{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3cd8759b-0db3-4a57-9870-d33ddd145586",
          "code": "846-48-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=846-48-0",
          "code_system": "CAS",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0",
            "c8bff89f-6908-4822-bc9c-3c73816adb81"
          ]
        },
        {
          "uuid": "ede212d2-a03c-45be-8211-8fe060f4df5b",
          "code": "C75064",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75064",
          "code_system": "NCI_THESAURUS",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "dfb40d16-4dcb-40e1-9c85-d6e4c0aa67ed",
          "code": "C013915",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013915",
          "code_system": "MESH",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "2a793913-91cf-445c-a2d1-ed5223228e6d",
          "code": "BOLDENONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Boldenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "09b959b2-787d-45de-8283-ea4357b3dc85",
          "code": "21 CFR 522.204",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.204 Boldenone.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.204",
          "code_system": "CFR",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "89cd844f-2a70-4a74-9d2b-9735b1d99ed3",
          "code": "SUB05869MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "8869f703-ec45-4698-bca6-44241de1226a",
          "code": "2464",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2464",
          "code_system": "INN",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "6ebb0750-cb9c-494a-8f37-8012f265e3b9",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "a1510875-ae61-48c0-a372-19f7cccb9a95",
          "code": "m2597",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2597?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "52e587c7-8c10-4317-93d2-10c77dc5accc",
          "code": "CHEMBL2106059",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106059",
          "code_system": "ChEMBL",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "bc77918a-5d16-4353-b094-2205740d9b61",
          "code": "212-686-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.533",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "40d95906-bce0-4887-b8ef-3a065742be3a",
          "code": "13308",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13308",
          "code_system": "PUBCHEM",
          "references": [
            "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0"
          ]
        },
        {
          "uuid": "28fd5e63-7289-4e29-5f43-761e053b1148",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0375e890-069a-c3ef-9b68-a375b1c33194"
          ]
        },
        {
          "uuid": "1cbb4b64-fa61-480f-a387-84320ad0a619",
          "code": "5H7I2IP58X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f9750556-3af7-1dc6-0e10-83376e1a4ffe",
          "code": "2289408",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2289408/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0375e890-069a-c3ef-9b68-a375b1c33194"
          ]
        },
        {
          "uuid": "73d71937-8ec8-9427-73e5-fef3e4f18379",
          "code": "DB01541",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01541",
          "code_system": "DRUG BANK",
          "references": [
            "0375e890-069a-c3ef-9b68-a375b1c33194"
          ]
        },
        {
          "uuid": "b1c2c218-3be5-b94f-a525-f53c98feacae",
          "code": "34584",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34584",
          "code_system": "CHEBI",
          "references": [
            "0375e890-069a-c3ef-9b68-a375b1c33194"
          ]
        },
        {
          "uuid": "a1c6fc01-d1e5-a80d-e50b-6d4f34f4e7e8",
          "code": "DTXSID20894201",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20894201",
          "code_system": "EPA CompTox",
          "references": [
            "bf388f98-5be2-f8af-c650-a98229820df2"
          ]
        },
        {
          "uuid": "22179989-e334-f724-f92e-04ae0d8f9ec1",
          "code": "Designer-drugs-Boldenone",
          "comments": "Wikipedia|List of designer drugs|Androgens|Testosterone based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "0375e890-069a-c3ef-9b68-a375b1c33194"
          ]
        },
        {
          "uuid": "060f8303-bf0f-9849-08d7-e7a1757c8762",
          "code": "79102",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=79102",
          "code_system": "NSC",
          "references": [
            "4c9803ec-1349-1d3b-1b24-8b1f36c7de5b"
          ]
        },
        {
          "uuid": "e26b6d4e-a2b8-b4e2-26f3-35b9357aa981",
          "code": "100000086347",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8a6d3bf2-0701-228f-c017-4ca148c203f8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ac160338-0649-4c62-9fc5-1459f64eeb4c",
          "amount": {
            "uuid": "87fcc2db-dd69-423e-add0-f59692bb7700"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3dfc6eb5-7a51-466b-aa68-48207829033d",
            "refuuid": "9acc971e-45a5-4d12-aef5-aff2a0dfa9da",
            "name": "BOLDENONE",
            "unii": "5H7I2IP58X",
            "linking_id": "5H7I2IP58X",
            "ref_pname": "BOLDENONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9f608fc7-70c1-45c6-9f8d-a37abf74eb11",
          "amount": {
            "uuid": "b84ec737-9fa4-47a3-a5fe-3e68a0f4df52"
          },
          "type": "PRODRUG->METABOLITE ACTIVE",
          "related_substance": {
            "uuid": "53d096f1-e7b7-410e-ada7-42603d450fb9",
            "refuuid": "d8bc591c-aa40-48cf-a1b8-09639f4d0a54",
            "name": "BOLDENONE ACETATE",
            "unii": "3T5IZ3HS3X",
            "linking_id": "3T5IZ3HS3X",
            "ref_pname": "BOLDENONE ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "71e5c449-9b87-4e1c-aa0d-8a6b667b0615",
          "amount": {
            "uuid": "46b3d52d-49c8-4ec0-8daa-8dfec36a4910",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d9498d50-7fac-7078-e2ed-2b5180e4afaa"
          ],
          "related_substance": {
            "uuid": "a289a469-f196-4606-92d4-60e3b3f26658",
            "refuuid": "de5088e3-60d2-48db-8c91-311bd3435f32",
            "name": "TESTOSTERONE",
            "unii": "3XMK78S47O",
            "linking_id": "3XMK78S47O",
            "ref_pname": "TESTOSTERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "90dd42d8-3839-40fa-98cf-5de89a7248b0",
          "name": "BOLDENONE",
          "stdName": "BOLDENONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa00bf54-f07e-40c9-b5ab-bba0f58241c2",
            "8a1fc0ad-32de-44c7-81b4-e2bc73862c16",
            "a06d1f5a-b36c-400f-90c4-14895e557b6b",
            "657d0372-6f15-4b8f-84f6-2935fbb1f51e",
            "2c4a2bd3-334a-4171-8e93-3655163acb34",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a5f1e9cb-6084-4cf2-87ff-a2c476c134d5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "8ce0aba7-0409-48e4-a233-341e4c285e50",
          "name": "BOLDENONE [MI]",
          "stdName": "BOLDENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "657d0372-6f15-4b8f-84f6-2935fbb1f51e",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": false
        },
        {
          "uuid": "00d0ffa6-d5f9-2609-1736-d7c9e652f583",
          "name": "Boldenone [WHO-DD]",
          "stdName": "BOLDENONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5183497b-6dbb-96d4-533c-e55afa157856"
          ],
          "display_name": false
        },
        {
          "uuid": "f86bfe11-8e03-4ceb-952c-67bdae0ade34",
          "name": "DEHYDROTESTOSTERONE",
          "stdName": "DEHYDROTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35a30069-32ad-4913-be34-fe34b569f743",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": false
        },
        {
          "uuid": "29c6c721-65e1-4fe7-931f-4d7e60a106e6",
          "name": "NSC-79102",
          "stdName": "NSC-79102",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e626eee8-f694-4ae6-b0fe-215e223bf2ab",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": false
        },
        {
          "uuid": "8e7ce4ab-329a-4262-9def-a719227ea501",
          "name": "PARENABOL",
          "stdName": "PARENABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35a30069-32ad-4913-be34-fe34b569f743",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": false
        },
        {
          "uuid": "46337139-518c-8c03-a9d0-fca1dd2d875f",
          "name": "TESTOSTERONE IMPURITY H [EP IMPURITY]",
          "stdName": "TESTOSTERONE IMPURITY H [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9498d50-7fac-7078-e2ed-2b5180e4afaa"
          ],
          "display_name": false
        },
        {
          "uuid": "b815061d-33d4-4030-9240-b84edd4edc5a",
          "name": "VEBONOL",
          "stdName": "VEBONOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35a30069-32ad-4913-be34-fe34b569f743",
            "0f6b70a1-752b-43c3-adf6-7fd151fe2d86"
          ],
          "display_name": false
        },
        {
          "uuid": "34355201-0a3d-4bea-b129-079240635816",
          "name": "boldenone [INN]",
          "stdName": "BOLDENONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a06d1f5a-b36c-400f-90c4-14895e557b6b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a1fc0ad-32de-44c7-81b4-e2bc73862c16",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a06d1f5a-b36c-400f-90c4-14895e557b6b",
          "citation": "INN Proposed List 20",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL20.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "657d0372-6f15-4b8f-84f6-2935fbb1f51e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f6b70a1-752b-43c3-adf6-7fd151fe2d86",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35a30069-32ad-4913-be34-fe34b569f743",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e626eee8-f694-4ae6-b0fe-215e223bf2ab",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19888a8e-4dca-4d3d-aac5-50e3c8ed11f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8224b735-0042-4112-b2e9-d7e2857129dd",
          "citation": "SRS import [5H7I2IP58X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5H7I2IP58X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c4a2bd3-334a-4171-8e93-3655163acb34",
          "citation": "BOLDENONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa00bf54-f07e-40c9-b5ab-bba0f58241c2",
          "citation": "BOLDENONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a6d3bf2-0701-228f-c017-4ca148c203f8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "0375e890-069a-c3ef-9b68-a375b1c33194",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d9498d50-7fac-7078-e2ed-2b5180e4afaa",
          "citation": "European Pharmacopoeia Online 9.8, Testosterone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c8bff89f-6908-4822-bc9c-3c73816adb81",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c9803ec-1349-1d3b-1b24-8b1f36c7de5b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "517a01ff-c7e0-7097-4c75-feffbf739bde",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "bf388f98-5be2-f8af-c650-a98229820df2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "5183497b-6dbb-96d4-533c-e55afa157856",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e1224acd-39e7-4172-bcad-14f05ac4a2f7",
          "id": "e1224acd-39e7-4172-bcad-14f05ac4a2f7",
          "molfile": "\n  Marvin  01132111392D          \n\n 21 24  0  0  1  0            999 V2000\n   10.7637   -4.3346    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.1341   -3.5283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2185   -5.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7637   -5.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9669   -5.3987    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.2496   -5.8533    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.2496   -6.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5325   -7.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7731   -6.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0792   -7.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3621   -6.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7526   -6.9643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3621   -5.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0792   -5.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7731   -5.8206    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.7731   -5.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5325   -5.3987    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5325   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2028   -4.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9669   -4.5831    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9669   -3.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 20  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 20  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 15  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]31)O",
          "formula": "C19H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e728d459-ef6a-49fa-9e63-0e6fe5a99489"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "286.4093",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9acc971e-45a5-4d12-aef5-aff2a0dfa9da",
      "version": "22",
      "structure": {
        "id": "daea4c63-91a6-47c9-be81-0038625f5664",
        "molfile": "\n  Marvin  01132111212D          \n\n 24 27  0  0  1  0            999 V2000\n    7.7291   -5.7877    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7291   -6.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0392   -7.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3261   -6.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7201   -6.9249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3261   -5.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0392   -5.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -7.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1973   -6.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1973   -5.8202    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9105   -5.3682    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.7028   -5.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1550   -4.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7028   -4.3101    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9105   -4.5572    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1507   -4.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -4.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -5.3682    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4842   -6.1326    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9105   -3.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0711   -3.5083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9105   -6.2165    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1973   -4.6364    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7291   -4.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18  1  1  0  0  0  0\n 10 18  1  0  0  0  0\n 18 19  1  6  0  0  0\n 15 20  1  1  0  0  0\n 11 15  1  0  0  0  0\n 14 21  1  1  0  0  0\n 11 22  1  6  0  0  0\n 10 23  1  1  0  0  0\n  1 24  1  1  0  0  0\nM  END",
        "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O",
        "formula": "C19H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "286.4093",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8a1fc0ad-32de-44c7-81b4-e2bc73862c16",
          "8224b735-0042-4112-b2e9-d7e2857129dd",
          "a06d1f5a-b36c-400f-90c4-14895e557b6b"
        ],
        "stereo_centers": 6
      },
      "unii": "5H7I2IP58X"
    }
  ]
}