{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f181270d-5778-46d2-a86d-509bb561488d",
          "code": "102369-06-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102369-06-2",
          "code_system": "CAS",
          "references": [
            "580155ab-13d6-4dd1-a155-77232008273f",
            "27ea5601-ad23-4c1c-a8a6-e9d3e901ad0b"
          ]
        },
        {
          "uuid": "c6ee99bf-228f-4e5e-b266-c4843d231cf1",
          "code": "2,3-EPOXYDECANAL",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=6104",
          "code_system": "JECFA EVALUATION",
          "references": [
            "580155ab-13d6-4dd1-a155-77232008273f"
          ]
        },
        {
          "uuid": "ed910259-3e20-4c3d-82ba-ad9ac52c30bf",
          "code": "71587390",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587390",
          "code_system": "PUBCHEM",
          "references": [
            "580155ab-13d6-4dd1-a155-77232008273f"
          ]
        },
        {
          "uuid": "6f72d6c6-d75b-4f64-b89b-1d12740f1373",
          "code": "5DKD54LEI5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c27d5dee-654e-f603-a223-8eb2e411b556",
          "code": "2125",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2125/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "f3d4b0ed-dd6c-b47d-d0de-fce8a116bbda"
          ]
        },
        {
          "uuid": "af8f3b7f-21bc-9636-8ba4-04357dd3ae44",
          "code": "DTXSID50907439",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50907439",
          "code_system": "EPA CompTox",
          "references": [
            "1a42dc6e-9a3e-8da0-1bca-9eab6793a4e1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f55c9d2e-6674-4c23-ac5a-cc8ffb19c799",
          "name": "(±)-2,3-EPOXYDECANAL",
          "stdName": "(+/-)-2,3-EPOXYDECANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51bee59-e894-4464-a1cb-3618623a309b",
            "1e81ecd1-f453-482b-9431-54e2d69e9feb"
          ],
          "display_name": false
        },
        {
          "uuid": "16ce55c9-fdee-4747-876a-1c884e80f788",
          "name": "2,3-EPOXYDECANAL",
          "stdName": "2,3-EPOXYDECANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a64bb5-4dce-4a38-aa11-d1c871579686",
            "d51bee59-e894-4464-a1cb-3618623a309b"
          ],
          "display_name": true
        },
        {
          "uuid": "c6152149-24f5-44c3-a3f5-b724d09706f7",
          "name": "2,3-EPOXYDECANAL, (±)-",
          "stdName": "2,3-EPOXYDECANAL, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51bee59-e894-4464-a1cb-3618623a309b",
            "1e81ecd1-f453-482b-9431-54e2d69e9feb"
          ],
          "display_name": false
        },
        {
          "uuid": "c897adc2-249e-47d8-8108-6b560ad26f05",
          "name": "3-HEPTYL OXIRANE-2-CARBOXALDEHYDE",
          "stdName": "3-HEPTYL OXIRANE-2-CARBOXALDEHYDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a64bb5-4dce-4a38-aa11-d1c871579686",
            "d51bee59-e894-4464-a1cb-3618623a309b"
          ],
          "display_name": false
        },
        {
          "uuid": "ff5d0edf-17eb-41fa-9d71-5010c64206e6",
          "name": "FEMA NO. 4659",
          "stdName": "FEMA NO. 4659",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a64bb5-4dce-4a38-aa11-d1c871579686",
            "d51bee59-e894-4464-a1cb-3618623a309b"
          ],
          "display_name": false
        },
        {
          "uuid": "b5614a62-7f96-4e40-b843-420778343ef6",
          "name": "OXIRANECARBOXALDEHYDE, 3-HEPTYL-, (2R,3S)-REL-",
          "stdName": "OXIRANECARBOXALDEHYDE, 3-HEPTYL-, (2R,3S)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b01c2c1b-724c-44ab-9513-cb89a204ba84",
            "d51bee59-e894-4464-a1cb-3618623a309b"
          ],
          "display_name": false
        },
        {
          "uuid": "cc0aa64b-ef4f-48fd-97a4-ea235fdae30f",
          "name": "OXIRANECARBOXALDEHYDE, 3-HEPTYL-, TRANS-",
          "stdName": "OXIRANECARBOXALDEHYDE, 3-HEPTYL-, TRANS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b01c2c1b-724c-44ab-9513-cb89a204ba84",
            "d51bee59-e894-4464-a1cb-3618623a309b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "15a64bb5-4dce-4a38-aa11-d1c871579686",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d51bee59-e894-4464-a1cb-3618623a309b",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b01c2c1b-724c-44ab-9513-cb89a204ba84",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e81ecd1-f453-482b-9431-54e2d69e9feb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "580155ab-13d6-4dd1-a155-77232008273f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391417000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32ae7854-8919-4e3d-b7db-894c474367eb",
          "citation": "SRS import [5DKD54LEI5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=5DKD54LEI5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391417000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27ea5601-ad23-4c1c-a8a6-e9d3e901ad0b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1a42dc6e-9a3e-8da0-1bca-9eab6793a4e1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "f3d4b0ed-dd6c-b47d-d0de-fce8a116bbda",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ba51c3b1-b537-449a-9239-c8ccd640ca09",
          "id": "ba51c3b1-b537-449a-9239-c8ccd640ca09",
          "molfile": "\n  Marvin  01132109382D          \n\n 12 12  0  0  0  0            999 V2000\n    8.1824   -5.3005    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.9043   -4.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6207   -5.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3481   -4.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0645   -5.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7918   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7918   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4974   -3.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7808   -6.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3574   -5.3005    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.6518   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6518   -4.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 11  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCC[C@H]1[C@H](C=O)O1",
          "formula": "C10H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "52671aac-7c93-4da6-b6e8-b49047e27351"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "170.2491",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ced19291-28c7-4e94-bf06-1b9c5a6d6081",
      "version": "8",
      "structure": {
        "id": "8f388bcc-2916-41b6-872c-84e4f288b2bc",
        "molfile": "\n  Marvin  01132107262D          \n\n 12 12  0  0  0  0            999 V2000\n   12.4974   -3.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3481   -4.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0645   -5.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7918   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7918   -4.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6207   -5.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9043   -4.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6518   -4.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6518   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1824   -5.3005    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3574   -5.3005    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7808   -6.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 11 10  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 10  7  1  6  0  0  0\n  8  9  2  0  0  0  0\n 11  9  1  1  0  0  0\n 10 12  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCC[C@H]1[C@H](C=O)O1",
        "formula": "C10H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "170.2491",
        "optical_activity": "( + / - )",
        "references": [
          "32ae7854-8919-4e3d-b7db-894c474367eb",
          "b01c2c1b-724c-44ab-9513-cb89a204ba84"
        ],
        "stereo_centers": 2
      },
      "unii": "5DKD54LEI5"
    }
  ]
}