    0.5664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9523    0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6668   -0.1481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6503   -0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4753   -0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  1  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 18  1  0  0  0  0\n 15 20  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  CHG  4   1   1  13  -1  14  -1  15   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8   9  15  16  17  18  19  20\nM  SAL   1  3  21  22  23\nM  SPA   1  9   1   2   3   4   5   6   7   8   9\nM  SDI   1  4   -4.0868   -1.2825   -4.0868    0.9864\nM  SDI   1  4   -0.3889    0.9864   -0.3889   -1.2825\nM  SMT   1 2\nM  END",
        "smiles": "C(O)[P+](CO)(CO)CO.C(O)[P+](CO)(CO)CO.O=S(=O)([O-])[O-]",
        "formula": "2C4H12O4P.O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "406.2829",
        "optical_activity": "NONE",
        "references": [
          "a9f8334f-786a-408c-bd4c-157ac1311a2f",
          "0a396105-11c1-4c26-abf2-04ede0563198"
        ],
        "stereo_centers": 0
      },
      "unii": "5I8RSL9E6S"
    }
  ]
}