{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "faa080a1-3db8-4446-8b65-c1bcedc3615a",
          "code": "61167-58-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61167-58-6",
          "code_system": "CAS",
          "references": [
            "8e17d9aa-0049-4964-a399-d3975c5334fc",
            "275d37c8-92a5-49ac-80fc-d661a907a0e9"
          ]
        },
        {
          "uuid": "c32411a2-a481-4d7d-a6c1-00f17e5684ab",
          "code": "262-634-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.922",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8e17d9aa-0049-4964-a399-d3975c5334fc"
          ]
        },
        {
          "uuid": "f7e24e3a-d8b1-4f78-bfe1-1ba1b22ad185",
          "code": "109058",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109058",
          "code_system": "PUBCHEM",
          "references": [
            "8e17d9aa-0049-4964-a399-d3975c5334fc"
          ]
        },
        {
          "uuid": "0aefc3bb-edc9-ca7b-dc0a-14bdc2e87565",
          "code": "DTXSID7052282",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7052282",
          "code_system": "EPA CompTox",
          "references": [
            "681b494a-4b2a-0f2f-fe9d-bc331ffe78f1"
          ]
        },
        {
          "uuid": "e40036bd-715d-403d-bf38-dceee7e5703f",
          "code": "5FAC6GZ50W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "afa6c422-bb0e-4b29-95dc-11d104ae12fa",
          "name": "2,2'-METHYLENEBIS(4-METHYL-6-TERT-BUTYLPHENOL) MONOACRYLATE",
          "stdName": "2,2'-METHYLENEBIS(4-METHYL-6-TERT-BUTYLPHENOL) MONOACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "00a95174-8a0e-4d12-9700-81f3bbee3a22",
          "name": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-METHYLPHENOL) MONOACRYLATE",
          "stdName": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-METHYLPHENOL) MONOACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "74d6e3f7-1782-4564-bf0a-c305fe19a944",
          "name": "2-(2-HYDROXY-3-TERT-BUTYL-5-METHYLBENZYL)-4-METHYL-6-TERT-BUTYLPHENYL ACRYLATE",
          "stdName": "2-(2-HYDROXY-3-TERT-BUTYL-5-METHYLBENZYL)-4-METHYL-6-TERT-BUTYLPHENYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "4bf98edf-77e8-4ada-81c7-32c40229881d",
          "name": "2-PROPENOIC ACID, 2-(1,1-DIMETHYLETHYL)-6-((3-(1,1-DIMETHYLETHYL)-2-HYDROXY-5-METHYLPHENYL)METHYL)-4-METHYLPHENYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-(1,1-DIMETHYLETHYL)-6-((3-(1,1-DIMETHYLETHYL)-2-HYDROXY-5-METHYLPHENYL)METHYL)-4-METHYLPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "ab81971e-d432-42b0-bd52-b2a8e454de2d",
          "name": "2-TERT-BUTYL-6-(3-TERT-BUTYL-2-HYDROXY-5-METHYLBENZYL)-4-METHYLPHENYL ACRYLATE",
          "stdName": "2-TERT-BUTYL-6-(3-TERT-BUTYL-2-HYDROXY-5-METHYLBENZYL)-4-METHYLPHENYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97de5467-bdd1-4417-a5b4-be4a606e5e9b"
          ],
          "display_name": true
        },
        {
          "uuid": "91716e77-4cef-4ebe-81da-f8e9095bd8e9",
          "name": "2-TERT-BUTYL-6-(3-TERT-BUTYL-5-METHYL-2-HYDROXYBENZYL)-4-METHYLPHENYL ACRYLATE",
          "stdName": "2-TERT-BUTYL-6-(3-TERT-BUTYL-5-METHYL-2-HYDROXYBENZYL)-4-METHYLPHENYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "05368c7e-bc47-4066-9b34-d33c343cf99e",
          "name": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYL)PHENYLMETHANE MONOACRYLATE",
          "stdName": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYL)PHENYLMETHANE MONOACRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "5f56cdff-ae9b-4868-b982-1851d4e5d9e0",
          "name": "IRGANOX 3052FF",
          "stdName": "IRGANOX 3052FF",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        },
        {
          "uuid": "284c3d58-d3f9-47c9-856b-92bb33291f91",
          "name": "SUMILIZER GM",
          "stdName": "SUMILIZER GM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45904c99-9689-4a64-b734-35fe42cd06d3",
            "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "97de5467-bdd1-4417-a5b4-be4a606e5e9b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "45904c99-9689-4a64-b734-35fe42cd06d3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ef7ffe2-8cb8-44a3-bd66-f26fabe53ee7",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e17d9aa-0049-4964-a399-d3975c5334fc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a720013-9df0-410f-9dd3-3c48fa78e16b",
          "citation": "SRS import [5FAC6GZ50W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5FAC6GZ50W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6df2e117-781f-47f3-9edd-dbcbbc251335",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "681b494a-4b2a-0f2f-fe9d-bc331ffe78f1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61167-58-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "275d37c8-92a5-49ac-80fc-d661a907a0e9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "96840c53-0af5-4d6f-8642-3c453784c080",
          "id": "96840c53-0af5-4d6f-8642-3c453784c080",
          "molfile": "\n  Marvin  01132107492D          \n\n 29 30  0  0  0  0            999 V2000\n    4.1564   -5.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8697   -4.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5840   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -4.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -5.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -6.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3069   -6.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3069   -7.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5918   -7.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -7.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7334   -7.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7334   -6.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5908   -5.9858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5908   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9319   -4.7531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3039   -4.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9164   -5.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4473   -7.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8608   -7.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0384   -8.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1657   -8.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -4.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0089   -3.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -3.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8697   -4.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7446   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -1.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 25  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n 22  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 26 29  1  0  0  0  0\nM  END",
          "smiles": "C=CC(=O)Oc1c(cc(C)cc1C(C)(C)C)Cc2cc(C)cc(c2O)C(C)(C)C",
          "formula": "C26H34O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad51cbcb-674a-4527-9b7d-4bcf97b688ce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "394.5473",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "012f1dae-fb31-4bb7-9a0e-46fef5cc84c3",
      "version": "3",
      "structure": {
        "id": "eae37a83-0315-43a6-a4b9-922f36a7fd32",
        "molfile": "\n  Marvin  01132112092D          \n\n 29 30  0  0  0  0            999 V2000\n    7.9319   -4.7531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5908   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5908   -5.9858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7334   -6.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -6.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3069   -6.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3069   -7.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -7.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7334   -7.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4473   -7.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8608   -7.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0384   -8.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1657   -8.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5918   -7.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0193   -5.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -4.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5840   -5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8697   -4.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8697   -4.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -3.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -4.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0089   -3.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3948   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7446   -2.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5697   -1.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1564   -5.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3039   -4.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9164   -5.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  5 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 16  2  0  0  0  0\n 21 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 18 27  1  0  0  0  0\n  2 28  1  0  0  0  0\n 28 29  2  0  0  0  0\nM  END",
        "smiles": "C=CC(=O)Oc1c(cc(C)cc1C(C)(C)C)Cc2cc(C)cc(c2O)C(C)(C)C",
        "formula": "C26H34O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "394.5473",
        "optical_activity": "NONE",
        "references": [
          "5a720013-9df0-410f-9dd3-3c48fa78e16b",
          "6df2e117-781f-47f3-9edd-dbcbbc251335"
        ],
        "stereo_centers": 0
      },
      "unii": "5FAC6GZ50W"
    }
  ]
}