{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aeba8a36-b7ff-46d4-85c8-4cb3bead2fc4",
          "code": "DL-ISOLEUCINE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5428",
          "code_system": "JECFA EVALUATION",
          "references": [
            "1f5ab040-4ff3-4905-81d5-09fcd1c9d3b8"
          ]
        },
        {
          "uuid": "83305c3f-2593-4a9c-9c33-c1c8547cffaa",
          "code": "443-79-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=443-79-8",
          "code_system": "CAS",
          "references": [
            "1f5ab040-4ff3-4905-81d5-09fcd1c9d3b8",
            "05202f5d-e839-490b-8141-e282be75f248"
          ]
        },
        {
          "uuid": "fa0fcb0b-d17d-4205-9d0f-a236d9d21a99",
          "code": "m6495",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6495?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1f5ab040-4ff3-4905-81d5-09fcd1c9d3b8"
          ]
        },
        {
          "uuid": "94b100d5-dd7a-4872-86ac-01b888d0d6f5",
          "code": "207-139-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.492",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f5ab040-4ff3-4905-81d5-09fcd1c9d3b8"
          ]
        },
        {
          "uuid": "7576ac18-2ab6-42bc-8a2b-dc07d6bc19c3",
          "code": "5HX0BYT4E3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a3c8d32f-a714-6a37-3fb8-cf0a988d60e6",
          "code": "DTXSID2046882",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2046882",
          "code_system": "EPA CompTox",
          "references": [
            "f2cdf417-4969-b71c-5bc1-e1943d830313"
          ]
        },
        {
          "uuid": "4087fdfc-bbaf-feb1-9120-a9fc9448f9e6",
          "code": "9958",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9958",
          "code_system": "NSC",
          "references": [
            "34fd24d5-1146-9c4f-b65e-4b703140ec26"
          ]
        },
        {
          "uuid": "63f89190-b2cd-ab1a-68ad-3152c5eb3a64",
          "code": "1412",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1412/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "3e4a3777-f7f7-69e1-da4e-131aa120ec2c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8279c2c-7f67-462e-89d3-7b4d12fbdebe",
          "name": "(±)-ERYTHRO-2-AMINO-3-METHYLPENTANOIC ACID",
          "stdName": "(+/-)-ERYTHRO-2-AMINO-3-METHYLPENTANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61c667cc-52e2-4c39-86d0-0df24cb4f14b"
          ],
          "display_name": false
        },
        {
          "uuid": "98252277-a5cb-4474-8624-573e18e76037",
          "name": "DL-ISOLEUCINE",
          "stdName": "DL-ISOLEUCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcb3ede9-389a-4791-9750-9d80cba4e146",
            "1744473b-5536-48e1-bce9-7546b9c7d07b",
            "ad492bcc-3a38-422f-af2e-822eeb775c7f",
            "ba051e84-3a33-47bd-ad04-1ae178a61bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "c32e86f4-431c-4797-9c1f-36c48c99940b",
          "name": "DL-ISOLEUCINE [FCC]",
          "stdName": "DL-ISOLEUCINE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad492bcc-3a38-422f-af2e-822eeb775c7f"
          ],
          "display_name": false
        },
        {
          "uuid": "3c291b12-d135-4020-b140-82dd777ef8ad",
          "name": "DL-ISOLEUCINE [FHFI]",
          "stdName": "DL-ISOLEUCINE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcb3ede9-389a-4791-9750-9d80cba4e146"
          ],
          "display_name": false
        },
        {
          "uuid": "8ae3c76b-b01a-4dd7-98df-6954b093d046",
          "name": "FEMA NO. 3295",
          "stdName": "FEMA NO. 3295",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1caa8a39-9bbf-46d1-ba23-00913ebf1247"
          ],
          "display_name": false
        },
        {
          "uuid": "10019324-6b55-4b7b-9733-5b81459e27a5",
          "name": "ISOLEUCINE DL-FORM",
          "stdName": "ISOLEUCINE DL-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98175431-7591-4a90-86f0-2e8d8070f549",
            "61c667cc-52e2-4c39-86d0-0df24cb4f14b"
          ],
          "display_name": false
        },
        {
          "uuid": "4af5c69b-357b-4a40-810b-28a7d0627c66",
          "name": "ISOLEUCINE DL-FORM [MI]",
          "stdName": "ISOLEUCINE DL-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61c667cc-52e2-4c39-86d0-0df24cb4f14b"
          ],
          "display_name": false
        },
        {
          "uuid": "61405d9c-7a38-4054-bfb5-9d9fdfb1ce78",
          "name": "ISOLEUCINE, DL-",
          "stdName": "ISOLEUCINE, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3a94e46-f7c3-4d22-8835-fec9af61cf5a"
          ],
          "display_name": true
        },
        {
          "uuid": "1800d5e8-a237-4220-9a18-0ebcefd50886",
          "name": "NSC-9958",
          "stdName": "NSC-9958",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f9bfd1c-6b48-431b-a8e5-da0e8fea50d3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "61c667cc-52e2-4c39-86d0-0df24cb4f14b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1caa8a39-9bbf-46d1-ba23-00913ebf1247",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcb3ede9-389a-4791-9750-9d80cba4e146",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f9bfd1c-6b48-431b-a8e5-da0e8fea50d3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f5ab040-4ff3-4905-81d5-09fcd1c9d3b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8319b02-5da5-497e-97eb-8b990fe267cf",
          "citation": "SRS import [5HX0BYT4E3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5HX0BYT4E3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1744473b-5536-48e1-bce9-7546b9c7d07b",
          "citation": "DL-ISOLEUCINE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba051e84-3a33-47bd-ad04-1ae178a61bf3",
          "citation": "DL-ISOLEUCINE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98175431-7591-4a90-86f0-2e8d8070f549",
          "citation": "ISOLEUCINE DL-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3a94e46-f7c3-4d22-8835-fec9af61cf5a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ad492bcc-3a38-422f-af2e-822eeb775c7f",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2cdf417-4969-b71c-5bc1-e1943d830313",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=443-79-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7bd4a59f-0088-9d15-41a5-4da7fb0c3d3f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "05202f5d-e839-490b-8141-e282be75f248",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34fd24d5-1146-9c4f-b65e-4b703140ec26",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "42b55602-f5ba-8935-d4a5-163580fdbdab",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3e4a3777-f7f7-69e1-da4e-131aa120ec2c",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62ee7fb1-5048-4394-aaa3-a29df36202b2",
          "id": "62ee7fb1-5048-4394-aaa3-a29df36202b2",
          "molfile": "\n  Marvin  01132105082D          \n\n  9  8  0  0  0  0            999 V2000\n    4.3799    0.4510    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3545    1.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6744    0.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9429    0.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0886    0.0572    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1077   -0.7596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8036    0.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7846    1.3251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5282    0.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  END",
          "smiles": "CC[C@H](C)[C@@H](C(=O)O)N",
          "formula": "C6H13NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d6897558-94e1-49a5-b550-87281a4b58c5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "131.1732",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b74b7ee-7c17-48a3-9134-c61e333d38e5",
      "version": "14",
      "structure": {
        "id": "7c53fe91-3fcf-4345-b2d1-970a09566c12",
        "molfile": "\n  Marvin  01132106272D          \n\n  9  8  0  0  0  0            999 V2000\n    5.8043    0.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0892    0.0572    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7853    1.3253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1083   -0.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5290    0.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3804    0.4511    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6748    0.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3550    1.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9433    0.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  2  4  1  1  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  6  0  0  0\n  9  7  1  0  0  0  0\nM  END",
        "smiles": "CC[C@H](C)[C@@H](C(=O)O)N",
        "formula": "C6H13NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "131.1732",
        "optical_activity": "( + / - )",
        "references": [
          "a8319b02-5da5-497e-97eb-8b990fe267cf",
          "ad492bcc-3a38-422f-af2e-822eeb775c7f"
        ],
        "stereo_centers": 2
      },
      "unii": "5HX0BYT4E3"
    }
  ]
}