{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "36fb7b09-d809-4447-b5ef-0f6c7ca6a08c", "code": "1191-85-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1191-85-1", "code_system": "CAS", "references": [ "a28723b4-35c5-4b80-8c29-da7bd849da51", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ] }, { "uuid": "b0c7fde3-58c5-40b2-b9fe-baabdaa40e3b", "code": "1780", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1780", "code_system": "PUBCHEM", "references": [ "a28723b4-35c5-4b80-8c29-da7bd849da51" ] }, { "uuid": "0d6f4aa6-a4b7-e2a1-847b-82b0ec846704", "code": "DTXSID20152318", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20152318", "code_system": "EPA CompTox", "references": [ "60c406b6-22cd-f232-abcd-6e485efc8dba" ] }, { "uuid": "0bb66b01-1ffd-4b11-9912-3f7ff545730e", "code": "5FEJ8J06DR", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "59d3b9ec-345c-44de-a2b0-4f80ac25b831", "name": "5,8,11,14-EICOSATETRAYNOIC ACID", "stdName": "5,8,11,14-EICOSATETRAYNOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21d35364-222d-4b9b-87b9-5eca24feaefd", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "display_name": true }, { "uuid": "bb55acb2-8152-44ac-bf47-9aaec346a605", "name": "EICOSATETRAYNOIC ACID", "stdName": "EICOSATETRAYNOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21d35364-222d-4b9b-87b9-5eca24feaefd", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "display_name": false }, { "uuid": "7dcbce39-1a7c-4dda-965a-6b0366d24ebe", "name": "ETA", "stdName": "ETA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "21d35364-222d-4b9b-87b9-5eca24feaefd", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "display_name": false }, { "uuid": "2ee45b90-063d-47db-9aea-58d9633c9c11", "name": "ETYA", "stdName": "ETYA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "21d35364-222d-4b9b-87b9-5eca24feaefd", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "display_name": false }, { "uuid": "03ba26a6-cf05-4dd4-96c9-f028926ac9db", "name": "RO 3-1428", "stdName": "RO 3-1428", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "21d35364-222d-4b9b-87b9-5eca24feaefd", "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "display_name": false } ], "references": [ { "uuid": "21d35364-222d-4b9b-87b9-5eca24feaefd", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7c3687b-25f7-44e5-80d0-27a6a77296c0", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a28723b4-35c5-4b80-8c29-da7bd849da51", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389751000, "tags": [ "NOMEN" ] }, { "uuid": "60c406b6-22cd-f232-abcd-6e485efc8dba", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1191-85-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bacd39b5-ef97-461b-a94f-575aefc1199f", "id": "bacd39b5-ef97-461b-a94f-575aefc1199f", "molfile": "\n Marvin 01132109402D \n\n 22 21 0 0 0 0 999 V2000\n 0.3793 -4.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2038 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6074 -4.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4324 -4.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8646 -5.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6778 -5.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5146 -5.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3370 -5.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7508 -4.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1593 -4.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5650 -3.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1376 -2.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7340 -1.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3175 -1.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4889 -1.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6608 -1.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8439 -1.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4246 -0.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5996 -0.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1904 0.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5840 0.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3654 0.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 3 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 3 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 3 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 3 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 20 2 0 0 0 0\nM END", "smiles": "CCCCCC#CCC#CCC#CCC#CCCCC(=O)O", "formula": "C20H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0d94aea7-3b58-40fc-9e36-d714d7316a24" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "296.4041", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3b8ca4c6-9279-4d37-851b-af5faad6a155", "version": "6", "structure": { "id": "b697f831-c3a6-4216-8d34-ca7dd138cb5e", "molfile": "\n Marvin 01132109272D \n\n 22 21 0 0 0 0 999 V2000\n 4.4889 -1.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7340 -1.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1376 -2.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1593 -4.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7508 -4.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5146 -5.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6608 -1.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6778 -5.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1904 0.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5840 0.9721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3370 -5.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3175 -1.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5650 -3.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3654 0.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8439 -1.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8646 -5.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5996 -0.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4246 -0.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4324 -4.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2038 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6074 -4.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3793 -4.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 12 1 0 0 0 0\n 3 2 3 0 0 0 0\n 4 13 1 0 0 0 0\n 5 4 3 0 0 0 0\n 6 11 1 0 0 0 0\n 7 1 3 0 0 0 0\n 8 6 3 0 0 0 0\n 9 17 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 1 1 0 0 0 0\n 13 3 1 0 0 0 0\n 14 9 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 8 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 16 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 19 1 0 0 0 0\n 22 20 1 0 0 0 0\nM END", "smiles": "CCCCCC#CCC#CCC#CCC#CCCCC(=O)O", "formula": "C20H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "296.4041", "optical_activity": "NONE", "references": [ "e7c3687b-25f7-44e5-80d0-27a6a77296c0" ], "stereo_centers": 0 }, "unii": "5FEJ8J06DR" } ] }