{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9d75b79c-8c78-4a7d-8912-72900b7eb9c0", "code": "71701-33-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=71701-33-2", "code_system": "CAS", "references": [ "bfca37a1-c02b-4dba-932d-1be7ff6b4677", "ab9f2447-9360-46a0-936a-58f2f2a770a5" ] }, { "uuid": "b36a7515-1d02-43da-9f9d-9f0e1edd4d00", "code": "275-875-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.068.956", "code_system": "ECHA (EC/EINECS)", "references": [ "bfca37a1-c02b-4dba-932d-1be7ff6b4677" ] }, { "uuid": "b5bb3bb1-b53a-478d-acf2-792ef4bbc2e6", "code": "172879", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/172879", "code_system": "PUBCHEM", "references": [ "bfca37a1-c02b-4dba-932d-1be7ff6b4677" ] }, { "uuid": "cebae6f7-40f1-370c-f895-ce72292fa844", "code": "DTXSID7072412", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7072412", "code_system": "EPA CompTox", "references": [ "70da025d-f764-c63a-7bc1-f5fc1ae0e9ff" ] }, { "uuid": "38fd3912-58dc-4280-9dc7-b1e58b443001", "code": "5FBQ5U4PJW", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b44c62ef-7f72-4685-95f2-a6b3727391ec", "name": "1-Amino-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-4-[(2,4,6-trimethylphenyl)amino]-9,10-anthracenedione", "stdName": "1-AMINO-2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-4-((2,4,6-TRIMETHYLPHENYL)AMINO)-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ab9f2447-9360-46a0-936a-58f2f2a770a5" ], "display_name": true }, { "uuid": "f104f88e-ce07-4480-8315-4681aea18ed1", "name": "9,10-Anthracenedione, 1-amino-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-4-[(2,4,6-trimethylphenyl)amino]-", "stdName": "9,10-ANTHRACENEDIONE, 1-AMINO-2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)-4-((2,4,6-TRIMETHYLPHENYL)AMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86b52891-4d08-4c50-8216-8bcf83e8f8bd", "d84dfa92-1348-424f-aa4c-6ff9ae9521bf" ], "display_name": false } ], "references": [ { "uuid": "d84dfa92-1348-424f-aa4c-6ff9ae9521bf", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "86b52891-4d08-4c50-8216-8bcf83e8f8bd", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bfca37a1-c02b-4dba-932d-1be7ff6b4677", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393739000, "tags": [ "NOMEN" ] }, { "uuid": "70da025d-f764-c63a-7bc1-f5fc1ae0e9ff", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71701-33-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ab9f2447-9360-46a0-936a-58f2f2a770a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b6e77b27-b657-4acc-8230-0814014baffb", "id": "b6e77b27-b657-4acc-8230-0814014baffb", "molfile": "\n Marvin 01132109282D \n\n 42 46 0 0 0 0 999 V2000\n 5.2476 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3926 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3926 -3.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -4.2413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3927 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3927 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -6.7163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2476 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5325 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5325 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2476 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8214 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2322 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2400 -4.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4066 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5816 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5816 -6.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7566 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3241 -4.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -7.5413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8183 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -7.5413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2484 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9634 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6785 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6785 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9634 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2484 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -4.2413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8183 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -4.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -3.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 42 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 40 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 39 2 0 0 0 0\n 10 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 26 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 29 28 1 0 0 0 0\n 39 28 1 0 0 0 0\n 29 30 2 0 0 0 0\n 31 29 1 0 0 0 0\n 32 31 1 0 0 0 0\n 36 31 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 2 0 0 0 0\n 39 37 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 1 0 0 0 0\nM END", "smiles": "Cc1cc(C)c(c(C)c1)Nc2cc(c(c3c2C(=O)c4ccccc4C3=O)N)Oc5ccc(cc5)C(C)(C)CC(C)(C)C", "formula": "C37H40N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7819a1a2-f9de-447c-8fe4-7d2dee02e04d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "560.7265", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c06aa7ac-2b48-4194-b9cb-9f9c26e71f9a", "version": "5", "structure": { "id": "8bb34cfd-e27e-4f30-bd95-bdbfa663f270", "molfile": "\n Marvin 01132107152D \n\n 42 46 0 0 0 0 999 V2000\n 8.1077 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3927 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3927 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8183 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2484 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9634 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6785 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6785 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9634 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2484 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8183 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -7.5413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5334 -4.2413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -4.2413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3926 -3.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -4.2413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -3.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3926 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2476 -2.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6776 -6.7163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2476 -6.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5325 -6.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5325 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2476 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9626 -5.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8214 -5.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4066 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5816 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5816 -6.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7566 -5.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3241 -4.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2322 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2400 -4.4246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1077 -7.5413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 7 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 5 14 1 0 0 0 0\n 1 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 6 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 18 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 21 25 1 0 0 0 0\n 19 26 1 0 0 0 0\n 17 18 1 0 0 0 0\n 4 17 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 28 33 2 0 0 0 0\n 27 28 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 36 39 1 0 0 0 0\n 34 40 1 0 0 0 0\n 34 41 1 0 0 0 0\n 31 34 1 0 0 0 0\n 2 27 1 0 0 0 0\n 1 42 1 0 0 0 0\nM END", "smiles": "Cc1cc(C)c(c(C)c1)Nc2cc(c(c3c2C(=O)c4ccccc4C3=O)N)Oc5ccc(cc5)C(C)(C)CC(C)(C)C", "formula": "C37H40N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "560.7265", "optical_activity": "NONE", "references": [ "d84dfa92-1348-424f-aa4c-6ff9ae9521bf" ], "stereo_centers": 0 }, "unii": "5FBQ5U4PJW" } ] }